summaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
authorTreehugger Robot <treehugger-gerrit@google.com>2016-05-19 18:41:01 +0000
committerGerrit Code Review <noreply-gerritcodereview@google.com>2016-05-19 18:41:01 +0000
commitce294655f981e19b420f2201b7c499a435ef1ce2 (patch)
tree3d29fc6c999dbb9ab3d78cb64b336caf8a36fd65
parent9870834a1f61689aaff1eedda0e1ee73d7150763 (diff)
parent3d3d1bae29e9b2d88c73aecda916640ba3a5e5b8 (diff)
downloadplatform_prebuilts_python_linux-x86_2.7.5-ce294655f981e19b420f2201b7c499a435ef1ce2.tar.gz
platform_prebuilts_python_linux-x86_2.7.5-ce294655f981e19b420f2201b7c499a435ef1ce2.tar.bz2
platform_prebuilts_python_linux-x86_2.7.5-ce294655f981e19b420f2201b7c499a435ef1ce2.zip
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/selinux/__init__.py0
-rw-r--r--lib/python2.7/site-packages/sepolgen/refparser.py10
-rw-r--r--lib/python2.7/site-packages/sepolgen/refpolicy.py16
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/__init__.py12
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/boolquery.py13
-rwxr-xr-xlib/python2.7/site-packages/setools/boundsquery.py72
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/categoryquery.py16
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/commonquery.py16
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/compquery.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/constraintquery.py19
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/contextquery.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/defaultquery.py9
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/descriptors.py35
-rw-r--r--lib/python2.7/site-packages/setools/devicetreeconquery.py79
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/__init__.py4
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/bool.py0
-rwxr-xr-xlib/python2.7/site-packages/setools/diff/bounds.py112
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/commons.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/conditional.py0
-rwxr-xr-xlib/python2.7/site-packages/setools/diff/constraints.py220
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/context.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/default.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/descriptors.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/difference.py8
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/fsuse.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/genfscon.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/initsid.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/mls.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/mlsrules.py70
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/netifcon.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/nodecon.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/objclass.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/polcap.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/portcon.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/properties.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/rbacrules.py91
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/roles.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/terules.py426
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/typeattr.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/types.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/diff/users.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/dta.py59
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/exception.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/fsusequery.py20
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/genfsconquery.py22
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/infoflow.py51
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/initsidquery.py20
-rw-r--r--lib/python2.7/site-packages/setools/iomemconquery.py124
-rw-r--r--lib/python2.7/site-packages/setools/ioportconquery.py124
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/mixins.py125
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/mlsrulequery.py30
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/netifconquery.py23
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/nodeconquery.py17
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/objclassquery.py18
-rw-r--r--lib/python2.7/site-packages/setools/pcideviceconquery.py93
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/permmap.py280
-rw-r--r--lib/python2.7/site-packages/setools/pirqconquery.py93
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/polcapquery.py13
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/__init__.py110
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/_qpol.py0
-rwxr-xr-xlib/python2.7/site-packages/setools/policyrep/_qpol.sobin2159327 -> 2329391 bytes
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/boolcond.py0
-rwxr-xr-xlib/python2.7/site-packages/setools/policyrep/bounds.py60
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/constraint.py345
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/context.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/default.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/exception.py7
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/fscontext.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/initsid.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/mls.py16
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/mlsrule.py6
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/netcontext.py25
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/objclass.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/polcap.py0
-rw-r--r--lib/python2.7/site-packages/setools/policyrep/qpol.i3498
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/qpol.py146
-rw-r--r--lib/python2.7/site-packages/setools/policyrep/qpol_wrap.c16972
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/rbacrule.py6
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/role.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/rule.py2
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/symbol.py0
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/terule.py128
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/typeattr.py9
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/policyrep/user.py0
-rw-r--r--lib/python2.7/site-packages/setools/policyrep/xencontext.py191
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/portconquery.py30
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/query.py146
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/rbacrulequery.py19
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/rolequery.py16
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/sensitivityquery.py19
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/terulequery.py80
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/typeattrquery.py16
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/typequery.py19
-rwxr-xr-x[-rw-r--r--]lib/python2.7/site-packages/setools/userquery.py20
-rw-r--r--lib/python2.7/site-packages/setools/util.py165
95 files changed, 23438 insertions, 953 deletions
diff --git a/lib/python2.7/site-packages/selinux/__init__.py b/lib/python2.7/site-packages/selinux/__init__.py
index 7a14d18..7a14d18 100644..100755
--- a/lib/python2.7/site-packages/selinux/__init__.py
+++ b/lib/python2.7/site-packages/selinux/__init__.py
diff --git a/lib/python2.7/site-packages/sepolgen/refparser.py b/lib/python2.7/site-packages/sepolgen/refparser.py
index 9b1d0c8..2cef8e8 100644
--- a/lib/python2.7/site-packages/sepolgen/refparser.py
+++ b/lib/python2.7/site-packages/sepolgen/refparser.py
@@ -113,6 +113,7 @@ tokens = (
'AUDITALLOW',
'NEVERALLOW',
'PERMISSIVE',
+ 'TYPEBOUNDS',
'TYPE_TRANSITION',
'TYPE_CHANGE',
'TYPE_MEMBER',
@@ -178,6 +179,7 @@ reserved = {
'auditallow' : 'AUDITALLOW',
'neverallow' : 'NEVERALLOW',
'permissive' : 'PERMISSIVE',
+ 'typebounds' : 'TYPEBOUNDS',
'type_transition' : 'TYPE_TRANSITION',
'type_change' : 'TYPE_CHANGE',
'type_member' : 'TYPE_MEMBER',
@@ -502,6 +504,7 @@ def p_policy_stmt(p):
'''policy_stmt : gen_require
| avrule_def
| typerule_def
+ | typebound_def
| typeattribute_def
| roleattribute_def
| interface_call
@@ -823,6 +826,13 @@ def p_typerule_def(p):
t.file_name = p[7]
p[0] = t
+def p_typebound_def(p):
+ '''typebound_def : TYPEBOUNDS IDENTIFIER comma_list SEMI'''
+ t = refpolicy.TypeBound()
+ t.type = p[2]
+ t.tgt_types.update(p[3])
+ p[0] = t
+
def p_bool(p):
'''bool : BOOL IDENTIFIER TRUE SEMI
| BOOL IDENTIFIER FALSE SEMI'''
diff --git a/lib/python2.7/site-packages/sepolgen/refpolicy.py b/lib/python2.7/site-packages/sepolgen/refpolicy.py
index 31b40d8..2ee029c 100644
--- a/lib/python2.7/site-packages/sepolgen/refpolicy.py
+++ b/lib/python2.7/site-packages/sepolgen/refpolicy.py
@@ -112,6 +112,9 @@ class Node(PolicyBase):
def typerules(self):
return filter(lambda x: isinstance(x, TypeRule), walktree(self))
+ def typebounds(self):
+ return filter(lambda x: isinstance(x, TypeBound), walktree(self))
+
def typeattributes(self):
"""Iterate over all of the TypeAttribute children of this Interface."""
return filter(lambda x: isinstance(x, TypeAttribute), walktree(self))
@@ -522,6 +525,19 @@ class TypeRule(Leaf):
self.tgt_types.to_space_str(),
self.obj_classes.to_space_str(),
self.dest_type)
+class TypeBound(Leaf):
+ """SElinux typebound statement.
+
+ This class represents a typebound statement.
+ """
+ def __init__(self, parent=None):
+ Leaf.__init__(self, parent)
+ self.type = ""
+ self.tgt_types = IdSet()
+
+ def to_string(self):
+ return "typebounds %s %s;" % (self.type, self.tgt_types.to_comma_str())
+
class RoleAllow(Leaf):
def __init__(self, parent=None):
diff --git a/lib/python2.7/site-packages/setools/__init__.py b/lib/python2.7/site-packages/setools/__init__.py
index f6bfff8..d4a0436 100644..100755
--- a/lib/python2.7/site-packages/setools/__init__.py
+++ b/lib/python2.7/site-packages/setools/__init__.py
@@ -17,7 +17,9 @@
# License along with SETools. If not, see
# <http://www.gnu.org/licenses/>.
#
-__version__ = "4.0.0-alpha3"
+__version__ = "4.0.1"
+
+import logging
# Python classes for policy representation
from . import policyrep
@@ -47,6 +49,7 @@ from .terulequery import TERuleQuery
from .constraintquery import ConstraintQuery
# Other queries
+from .boundsquery import BoundsQuery
from .defaultquery import DefaultQuery
# In-policy Context Queries
@@ -56,6 +59,11 @@ from .initsidquery import InitialSIDQuery
from .netifconquery import NetifconQuery
from .nodeconquery import NodeconQuery
from .portconquery import PortconQuery
+from .ioportconquery import IoportconQuery
+from .iomemconquery import IomemconQuery
+from .pirqconquery import PirqconQuery
+from .pcideviceconquery import PcideviceconQuery
+from .devicetreeconquery import DevicetreeconQuery
# Information Flow Analysis
from .infoflow import InfoFlowAnalysis
@@ -66,3 +74,5 @@ from .dta import DomainTransitionAnalysis
# Policy difference
from .diff import PolicyDifference
+
+logging.getLogger(__name__).addHandler(logging.NullHandler())
diff --git a/lib/python2.7/site-packages/setools/boolquery.py b/lib/python2.7/site-packages/setools/boolquery.py
index b70b7d5..2e991c2 100644..100755
--- a/lib/python2.7/site-packages/setools/boolquery.py
+++ b/lib/python2.7/site-packages/setools/boolquery.py
@@ -18,11 +18,12 @@
#
import logging
-from . import compquery
from .descriptors import CriteriaDescriptor
+from .mixins import MatchName
+from .query import PolicyQuery
-class BoolQuery(compquery.ComponentQuery):
+class BoolQuery(MatchName, PolicyQuery):
"""Query SELinux policy Booleans.
@@ -50,10 +51,14 @@ class BoolQuery(compquery.ComponentQuery):
else:
self._default = bool(value)
+ def __init__(self, policy, **kwargs):
+ super(BoolQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all Booleans matching the criteria."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+ self.log.info("Generating Boolean results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
self.log.debug("Default: {0.default}".format(self))
for boolean in self.policy.bools():
diff --git a/lib/python2.7/site-packages/setools/boundsquery.py b/lib/python2.7/site-packages/setools/boundsquery.py
new file mode 100755
index 0000000..a1ec87d
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/boundsquery.py
@@ -0,0 +1,72 @@
+# Copyright 2016, Tresys Technology, LLC
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+import logging
+import re
+
+from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .query import PolicyQuery
+from .util import match_regex
+
+
+class BoundsQuery(PolicyQuery):
+
+ """
+ Query *bounds statements.
+
+ Parameter:
+ policy The policy to query.
+
+ Keyword Parameters/Class attributes:
+ ruletype The rule type(s) to match.
+ """
+
+ ruletype = CriteriaSetDescriptor(lookup_function="validate_bounds_ruletype")
+ parent = CriteriaDescriptor("parent_regex")
+ parent_regex = False
+ child = CriteriaDescriptor("child_regex")
+ child_regex = False
+
+ def __init__(self, policy, **kwargs):
+ super(BoundsQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
+ def results(self):
+ """Generator which yields all matching *bounds statements."""
+ self.log.info("Generating bounds results from {0.policy}".format(self))
+ self.log.debug("Ruletypes: {0.ruletype}".format(self))
+ self.log.debug("Parent: {0.parent!r}, regex: {0.parent_regex}".format(self))
+ self.log.debug("Child: {0.child!r}, regex: {0.child_regex}".format(self))
+
+ for b in self.policy.bounds():
+ if self.ruletype and b.ruletype not in self.ruletype:
+ continue
+
+ if self.parent and not match_regex(
+ b.parent,
+ self.parent,
+ self.parent_regex):
+ continue
+
+ if self.child and not match_regex(
+ b.child,
+ self.child,
+ self.child_regex):
+ continue
+
+ yield b
diff --git a/lib/python2.7/site-packages/setools/categoryquery.py b/lib/python2.7/site-packages/setools/categoryquery.py
index d4d7c4c..49b2dbc 100644..100755
--- a/lib/python2.7/site-packages/setools/categoryquery.py
+++ b/lib/python2.7/site-packages/setools/categoryquery.py
@@ -18,11 +18,11 @@
#
import logging
-from . import compquery
-from . import mixins
+from .mixins import MatchAlias, MatchName
+from .query import PolicyQuery
-class CategoryQuery(mixins.MatchAlias, compquery.ComponentQuery):
+class CategoryQuery(MatchAlias, MatchName, PolicyQuery):
"""
Query MLS Categories
@@ -39,11 +39,15 @@ class CategoryQuery(mixins.MatchAlias, compquery.ComponentQuery):
will be used on the alias names.
"""
+ def __init__(self, policy, **kwargs):
+ super(CategoryQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching categories."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
- self.log.debug("Alias: {0.alias}, regex: {0.alias_regex}".format(self))
+ self.log.info("Generating category results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
+ self._match_alias_debug(self.log)
for cat in self.policy.categories():
if not self._match_name(cat):
diff --git a/lib/python2.7/site-packages/setools/commonquery.py b/lib/python2.7/site-packages/setools/commonquery.py
index e105ccb..d447396 100644..100755
--- a/lib/python2.7/site-packages/setools/commonquery.py
+++ b/lib/python2.7/site-packages/setools/commonquery.py
@@ -19,10 +19,11 @@
import logging
import re
-from . import compquery, mixins
+from .mixins import MatchName, MatchPermission
+from .query import PolicyQuery
-class CommonQuery(mixins.MatchPermission, compquery.ComponentQuery):
+class CommonQuery(MatchPermission, MatchName, PolicyQuery):
"""
Query common permission sets.
@@ -43,12 +44,15 @@ class CommonQuery(mixins.MatchPermission, compquery.ComponentQuery):
on the permission names instead of set logic.
"""
+ def __init__(self, policy, **kwargs):
+ super(CommonQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching commons."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
- self.log.debug("Perms: {0.perms!r}, regex: {0.perms_regex}, eq: {0.perms_equal}".
- format(self))
+ self.log.info("Generating common results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
+ self._match_perms_debug(self.log)
for com in self.policy.commons():
if not self._match_name(com):
diff --git a/lib/python2.7/site-packages/setools/compquery.py b/lib/python2.7/site-packages/setools/compquery.py
index 3d8851a..3d8851a 100644..100755
--- a/lib/python2.7/site-packages/setools/compquery.py
+++ b/lib/python2.7/site-packages/setools/compquery.py
diff --git a/lib/python2.7/site-packages/setools/constraintquery.py b/lib/python2.7/site-packages/setools/constraintquery.py
index a7fee76..6ea4473 100644..100755
--- a/lib/python2.7/site-packages/setools/constraintquery.py
+++ b/lib/python2.7/site-packages/setools/constraintquery.py
@@ -19,12 +19,14 @@
import logging
import re
-from . import mixins, query
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .mixins import MatchObjClass, MatchPermission
from .policyrep.exception import ConstraintUseError
+from .query import PolicyQuery
+from .util import match_in_set
-class ConstraintQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuery):
+class ConstraintQuery(MatchObjClass, MatchPermission, PolicyQuery):
"""
Query constraint rules, (mls)constrain/(mls)validatetrans.
@@ -72,6 +74,10 @@ class ConstraintQuery(mixins.MatchObjClass, mixins.MatchPermission, query.Policy
type_regex = False
type_indirect = True
+ def __init__(self, policy, **kwargs):
+ super(ConstraintQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def _match_expr(self, expr, criteria, indirect, regex):
"""
Match roles/types/users in a constraint expression,
@@ -91,15 +97,14 @@ class ConstraintQuery(mixins.MatchObjClass, mixins.MatchPermission, query.Policy
else:
obj = expr
- return self._match_in_set(obj, criteria, regex)
+ return match_in_set(obj, criteria, regex)
def results(self):
"""Generator which yields all matching constraints rules."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating constraint results from {0.policy}".format(self))
self.log.debug("Ruletypes: {0.ruletype}".format(self))
- self.log.debug("Class: {0.tclass!r}, regex: {0.tclass_regex}".format(self))
- self.log.debug("Perms: {0.perms!r}, regex: {0.perms_regex}, eq: {0.perms_equal}".
- format(self))
+ self._match_object_class_debug(self.log)
+ self._match_perms_debug(self.log)
self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
diff --git a/lib/python2.7/site-packages/setools/contextquery.py b/lib/python2.7/site-packages/setools/contextquery.py
index 5ce1632..5ce1632 100644..100755
--- a/lib/python2.7/site-packages/setools/contextquery.py
+++ b/lib/python2.7/site-packages/setools/contextquery.py
diff --git a/lib/python2.7/site-packages/setools/defaultquery.py b/lib/python2.7/site-packages/setools/defaultquery.py
index dac93bc..7565415 100644..100755
--- a/lib/python2.7/site-packages/setools/defaultquery.py
+++ b/lib/python2.7/site-packages/setools/defaultquery.py
@@ -46,10 +46,17 @@ class DefaultQuery(MatchObjClass, PolicyQuery):
default = CriteriaDescriptor(lookup_function="validate_default_value")
default_range = CriteriaDescriptor(lookup_function="validate_default_range")
+ def __init__(self, policy, **kwargs):
+ super(DefaultQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching default_* statements."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating default_* results from {0.policy}".format(self))
self.log.debug("Ruletypes: {0.ruletype}".format(self))
+ self._match_object_class_debug(self.log)
+ self.log.debug("Default: {0.default}".format(self))
+ self.log.debug("Range: {0.default_range}".format(self))
for d in self.policy.defaults():
if self.ruletype and d.ruletype not in self.ruletype:
diff --git a/lib/python2.7/site-packages/setools/descriptors.py b/lib/python2.7/site-packages/setools/descriptors.py
index c4bb73c..c4eb81c 100644..100755
--- a/lib/python2.7/site-packages/setools/descriptors.py
+++ b/lib/python2.7/site-packages/setools/descriptors.py
@@ -190,3 +190,38 @@ class EdgeAttrList(NetworkXGraphEdgeDescriptor):
# in Python3 a .clear() function was added for lists
# keep this implementation for Python 2 compat
del obj.G[obj.source][obj.target][self.name][:]
+
+
+#
+# Permission map descriptors
+#
+class PermissionMapDescriptor(object):
+
+ """
+ Descriptor for Permission Map mappings.
+
+ Parameter:
+ name The map setting name.
+ validator A callable for validating the setting.
+
+ Instance class attribute use (obj parameter):
+ perm_map The full permission map.
+ class_ The mapping's object class
+ perm The mapping's permission
+ """
+
+ def __init__(self, propname, validator):
+ self.name = propname
+ self.validator = validator
+
+ def __get__(self, obj, objtype=None):
+ if obj is None:
+ return self
+
+ return obj.perm_map[obj.class_][obj.perm][self.name]
+
+ def __set__(self, obj, value):
+ obj.perm_map[obj.class_][obj.perm][self.name] = self.validator(value)
+
+ def __delete__(self, obj):
+ raise AttributeError
diff --git a/lib/python2.7/site-packages/setools/devicetreeconquery.py b/lib/python2.7/site-packages/setools/devicetreeconquery.py
new file mode 100644
index 0000000..8cf4f3a
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/devicetreeconquery.py
@@ -0,0 +1,79 @@
+# Derived from portconquery.py
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+import logging
+
+from .mixins import MatchContext
+from .query import PolicyQuery
+
+
+class DevicetreeconQuery(MatchContext, PolicyQuery):
+
+ """
+ Devicetreecon context query.
+
+ Parameter:
+ policy The policy to query.
+
+ Keyword Parameters/Class attributes:
+ path A single devicetree path.
+
+ user The criteria to match the context's user.
+ user_regex If true, regular expression matching
+ will be used on the user.
+
+ role The criteria to match the context's role.
+ role_regex If true, regular expression matching
+ will be used on the role.
+
+ type_ The criteria to match the context's type.
+ type_regex If true, regular expression matching
+ will be used on the type.
+
+ range_ The criteria to match the context's range.
+ range_subset If true, the criteria will match if it is a subset
+ of the context's range.
+ range_overlap If true, the criteria will match if it overlaps
+ any of the context's range.
+ range_superset If true, the criteria will match if it is a superset
+ of the context's range.
+ range_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+ """
+
+ path = None
+
+ def __init__(self, policy, **kwargs):
+ super(DevicetreeconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
+ def results(self):
+ """Generator which yields all matching devicetreecons."""
+ self.log.info("Generating results from {0.policy}".format(self))
+ self.log.debug("Path: {0.path!r}".format(self))
+ self._match_context_debug(self.log)
+
+ for devicetreecon in self.policy.devicetreecons():
+
+ if self.path and self.path != devicetreecon.path:
+ continue
+
+ if not self._match_context(devicetreecon.context):
+ continue
+
+ yield devicetreecon
diff --git a/lib/python2.7/site-packages/setools/diff/__init__.py b/lib/python2.7/site-packages/setools/diff/__init__.py
index 8d5900a..612574c 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/__init__.py
+++ b/lib/python2.7/site-packages/setools/diff/__init__.py
@@ -17,7 +17,9 @@
# <http://www.gnu.org/licenses/>.
#
from .bool import BooleansDifference
+from .bounds import BoundsDifference
from .commons import CommonDifference
+from .constraints import ConstraintsDifference
from .default import DefaultsDifference
from .fsuse import FSUsesDifference
from .genfscon import GenfsconsDifference
@@ -41,8 +43,10 @@ __all__ = ['PolicyDifference']
class PolicyDifference(BooleansDifference,
+ BoundsDifference,
CategoriesDifference,
CommonDifference,
+ ConstraintsDifference,
DefaultsDifference,
FSUsesDifference,
GenfsconsDifference,
diff --git a/lib/python2.7/site-packages/setools/diff/bool.py b/lib/python2.7/site-packages/setools/diff/bool.py
index 212a715..212a715 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/bool.py
+++ b/lib/python2.7/site-packages/setools/diff/bool.py
diff --git a/lib/python2.7/site-packages/setools/diff/bounds.py b/lib/python2.7/site-packages/setools/diff/bounds.py
new file mode 100755
index 0000000..e23c91f
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/diff/bounds.py
@@ -0,0 +1,112 @@
+# Copyright 2016, Tresys Technology, LLC
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+from collections import namedtuple
+
+from .descriptors import DiffResultDescriptor
+from .difference import Difference, SymbolWrapper, Wrapper
+
+
+modified_bounds_record = namedtuple("modified_bound", ["rule", "added_bound", "removed_bound"])
+
+
+class BoundsDifference(Difference):
+
+ """Determine the difference in *bounds between two policies."""
+
+ added_typebounds = DiffResultDescriptor("diff_typebounds")
+ removed_typebounds = DiffResultDescriptor("diff_typebounds")
+ modified_typebounds = DiffResultDescriptor("diff_typebounds")
+
+ # Lists of rules for each policy
+ _left_typebounds = None
+ _right_typebounds = None
+
+ def diff_typebounds(self):
+ """Generate the difference in typebound rules between the policies."""
+
+ self.log.info("Generating typebounds differences from {0.left_policy} to {0.right_policy}".
+ format(self))
+
+ if self._left_typebounds is None or self._right_typebounds is None:
+ self._create_typebound_lists()
+
+ self.added_typebounds, self.removed_typebounds, matched_typebounds = self._set_diff(
+ (BoundsWrapper(c) for c in self._left_typebounds),
+ (BoundsWrapper(c) for c in self._right_typebounds),
+ key=lambda b: str(b.child))
+
+ self.modified_typebounds = []
+
+ for left_bound, right_bound in matched_typebounds:
+ if SymbolWrapper(left_bound.parent) != SymbolWrapper(right_bound.parent):
+ self.modified_typebounds.append(modified_bounds_record(
+ left_bound, right_bound.parent, left_bound.parent))
+
+ #
+ # Internal functions
+ #
+ def _create_typebound_lists(self):
+ """Create rule lists for both policies."""
+ self._left_typebounds = []
+ for rule in self.left_policy.bounds():
+ if rule.ruletype == "typebounds":
+ self._left_typebounds.append(rule)
+ else:
+ self.log.error("Unknown rule type: {0} (This is an SETools bug)".
+ format(rule.ruletype))
+
+ self._right_typebounds = []
+ for rule in self.right_policy.bounds():
+ if rule.ruletype == "typebounds":
+ self._right_typebounds.append(rule)
+ else:
+ self.log.error("Unknown rule type: {0} (This is an SETools bug)".
+ format(rule.ruletype))
+
+ def _reset_diff(self):
+ """Reset diff results on policy changes."""
+ self.log.debug("Resetting all *bounds differences")
+ self.added_typebounds = None
+ self.removed_typebounds = None
+
+ # Sets of rules for each policy
+ self._left_typebounds = None
+ self._right_typebounds = None
+
+
+class BoundsWrapper(Wrapper):
+
+ """Wrap *bounds for diff purposes."""
+
+ def __init__(self, rule):
+ self.origin = rule
+ self.ruletype = rule.ruletype
+ self.parent = SymbolWrapper(rule.parent)
+ self.child = SymbolWrapper(rule.child)
+ self.key = hash(rule)
+
+ def __hash__(self):
+ return self.key
+
+ def __lt__(self, other):
+ return self.key < other.key
+
+ def __eq__(self, other):
+ return self.ruletype == other.ruletype and \
+ self.child == other.child
diff --git a/lib/python2.7/site-packages/setools/diff/commons.py b/lib/python2.7/site-packages/setools/diff/commons.py
index 41c13f8..41c13f8 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/commons.py
+++ b/lib/python2.7/site-packages/setools/diff/commons.py
diff --git a/lib/python2.7/site-packages/setools/diff/conditional.py b/lib/python2.7/site-packages/setools/diff/conditional.py
index 95a620e..95a620e 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/conditional.py
+++ b/lib/python2.7/site-packages/setools/diff/conditional.py
diff --git a/lib/python2.7/site-packages/setools/diff/constraints.py b/lib/python2.7/site-packages/setools/diff/constraints.py
new file mode 100755
index 0000000..d2e50f4
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/diff/constraints.py
@@ -0,0 +1,220 @@
+# Copyright 2016, Tresys Technology, LLC
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+from collections import namedtuple
+
+from .descriptors import DiffResultDescriptor
+from .difference import Difference, SymbolWrapper, Wrapper
+
+
+class ConstraintsDifference(Difference):
+
+ """
+ Determine the difference in constraints between two policies.
+
+ Since the compiler does not union constraints, there may be multiple
+ constraints with the same ruletype, object class, and permission
+ set, so constraints can only be added or removed, not modified.
+
+ The constraint expressions are compared only on a basic level.
+ Expressions that are logically equivalent but are structurally
+ different, for example, by associativity, will be considered
+ different. Type and role attributes are also not expanded,
+ so if there are changes to attribute members, it will not
+ be reflected as a difference.
+ """
+
+ added_constrains = DiffResultDescriptor("diff_constrains")
+ removed_constrains = DiffResultDescriptor("diff_constrains")
+
+ added_mlsconstrains = DiffResultDescriptor("diff_mlsconstrains")
+ removed_mlsconstrains = DiffResultDescriptor("diff_mlsconstrains")
+
+ added_validatetrans = DiffResultDescriptor("diff_validatetrans")
+ removed_validatetrans = DiffResultDescriptor("diff_validatetrans")
+
+ added_mlsvalidatetrans = DiffResultDescriptor("diff_mlsvalidatetrans")
+ removed_mlsvalidatetrans = DiffResultDescriptor("diff_mlsvalidatetrans")
+
+ # Lists of rules for each policy
+ _left_constrains = None
+ _right_constrains = None
+
+ _left_mlsconstrains = None
+ _right_mlsconstrains = None
+
+ _left_validatetrans = None
+ _right_validatetrans = None
+
+ _left_mlsvalidatetrans = None
+ _right_mlsvalidatetrans = None
+
+ def diff_constrains(self):
+ """Generate the difference in constraint rules between the policies."""
+
+ self.log.info("Generating constraint differences from {0.left_policy} to {0.right_policy}".
+ format(self))
+
+ if self._left_constrains is None or self._right_constrains is None:
+ self._create_constrain_lists()
+
+ self.added_constrains, self.removed_constrains, _ = self._set_diff(
+ (ConstraintWrapper(c) for c in self._left_constrains),
+ (ConstraintWrapper(c) for c in self._right_constrains))
+
+ def diff_mlsconstrains(self):
+ """Generate the difference in MLS constraint rules between the policies."""
+
+ self.log.info(
+ "Generating MLS constraint differences from {0.left_policy} to {0.right_policy}".
+ format(self))
+
+ if self._left_mlsconstrains is None or self._right_mlsconstrains is None:
+ self._create_constrain_lists()
+
+ self.added_mlsconstrains, self.removed_mlsconstrains, _ = self._set_diff(
+ (ConstraintWrapper(c) for c in self._left_mlsconstrains),
+ (ConstraintWrapper(c) for c in self._right_mlsconstrains))
+
+ def diff_validatetrans(self):
+ """Generate the difference in validatetrans rules between the policies."""
+
+ self.log.info(
+ "Generating validatetrans differences from {0.left_policy} to {0.right_policy}".
+ format(self))
+
+ if self._left_validatetrans is None or self._right_validatetrans is None:
+ self._create_constrain_lists()
+
+ self.added_validatetrans, self.removed_validatetrans, _ = self._set_diff(
+ (ConstraintWrapper(c) for c in self._left_validatetrans),
+ (ConstraintWrapper(c) for c in self._right_validatetrans))
+
+ def diff_mlsvalidatetrans(self):
+ """Generate the difference in MLS validatetrans rules between the policies."""
+
+ self.log.info(
+ "Generating mlsvalidatetrans differences from {0.left_policy} to {0.right_policy}".
+ format(self))
+
+ if self._left_mlsvalidatetrans is None or self._right_mlsvalidatetrans is None:
+ self._create_constrain_lists()
+
+ self.added_mlsvalidatetrans, self.removed_mlsvalidatetrans, _ = self._set_diff(
+ (ConstraintWrapper(c) for c in self._left_mlsvalidatetrans),
+ (ConstraintWrapper(c) for c in self._right_mlsvalidatetrans))
+
+ #
+ # Internal functions
+ #
+ def _create_constrain_lists(self):
+ """Create rule lists for both policies."""
+ self._left_constrains = []
+ self._left_mlsconstrains = []
+ self._left_validatetrans = []
+ self._left_mlsvalidatetrans = []
+ for rule in self.left_policy.constraints():
+ if rule.ruletype == "constrain":
+ self._left_constrains.append(rule)
+ elif rule.ruletype == "mlsconstrain":
+ self._left_mlsconstrains.append(rule)
+ elif rule.ruletype == "validatetrans":
+ self._left_validatetrans.append(rule)
+ elif rule.ruletype == "mlsvalidatetrans":
+ self._left_mlsvalidatetrans.append(rule)
+ else:
+ self.log.error("Unknown rule type: {0} (This is an SETools bug)".
+ format(rule.ruletype))
+
+ self._right_constrains = []
+ self._right_mlsconstrains = []
+ self._right_validatetrans = []
+ self._right_mlsvalidatetrans = []
+ for rule in self.right_policy.constraints():
+ if rule.ruletype == "constrain":
+ self._right_constrains.append(rule)
+ elif rule.ruletype == "mlsconstrain":
+ self._right_mlsconstrains.append(rule)
+ elif rule.ruletype == "validatetrans":
+ self._right_validatetrans.append(rule)
+ elif rule.ruletype == "mlsvalidatetrans":
+ self._right_mlsvalidatetrans.append(rule)
+ else:
+ self.log.error("Unknown rule type: {0} (This is an SETools bug)".
+ format(rule.ruletype))
+
+ def _reset_diff(self):
+ """Reset diff results on policy changes."""
+ self.log.debug("Resetting all constraints differences")
+ self.added_constrains = None
+ self.removed_constrains = None
+ self.added_mlsconstrains = None
+ self.removed_mlsconstrains = None
+ self.added_validatetrans = None
+ self.removed_validatetrans = None
+ self.added_mlsvalidatetrans = None
+ self.removed_mlsvalidatetrans = None
+
+ # Sets of rules for each policy
+ self._left_constrains = None
+ self._left_mlsconstrains = None
+ self._left_validatetrans = None
+ self._left_mlsvalidatetrans = None
+ self._right_constrains = None
+ self._right_mlsconstrains = None
+ self._right_validatetrans = None
+ self._right_mlsvalidatetrans = None
+
+
+class ConstraintWrapper(Wrapper):
+
+ """Wrap constraints for diff purposes."""
+
+ def __init__(self, rule):
+ self.origin = rule
+ self.ruletype = rule.ruletype
+ self.tclass = SymbolWrapper(rule.tclass)
+
+ try:
+ self.perms = rule.perms
+ except AttributeError:
+ # (mls)validatetrans
+ self.perms = None
+
+ self.key = hash(rule)
+
+ self.expr = []
+ for op in rule.postfix_expression():
+ if isinstance(op, frozenset):
+ # lists of types/users/roles
+ self.expr.append(frozenset(SymbolWrapper(item) for item in op))
+ else:
+ # strings in the expression such as u1/r1/t1 or "=="
+ self.expr.append(op)
+
+ def __hash__(self):
+ return self.key
+
+ def __lt__(self, other):
+ return self.key < other.key
+
+ def __eq__(self, other):
+ return self.ruletype == other.ruletype and \
+ self.tclass == other.tclass and \
+ self.perms == other.perms and \
+ self.expr == other.expr
diff --git a/lib/python2.7/site-packages/setools/diff/context.py b/lib/python2.7/site-packages/setools/diff/context.py
index 4124aff..4124aff 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/context.py
+++ b/lib/python2.7/site-packages/setools/diff/context.py
diff --git a/lib/python2.7/site-packages/setools/diff/default.py b/lib/python2.7/site-packages/setools/diff/default.py
index ce7c569..ce7c569 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/default.py
+++ b/lib/python2.7/site-packages/setools/diff/default.py
diff --git a/lib/python2.7/site-packages/setools/diff/descriptors.py b/lib/python2.7/site-packages/setools/diff/descriptors.py
index 2295d74..2295d74 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/descriptors.py
+++ b/lib/python2.7/site-packages/setools/diff/descriptors.py
diff --git a/lib/python2.7/site-packages/setools/diff/difference.py b/lib/python2.7/site-packages/setools/diff/difference.py
index 189c67d..f3cde8a 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/difference.py
+++ b/lib/python2.7/site-packages/setools/diff/difference.py
@@ -27,7 +27,7 @@ class Difference(object):
"""Base class for all policy differences."""
def __init__(self, left_policy, right_policy):
- self.log = logging.getLogger(self.__class__.__name__)
+ self.log = logging.getLogger(__name__)
self.left_policy = left_policy
self.right_policy = right_policy
@@ -72,7 +72,7 @@ class Difference(object):
yield Wrapper(expanded_rule)
@staticmethod
- def _set_diff(left, right):
+ def _set_diff(left, right, key=None):
"""
Standard diff of two sets.
@@ -108,8 +108,8 @@ class Difference(object):
# instead of giving wrong results. If there is a better way to,
# ensure the items match up, please let me know how or submit a patch.
matched_items = set()
- left_matched_items = sorted((left_items - removed_items))
- right_matched_items = sorted((right_items - added_items))
+ left_matched_items = sorted((left_items - removed_items), key=key)
+ right_matched_items = sorted((right_items - added_items), key=key)
assert len(left_matched_items) == len(right_matched_items), \
"Matched items assertion failure (this is an SETools bug), {0} != {1}". \
format(len(left_matched_items), len(right_matched_items))
diff --git a/lib/python2.7/site-packages/setools/diff/fsuse.py b/lib/python2.7/site-packages/setools/diff/fsuse.py
index 3a0c0e1..3a0c0e1 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/fsuse.py
+++ b/lib/python2.7/site-packages/setools/diff/fsuse.py
diff --git a/lib/python2.7/site-packages/setools/diff/genfscon.py b/lib/python2.7/site-packages/setools/diff/genfscon.py
index 24f0a7d..24f0a7d 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/genfscon.py
+++ b/lib/python2.7/site-packages/setools/diff/genfscon.py
diff --git a/lib/python2.7/site-packages/setools/diff/initsid.py b/lib/python2.7/site-packages/setools/diff/initsid.py
index 33098ad..33098ad 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/initsid.py
+++ b/lib/python2.7/site-packages/setools/diff/initsid.py
diff --git a/lib/python2.7/site-packages/setools/diff/mls.py b/lib/python2.7/site-packages/setools/diff/mls.py
index efd758f..efd758f 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/mls.py
+++ b/lib/python2.7/site-packages/setools/diff/mls.py
diff --git a/lib/python2.7/site-packages/setools/diff/mlsrules.py b/lib/python2.7/site-packages/setools/diff/mlsrules.py
index 75f443e..80f99b2 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/mlsrules.py
+++ b/lib/python2.7/site-packages/setools/diff/mlsrules.py
@@ -16,7 +16,7 @@
# License along with SETools. If not, see
# <http://www.gnu.org/licenses/>.
#
-from collections import namedtuple
+from collections import defaultdict, namedtuple
from .descriptors import DiffResultDescriptor
from .difference import Difference, SymbolWrapper, Wrapper
@@ -37,8 +37,8 @@ class MLSRulesDifference(Difference):
modified_range_transitions = DiffResultDescriptor("diff_range_transitions")
# Lists of rules for each policy
- _left_range_transitions = None
- _right_range_transitions = None
+ _left_mls_rules = defaultdict(list)
+ _right_mls_rules = defaultdict(list)
def diff_range_transitions(self):
"""Generate the difference in range_transition rules between the policies."""
@@ -47,43 +47,12 @@ class MLSRulesDifference(Difference):
"Generating range_transition differences from {0.left_policy} to {0.right_policy}".
format(self))
- if self._left_range_transitions is None or self._right_range_transitions is None:
+ if not self._left_mls_rules or not self._right_mls_rules:
self._create_mls_rule_lists()
- self.added_range_transitions, \
- self.removed_range_transitions, \
- self.modified_range_transitions = self._diff_mls_rules(
- self._expand_generator(self._left_range_transitions, MLSRuleWrapper),
- self._expand_generator(self._right_range_transitions, MLSRuleWrapper))
-
- #
- # Internal functions
- #
- def _create_mls_rule_lists(self):
- """Create rule lists for both policies."""
- self._left_range_transitions = []
- for rule in self.left_policy.mlsrules():
- # do not expand yet, to keep memory
- # use down as long as possible
- if rule.ruletype == "range_transition":
- self._left_range_transitions.append(rule)
- else:
- self.log.error("Unknown rule type: {0} (This is an SETools bug)".
- format(rule.ruletype))
-
- self._right_range_transitions = []
- for rule in self.right_policy.mlsrules():
- # do not expand yet, to keep memory
- # use down as long as possible
- if rule.ruletype == "range_transition":
- self._right_range_transitions.append(rule)
- else:
- self.log.error("Unknown rule type: {0} (This is an SETools bug)".
- format(rule.ruletype))
-
- def _diff_mls_rules(self, left_list, right_list):
- """Common method for comparing type_* rules."""
- added, removed, matched = self._set_diff(left_list, right_list)
+ added, removed, matched = self._set_diff(
+ self._expand_generator(self._left_mls_rules["range_transition"], MLSRuleWrapper),
+ self._expand_generator(self._right_mls_rules["range_transition"], MLSRuleWrapper))
modified = []
@@ -95,7 +64,26 @@ class MLSRulesDifference(Difference):
right_rule.default,
left_rule.default))
- return added, removed, modified
+ self.added_range_transitions = added
+ self.removed_range_transitions = removed
+ self.modified_range_transitions = modified
+
+ #
+ # Internal functions
+ #
+ def _create_mls_rule_lists(self):
+ """Create rule lists for both policies."""
+ # do not expand yet, to keep memory
+ # use down as long as possible
+ self.log.debug("Building MLS rule lists from {0.left_policy}".format(self))
+ for rule in self.left_policy.mlsrules():
+ self._left_mls_rules[rule.ruletype].append(rule)
+
+ self.log.debug("Building MLS rule lists from {0.right_policy}".format(self))
+ for rule in self.right_policy.mlsrules():
+ self._right_mls_rules[rule.ruletype].append(rule)
+
+ self.log.debug("Completed building MLS rule lists.")
def _reset_diff(self):
"""Reset diff results on policy changes."""
@@ -105,8 +93,8 @@ class MLSRulesDifference(Difference):
self.modified_range_transitions = None
# Sets of rules for each policy
- self._left_range_transitions = None
- self._right_range_transitions = None
+ self._left_mls_rules.clear()
+ self._right_mls_rules.clear()
class MLSRuleWrapper(Wrapper):
diff --git a/lib/python2.7/site-packages/setools/diff/netifcon.py b/lib/python2.7/site-packages/setools/diff/netifcon.py
index 8a2b9e3..8a2b9e3 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/netifcon.py
+++ b/lib/python2.7/site-packages/setools/diff/netifcon.py
diff --git a/lib/python2.7/site-packages/setools/diff/nodecon.py b/lib/python2.7/site-packages/setools/diff/nodecon.py
index 6e94c9e..6e94c9e 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/nodecon.py
+++ b/lib/python2.7/site-packages/setools/diff/nodecon.py
diff --git a/lib/python2.7/site-packages/setools/diff/objclass.py b/lib/python2.7/site-packages/setools/diff/objclass.py
index 6a12de4..6a12de4 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/objclass.py
+++ b/lib/python2.7/site-packages/setools/diff/objclass.py
diff --git a/lib/python2.7/site-packages/setools/diff/polcap.py b/lib/python2.7/site-packages/setools/diff/polcap.py
index 9c0afe2..9c0afe2 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/polcap.py
+++ b/lib/python2.7/site-packages/setools/diff/polcap.py
diff --git a/lib/python2.7/site-packages/setools/diff/portcon.py b/lib/python2.7/site-packages/setools/diff/portcon.py
index 17df377..17df377 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/portcon.py
+++ b/lib/python2.7/site-packages/setools/diff/portcon.py
diff --git a/lib/python2.7/site-packages/setools/diff/properties.py b/lib/python2.7/site-packages/setools/diff/properties.py
index 8cd4c13..8cd4c13 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/properties.py
+++ b/lib/python2.7/site-packages/setools/diff/properties.py
diff --git a/lib/python2.7/site-packages/setools/diff/rbacrules.py b/lib/python2.7/site-packages/setools/diff/rbacrules.py
index 8a51b88..81be013 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/rbacrules.py
+++ b/lib/python2.7/site-packages/setools/diff/rbacrules.py
@@ -16,7 +16,7 @@
# License along with SETools. If not, see
# <http://www.gnu.org/licenses/>.
#
-from collections import namedtuple
+from collections import defaultdict, namedtuple
from .descriptors import DiffResultDescriptor
from .difference import Difference, SymbolWrapper, Wrapper
@@ -40,11 +40,8 @@ class RBACRulesDifference(Difference):
modified_role_transitions = DiffResultDescriptor("diff_role_transitions")
# Lists of rules for each policy
- _left_role_allows = None
- _right_role_allows = None
-
- _left_role_transitions = None
- _right_role_transitions = None
+ _left_rbac_rules = defaultdict(list)
+ _right_rbac_rules = defaultdict(list)
def diff_role_allows(self):
"""Generate the difference in role allow rules between the policies."""
@@ -53,12 +50,12 @@ class RBACRulesDifference(Difference):
"Generating role allow differences from {0.left_policy} to {0.right_policy}".
format(self))
- if self._left_role_allows is None or self._right_role_allows is None:
+ if not self._left_rbac_rules or not self._right_rbac_rules:
self._create_rbac_rule_lists()
- self.added_role_allows, self.removed_role_allows, _ = \
- self._set_diff(self._expand_generator(self._left_role_allows, RoleAllowWrapper),
- self._expand_generator(self._right_role_allows, RoleAllowWrapper))
+ self.added_role_allows, self.removed_role_allows, _ = self._set_diff(
+ self._expand_generator(self._left_rbac_rules["allow"], RoleAllowWrapper),
+ self._expand_generator(self._right_rbac_rules["allow"], RoleAllowWrapper))
def diff_role_transitions(self):
"""Generate the difference in role_transition rules between the policies."""
@@ -67,52 +64,15 @@ class RBACRulesDifference(Difference):
"Generating role_transition differences from {0.left_policy} to {0.right_policy}".
format(self))
- if self._left_role_transitions is None or self._right_role_transitions is None:
+ if not self._left_rbac_rules or not self._right_rbac_rules:
self._create_rbac_rule_lists()
- self.added_role_transitions, \
- self.removed_role_transitions, \
- self.modified_role_transitions = self._diff_rbac_rules(
- self._expand_generator(self._left_role_transitions, RoleTransitionWrapper),
- self._expand_generator(self._right_role_transitions, RoleTransitionWrapper))
-
- #
- # Internal functions
- #
- def _create_rbac_rule_lists(self):
- """Create rule lists for both policies."""
- self._left_role_allows = []
- self._left_role_transitions = []
- for rule in self.left_policy.rbacrules():
- # do not expand yet, to keep memory
- # use down as long as possible
- if rule.ruletype == "allow":
- self._left_role_allows.append(rule)
- elif rule.ruletype == "role_transition":
- self._left_role_transitions.append(rule)
- else:
- self.log.error("Unknown rule type: {0} (This is an SETools bug)".
- format(rule.ruletype))
-
- self._right_role_allows = []
- self._right_role_transitions = []
- for rule in self.right_policy.rbacrules():
- # do not expand yet, to keep memory
- # use down as long as possible
- if rule.ruletype == "allow":
- self._right_role_allows.append(rule)
- elif rule.ruletype == "role_transition":
- self._right_role_transitions.append(rule)
- else:
- self.log.error("Unknown rule type: {0} (This is an SETools bug)".
- format(rule.ruletype))
-
- def _diff_rbac_rules(self, left_list, right_list):
- """Common method for comparing rbac rules."""
- added, removed, matched = self._set_diff(left_list, right_list)
+ added, removed, matched = self._set_diff(
+ self._expand_generator(self._left_rbac_rules["role_transition"], RoleTransitionWrapper),
+ self._expand_generator(self._right_rbac_rules["role_transition"],
+ RoleTransitionWrapper))
modified = []
-
for left_rule, right_rule in matched:
# Criteria for modified rules
# 1. change to default role
@@ -121,7 +81,26 @@ class RBACRulesDifference(Difference):
right_rule.default,
left_rule.default))
- return added, removed, modified
+ self.added_role_transitions = added
+ self.removed_role_transitions = removed
+ self.modified_role_transitions = modified
+
+ #
+ # Internal functions
+ #
+ def _create_rbac_rule_lists(self):
+ """Create rule lists for both policies."""
+ # do not expand yet, to keep memory
+ # use down as long as possible
+ self.log.debug("Building RBAC rule lists from {0.left_policy}".format(self))
+ for rule in self.left_policy.rbacrules():
+ self._left_rbac_rules[rule.ruletype].append(rule)
+
+ self.log.debug("Building RBAC rule lists from {0.right_policy}".format(self))
+ for rule in self.right_policy.rbacrules():
+ self._right_rbac_rules[rule.ruletype].append(rule)
+
+ self.log.debug("Completed building RBAC rule lists.")
def _reset_diff(self):
"""Reset diff results on policy changes."""
@@ -134,10 +113,8 @@ class RBACRulesDifference(Difference):
self.modified_role_transitions = None
# Sets of rules for each policy
- self._left_role_allows = None
- self._right_role_allows = None
- self._left_role_transitions = None
- self._right_role_transitions = None
+ self._left_rbac_rules.clear()
+ self._right_rbac_rules.clear()
class RoleAllowWrapper(Wrapper):
diff --git a/lib/python2.7/site-packages/setools/diff/roles.py b/lib/python2.7/site-packages/setools/diff/roles.py
index 38ca84e..38ca84e 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/roles.py
+++ b/lib/python2.7/site-packages/setools/diff/roles.py
diff --git a/lib/python2.7/site-packages/setools/diff/terules.py b/lib/python2.7/site-packages/setools/diff/terules.py
index 179e5ec..437bc06 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/terules.py
+++ b/lib/python2.7/site-packages/setools/diff/terules.py
@@ -16,8 +16,9 @@
# License along with SETools. If not, see
# <http://www.gnu.org/licenses/>.
#
-from collections import namedtuple
+from collections import defaultdict, namedtuple
+from ..policyrep import ioctlSet
from ..policyrep.exception import RuleNotConditional, RuleUseError, TERuleNoFilename
from .conditional import ConditionalExprWrapper
@@ -33,272 +34,219 @@ modified_avrule_record = namedtuple("modified_avrule", ["rule",
modified_terule_record = namedtuple("modified_terule", ["rule", "added_default", "removed_default"])
-class TERulesDifference(Difference):
+def av_diff_template(ruletype):
"""
- Determine the difference in type enforcement rules
- between two policies.
- """
+ This is a template for the access vector diff functions.
- added_allows = DiffResultDescriptor("diff_allows")
- removed_allows = DiffResultDescriptor("diff_allows")
- modified_allows = DiffResultDescriptor("diff_allows")
-
- added_auditallows = DiffResultDescriptor("diff_auditallows")
- removed_auditallows = DiffResultDescriptor("diff_auditallows")
- modified_auditallows = DiffResultDescriptor("diff_auditallows")
+ Parameters:
+ ruletype The rule type, e.g. "allow".
+ """
- added_neverallows = DiffResultDescriptor("diff_neverallows")
- removed_neverallows = DiffResultDescriptor("diff_neverallows")
- modified_neverallows = DiffResultDescriptor("diff_neverallows")
+ def diff(self):
+ """Generate the difference in rules between the policies."""
- added_dontaudits = DiffResultDescriptor("diff_dontaudits")
- removed_dontaudits = DiffResultDescriptor("diff_dontaudits")
- modified_dontaudits = DiffResultDescriptor("diff_dontaudits")
+ self.log.info(
+ "Generating {0} differences from {1.left_policy} to {1.right_policy}".
+ format(ruletype, self))
- added_type_transitions = DiffResultDescriptor("diff_type_transitions")
- removed_type_transitions = DiffResultDescriptor("diff_type_transitions")
- modified_type_transitions = DiffResultDescriptor("diff_type_transitions")
+ if not self._left_te_rules or not self._right_te_rules:
+ self._create_te_rule_lists()
- added_type_changes = DiffResultDescriptor("diff_type_changes")
- removed_type_changes = DiffResultDescriptor("diff_type_changes")
- modified_type_changes = DiffResultDescriptor("diff_type_changes")
+ added, removed, matched = self._set_diff(
+ self._expand_generator(self._left_te_rules[ruletype], AVRuleWrapper),
+ self._expand_generator(self._right_te_rules[ruletype], AVRuleWrapper))
- added_type_members = DiffResultDescriptor("diff_type_members")
- removed_type_members = DiffResultDescriptor("diff_type_members")
- modified_type_members = DiffResultDescriptor("diff_type_members")
+ modified = []
+ for left_rule, right_rule in matched:
+ # Criteria for modified rules
+ # 1. change to permissions
+ added_perms, removed_perms, matched_perms = self._set_diff(left_rule.perms,
+ right_rule.perms)
- # Lists of rules for each policy
- _left_allows = None
- _right_allows = None
+ # the final set comprehension is to avoid having lists
+ # like [("perm1", "perm1"), ("perm2", "perm2")], as the
+ # matched_perms return from _set_diff is a set of tuples
+ if added_perms or removed_perms:
+ modified.append(modified_avrule_record(left_rule,
+ added_perms,
+ removed_perms,
+ set(p[0] for p in matched_perms)))
- _left_auditallows = None
- _right_auditallows = None
+ setattr(self, "added_{0}s".format(ruletype), added)
+ setattr(self, "removed_{0}s".format(ruletype), removed)
+ setattr(self, "modified_{0}s".format(ruletype), modified)
- _left_neverallows = None
- _right_neverallows = None
+ return diff
- _left_dontaudits = None
- _right_dontaudits = None
- _left_type_transitions = None
- _right_type_transitions = None
+def avx_diff_template(ruletype):
- _left_type_changes = None
- _right_type_changes = None
+ """
+ This is a template for the extended permission access vector diff functions.
- _left_type_members = None
- _right_type_members = None
+ Parameters:
+ ruletype The rule type, e.g. "allowxperm".
+ """
- def diff_allows(self):
- """Generate the difference in allow rules between the policies."""
+ def diff(self):
+ """Generate the difference in rules between the policies."""
self.log.info(
- "Generating allow differences from {0.left_policy} to {0.right_policy}".format(self))
+ "Generating {0} differences from {1.left_policy} to {1.right_policy}".
+ format(ruletype, self))
- if self._left_allows is None or self._right_allows is None:
+ if not self._left_te_rules or not self._right_te_rules:
self._create_te_rule_lists()
- self.added_allows, self.removed_allows, self.modified_allows = self._diff_av_rules(
- self._expand_generator(self._left_allows, AVRuleWrapper),
- self._expand_generator(self._right_allows, AVRuleWrapper))
+ added, removed, matched = self._set_diff(
+ self._expand_generator(self._left_te_rules[ruletype], AVRuleXpermWrapper),
+ self._expand_generator(self._right_te_rules[ruletype], AVRuleXpermWrapper))
- def diff_auditallows(self):
- """Generate the difference in auditallow rules between the policies."""
+ modified = []
+ for left_rule, right_rule in matched:
+ # Criteria for modified rules
+ # 1. change to permissions
+ added_perms, removed_perms, matched_perms = self._set_diff(left_rule.perms,
+ right_rule.perms)
- self.log.info(
- "Generating auditallow differences from {0.left_policy} to {0.right_policy}".
- format(self))
+ # the final set comprehension is to avoid having lists
+ # like [("perm1", "perm1"), ("perm2", "perm2")], as the
+ # matched_perms return from _set_diff is a set of tuples
+ if added_perms or removed_perms:
+ modified.append(modified_avrule_record(left_rule,
+ ioctlSet(added_perms),
+ ioctlSet(removed_perms),
+ ioctlSet(p[0] for p in matched_perms)))
- if self._left_auditallows is None or self._right_auditallows is None:
- self._create_te_rule_lists()
+ setattr(self, "added_{0}s".format(ruletype), added)
+ setattr(self, "removed_{0}s".format(ruletype), removed)
+ setattr(self, "modified_{0}s".format(ruletype), modified)
- self.added_auditallows, \
- self.removed_auditallows, \
- self.modified_auditallows = self._diff_av_rules(
- self._expand_generator(self._left_auditallows, AVRuleWrapper),
- self._expand_generator(self._right_auditallows, AVRuleWrapper))
+ return diff
- def diff_neverallows(self):
- """Generate the difference in neverallow rules between the policies."""
- self.log.info(
- "Generating neverallow differences from {0.left_policy} to {0.right_policy}".
- format(self))
+def te_diff_template(ruletype):
- if self._left_neverallows is None or self._right_neverallows is None:
- self._create_te_rule_lists()
+ """
+ This is a template for the type_* diff functions.
- self.added_neverallows, \
- self.removed_neverallows, \
- self.modified_neverallows = self._diff_av_rules(
- self._expand_generator(self._left_neverallows, AVRuleWrapper),
- self._expand_generator(self._right_neverallows, AVRuleWrapper))
+ Parameters:
+ ruletype The rule type, e.g. "type_transition".
+ """
- def diff_dontaudits(self):
- """Generate the difference in dontaudit rules between the policies."""
+ def diff(self):
+ """Generate the difference in rules between the policies."""
self.log.info(
- "Generating dontaudit differences from {0.left_policy} to {0.right_policy}".
- format(self))
+ "Generating {0} differences from {1.left_policy} to {1.right_policy}".
+ format(ruletype, self))
- if self._left_dontaudits is None or self._right_dontaudits is None:
+ if not self._left_te_rules or not self._right_te_rules:
self._create_te_rule_lists()
- self.added_dontaudits, \
- self.removed_dontaudits, \
- self.modified_dontaudits = self._diff_av_rules(
- self._expand_generator(self._left_dontaudits, AVRuleWrapper),
- self._expand_generator(self._right_dontaudits, AVRuleWrapper))
+ added, removed, matched = self._set_diff(
+ self._expand_generator(self._left_te_rules[ruletype], TERuleWrapper),
+ self._expand_generator(self._right_te_rules[ruletype], TERuleWrapper))
- def diff_type_transitions(self):
- """Generate the difference in type_transition rules between the policies."""
-
- self.log.info(
- "Generating type_transition differences from {0.left_policy} to {0.right_policy}".
- format(self))
+ modified = []
+ for left_rule, right_rule in matched:
+ # Criteria for modified rules
+ # 1. change to default type
+ if SymbolWrapper(left_rule.default) != SymbolWrapper(right_rule.default):
+ modified.append(modified_terule_record(left_rule,
+ right_rule.default,
+ left_rule.default))
- if self._left_type_transitions is None or self._right_type_transitions is None:
- self._create_te_rule_lists()
+ setattr(self, "added_{0}s".format(ruletype), added)
+ setattr(self, "removed_{0}s".format(ruletype), removed)
+ setattr(self, "modified_{0}s".format(ruletype), modified)
- self.added_type_transitions, \
- self.removed_type_transitions, \
- self.modified_type_transitions = self._diff_te_rules(
- self._expand_generator(self._left_type_transitions, TERuleWrapper),
- self._expand_generator(self._right_type_transitions, TERuleWrapper))
+ return diff
- def diff_type_changes(self):
- """Generate the difference in type_change rules between the policies."""
- self.log.info(
- "Generating type_change differences from {0.left_policy} to {0.right_policy}".
- format(self))
+class TERulesDifference(Difference):
- if self._left_type_changes is None or self._right_type_changes is None:
- self._create_te_rule_lists()
+ """
+ Determine the difference in type enforcement rules
+ between two policies.
+ """
- self.added_type_changes, \
- self.removed_type_changes, \
- self.modified_type_changes = self._diff_te_rules(
- self._expand_generator(self._left_type_changes, TERuleWrapper),
- self._expand_generator(self._right_type_changes, TERuleWrapper))
+ diff_allows = av_diff_template("allow")
+ added_allows = DiffResultDescriptor("diff_allows")
+ removed_allows = DiffResultDescriptor("diff_allows")
+ modified_allows = DiffResultDescriptor("diff_allows")
- def diff_type_members(self):
- """Generate the difference in type_member rules between the policies."""
+ diff_auditallows = av_diff_template("auditallow")
+ added_auditallows = DiffResultDescriptor("diff_auditallows")
+ removed_auditallows = DiffResultDescriptor("diff_auditallows")
+ modified_auditallows = DiffResultDescriptor("diff_auditallows")
- self.log.info(
- "Generating type_member differences from {0.left_policy} to {0.right_policy}".
- format(self))
+ diff_neverallows = av_diff_template("neverallow")
+ added_neverallows = DiffResultDescriptor("diff_neverallows")
+ removed_neverallows = DiffResultDescriptor("diff_neverallows")
+ modified_neverallows = DiffResultDescriptor("diff_neverallows")
- if self._left_type_members is None or self._right_type_members is None:
- self._create_te_rule_lists()
+ diff_dontaudits = av_diff_template("dontaudit")
+ added_dontaudits = DiffResultDescriptor("diff_dontaudits")
+ removed_dontaudits = DiffResultDescriptor("diff_dontaudits")
+ modified_dontaudits = DiffResultDescriptor("diff_dontaudits")
- self.added_type_members, \
- self.removed_type_members, \
- self.modified_type_members = self._diff_te_rules(
- self._expand_generator(self._left_type_members, TERuleWrapper),
- self._expand_generator(self._right_type_members, TERuleWrapper))
+ diff_allowxperms = avx_diff_template("allowxperm")
+ added_allowxperms = DiffResultDescriptor("diff_allowxperms")
+ removed_allowxperms = DiffResultDescriptor("diff_allowxperms")
+ modified_allowxperms = DiffResultDescriptor("diff_allowxperms")
- #
- # Internal functions
- #
- def _create_te_rule_lists(self):
- """Create rule lists for both policies."""
+ diff_auditallowxperms = avx_diff_template("auditallowxperm")
+ added_auditallowxperms = DiffResultDescriptor("diff_auditallowxperms")
+ removed_auditallowxperms = DiffResultDescriptor("diff_auditallowxperms")
+ modified_auditallowxperms = DiffResultDescriptor("diff_auditallowxperms")
- self._left_allows = []
- self._left_auditallows = []
- self._left_neverallows = []
- self._left_dontaudits = []
- self._left_type_transitions = []
- self._left_type_changes = []
- self._left_type_members = []
- for rule in self.left_policy.terules():
- # do not expand yet, to keep memory
- # use down as long as possible
- if rule.ruletype == "allow":
- self._left_allows.append(rule)
- elif rule.ruletype == "auditallow":
- self._left_auditallows.append(rule)
- elif rule.ruletype == "neverallow":
- self._left_neverallows.append(rule)
- elif rule.ruletype == "dontaudit":
- self._left_dontaudits.append(rule)
- elif rule.ruletype == "type_transition":
- self._left_type_transitions.append(rule)
- elif rule.ruletype == "type_change":
- self._left_type_changes.append(rule)
- elif rule.ruletype == "type_member":
- self._left_type_members.append(rule)
- else:
- self.log.error("Unknown rule type: {0} (This is an SETools bug)".
- format(rule.ruletype))
-
- self._right_allows = []
- self._right_auditallows = []
- self._right_neverallows = []
- self._right_dontaudits = []
- self._right_type_transitions = []
- self._right_type_changes = []
- self._right_type_members = []
- for rule in self.right_policy.terules():
- # do not expand yet, to keep memory
- # use down as long as possible
- if rule.ruletype == "allow":
- self._right_allows.append(rule)
- elif rule.ruletype == "auditallow":
- self._right_auditallows.append(rule)
- elif rule.ruletype == "neverallow":
- self._right_neverallows.append(rule)
- elif rule.ruletype == "dontaudit":
- self._right_dontaudits.append(rule)
- elif rule.ruletype == "type_transition":
- self._right_type_transitions.append(rule)
- elif rule.ruletype == "type_change":
- self._right_type_changes.append(rule)
- elif rule.ruletype == "type_member":
- self._right_type_members.append(rule)
- else:
- self.log.error("Unknown rule type: {0} (This is an SETools bug)".
- format(rule.ruletype))
-
- def _diff_av_rules(self, left_list, right_list):
- """Common method for comparing access vector rules."""
- added, removed, matched = self._set_diff(left_list, right_list)
+ diff_neverallowxperms = avx_diff_template("neverallowxperm")
+ added_neverallowxperms = DiffResultDescriptor("diff_neverallowxperms")
+ removed_neverallowxperms = DiffResultDescriptor("diff_neverallowxperms")
+ modified_neverallowxperms = DiffResultDescriptor("diff_neverallowxperms")
- modified = []
+ diff_dontauditxperms = avx_diff_template("dontauditxperm")
+ added_dontauditxperms = DiffResultDescriptor("diff_dontauditxperms")
+ removed_dontauditxperms = DiffResultDescriptor("diff_dontauditxperms")
+ modified_dontauditxperms = DiffResultDescriptor("diff_dontauditxperms")
- for left_rule, right_rule in matched:
- # Criteria for modified rules
- # 1. change to permissions
- added_perms, removed_perms, matched_perms = self._set_diff(left_rule.perms,
- right_rule.perms)
+ diff_type_transitions = te_diff_template("type_transition")
+ added_type_transitions = DiffResultDescriptor("diff_type_transitions")
+ removed_type_transitions = DiffResultDescriptor("diff_type_transitions")
+ modified_type_transitions = DiffResultDescriptor("diff_type_transitions")
- # the final set comprehension is to avoid having lists
- # like [("perm1", "perm1"), ("perm2", "perm2")], as the
- # matched_perms return from _set_diff is a set of tuples
- if added_perms or removed_perms:
- modified.append(modified_avrule_record(left_rule,
- added_perms,
- removed_perms,
- set(p[0] for p in matched_perms)))
+ diff_type_changes = te_diff_template("type_change")
+ added_type_changes = DiffResultDescriptor("diff_type_changes")
+ removed_type_changes = DiffResultDescriptor("diff_type_changes")
+ modified_type_changes = DiffResultDescriptor("diff_type_changes")
- return added, removed, modified
+ diff_type_members = te_diff_template("type_member")
+ added_type_members = DiffResultDescriptor("diff_type_members")
+ removed_type_members = DiffResultDescriptor("diff_type_members")
+ modified_type_members = DiffResultDescriptor("diff_type_members")
- def _diff_te_rules(self, left_list, right_list):
- """Common method for comparing type_* rules."""
- added, removed, matched = self._set_diff(left_list, right_list)
+ # Lists of rules for each policy
+ _left_te_rules = defaultdict(list)
+ _right_te_rules = defaultdict(list)
- modified = []
+ #
+ # Internal functions
+ #
+ def _create_te_rule_lists(self):
+ """Create rule lists for both policies."""
+ # do not expand yet, to keep memory
+ # use down as long as possible
+ self.log.debug("Building TE rule lists from {0.left_policy}".format(self))
+ for rule in self.left_policy.terules():
+ self._left_te_rules[rule.ruletype].append(rule)
- for left_rule, right_rule in matched:
- # Criteria for modified rules
- # 1. change to default type
- if SymbolWrapper(left_rule.default) != SymbolWrapper(right_rule.default):
- modified.append(modified_terule_record(left_rule,
- right_rule.default,
- left_rule.default))
+ self.log.debug("Building TE rule lists from {0.right_policy}".format(self))
+ for rule in self.right_policy.terules():
+ self._right_te_rules[rule.ruletype].append(rule)
- return added, removed, modified
+ self.log.debug("Completed building TE rule lists.")
def _reset_diff(self):
"""Reset diff results on policy changes."""
@@ -315,6 +263,18 @@ class TERulesDifference(Difference):
self.added_dontaudits = None
self.removed_dontaudits = None
self.modified_dontaudits = None
+ self.added_allowxperms = None
+ self.removed_allowxperms = None
+ self.modified_allowxperms = None
+ self.added_auditallowxperms = None
+ self.removed_auditallowxperms = None
+ self.modified_auditallowxperms = None
+ self.added_neverallowxperms = None
+ self.removed_neverallowxperms = None
+ self.modified_neverallowxperms = None
+ self.added_dontauditxperms = None
+ self.removed_dontauditxperms = None
+ self.modified_dontauditxperms = None
self.added_type_transitions = None
self.removed_type_transitions = None
self.modified_type_transitions = None
@@ -326,20 +286,8 @@ class TERulesDifference(Difference):
self.modified_type_members = None
# Sets of rules for each policy
- self._left_allows = None
- self._right_allows = None
- self._left_auditallows = None
- self._right_auditallows = None
- self._left_neverallows = None
- self._right_neverallows = None
- self._left_dontaudits = None
- self._right_dontaudits = None
- self._left_type_transitions = None
- self._right_type_transitions = None
- self._left_type_changes = None
- self._right_type_changes = None
- self._left_type_members = None
- self._right_type_members = None
+ self._left_te_rules.clear()
+ self._right_te_rules.clear()
class AVRuleWrapper(Wrapper):
@@ -377,6 +325,34 @@ class AVRuleWrapper(Wrapper):
self.conditional_block == other.conditional_block
+class AVRuleXpermWrapper(Wrapper):
+
+ """Wrap extended permission access vector rules to allow set operations."""
+
+ def __init__(self, rule):
+ self.origin = rule
+ self.ruletype = rule.ruletype
+ self.source = SymbolWrapper(rule.source)
+ self.target = SymbolWrapper(rule.target)
+ self.tclass = SymbolWrapper(rule.tclass)
+ self.xperm_type = rule.xperm_type
+ self.key = hash(rule)
+
+ def __hash__(self):
+ return self.key
+
+ def __lt__(self, other):
+ return self.key < other.key
+
+ def __eq__(self, other):
+ # because TERuleDifference groups rules by ruletype,
+ # the ruletype always matches.
+ return self.source == other.source and \
+ self.target == other.target and \
+ self.tclass == other.tclass and \
+ self.xperm_type == other.xperm_type
+
+
class TERuleWrapper(Wrapper):
"""Wrap type_* rules to allow set operations."""
diff --git a/lib/python2.7/site-packages/setools/diff/typeattr.py b/lib/python2.7/site-packages/setools/diff/typeattr.py
index 8c51832..8c51832 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/typeattr.py
+++ b/lib/python2.7/site-packages/setools/diff/typeattr.py
diff --git a/lib/python2.7/site-packages/setools/diff/types.py b/lib/python2.7/site-packages/setools/diff/types.py
index d0e99d9..d0e99d9 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/types.py
+++ b/lib/python2.7/site-packages/setools/diff/types.py
diff --git a/lib/python2.7/site-packages/setools/diff/users.py b/lib/python2.7/site-packages/setools/diff/users.py
index 78f3d3e..78f3d3e 100644..100755
--- a/lib/python2.7/site-packages/setools/diff/users.py
+++ b/lib/python2.7/site-packages/setools/diff/users.py
diff --git a/lib/python2.7/site-packages/setools/dta.py b/lib/python2.7/site-packages/setools/dta.py
index 53328f4..b16838d 100644..100755
--- a/lib/python2.7/site-packages/setools/dta.py
+++ b/lib/python2.7/site-packages/setools/dta.py
@@ -54,7 +54,7 @@ class DomainTransitionAnalysis(object):
Parameter:
policy The policy to analyze.
"""
- self.log = logging.getLogger(self.__class__.__name__)
+ self.log = logging.getLogger(__name__)
self.policy = policy
self.exclude = exclude
@@ -82,7 +82,7 @@ class DomainTransitionAnalysis(object):
if types:
self._exclude = [self.policy.lookup_type(t) for t in types]
else:
- self._exclude = None
+ self._exclude = []
self.rebuildsubgraph = True
@@ -107,7 +107,7 @@ class DomainTransitionAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating one shortest path from {0} to {1}...".format(s, t))
+ self.log.info("Generating one domain transition path from {0} to {1}...".format(s, t))
try:
yield self.__generate_steps(nx.shortest_path(self.subG, s, t))
@@ -143,7 +143,8 @@ class DomainTransitionAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating all paths from {0} to {1}, max len {2}...".format(s, t, maxlen))
+ self.log.info("Generating all domain transition paths from {0} to {1}, max length {2}...".
+ format(s, t, maxlen))
try:
for path in nx.all_simple_paths(self.subG, s, t, maxlen):
@@ -175,7 +176,8 @@ class DomainTransitionAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating all shortest paths from {0} to {1}...".format(s, t))
+ self.log.info("Generating all shortest domain transition paths from {0} to {1}...".
+ format(s, t))
try:
for path in nx.all_shortest_paths(self.subG, s, t):
@@ -207,7 +209,7 @@ class DomainTransitionAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating all transitions {1} {0}".
+ self.log.info("Generating all domain transitions {1} {0}".
format(s, "in to" if self.reverse else "out from"))
try:
@@ -247,21 +249,21 @@ class DomainTransitionAnalysis(object):
@staticmethod
def __generate_entrypoints(edge):
"""
- Generator which yields the entrypoint, execute, and
+ Creates a list of entrypoint, execute, and
type_transition rules for each entrypoint.
Parameter:
data The dictionary of entrypoints.
- Yield: tuple(type, entry, exec, trans)
+ Return: list of tuple(type, entry, exec, trans)
type The entrypoint type.
entry The list of entrypoint rules.
exec The list of execute rules.
trans The list of type_transition rules.
"""
- for e in edge.entrypoint:
- yield entrypoint_output(e, edge.entrypoint[e], edge.execute[e], edge.type_transition[e])
+ return [entrypoint_output(e, edge.entrypoint[e], edge.execute[e], edge.type_transition[e])
+ for e in edge.entrypoint]
def __generate_steps(self, path):
"""
@@ -361,7 +363,7 @@ class DomainTransitionAnalysis(object):
self.G.clear()
self.G.name = "Domain transition graph for {0}.".format(self.policy)
- self.log.info("Building graph from {0}...".format(self.policy))
+ self.log.info("Building domain transition graph from {0}...".format(self.policy))
# hash tables keyed on domain type
setexec = defaultdict(list)
@@ -500,7 +502,10 @@ class DomainTransitionAnalysis(object):
self.rebuildgraph = False
self.rebuildsubgraph = True
- self.log.info("Completed building graph.")
+ self.log.info("Completed building domain transition graph.")
+ self.log.debug("Graph stats: nodes: {0}, edges: {1}.".format(
+ nx.number_of_nodes(self.G),
+ nx.number_of_edges(self.G)))
def __remove_excluded_entrypoints(self):
invalid_edges = []
@@ -535,7 +540,7 @@ class DomainTransitionAnalysis(object):
if self.rebuildgraph:
self._build_graph()
- self.log.info("Building subgraph.")
+ self.log.info("Building domain transition subgraph.")
self.log.debug("Excluding {0}".format(self.exclude))
self.log.debug("Reverse {0}".format(self.reverse))
@@ -553,7 +558,10 @@ class DomainTransitionAnalysis(object):
self.__remove_excluded_entrypoints()
self.rebuildsubgraph = False
- self.log.info("Completed building subgraph.")
+ self.log.info("Completed building domain transition subgraph.")
+ self.log.debug("Subgraph stats: nodes: {0}, edges: {1}.".format(
+ nx.number_of_nodes(self.subG),
+ nx.number_of_edges(self.subG)))
class Edge(object):
@@ -562,6 +570,7 @@ class Edge(object):
A graph edge. Also used for returning domain transition steps.
Parameters:
+ graph The NetworkX graph.
source The source type of the edge.
target The target tyep of the edge.
@@ -583,12 +592,6 @@ class Edge(object):
self.source = source
self.target = target
- # a bit of a hack to make Edges work
- # in NetworkX functions that work on
- # 2-tuples of (source, target)
- # (see __getitem__ below)
- self.st_tuple = (source, target)
-
if not self.G.has_edge(source, target):
if not create:
raise ValueError("Edge does not exist in graph")
@@ -603,4 +606,18 @@ class Edge(object):
self.setcurrent = None
def __getitem__(self, key):
- return self.st_tuple[key]
+ # This is implemented so this object can be used in NetworkX
+ # functions that operate on (source, target) tuples
+ if isinstance(key, slice):
+ return [self._index_to_item(i) for i in range(* key.indices(2))]
+ else:
+ return self._index_to_item(key)
+
+ def _index_to_item(self, index):
+ """Return source or target based on index."""
+ if index == 0:
+ return self.source
+ elif index == 1:
+ return self.target
+ else:
+ raise IndexError("Invalid index (edges only have 2 items): {0}".format(index))
diff --git a/lib/python2.7/site-packages/setools/exception.py b/lib/python2.7/site-packages/setools/exception.py
index c3505cd..c3505cd 100644..100755
--- a/lib/python2.7/site-packages/setools/exception.py
+++ b/lib/python2.7/site-packages/setools/exception.py
diff --git a/lib/python2.7/site-packages/setools/fsusequery.py b/lib/python2.7/site-packages/setools/fsusequery.py
index 131a649..a877501 100644..100755
--- a/lib/python2.7/site-packages/setools/fsusequery.py
+++ b/lib/python2.7/site-packages/setools/fsusequery.py
@@ -19,11 +19,13 @@
import logging
import re
-from . import contextquery
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .mixins import MatchContext
+from .query import PolicyQuery
+from .util import match_regex
-class FSUseQuery(contextquery.ContextQuery):
+class FSUseQuery(MatchContext, PolicyQuery):
"""
Query fs_use_* statements.
@@ -60,22 +62,22 @@ class FSUseQuery(contextquery.ContextQuery):
fs = CriteriaDescriptor("fs_regex")
fs_regex = False
+ def __init__(self, policy, **kwargs):
+ super(FSUseQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching fs_use_* statements."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating fs_use_* results from {0.policy}".format(self))
self.log.debug("Ruletypes: {0.ruletype}".format(self))
self.log.debug("FS: {0.fs!r}, regex: {0.fs_regex}".format(self))
- self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
- self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
- self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
- self.log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
- "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+ self._match_context_debug(self.log)
for fsu in self.policy.fs_uses():
if self.ruletype and fsu.ruletype not in self.ruletype:
continue
- if self.fs and not self._match_regex(
+ if self.fs and not match_regex(
fsu.fs,
self.fs,
self.fs_regex):
diff --git a/lib/python2.7/site-packages/setools/genfsconquery.py b/lib/python2.7/site-packages/setools/genfsconquery.py
index c67dfd6..ea9dbd1 100644..100755
--- a/lib/python2.7/site-packages/setools/genfsconquery.py
+++ b/lib/python2.7/site-packages/setools/genfsconquery.py
@@ -19,11 +19,13 @@
import logging
import re
-from . import contextquery
from .descriptors import CriteriaDescriptor
+from .mixins import MatchContext
+from .query import PolicyQuery
+from .util import match_regex
-class GenfsconQuery(contextquery.ContextQuery):
+class GenfsconQuery(MatchContext, PolicyQuery):
"""
Query genfscon statements.
@@ -64,26 +66,26 @@ class GenfsconQuery(contextquery.ContextQuery):
path = CriteriaDescriptor("path_regex")
path_regex = False
+ def __init__(self, policy, **kwargs):
+ super(GenfsconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching genfscons."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating genfscon results from {0.policy}".format(self))
self.log.debug("FS: {0.fs!r}, regex: {0.fs_regex}".format(self))
self.log.debug("Path: {0.path!r}, regex: {0.path_regex}".format(self))
self.log.debug("Filetype: {0.filetype!r}".format(self))
- self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
- self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
- self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
- self.log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
- "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+ self._match_context_debug(self.log)
for genfs in self.policy.genfscons():
- if self.fs and not self._match_regex(
+ if self.fs and not match_regex(
genfs.fs,
self.fs,
self.fs_regex):
continue
- if self.path and not self._match_regex(
+ if self.path and not match_regex(
genfs.path,
self.path,
self.path_regex):
diff --git a/lib/python2.7/site-packages/setools/infoflow.py b/lib/python2.7/site-packages/setools/infoflow.py
index 5812828..15eb38e 100644..100755
--- a/lib/python2.7/site-packages/setools/infoflow.py
+++ b/lib/python2.7/site-packages/setools/infoflow.py
@@ -41,7 +41,7 @@ class InfoFlowAnalysis(object):
exclude The types excluded from the information flow analysis.
(default is none)
"""
- self.log = logging.getLogger(self.__class__.__name__)
+ self.log = logging.getLogger(__name__)
self.policy = policy
@@ -113,7 +113,8 @@ class InfoFlowAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating one shortest path from {0} to {1}...".format(s, t))
+ self.log.info("Generating one shortest information flow path from {0} to {1}...".
+ format(s, t))
try:
yield self.__generate_steps(nx.shortest_path(self.subG, s, t))
@@ -153,7 +154,8 @@ class InfoFlowAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating all paths from {0} to {1}, max len {2}...".format(s, t, maxlen))
+ self.log.info("Generating all information flow paths from {0} to {1}, max length {2}...".
+ format(s, t, maxlen))
try:
for path in nx.all_simple_paths(self.subG, s, t, maxlen):
@@ -188,7 +190,8 @@ class InfoFlowAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating all shortest paths from {0} to {1}...".format(s, t))
+ self.log.info("Generating all shortest information flow paths from {0} to {1}...".
+ format(s, t))
try:
for path in nx.all_shortest_paths(self.subG, s, t):
@@ -226,7 +229,8 @@ class InfoFlowAnalysis(object):
if self.rebuildsubgraph:
self._build_subgraph()
- self.log.info("Generating all infoflows {0} {1}".format("out of" if out else "into", s))
+ self.log.info("Generating all information flows {0} {1}".
+ format("out of" if out else "into", s))
if out:
flows = self.subG.out_edges_iter(s)
@@ -294,7 +298,7 @@ class InfoFlowAnalysis(object):
self.perm_map.map_policy(self.policy)
- self.log.info("Building graph from {0}...".format(self.policy))
+ self.log.info("Building information flow graph from {0}...".format(self.policy))
for rule in self.policy.terules():
if rule.ruletype != "allow":
@@ -318,13 +322,16 @@ class InfoFlowAnalysis(object):
self.rebuildgraph = False
self.rebuildsubgraph = True
- self.log.info("Completed building graph.")
+ self.log.info("Completed building information flow graph.")
+ self.log.debug("Graph stats: nodes: {0}, edges: {1}.".format(
+ nx.number_of_nodes(self.G),
+ nx.number_of_edges(self.G)))
def _build_subgraph(self):
if self.rebuildgraph:
self._build_graph()
- self.log.info("Building subgraph...")
+ self.log.info("Building information flow subgraph...")
self.log.debug("Excluding {0!r}".format(self.exclude))
self.log.debug("Min weight {0}".format(self.min_weight))
@@ -345,7 +352,10 @@ class InfoFlowAnalysis(object):
self.subG.remove_edges_from(delete_list)
self.rebuildsubgraph = False
- self.log.info("Completed building subgraph.")
+ self.log.info("Completed building information flow subgraph.")
+ self.log.debug("Subgraph stats: nodes: {0}, edges: {1}.".format(
+ nx.number_of_nodes(self.subG),
+ nx.number_of_edges(self.subG)))
class Edge(object):
@@ -354,6 +364,7 @@ class Edge(object):
A graph edge. Also used for returning information flow steps.
Parameters:
+ graph The NetworkX graph.
source The source type of the edge.
target The target type of the edge.
@@ -376,12 +387,6 @@ class Edge(object):
self.source = source
self.target = target
- # a bit of a hack to make edges work
- # in NetworkX functions that work on
- # 2-tuples of (source, target)
- # (see __getitem__ below)
- self.st_tuple = (source, target)
-
if not self.G.has_edge(source, target):
if create:
self.G.add_edge(source, target, weight=1)
@@ -391,4 +396,18 @@ class Edge(object):
raise ValueError("Edge does not exist in graph")
def __getitem__(self, key):
- return self.st_tuple[key]
+ # This is implemented so this object can be used in NetworkX
+ # functions that operate on (source, target) tuples
+ if isinstance(key, slice):
+ return [self._index_to_item(i) for i in range(* key.indices(2))]
+ else:
+ return self._index_to_item(key)
+
+ def _index_to_item(self, index):
+ """Return source or target based on index."""
+ if index == 0:
+ return self.source
+ elif index == 1:
+ return self.target
+ else:
+ raise IndexError("Invalid index (edges only have 2 items): {0}".format(index))
diff --git a/lib/python2.7/site-packages/setools/initsidquery.py b/lib/python2.7/site-packages/setools/initsidquery.py
index 1eb3790..aa62edb 100644..100755
--- a/lib/python2.7/site-packages/setools/initsidquery.py
+++ b/lib/python2.7/site-packages/setools/initsidquery.py
@@ -18,11 +18,11 @@
#
import logging
-from . import compquery
-from . import contextquery
+from .mixins import MatchContext, MatchName
+from .query import PolicyQuery
-class InitialSIDQuery(compquery.ComponentQuery, contextquery.ContextQuery):
+class InitialSIDQuery(MatchName, MatchContext, PolicyQuery):
"""
Initial SID (Initial context) query.
@@ -54,15 +54,15 @@ class InitialSIDQuery(compquery.ComponentQuery, contextquery.ContextQuery):
No effect if not using set operations.
"""
+ def __init__(self, policy, **kwargs):
+ super(InitialSIDQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching initial SIDs."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
- self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
- self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
- self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
- self.log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
- "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+ self.log.info("Generating initial SID results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
+ self._match_context_debug(self.log)
for i in self.policy.initialsids():
if not self._match_name(i):
diff --git a/lib/python2.7/site-packages/setools/iomemconquery.py b/lib/python2.7/site-packages/setools/iomemconquery.py
new file mode 100644
index 0000000..cc1c69a
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/iomemconquery.py
@@ -0,0 +1,124 @@
+# Derived from portconquery.py
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+import logging
+
+from .mixins import MatchContext
+from .policyrep.xencontext import addr_range
+from .query import PolicyQuery
+from .util import match_range
+
+
+class IomemconQuery(MatchContext, PolicyQuery):
+
+ """
+ Iomemcon context query.
+
+ Parameter:
+ policy The policy to query.
+
+ Keyword Parameters/Class attributes:
+ addr A 2-tuple of the memory addr range to match. (Set both to
+ the same value for a single mem addr)
+ addr_subset If true, the criteria will match if it is a subset
+ of the iomemcon's range.
+ addr_overlap If true, the criteria will match if it overlaps
+ any of the iomemcon's range.
+ addr_superset If true, the criteria will match if it is a superset
+ of the iomemcon's range.
+ addr_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+
+ user The criteria to match the context's user.
+ user_regex If true, regular expression matching
+ will be used on the user.
+
+ role The criteria to match the context's role.
+ role_regex If true, regular expression matching
+ will be used on the role.
+
+ type_ The criteria to match the context's type.
+ type_regex If true, regular expression matching
+ will be used on the type.
+
+ range_ The criteria to match the context's range.
+ range_subset If true, the criteria will match if it is a subset
+ of the context's range.
+ range_overlap If true, the criteria will match if it overlaps
+ any of the context's range.
+ range_superset If true, the criteria will match if it is a superset
+ of the context's range.
+ range_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+ """
+
+ _addr = None
+ addr_subset = False
+ addr_overlap = False
+ addr_superset = False
+ addr_proper = False
+
+ @property
+ def addr(self):
+ return self._addr
+
+ @addr.setter
+ def addr(self, value):
+ pending_addr = addr_range(*value)
+
+ if all(pending_addr):
+ if pending_addr.low < 1 or pending_addr.high < 1:
+ raise ValueError("Memory address must be positive: {0.low}-{0.high}".
+ format(pending_addr))
+
+ if pending_addr.low > pending_addr.high:
+ raise ValueError(
+ "The low mem addr must be smaller than the high mem addr: {0.low}-{0.high}".
+ format(pending_addr))
+
+ self._addr = pending_addr
+ else:
+ self._addr = None
+
+ def __init__(self, policy, **kwargs):
+ super(IomemconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
+ def results(self):
+ """Generator which yields all matching iomemcons."""
+ self.log.info("Generating results from {0.policy}".format(self))
+ self.log.debug("Address: {0.addr!r}, overlap: {0.addr_overlap}, "
+ "subset: {0.addr_subset}, superset: {0.addr_superset}, "
+ "proper: {0.addr_proper}".format(self))
+ self._match_context_debug(self.log)
+
+ for iomemcon in self.policy.iomemcons():
+
+ if self.addr and not match_range(
+ iomemcon.addr,
+ self.addr,
+ self.addr_subset,
+ self.addr_overlap,
+ self.addr_superset,
+ self.addr_proper):
+ continue
+
+ if not self._match_context(iomemcon.context):
+ continue
+
+ yield iomemcon
diff --git a/lib/python2.7/site-packages/setools/ioportconquery.py b/lib/python2.7/site-packages/setools/ioportconquery.py
new file mode 100644
index 0000000..84775a6
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/ioportconquery.py
@@ -0,0 +1,124 @@
+# Derived from portconquery.py
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+import logging
+
+from .mixins import MatchContext
+from .policyrep.xencontext import port_range
+from .query import PolicyQuery
+from .util import match_range
+
+
+class IoportconQuery(MatchContext, PolicyQuery):
+
+ """
+ Ioportcon context query.
+
+ Parameter:
+ policy The policy to query.
+
+ Keyword Parameters/Class attributes:
+ ports A 2-tuple of the port range to match. (Set both to
+ the same value for a single port)
+ ports_subset If true, the criteria will match if it is a subset
+ of the ioportcon's range.
+ ports_overlap If true, the criteria will match if it overlaps
+ any of the ioportcon's range.
+ ports_superset If true, the criteria will match if it is a superset
+ of the ioportcon's range.
+ ports_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+
+ user The criteria to match the context's user.
+ user_regex If true, regular expression matching
+ will be used on the user.
+
+ role The criteria to match the context's role.
+ role_regex If true, regular expression matching
+ will be used on the role.
+
+ type_ The criteria to match the context's type.
+ type_regex If true, regular expression matching
+ will be used on the type.
+
+ range_ The criteria to match the context's range.
+ range_subset If true, the criteria will match if it is a subset
+ of the context's range.
+ range_overlap If true, the criteria will match if it overlaps
+ any of the context's range.
+ range_superset If true, the criteria will match if it is a superset
+ of the context's range.
+ range_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+ """
+
+ _ports = None
+ ports_subset = False
+ ports_overlap = False
+ ports_superset = False
+ ports_proper = False
+
+ @property
+ def ports(self):
+ return self._ports
+
+ @ports.setter
+ def ports(self, value):
+ pending_ports = port_range(*value)
+
+ if all(pending_ports):
+ if pending_ports.low < 1 or pending_ports.high < 1:
+ raise ValueError("Port numbers must be positive: {0.low}-{0.high}".
+ format(pending_ports))
+
+ if pending_ports.low > pending_ports.high:
+ raise ValueError(
+ "The low port must be smaller than the high port: {0.low}-{0.high}".
+ format(pending_ports))
+
+ self._ports = pending_ports
+ else:
+ self._ports = None
+
+ def __init__(self, policy, **kwargs):
+ super(IoportconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
+ def results(self):
+ """Generator which yields all matching ioportcons."""
+ self.log.info("Generating results from {0.policy}".format(self))
+ self.log.debug("Ports: {0.ports!r}, overlap: {0.ports_overlap}, "
+ "subset: {0.ports_subset}, superset: {0.ports_superset}, "
+ "proper: {0.ports_proper}".format(self))
+ self._match_context_debug(self.log)
+
+ for ioportcon in self.policy.ioportcons():
+
+ if self.ports and not match_range(
+ ioportcon.ports,
+ self.ports,
+ self.ports_subset,
+ self.ports_overlap,
+ self.ports_superset,
+ self.ports_proper):
+ continue
+
+ if not self._match_context(ioportcon.context):
+ continue
+
+ yield ioportcon
diff --git a/lib/python2.7/site-packages/setools/mixins.py b/lib/python2.7/site-packages/setools/mixins.py
index 99dc9ff..97e4fec 100644..100755
--- a/lib/python2.7/site-packages/setools/mixins.py
+++ b/lib/python2.7/site-packages/setools/mixins.py
@@ -20,6 +20,7 @@
import re
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .util import match_in_set, match_regex, match_range, match_regex_or_set
class MatchAlias(object):
@@ -29,6 +30,10 @@ class MatchAlias(object):
alias = CriteriaDescriptor("alias_regex")
alias_regex = False
+ def _match_alias_debug(self, log):
+ """Emit log debugging info for alias matching."""
+ log.debug("Alias: {0.alias}, regex: {0.alias_regex}".format(self))
+
def _match_alias(self, obj):
"""
Match the alias criteria
@@ -41,7 +46,113 @@ class MatchAlias(object):
# if there is no criteria, everything matches.
return True
- return self._match_in_set(obj.aliases(), self.alias, self.alias_regex)
+ return match_in_set(obj.aliases(), self.alias, self.alias_regex)
+
+
+class MatchContext(object):
+
+ """
+ Mixin for matching contexts.
+
+ Class attributes:
+ user The user to match in the context.
+ user_regex If true, regular expression matching
+ will be used on the user.
+ role The role to match in the context.
+ role_regex If true, regular expression matching
+ will be used on the role.
+ type_ The type to match in the context.
+ type_regex If true, regular expression matching
+ will be used on the type.
+ range_ The range to match in the context.
+ range_subset If true, the criteria will match if it
+ is a subset of the context's range.
+ range_overlap If true, the criteria will match if it
+ overlaps any of the context's range.
+ range_superset If true, the criteria will match if it
+ is a superset of the context's range.
+ range_proper If true, use proper superset/subset
+ on range matching operations.
+ No effect if not using set operations.
+ """
+
+ user = CriteriaDescriptor("user_regex", "lookup_user")
+ user_regex = False
+ role = CriteriaDescriptor("role_regex", "lookup_role")
+ role_regex = False
+ type_ = CriteriaDescriptor("type_regex", "lookup_type")
+ type_regex = False
+ range_ = CriteriaDescriptor(lookup_function="lookup_range")
+ range_overlap = False
+ range_subset = False
+ range_superset = False
+ range_proper = False
+
+ def _match_context_debug(self, log):
+ """Emit log debugging info for context matching."""
+ log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
+ log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
+ log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
+ log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
+ "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+
+ def _match_context(self, context):
+ """
+ Match the context criteria.
+
+ Parameter:
+ obj An object with context attributes "user", "role",
+ "type_" and "range_".
+ """
+
+ if self.user and not match_regex(
+ context.user,
+ self.user,
+ self.user_regex):
+ return False
+
+ if self.role and not match_regex(
+ context.role,
+ self.role,
+ self.role_regex):
+ return False
+
+ if self.type_ and not match_regex(
+ context.type_,
+ self.type_,
+ self.type_regex):
+ return False
+
+ if self.range_ and not match_range(
+ context.range_,
+ self.range_,
+ self.range_subset,
+ self.range_overlap,
+ self.range_superset,
+ self.range_proper):
+ return False
+
+ return True
+
+
+class MatchName(object):
+
+ """Mixin for matching an object's name."""
+
+ name = CriteriaDescriptor("name_regex")
+ name_regex = False
+
+ def _match_name_debug(self, log):
+ """Log debugging messages for name matching."""
+ log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+
+ def _match_name(self, obj):
+ """Match the object to the name criteria."""
+ if not self.name:
+ # if there is no criteria, everything matches.
+ return True
+
+ return match_regex(obj, self.name, self.name_regex)
class MatchObjClass(object):
@@ -51,6 +162,10 @@ class MatchObjClass(object):
tclass = CriteriaSetDescriptor("tclass_regex", "lookup_class")
tclass_regex = False
+ def _match_object_class_debug(self, log):
+ """Emit log debugging info for permission matching."""
+ log.debug("Class: {0.tclass!r}, regex: {0.tclass_regex}".format(self))
+
def _match_object_class(self, obj):
"""
Match the object class criteria
@@ -77,6 +192,11 @@ class MatchPermission(object):
perms_regex = False
perms_subset = False
+ def _match_perms_debug(self, log):
+ """Emit log debugging info for permission matching."""
+ log.debug("Perms: {0.perms!r}, regex: {0.perms_regex}, eq: {0.perms_equal}, "
+ "subset: {0.perms_subset!r}".format(self))
+
def _match_perms(self, obj):
"""
Match the permission criteria
@@ -92,5 +212,4 @@ class MatchPermission(object):
if self.perms_subset:
return obj.perms >= self.perms
else:
- return self._match_regex_or_set(obj.perms, self.perms, self.perms_equal,
- self.perms_regex)
+ return match_regex_or_set(obj.perms, self.perms, self.perms_equal, self.perms_regex)
diff --git a/lib/python2.7/site-packages/setools/mlsrulequery.py b/lib/python2.7/site-packages/setools/mlsrulequery.py
index 615964e..f53f7c7 100644..100755
--- a/lib/python2.7/site-packages/setools/mlsrulequery.py
+++ b/lib/python2.7/site-packages/setools/mlsrulequery.py
@@ -18,11 +18,13 @@
#
import logging
-from . import mixins, query
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .mixins import MatchObjClass
+from .query import PolicyQuery
+from .util import match_indirect_regex, match_range
-class MLSRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
+class MLSRuleQuery(MatchObjClass, PolicyQuery):
"""
Query MLS rules.
@@ -46,8 +48,10 @@ class MLSRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
ruletype = CriteriaSetDescriptor(lookup_function="validate_mls_ruletype")
source = CriteriaDescriptor("source_regex", "lookup_type_or_attr")
source_regex = False
+ source_indirect = True
target = CriteriaDescriptor("target_regex", "lookup_type_or_attr")
target_regex = False
+ target_indirect = True
tclass = CriteriaSetDescriptor("tclass_regex", "lookup_class")
tclass_regex = False
default = CriteriaDescriptor(lookup_function="lookup_range")
@@ -56,13 +60,19 @@ class MLSRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
default_superset = False
default_proper = False
+ def __init__(self, policy, **kwargs):
+ super(MLSRuleQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching MLS rules."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating MLS rule results from {0.policy}".format(self))
self.log.debug("Ruletypes: {0.ruletype}".format(self))
- self.log.debug("Source: {0.source!r}, regex: {0.source_regex}".format(self))
- self.log.debug("Target: {0.target!r}, regex: {0.target_regex}".format(self))
- self.log.debug("Class: {0.tclass!r}, regex: {0.tclass_regex}".format(self))
+ self.log.debug("Source: {0.source!r}, indirect: {0.source_indirect}, "
+ "regex: {0.source_regex}".format(self))
+ self.log.debug("Target: {0.target!r}, indirect: {0.target_indirect}, "
+ "regex: {0.target_regex}".format(self))
+ self._match_object_class_debug(self.log)
self.log.debug("Default: {0.default!r}, overlap: {0.default_overlap}, "
"subset: {0.default_subset}, superset: {0.default_superset}, "
"proper: {0.default_proper}".format(self))
@@ -78,18 +88,20 @@ class MLSRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
#
# Matching on source type
#
- if self.source and not self._match_regex(
+ if self.source and not match_indirect_regex(
rule.source,
self.source,
+ self.source_indirect,
self.source_regex):
continue
#
# Matching on target type
#
- if self.target and not self._match_regex(
+ if self.target and not match_indirect_regex(
rule.target,
self.target,
+ self.target_indirect,
self.target_regex):
continue
@@ -102,7 +114,7 @@ class MLSRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
#
# Matching on range
#
- if self.default and not self._match_range(
+ if self.default and not match_range(
rule.default,
self.default,
self.default_subset,
diff --git a/lib/python2.7/site-packages/setools/netifconquery.py b/lib/python2.7/site-packages/setools/netifconquery.py
index 30db977..125b80b 100644..100755
--- a/lib/python2.7/site-packages/setools/netifconquery.py
+++ b/lib/python2.7/site-packages/setools/netifconquery.py
@@ -18,11 +18,12 @@
#
import logging
-from . import compquery
-from . import contextquery
+from .mixins import MatchContext, MatchName
+from .query import PolicyQuery
+from .util import match_regex
-class NetifconQuery(compquery.ComponentQuery, contextquery.ContextQuery):
+class NetifconQuery(MatchContext, MatchName, PolicyQuery):
"""
Network interface context query.
@@ -54,18 +55,18 @@ class NetifconQuery(compquery.ComponentQuery, contextquery.ContextQuery):
No effect if not using set operations.
"""
+ def __init__(self, policy, **kwargs):
+ super(NetifconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching netifcons."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
- self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
- self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
- self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
- self.log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
- "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+ self.log.info("Generating netifcon results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
+ self._match_context_debug(self.log)
for netif in self.policy.netifcons():
- if self.name and not self._match_regex(
+ if self.name and not match_regex(
netif.netif,
self.name,
self.name_regex):
diff --git a/lib/python2.7/site-packages/setools/nodeconquery.py b/lib/python2.7/site-packages/setools/nodeconquery.py
index eb21d81..4410f96 100644..100755
--- a/lib/python2.7/site-packages/setools/nodeconquery.py
+++ b/lib/python2.7/site-packages/setools/nodeconquery.py
@@ -24,10 +24,11 @@ except ImportError: # pragma: no cover
import logging
from socket import AF_INET, AF_INET6
-from . import contextquery
+from .mixins import MatchContext
+from .query import PolicyQuery
-class NodeconQuery(contextquery.ContextQuery):
+class NodeconQuery(MatchContext, PolicyQuery):
"""
Query nodecon statements.
@@ -97,16 +98,16 @@ class NodeconQuery(contextquery.ContextQuery):
else:
self._network = None
+ def __init__(self, policy, **kwargs):
+ super(NodeconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching nodecons."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating nodecon results from {0.policy}".format(self))
self.log.debug("Network: {0.network!r}, overlap: {0.network_overlap}".format(self))
self.log.debug("IP Version: {0.ip_version}".format(self))
- self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
- self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
- self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
- self.log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
- "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+ self._match_context_debug(self.log)
for nodecon in self.policy.nodecons():
diff --git a/lib/python2.7/site-packages/setools/objclassquery.py b/lib/python2.7/site-packages/setools/objclassquery.py
index 8f40df8..7bb1c88 100644..100755
--- a/lib/python2.7/site-packages/setools/objclassquery.py
+++ b/lib/python2.7/site-packages/setools/objclassquery.py
@@ -19,12 +19,14 @@
import logging
import re
-from . import compquery
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .mixins import MatchName
from .policyrep.exception import NoCommon
+from .query import PolicyQuery
+from .util import match_regex, match_regex_or_set
-class ObjClassQuery(compquery.ComponentQuery):
+class ObjClassQuery(MatchName, PolicyQuery):
"""
Query object classes.
@@ -60,10 +62,14 @@ class ObjClassQuery(compquery.ComponentQuery):
perms_indirect = True
perms_regex = False
+ def __init__(self, policy, **kwargs):
+ super(ObjClassQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching object classes."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+ self.log.info("Generating object class results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
self.log.debug("Common: {0.common!r}, regex: {0.common_regex}".format(self))
self.log.debug("Perms: {0.perms}, regex: {0.perms_regex}, "
"eq: {0.perms_equal}, indirect: {0.perms_indirect}".format(self))
@@ -74,7 +80,7 @@ class ObjClassQuery(compquery.ComponentQuery):
if self.common:
try:
- if not self._match_regex(
+ if not match_regex(
class_.common,
self.common,
self.common_regex):
@@ -91,7 +97,7 @@ class ObjClassQuery(compquery.ComponentQuery):
except NoCommon:
pass
- if not self._match_regex_or_set(
+ if not match_regex_or_set(
perms,
self.perms,
self.perms_equal,
diff --git a/lib/python2.7/site-packages/setools/pcideviceconquery.py b/lib/python2.7/site-packages/setools/pcideviceconquery.py
new file mode 100644
index 0000000..666a65c
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/pcideviceconquery.py
@@ -0,0 +1,93 @@
+# Derived from portconquery.py
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+import logging
+
+from .mixins import MatchContext
+from .query import PolicyQuery
+
+
+class PcideviceconQuery(MatchContext, PolicyQuery):
+
+ """
+ Pcidevicecon context query.
+
+ Parameter:
+ policy The policy to query.
+
+ Keyword Parameters/Class attributes:
+ device A single PCI device ID.
+
+ user The criteria to match the context's user.
+ user_regex If true, regular expression matching
+ will be used on the user.
+
+ role The criteria to match the context's role.
+ role_regex If true, regular expression matching
+ will be used on the role.
+
+ type_ The criteria to match the context's type.
+ type_regex If true, regular expression matching
+ will be used on the type.
+
+ range_ The criteria to match the context's range.
+ range_subset If true, the criteria will match if it is a subset
+ of the context's range.
+ range_overlap If true, the criteria will match if it overlaps
+ any of the context's range.
+ range_superset If true, the criteria will match if it is a superset
+ of the context's range.
+ range_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+ """
+
+ _device = None
+
+ @property
+ def device(self):
+ return self._device
+
+ @device.setter
+ def device(self, value):
+ if value:
+ if value < 1:
+ raise ValueError("PCI device ID must be positive: {0}".format(value))
+
+ self._device = value
+ else:
+ self._device = None
+
+ def __init__(self, policy, **kwargs):
+ super(PcideviceconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
+ def results(self):
+ """Generator which yields all matching pcidevicecons."""
+ self.log.info("Generating results from {0.policy}".format(self))
+ self.log.debug("Device ID: {0.device!r}".format(self))
+ self._match_context_debug(self.log)
+
+ for pcidevicecon in self.policy.pcidevicecons():
+
+ if self.device and self.device != pcidevicecon.device:
+ continue
+
+ if not self._match_context(pcidevicecon.context):
+ continue
+
+ yield pcidevicecon
diff --git a/lib/python2.7/site-packages/setools/permmap.py b/lib/python2.7/site-packages/setools/permmap.py
index 54cd9f9..55da2fa 100644..100755
--- a/lib/python2.7/site-packages/setools/permmap.py
+++ b/lib/python2.7/site-packages/setools/permmap.py
@@ -18,26 +18,31 @@
#
import sys
import logging
+import copy
+from collections import OrderedDict
from errno import ENOENT
from . import exception
from . import policyrep
+from .descriptors import PermissionMapDescriptor
+
+infoflow_directions = ["r", "w", "b", "n", "u"]
+min_weight = 1
+max_weight = 10
class PermissionMap(object):
"""Permission Map for information flow analysis."""
- valid_infoflow_directions = ["r", "w", "b", "n", "u"]
- min_weight = 1
- max_weight = 10
-
def __init__(self, permmapfile=None):
"""
Parameter:
permmapfile The path to the permission map to load.
"""
- self.log = logging.getLogger(self.__class__.__name__)
+ self.log = logging.getLogger(__name__)
+ self.permmap = OrderedDict()
+ self.permmapfile = None
if permmapfile:
self.load(permmapfile)
@@ -52,6 +57,17 @@ class PermissionMap(object):
else:
raise RuntimeError("Unable to load default permission map.")
+ def __str__(self):
+ return self.permmapfile
+
+ def __deepcopy__(self, memo):
+ newobj = PermissionMap.__new__(PermissionMap)
+ newobj.log = self.log
+ newobj.permmap = copy.deepcopy(self.permmap)
+ newobj.permmapfile = self.permmapfile
+ memo[id(self)] = newobj
+ return newobj
+
def load(self, permmapfile):
"""
Parameter:
@@ -64,11 +80,12 @@ class PermissionMap(object):
# 2 = read class name and number of perms
# 3 = read perms
with open(permmapfile, "r") as mapfile:
+ total_perms = 0
class_count = 0
num_classes = 0
state = 1
- self.permmap = dict()
+ self.permmap.clear()
for line_num, line in enumerate(mapfile, start=1):
entry = line.split()
@@ -117,7 +134,7 @@ class PermissionMap(object):
"{0}:{1}:Extra class found: {2}".
format(permmapfile, line_num, class_name))
- self.permmap[class_name] = dict()
+ self.permmap[class_name] = OrderedDict()
perm_count = 0
state = 3
@@ -125,7 +142,7 @@ class PermissionMap(object):
perm_name = str(entry[0])
flow_direction = str(entry[1])
- if flow_direction not in self.valid_infoflow_directions:
+ if flow_direction not in infoflow_directions:
raise exception.PermissionMapParseError(
"{0}:{1}:Invalid information flow direction: {2}".
format(permmapfile, line_num, entry[1]))
@@ -137,20 +154,100 @@ class PermissionMap(object):
"{0}:{1}:Invalid permission weight: {2}".
format(permmapfile, line_num, entry[2]))
- if not self.min_weight <= weight <= self.max_weight:
+ if not min_weight <= weight <= max_weight:
raise exception.PermissionMapParseError(
"{0}:{1}:Permission weight must be {3}-{4}: {2}".
format(permmapfile, line_num, entry[2],
- self.min_weight, self.max_weight))
+ min_weight, max_weight))
+
+ self.log.debug("Read {0}:{1} {2} {3}".format(
+ class_name, perm_name, flow_direction, weight))
- self.permmap[class_name][perm_name] = {'direction': flow_direction,
- 'weight': weight,
- 'enabled': True}
+ if flow_direction == 'u':
+ self.log.info("Permission {0}:{1} is unmapped.".format(
+ class_name, perm_name))
+ mapping = Mapping(self.permmap, class_name, perm_name, create=True)
+ mapping.direction = flow_direction
+ mapping.weight = weight
+
+ total_perms += 1
perm_count += 1
if perm_count >= num_perms:
state = 2
+ self.permmapfile = permmapfile
+ self.log.info("Successfully opened permission map \"{0}\"".format(permmapfile))
+ self.log.debug("Read {0} classes and {1} total permissions.".format(
+ class_count, total_perms))
+
+ def save(self, permmapfile):
+ """
+ Save the permission map to the specified path. Existing files
+ will be overwritten.
+
+ Parameter:
+ permmapfile The path to write the permission map.
+ """
+ with open(permmapfile, "w") as mapfile:
+ self.log.info("Writing permission map to \"{0}\"".format(permmapfile))
+ mapfile.write("{0}\n\n".format(len(self.permmap)))
+
+ for classname, perms in self.permmap.items():
+ mapfile.write("class {0} {1}\n".format(classname, len(perms)))
+
+ for permname, settings in perms.items():
+ direction = settings['direction']
+ weight = settings['weight']
+
+ assert min_weight <= weight <= max_weight, \
+ "{0}:{1} weight is out of range ({2}). This is an SETools bug.".format(
+ classname, permname, weight)
+
+ assert direction in infoflow_directions, \
+ "{0}:{1} flow direction ({2}) is invalid. This is an SETools bug.".format(
+ classname, permname, direction)
+
+ if direction == 'u':
+ self.log.warning("Warning: permission {0} in class {1} is unmapped.".format(
+ permname, classname))
+
+ mapfile.write("{0:>20} {1:>9} {2:>9}\n".format(permname, direction, weight))
+
+ mapfile.write("\n")
+
+ self.log.info("Successfully wrote permission map to \"{0}\"".format(permmapfile))
+
+ def classes(self):
+ """
+ Generate class names in the permission map.
+
+ Yield:
+ class An object class name.
+ """
+ for cls in self.permmap.keys():
+ yield cls
+
+ def perms(self, class_):
+ """
+ Generate permission mappings for the specified class.
+
+ Parameter:
+ class_ An object class name.
+
+ Yield:
+ Mapping A permission's complete map (weight, direction, enabled)
+ """
+ try:
+ for perm in self.permmap[class_].keys():
+ yield Mapping(self.permmap, class_, perm)
+ except KeyError:
+ raise exception.UnmappedClass("{0} is not mapped.".format(class_))
+
+ def mapping(self, class_, perm):
+ """Retrieve a specific permission's mapping."""
+ return Mapping(self.permmap, class_, perm)
+
def exclude_class(self, class_):
"""
Exclude all permissions in an object class for calculating rule weights.
@@ -161,14 +258,8 @@ class PermissionMap(object):
Exceptions:
UnmappedClass The specified object class is not mapped.
"""
-
- classname = str(class_)
-
- try:
- for perm in self.permmap[classname]:
- self.permmap[classname][perm]['enabled'] = False
- except KeyError:
- raise exception.UnmappedClass("{0} is not mapped.".format(classname))
+ for perm in self.perms(class_):
+ perm.enabled = False
def exclude_permission(self, class_, permission):
"""
@@ -182,16 +273,7 @@ class PermissionMap(object):
UnmappedClass The specified object class is not mapped.
UnmappedPermission The specified permission is not mapped for the object class.
"""
- classname = str(class_)
-
- if classname not in self.permmap:
- raise exception.UnmappedClass("{0} is not mapped.".format(classname))
-
- try:
- self.permmap[classname][permission]['enabled'] = False
- except KeyError:
- raise exception.UnmappedPermission("{0}:{1} is not mapped.".
- format(classname, permission))
+ Mapping(self.permmap, class_, permission).enabled = False
def include_class(self, class_):
"""
@@ -204,13 +286,8 @@ class PermissionMap(object):
UnmappedClass The specified object class is not mapped.
"""
- classname = str(class_)
-
- try:
- for perm in self.permmap[classname]:
- self.permmap[classname][perm]['enabled'] = True
- except KeyError:
- raise exception.UnmappedClass("{0} is not mapped.".format(classname))
+ for perm in self.perms(class_):
+ perm.enabled = True
def include_permission(self, class_, permission):
"""
@@ -225,16 +302,7 @@ class PermissionMap(object):
UnmappedPermission The specified permission is not mapped for the object class.
"""
- classname = str(class_)
-
- if classname not in self.permmap:
- raise exception.UnmappedClass("{0} is not mapped.".format(classname))
-
- try:
- self.permmap[classname][permission]['enabled'] = True
- except KeyError:
- raise exception.UnmappedPermission("{0}:{1} is not mapped.".
- format(classname, permission))
+ Mapping(self.permmap, class_, permission).enabled = True
def map_policy(self, policy):
"""Create mappings for all classes and permissions in the specified policy."""
@@ -242,8 +310,8 @@ class PermissionMap(object):
class_name = str(class_)
if class_name not in self.permmap:
- self.log.info("Adding unmapped class {0} from {1}".format(class_name, policy))
- self.permmap[class_name] = dict()
+ self.log.debug("Adding unmapped class {0} from {1}".format(class_name, policy))
+ self.permmap[class_name] = OrderedDict()
perms = class_.perms
@@ -254,11 +322,9 @@ class PermissionMap(object):
for perm_name in perms:
if perm_name not in self.permmap[class_name]:
- self.log.info("Adding unmapped permission {0} in {1} from {2}".
- format(perm_name, class_name, policy))
- self.permmap[class_name][perm_name] = {'direction': 'u',
- 'weight': 1,
- 'enabled': True}
+ self.log.debug("Adding unmapped permission {0} in {1} from {2}".
+ format(perm_name, class_name, policy))
+ Mapping(self.permmap, class_name, perm_name, create=True)
def rule_weight(self, rule):
"""
@@ -280,29 +346,22 @@ class PermissionMap(object):
raise exception.RuleTypeError("{0} rules cannot be used for calculating a weight".
format(rule.ruletype))
- if class_name not in self.permmap:
- raise exception.UnmappedClass("{0} is not mapped.".format(class_name))
-
# iterate over the permissions and determine the
# weight of the rule in each direction. The result
# is the largest-weight permission in each direction
for perm_name in rule.perms:
- try:
- mapping = self.permmap[class_name][perm_name]
- except KeyError:
- raise exception.UnmappedPermission("{0}:{1} is not mapped.".
- format(class_name, perm_name))
+ mapping = Mapping(self.permmap, class_name, perm_name)
- if not mapping['enabled']:
+ if not mapping.enabled:
continue
- if mapping['direction'] == "r":
- read_weight = max(read_weight, mapping['weight'])
- elif mapping['direction'] == "w":
- write_weight = max(write_weight, mapping['weight'])
- elif mapping['direction'] == "b":
- read_weight = max(read_weight, mapping['weight'])
- write_weight = max(write_weight, mapping['weight'])
+ if mapping.direction == "r":
+ read_weight = max(read_weight, mapping.weight)
+ elif mapping.direction == "w":
+ write_weight = max(write_weight, mapping.weight)
+ elif mapping.direction == "b":
+ read_weight = max(read_weight, mapping.weight)
+ write_weight = max(write_weight, mapping.weight)
return (read_weight, write_weight)
@@ -319,20 +378,7 @@ class PermissionMap(object):
UnmappedClass The specified object class is not mapped.
UnmappedPermission The specified permission is not mapped for the object class.
"""
-
- if direction not in self.valid_infoflow_directions:
- raise ValueError("Invalid information flow direction: {0}".format(direction))
-
- classname = str(class_)
-
- if classname not in self.permmap:
- raise exception.UnmappedClass("{0} is not mapped.".format(classname))
-
- try:
- self.permmap[classname][permission]['direction'] = direction
- except KeyError:
- raise exception.UnmappedPermission("{0}:{1} is not mapped.".
- format(classname, permission))
+ Mapping(self.permmap, class_, permission).direction = direction
def set_weight(self, class_, permission, weight):
"""
@@ -347,17 +393,61 @@ class PermissionMap(object):
UnmappedClass The specified object class is not mapped.
UnmappedPermission The specified permission is not mapped for the object class.
"""
+ Mapping(self.permmap, class_, permission).weight = weight
- if not self.min_weight <= weight <= self.max_weight:
- raise ValueError("Permission weights must be 1-10: {0}".format(weight))
- classname = str(class_)
+#
+# Settings Validation Functions
+#
+def validate_weight(weight):
+ if not min_weight <= weight <= max_weight:
+ raise ValueError("Permission weights must be 1-10: {0}".format(weight))
- if classname not in self.permmap:
- raise exception.UnmappedClass("{0} is not mapped.".format(classname))
+ return weight
- try:
- self.permmap[classname][permission]['weight'] = weight
- except KeyError:
- raise exception.UnmappedPermission("{0}:{1} is not mapped.".
- format(classname, permission))
+
+def validate_direction(direction):
+ if direction not in infoflow_directions:
+ raise ValueError("Invalid information flow direction: {0}".format(direction))
+
+ return direction
+
+
+def validate_enabled(enabled):
+ return bool(enabled)
+
+
+class Mapping(object):
+
+ """A mapping for a permission in the permission map."""
+
+ weight = PermissionMapDescriptor("weight", validate_weight)
+ direction = PermissionMapDescriptor("direction", validate_direction)
+ enabled = PermissionMapDescriptor("enabled", validate_enabled)
+
+ def __init__(self, perm_map, classname, permission, create=False):
+ self.perm_map = perm_map
+ self.class_ = classname
+ self.perm = permission
+
+ if create:
+ if classname not in self.perm_map:
+ self.perm_map[classname] = OrderedDict()
+
+ self.perm_map[classname][permission] = {'direction': 'u',
+ 'weight': 1,
+ 'enabled': True}
+
+ else:
+ if classname not in self.perm_map:
+ raise exception.UnmappedClass("{0} is not mapped.".format(classname))
+
+ if permission not in self.perm_map[classname]:
+ raise exception.UnmappedPermission("{0}:{1} is not mapped.".
+ format(classname, permission))
+
+ def __lt__(self, other):
+ if self.class_ == other.class_:
+ return self.perm < other.perm
+ else:
+ return self.class_ < other.class_
diff --git a/lib/python2.7/site-packages/setools/pirqconquery.py b/lib/python2.7/site-packages/setools/pirqconquery.py
new file mode 100644
index 0000000..529a5ee
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/pirqconquery.py
@@ -0,0 +1,93 @@
+# Derived from portconquery.py
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+import logging
+
+from .mixins import MatchContext
+from .query import PolicyQuery
+
+
+class PirqconQuery(MatchContext, PolicyQuery):
+
+ """
+ Pirqcon context query.
+
+ Parameter:
+ policy The policy to query.
+
+ Keyword Parameters/Class attributes:
+ irq A single IRQ value.
+
+ user The criteria to match the context's user.
+ user_regex If true, regular expression matching
+ will be used on the user.
+
+ role The criteria to match the context's role.
+ role_regex If true, regular expression matching
+ will be used on the role.
+
+ type_ The criteria to match the context's type.
+ type_regex If true, regular expression matching
+ will be used on the type.
+
+ range_ The criteria to match the context's range.
+ range_subset If true, the criteria will match if it is a subset
+ of the context's range.
+ range_overlap If true, the criteria will match if it overlaps
+ any of the context's range.
+ range_superset If true, the criteria will match if it is a superset
+ of the context's range.
+ range_proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+ """
+
+ _irq = None
+
+ @property
+ def irq(self):
+ return self._irq
+
+ @irq.setter
+ def irq(self, value):
+ if value:
+ if value < 1:
+ raise ValueError("The IRQ must be positive: {0}".format(value))
+
+ self._irq = value
+ else:
+ self._irq = None
+
+ def __init__(self, policy, **kwargs):
+ super(PirqconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
+ def results(self):
+ """Generator which yields all matching pirqcons."""
+ self.log.info("Generating results from {0.policy}".format(self))
+ self.log.debug("IRQ: {0.irq!r}".format(self))
+ self._match_context_debug(self.log)
+
+ for pirqcon in self.policy.pirqcons():
+
+ if self.irq and self.irq != pirqcon.irq:
+ continue
+
+ if not self._match_context(pirqcon.context):
+ continue
+
+ yield pirqcon
diff --git a/lib/python2.7/site-packages/setools/polcapquery.py b/lib/python2.7/site-packages/setools/polcapquery.py
index e024b05..34ca769 100644..100755
--- a/lib/python2.7/site-packages/setools/polcapquery.py
+++ b/lib/python2.7/site-packages/setools/polcapquery.py
@@ -18,10 +18,11 @@
#
import logging
-from . import compquery
+from .mixins import MatchName
+from .query import PolicyQuery
-class PolCapQuery(compquery.ComponentQuery):
+class PolCapQuery(MatchName, PolicyQuery):
"""
Query SELinux policy capabilities
@@ -35,10 +36,14 @@ class PolCapQuery(compquery.ComponentQuery):
be used for matching the name.
"""
+ def __init__(self, policy, **kwargs):
+ super(PolCapQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching policy capabilities."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+ self.log.info("Generating policy capability results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
for cap in self.policy.polcaps():
if not self._match_name(cap):
diff --git a/lib/python2.7/site-packages/setools/policyrep/__init__.py b/lib/python2.7/site-packages/setools/policyrep/__init__.py
index 5894cdb..be305bb 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/__init__.py
+++ b/lib/python2.7/site-packages/setools/policyrep/__init__.py
@@ -1,4 +1,4 @@
-# Copyright 2014-2015, Tresys Technology, LLC
+# Copyright 2014-2016, Tresys Technology, LLC
#
# This file is part of SETools.
#
@@ -41,11 +41,9 @@ from . import qpol
# This also makes sense since an object would only
# be valid for the policy it comes from.
-# Exceptions
-from . import exception
-
# Components
from . import boolcond
+from . import bounds
from . import default
from . import mls
from . import objclass
@@ -67,6 +65,14 @@ from . import fscontext
from . import initsid
from . import netcontext
+# Xen
+from . import xencontext
+
+# Classes useful for policyrep users:
+from . import exception
+from .netcontext import PortconProtocol, port_range
+from .terule import ioctlSet
+
class SELinuxPolicy(object):
@@ -78,7 +84,7 @@ class SELinuxPolicy(object):
policyfile Path to a policy to open.
"""
- self.log = logging.getLogger(self.__class__.__name__)
+ self.log = logging.getLogger(__name__)
self.policy = None
self.filename = None
@@ -166,6 +172,11 @@ class SELinuxPolicy(object):
"""The policy database version (e.g. v29)"""
return self.policy.version()
+ @property
+ def target_platform(self):
+ """The policy platform (selinux or xen)"""
+ return self.policy.target_platform()
+
#
# Policy statistics
#
@@ -176,11 +187,21 @@ class SELinuxPolicy(object):
return self.policy.avrule_allow_count()
@property
+ def allowxperm_count(self):
+ """The number of allowxperm rules."""
+ return self.policy.avrule_allowx_count()
+
+ @property
def auditallow_count(self):
"""The number of auditallow rules."""
return self.policy.avrule_auditallow_count()
@property
+ def auditallowxperm_count(self):
+ """The number of auditallowxperm rules."""
+ return self.policy.avrule_auditallowx_count()
+
+ @property
def boolean_count(self):
"""The number of Booleans."""
return self.policy.bool_count()
@@ -216,11 +237,21 @@ class SELinuxPolicy(object):
return sum(1 for d in self.defaults())
@property
+ def devicetreecon_count(self):
+ """The number of Xen devicetreecon statements."""
+ return self.policy.devicetreecon_count()
+
+ @property
def dontaudit_count(self):
"""The number of dontaudit rules."""
return self.policy.avrule_dontaudit_count()
@property
+ def dontauditxperm_count(self):
+ """The number of dontauditxperm rules."""
+ return self.policy.avrule_dontauditx_count()
+
+ @property
def fs_use_count(self):
"""fs_use_* statements."""
return self.policy.fs_use_count()
@@ -236,6 +267,16 @@ class SELinuxPolicy(object):
return self.policy.isid_count()
@property
+ def iomemcon_count(self):
+ """The number of Xen iomemcon statements."""
+ return self.policy.iomemcon_count()
+
+ @property
+ def ioportcon_count(self):
+ """The number of Xen ioportcon statements."""
+ return self.policy.ioportcon_count()
+
+ @property
def level_count(self):
"""The number of levels."""
return sum(1 for _ in self.levels())
@@ -261,11 +302,21 @@ class SELinuxPolicy(object):
return self.policy.avrule_neverallow_count()
@property
+ def neverallowxperm_count(self):
+ """The number of neverallowxperm rules."""
+ return self.policy.avrule_neverallowx_count()
+
+ @property
def nodecon_count(self):
"""The number of nodecon statements."""
return self.policy.nodecon_count()
@property
+ def pcidevicecon_count(self):
+ """The number of Xen pcidevicecon statements."""
+ return self.policy.pcidevicecon_count()
+
+ @property
def permission_count(self):
"""The number of permissions."""
return sum(len(c.perms) for c in chain(self.commons(), self.classes()))
@@ -276,6 +327,11 @@ class SELinuxPolicy(object):
return self.policy.permissive_count()
@property
+ def pirqcon_count(self):
+ """The number of Xen pirqcon statements."""
+ return self.policy.pirqcon_count()
+
+ @property
def polcap_count(self):
"""The number of policy capabilities."""
return self.policy.polcap_count()
@@ -331,6 +387,11 @@ class SELinuxPolicy(object):
return self.policy.terule_trans_count() + self.policy.filename_trans_count()
@property
+ def typebounds_count(self):
+ """The number of typebounds rules."""
+ return sum(1 for b in self.bounds() if b.ruletype == "typebounds")
+
+ @property
def user_count(self):
"""The number of users."""
return self.policy.user_count()
@@ -400,6 +461,11 @@ class SELinuxPolicy(object):
for bool_ in self.policy.bool_iter():
yield boolcond.boolean_factory(self.policy, bool_)
+ def bounds(self):
+ """Generator which yields all *bounds statements (typebounds, etc.)"""
+ for bound in self.policy.typebounds_iter():
+ yield bounds.bounds_factory(self.policy, bound)
+
def categories(self):
"""Generator which yields all MLS categories."""
for cat in self.policy.cat_iter():
@@ -500,6 +566,7 @@ class SELinuxPolicy(object):
def terules(self):
"""Generator which yields all type enforcement rules."""
for rule in chain(self.policy.avrule_iter(),
+ self.policy.avrulex_iter(),
self.policy.terule_iter(),
self.policy.filename_trans_iter()):
yield terule.te_rule_factory(self.policy, rule)
@@ -508,6 +575,11 @@ class SELinuxPolicy(object):
# Policy rule type validators
#
@staticmethod
+ def validate_bounds_ruletype(types):
+ """Validate constraint types."""
+ return bounds.validate_ruletype(types)
+
+ @staticmethod
def validate_constraint_ruletype(types):
"""Validate constraint types."""
return constraint.validate_ruletype(types)
@@ -590,3 +662,31 @@ class SELinuxPolicy(object):
"""Generator which yields all portcon statements."""
for port in self.policy.portcon_iter():
yield netcontext.portcon_factory(self.policy, port)
+
+ #
+ # Xen labeling statements
+ #
+ def iomemcons(self):
+ """Generator which yields all iomemcon statements."""
+ for mem_addr in self.policy.iomemcon_iter():
+ yield xencontext.iomemcon_factory(self.policy, mem_addr)
+
+ def ioportcons(self):
+ """Generator which yields all ioportcon statements."""
+ for port in self.policy.ioportcon_iter():
+ yield xencontext.ioportcon_factory(self.policy, port)
+
+ def pcidevicecons(self):
+ """Generator which yields all pcidevicecon statements."""
+ for device in self.policy.pcidevicecon_iter():
+ yield xencontext.pcidevicecon_factory(self.policy, device)
+
+ def pirqcons(self):
+ """Generator which yields all pirqcon statements."""
+ for irq in self.policy.pirqcon_iter():
+ yield xencontext.pirqcon_factory(self.policy, irq)
+
+ def devicetreecons(self):
+ """Generator which yields all devicetreecon statements."""
+ for path in self.policy.devicetreecon_iter():
+ yield xencontext.devicetreecon_factory(self.policy, path)
diff --git a/lib/python2.7/site-packages/setools/policyrep/_qpol.py b/lib/python2.7/site-packages/setools/policyrep/_qpol.py
index 97a341e..97a341e 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/_qpol.py
+++ b/lib/python2.7/site-packages/setools/policyrep/_qpol.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/_qpol.so b/lib/python2.7/site-packages/setools/policyrep/_qpol.so
index f459582..ce80c45 100755
--- a/lib/python2.7/site-packages/setools/policyrep/_qpol.so
+++ b/lib/python2.7/site-packages/setools/policyrep/_qpol.so
Binary files differ
diff --git a/lib/python2.7/site-packages/setools/policyrep/boolcond.py b/lib/python2.7/site-packages/setools/policyrep/boolcond.py
index f7df2c5..f7df2c5 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/boolcond.py
+++ b/lib/python2.7/site-packages/setools/policyrep/boolcond.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/bounds.py b/lib/python2.7/site-packages/setools/policyrep/bounds.py
new file mode 100755
index 0000000..469ddef
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/policyrep/bounds.py
@@ -0,0 +1,60 @@
+# Copyright 2016, Tresys Technology, LLC
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+from . import exception
+from .symbol import PolicySymbol
+from .qpol import qpol_typebounds_t
+from .typeattr import type_factory
+
+
+def bounds_factory(policy, sym):
+ """Factory for creating bounds statement objects."""
+
+ if isinstance(sym, qpol_typebounds_t):
+ return Bounds(policy, sym)
+ else:
+ raise TypeError("typebounds rules cannot be looked up.")
+
+
+def validate_ruletype(t):
+ """Validate *bounds rule types."""
+ if t not in ["typebounds"]:
+ raise exception.InvalidBoundsType("{0} is not a valid *bounds rule type.".format(t))
+
+ return t
+
+
+class Bounds(PolicySymbol):
+
+ """A typebounds statement."""
+
+ def __str__(self):
+ return "{0.ruletype} {0.parent} {0.child};".format(self)
+
+ def __hash__(self):
+ return hash("{0.ruletype}|{0.child};".format(self))
+
+ ruletype = "typebounds"
+
+ @property
+ def parent(self):
+ return type_factory(self.policy, self.qpol_symbol.parent_name(self.policy))
+
+ @property
+ def child(self):
+ return type_factory(self.policy, self.qpol_symbol.child_name(self.policy))
diff --git a/lib/python2.7/site-packages/setools/policyrep/constraint.py b/lib/python2.7/site-packages/setools/policyrep/constraint.py
index abaa6d1..4437761 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/constraint.py
+++ b/lib/python2.7/site-packages/setools/policyrep/constraint.py
@@ -1,4 +1,4 @@
-# Copyright 2014-2015, Tresys Technology, LLC
+# Copyright 2014-2016, Tresys Technology, LLC
#
# This file is part of SETools.
#
@@ -16,13 +16,13 @@
# License along with SETools. If not, see
# <http://www.gnu.org/licenses/>.
#
-from . import exception
from . import qpol
-from . import role
-from . import symbol
-from . import objclass
-from . import typeattr
-from . import user
+from .exception import ConstraintUseError, InvalidConstraintType
+from .role import role_factory
+from .symbol import PolicySymbol
+from .objclass import class_factory
+from .typeattr import type_or_attr_factory
+from .user import user_factory
def _is_mls(policy, sym):
@@ -41,7 +41,7 @@ def _is_mls(policy, sym):
def validate_ruletype(t):
"""Validate constraint rule types."""
if t not in ["constrain", "mlsconstrain", "validatetrans", "mlsvalidatetrans"]:
- raise exception.InvalidConstraintType("{0} is not a valid constraint type.".format(t))
+ raise InvalidConstraintType("{0} is not a valid constraint type.".format(t))
return t
@@ -65,127 +65,213 @@ def constraint_factory(policy, sym):
raise TypeError("Constraints cannot be looked-up.")
-class BaseConstraint(symbol.PolicySymbol):
+class BaseConstraint(PolicySymbol):
"""Base class for constraint rules."""
- _expr_type_to_text = {
- qpol.QPOL_CEXPR_TYPE_NOT: "not",
- qpol.QPOL_CEXPR_TYPE_AND: "and",
- qpol.QPOL_CEXPR_TYPE_OR: "\n\tor"}
-
- _expr_op_to_text = {
- qpol.QPOL_CEXPR_OP_EQ: "==",
- qpol.QPOL_CEXPR_OP_NEQ: "!=",
- qpol.QPOL_CEXPR_OP_DOM: "dom",
- qpol.QPOL_CEXPR_OP_DOMBY: "domby",
- qpol.QPOL_CEXPR_OP_INCOMP: "incomp"}
-
- _sym_to_text = {
- qpol.QPOL_CEXPR_SYM_USER: "u1",
- qpol.QPOL_CEXPR_SYM_ROLE: "r1",
- qpol.QPOL_CEXPR_SYM_TYPE: "t1",
- qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_TARGET: "u2",
- qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_TARGET: "r2",
- qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_TARGET: "t2",
- qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_XTARGET: "u3",
- qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_XTARGET: "r3",
- qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_XTARGET: "t3",
- qpol.QPOL_CEXPR_SYM_L1L2: "l1",
- qpol.QPOL_CEXPR_SYM_L1H2: "l1",
- qpol.QPOL_CEXPR_SYM_H1L2: "h1",
- qpol.QPOL_CEXPR_SYM_H1H2: "h1",
- qpol.QPOL_CEXPR_SYM_L1H1: "l1",
- qpol.QPOL_CEXPR_SYM_L2H2: "l2",
- qpol.QPOL_CEXPR_SYM_L1L2 + qpol.QPOL_CEXPR_SYM_TARGET: "l2",
- qpol.QPOL_CEXPR_SYM_L1H2 + qpol.QPOL_CEXPR_SYM_TARGET: "h2",
- qpol.QPOL_CEXPR_SYM_H1L2 + qpol.QPOL_CEXPR_SYM_TARGET: "l2",
- qpol.QPOL_CEXPR_SYM_H1H2 + qpol.QPOL_CEXPR_SYM_TARGET: "h2",
- qpol.QPOL_CEXPR_SYM_L1H1 + qpol.QPOL_CEXPR_SYM_TARGET: "h1",
- qpol.QPOL_CEXPR_SYM_L2H2 + qpol.QPOL_CEXPR_SYM_TARGET: "h2"}
-
- # Boolean operators
- _expr_type_to_precedence = {
- qpol.QPOL_CEXPR_TYPE_NOT: 3,
- qpol.QPOL_CEXPR_TYPE_AND: 2,
- qpol.QPOL_CEXPR_TYPE_OR: 1}
-
- # Logical operators have the same precedence
- _logical_op_precedence = 4
+ _role_syms = [qpol.QPOL_CEXPR_SYM_ROLE,
+ qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_TARGET,
+ qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_XTARGET]
+
+ _type_syms = [qpol.QPOL_CEXPR_SYM_TYPE,
+ qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_TARGET,
+ qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_XTARGET]
+
+ _user_syms = [qpol.QPOL_CEXPR_SYM_USER,
+ qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_TARGET,
+ qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_XTARGET]
def __init__(self, policy, qpol_symbol, ruletype):
- symbol.PolicySymbol.__init__(self, policy, qpol_symbol)
+ PolicySymbol.__init__(self, policy, qpol_symbol)
self.ruletype = ruletype
def __str__(self):
raise NotImplementedError
- def _build_expression(self):
+ # There is no levels function as specific
+ # levels cannot be used in expressions, only
+ # the l1, h1, etc. symbols
+
+ @property
+ def roles(self):
+ """The roles used in the expression."""
+ return set(self._get_symbols(self._role_syms, role_factory))
+
+ @property
+ def perms(self):
+ raise NotImplementedError
+
+ def statement(self):
+ return str(self)
+
+ @property
+ def tclass(self):
+ """Object class for this constraint."""
+ return class_factory(self.policy, self.qpol_symbol.object_class(self.policy))
+
+ @property
+ def types(self):
+ """The types and type attributes used in the expression."""
+
+ return set(self._get_symbols(self._type_syms, type_or_attr_factory))
+
+ @property
+ def users(self):
+ """The users used in the expression."""
+ return set(self._get_symbols(self._user_syms, user_factory))
+
+ def expression(self):
+ """
+ The constraint's expression in infix notation.
+
+ Return: list
+ """
+
+ _precedence = {
+ "not": 4,
+ "and": 2,
+ "or": 1,
+ "==": 3,
+ "!=": 3,
+ "dom": 3,
+ "domby": 3,
+ "incomp": 3}
+
+ _max_precedence = 4
+
+ _operands = ["u1", "u2", "u3",
+ "r1", "r2", "r3",
+ "t1", "t2", "t3",
+ "l1", "l2",
+ "h1", "h2"]
+
# qpol representation is in postfix notation. This code
# converts it to infix notation. Parentheses are added
# to ensure correct expressions, though they may end up
# being overused. Set previous operator at start to the
# highest precedence (op) so if there is a single binary
# operator, no parentheses are output
-
stack = []
- prev_op_precedence = self._logical_op_precedence
+ prev_op_precedence = _max_precedence
+ for op in self.postfix_expression():
+ if isinstance(op, frozenset) or op in _operands:
+ # operands
+ stack.append(op)
+ else:
+ # operators
+ if op == "not":
+ # unary operator
+ operator = op
+ operand = stack.pop()
+ op_precedence = _precedence[op]
+ stack.append([operator, "(", operand, ")"])
+ else:
+ # binary operators
+ operand2 = stack.pop()
+ operand1 = stack.pop()
+ operator = op
+
+ # if previous operator is of higher precedence
+ # no parentheses are needed.
+ if _precedence[op] < prev_op_precedence:
+ stack.append([operand1, operator, operand2])
+ else:
+ stack.append(["(", operand1, operator, operand2, ")"])
+
+ prev_op_precedence = _precedence[op]
+
+ return self._flatten_expression(stack)
+
+ def postfix_expression(self):
+ """
+ The constraint's expression in postfix notation.
+
+ Return: list
+ """
+
+ _expr_type_to_text = {
+ qpol.QPOL_CEXPR_TYPE_NOT: "not",
+ qpol.QPOL_CEXPR_TYPE_AND: "and",
+ qpol.QPOL_CEXPR_TYPE_OR: "or"}
+
+ _expr_op_to_text = {
+ qpol.QPOL_CEXPR_OP_EQ: "==",
+ qpol.QPOL_CEXPR_OP_NEQ: "!=",
+ qpol.QPOL_CEXPR_OP_DOM: "dom",
+ qpol.QPOL_CEXPR_OP_DOMBY: "domby",
+ qpol.QPOL_CEXPR_OP_INCOMP: "incomp"}
+
+ _sym_to_text = {
+ qpol.QPOL_CEXPR_SYM_USER: "u1",
+ qpol.QPOL_CEXPR_SYM_ROLE: "r1",
+ qpol.QPOL_CEXPR_SYM_TYPE: "t1",
+ qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_TARGET: "u2",
+ qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_TARGET: "r2",
+ qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_TARGET: "t2",
+ qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_XTARGET: "u3",
+ qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_XTARGET: "r3",
+ qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_XTARGET: "t3",
+ qpol.QPOL_CEXPR_SYM_L1L2: "l1",
+ qpol.QPOL_CEXPR_SYM_L1H2: "l1",
+ qpol.QPOL_CEXPR_SYM_H1L2: "h1",
+ qpol.QPOL_CEXPR_SYM_H1H2: "h1",
+ qpol.QPOL_CEXPR_SYM_L1H1: "l1",
+ qpol.QPOL_CEXPR_SYM_L2H2: "l2",
+ qpol.QPOL_CEXPR_SYM_L1L2 + qpol.QPOL_CEXPR_SYM_TARGET: "l2",
+ qpol.QPOL_CEXPR_SYM_L1H2 + qpol.QPOL_CEXPR_SYM_TARGET: "h2",
+ qpol.QPOL_CEXPR_SYM_H1L2 + qpol.QPOL_CEXPR_SYM_TARGET: "l2",
+ qpol.QPOL_CEXPR_SYM_H1H2 + qpol.QPOL_CEXPR_SYM_TARGET: "h2",
+ qpol.QPOL_CEXPR_SYM_L1H1 + qpol.QPOL_CEXPR_SYM_TARGET: "h1",
+ qpol.QPOL_CEXPR_SYM_L2H2 + qpol.QPOL_CEXPR_SYM_TARGET: "h2"}
+
+ expression = []
for expr_node in self.qpol_symbol.expr_iter(self.policy):
op = expr_node.op(self.policy)
sym_type = expr_node.sym_type(self.policy)
expr_type = expr_node.expr_type(self.policy)
if expr_type == qpol.QPOL_CEXPR_TYPE_ATTR:
- # logical operator with symbol (e.g. u1 == u2)
- operand1 = self._sym_to_text[sym_type]
- operand2 = self._sym_to_text[sym_type + qpol.QPOL_CEXPR_SYM_TARGET]
- operator = self._expr_op_to_text[op]
+ # logical operator with symbols (e.g. u1 == u2)
+ operand1 = _sym_to_text[sym_type]
+ operand2 = _sym_to_text[sym_type + qpol.QPOL_CEXPR_SYM_TARGET]
+ operator = _expr_op_to_text[op]
- stack.append([operand1, operator, operand2])
-
- prev_op_precedence = self._logical_op_precedence
+ expression.extend([operand1, operand2, operator])
elif expr_type == qpol.QPOL_CEXPR_TYPE_NAMES:
# logical operator with type or attribute list (e.g. t1 == { spam_t eggs_t })
- operand1 = self._sym_to_text[sym_type]
- operator = self._expr_op_to_text[op]
+ operand1 = _sym_to_text[sym_type]
+ operator = _expr_op_to_text[op]
names = list(expr_node.names_iter(self.policy))
- if not names:
- operand2 = "<empty set>"
- elif len(names) == 1:
- operand2 = names[0]
+ if sym_type in self._role_syms:
+ operand2 = frozenset(role_factory(self.policy, n) for n in names)
+ elif sym_type in self._type_syms:
+ operand2 = frozenset(type_or_attr_factory(self.policy, n) for n in names)
else:
- operand2 = "{{ {0} }}".format(' '.join(names))
+ operand2 = frozenset(user_factory(self.policy, n) for n in names)
- stack.append([operand1, operator, operand2])
+ expression.extend([operand1, operand2, operator])
+ else:
+ # individual operators (and/or/not)
+ expression.append(_expr_type_to_text[expr_type])
- prev_op_precedence = self._logical_op_precedence
- elif expr_type == qpol.QPOL_CEXPR_TYPE_NOT:
- # unary operator (not)
- operand = stack.pop()
- operator = self._expr_type_to_text[expr_type]
+ return expression
- stack.append([operator, "(", operand, ")"])
+ #
+ # Internal functions
+ #
+ def _flatten_expression(self, expr):
+ """Flatten the expression into a flat list."""
+ ret = []
- prev_op_precedence = self._expr_type_to_precedence[expr_type]
+ for i in expr:
+ if isinstance(i, list):
+ ret.extend(self._flatten_expression(i))
else:
- # binary operator (and/or)
- operand1 = stack.pop()
- operand2 = stack.pop()
- operator = self._expr_type_to_text[expr_type]
- op_precedence = self._expr_type_to_precedence[expr_type]
-
- # if previous operator is of higher precedence
- # no parentheses are needed.
- if op_precedence < prev_op_precedence:
- stack.append([operand1, operator, operand2])
- else:
- stack.append(["(", operand1, operator, operand2, ")"])
-
- prev_op_precedence = op_precedence
+ ret.append(i)
- return self.__unwind_subexpression(stack)
+ return ret
def _get_symbols(self, syms, factory):
"""
@@ -205,60 +291,21 @@ class BaseConstraint(symbol.PolicySymbol):
for s in expr_node.names_iter(self.policy):
yield factory(self.policy, s)
- def __unwind_subexpression(self, expr):
+ @staticmethod
+ def _expression_str(expr):
+ """Generate the string representation of the expression."""
ret = []
- # do a string.join on sublists (subexpressions)
- for i in expr:
- if isinstance(i, list):
- ret.append(self.__unwind_subexpression(i))
+ for item in expr:
+ if isinstance(item, frozenset):
+ if len(item) > 1:
+ ret.append("{{ {0} }} ".format(" ".join(str(j) for j in item)))
+ else:
+ ret.append("{0}".format(" ".join(str(j) for j in item)))
else:
- ret.append(i)
-
- return ' '.join(ret)
-
- # There is no levels function as specific
- # levels cannot be used in expressions, only
- # the l1, h1, etc. symbols
-
- @property
- def roles(self):
- """The roles used in the expression."""
- role_syms = [qpol.QPOL_CEXPR_SYM_ROLE,
- qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_TARGET,
- qpol.QPOL_CEXPR_SYM_ROLE + qpol.QPOL_CEXPR_SYM_XTARGET]
-
- return set(self._get_symbols(role_syms, role.role_factory))
-
- @property
- def perms(self):
- raise NotImplementedError
-
- def statement(self):
- return str(self)
-
- @property
- def tclass(self):
- """Object class for this constraint."""
- return objclass.class_factory(self.policy, self.qpol_symbol.object_class(self.policy))
-
- @property
- def types(self):
- """The types and type attributes used in the expression."""
- type_syms = [qpol.QPOL_CEXPR_SYM_TYPE,
- qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_TARGET,
- qpol.QPOL_CEXPR_SYM_TYPE + qpol.QPOL_CEXPR_SYM_XTARGET]
-
- return set(self._get_symbols(type_syms, typeattr.type_or_attr_factory))
-
- @property
- def users(self):
- """The users used in the expression."""
- user_syms = [qpol.QPOL_CEXPR_SYM_USER,
- qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_TARGET,
- qpol.QPOL_CEXPR_SYM_USER + qpol.QPOL_CEXPR_SYM_XTARGET]
+ ret.append(item)
- return set(self._get_symbols(user_syms, user.user_factory))
+ return " ".join(ret)
class Constraint(BaseConstraint):
@@ -270,12 +317,12 @@ class Constraint(BaseConstraint):
perms = self.perms
if len(perms) > 1:
- rule_string += "{{ {0} }} (\n".format(' '.join(perms))
+ rule_string += "{{ {0} }} (".format(' '.join(perms))
else:
# convert to list since sets cannot be indexed
- rule_string += "{0} (\n".format(list(perms)[0])
+ rule_string += "{0} (".format(list(perms)[0])
- rule_string += "\t{0}\n);".format(self._build_expression())
+ rule_string += "{0});".format(self._expression_str(self.expression()))
return rule_string
@@ -290,9 +337,9 @@ class Validatetrans(BaseConstraint):
"""A validatetrans rule (validatetrans/mlsvalidatetrans)."""
def __str__(self):
- return "{0.ruletype} {0.tclass}\n\t{1}\n);".format(self, self._build_expression())
+ return "{0.ruletype} {0.tclass} ({1});".format(self,
+ self._expression_str(self.expression()))
@property
def perms(self):
- raise exception.ConstraintUseError("{0} rules do not have permissions.".
- format(self.ruletype))
+ raise ConstraintUseError("{0} rules do not have permissions.".format(self.ruletype))
diff --git a/lib/python2.7/site-packages/setools/policyrep/context.py b/lib/python2.7/site-packages/setools/policyrep/context.py
index f2f3fc7..f2f3fc7 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/context.py
+++ b/lib/python2.7/site-packages/setools/policyrep/context.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/default.py b/lib/python2.7/site-packages/setools/policyrep/default.py
index 40c7197..40c7197 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/default.py
+++ b/lib/python2.7/site-packages/setools/policyrep/default.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/exception.py b/lib/python2.7/site-packages/setools/policyrep/exception.py
index bab5792..f29b467 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/exception.py
+++ b/lib/python2.7/site-packages/setools/policyrep/exception.py
@@ -150,10 +150,15 @@ class InvalidRuleType(InvalidSymbol):
pass
+class InvalidBoundsType(InvalidSymbol):
+
+ """Exception for invalid *bounds rule types."""
+ pass
+
+
class InvalidConstraintType(InvalidSymbol):
"""Exception for invalid constraint types."""
- # This is not a rule but is similar.
pass
diff --git a/lib/python2.7/site-packages/setools/policyrep/fscontext.py b/lib/python2.7/site-packages/setools/policyrep/fscontext.py
index 1dc648e..1dc648e 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/fscontext.py
+++ b/lib/python2.7/site-packages/setools/policyrep/fscontext.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/initsid.py b/lib/python2.7/site-packages/setools/policyrep/initsid.py
index 0197c74..0197c74 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/initsid.py
+++ b/lib/python2.7/site-packages/setools/policyrep/initsid.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/mls.py b/lib/python2.7/site-packages/setools/policyrep/mls.py
index 65a5ddc..68662c4 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/mls.py
+++ b/lib/python2.7/site-packages/setools/policyrep/mls.py
@@ -109,7 +109,7 @@ def level_factory(policy, sym):
try:
semantic_level = qpol.qpol_semantic_level_t(policy, sens)
except ValueError:
- raise exception.InvalidLevel("{0} is invalid ({1} is not a valid sensitivity)".
+ raise exception.InvalidLevel("{0} is not a valid level ({1} is not a valid sensitivity)".
format(sym, sens))
try:
@@ -125,23 +125,25 @@ def level_factory(policy, sym):
semantic_level.add_cats(policy, catrange[0], catrange[1])
except ValueError:
raise exception.InvalidLevel(
- "{0} is invalid ({1} is not a valid category range)".format(sym, group))
+ "{0} is not a valid level ({1} is not a valid category range)".
+ format(sym, group))
elif len(catrange) == 1:
try:
semantic_level.add_cats(policy, catrange[0], catrange[0])
except ValueError:
- raise exception.InvalidLevel("{0} is invalid ({1} is not a valid category)".
- format(sym, group))
+ raise exception.InvalidLevel(
+ "{0} is not a valid level ({1} is not a valid category)".format(sym, group))
else:
- raise exception.InvalidLevel("{0} is invalid (level parsing error)".format(sym))
+ raise exception.InvalidLevel(
+ "{0} is not a valid level (level parsing error)".format(sym))
# convert to level object
try:
policy_level = qpol.qpol_mls_level_t(policy, semantic_level)
except ValueError:
raise exception.InvalidLevel(
- "{0} is invalid (one or more categories are not associated with the sensitivity)".
- format(sym))
+ "{0} is not a valid level (one or more categories are not associated with the "
+ "sensitivity)".format(sym))
return Level(policy, policy_level)
diff --git a/lib/python2.7/site-packages/setools/policyrep/mlsrule.py b/lib/python2.7/site-packages/setools/policyrep/mlsrule.py
index 77f2df4..c4f3a3a 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/mlsrule.py
+++ b/lib/python2.7/site-packages/setools/policyrep/mlsrule.py
@@ -42,10 +42,10 @@ def expanded_mls_rule_factory(original, source, target):
target The target type of the expanded rule.
"""
- if isinstance(original, MLSRule):
- rule = ExpandedMLSRule(original.policy, original.qpol_symbol)
- elif isinstance(original, MLSRule):
+ if isinstance(original, ExpandedMLSRule):
return original
+ elif isinstance(original, MLSRule):
+ rule = ExpandedMLSRule(original.policy, original.qpol_symbol)
else:
raise TypeError("The original rule must be a MLS rule class.")
diff --git a/lib/python2.7/site-packages/setools/policyrep/netcontext.py b/lib/python2.7/site-packages/setools/policyrep/netcontext.py
index 4c9b6ec..6a70a5a 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/netcontext.py
+++ b/lib/python2.7/site-packages/setools/policyrep/netcontext.py
@@ -16,7 +16,7 @@
# License along with SETools. If not, see
# <http://www.gnu.org/licenses/>.
#
-import socket
+from socket import IPPROTO_TCP, IPPROTO_UDP, getprotobyname
from collections import namedtuple
from . import qpol
@@ -25,6 +25,10 @@ from . import context
port_range = namedtuple("port_range", ["low", "high"])
+# Python does not have a constant
+# for the DCCP protocol.
+IPPROTO_DCCP = getprotobyname("dccp")
+
def netifcon_factory(policy, name):
"""Factory function for creating netifcon objects."""
@@ -146,8 +150,23 @@ class PortconProtocol(int):
corresponding protocol string (udp, tcp).
"""
- _proto_to_text = {socket.IPPROTO_TCP: 'tcp',
- socket.IPPROTO_UDP: 'udp'}
+ _proto_to_text = {IPPROTO_DCCP: 'dccp',
+ IPPROTO_TCP: 'tcp',
+ IPPROTO_UDP: 'udp'}
+
+ def __new__(cls, value):
+ try:
+ # convert string representation
+ num = getprotobyname(value)
+ except TypeError:
+ num = value
+
+ if num not in cls._proto_to_text:
+ raise ValueError("{0} is not a supported IP protocol. "
+ "Values such as {1} (TCP) or {2} (UDP) should be used.".
+ format(value, IPPROTO_TCP, IPPROTO_UDP))
+
+ return super(PortconProtocol, cls).__new__(cls, num)
def __str__(self):
return self._proto_to_text[self]
diff --git a/lib/python2.7/site-packages/setools/policyrep/objclass.py b/lib/python2.7/site-packages/setools/policyrep/objclass.py
index bf9a553..bf9a553 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/objclass.py
+++ b/lib/python2.7/site-packages/setools/policyrep/objclass.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/polcap.py b/lib/python2.7/site-packages/setools/policyrep/polcap.py
index 8ab164d..8ab164d 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/polcap.py
+++ b/lib/python2.7/site-packages/setools/policyrep/polcap.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/qpol.i b/lib/python2.7/site-packages/setools/policyrep/qpol.i
new file mode 100644
index 0000000..267250d
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/policyrep/qpol.i
@@ -0,0 +1,3498 @@
+/**
+ * SWIG declarations for libqpol.
+ *
+ * @author Jeremy A. Mowery jmowery@tresys.com
+ * @author Jason Tang jtang@tresys.com
+ *
+ * Copyright (C) 2006-2008 Tresys Technology, LLC
+ *
+ * This library is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU Lesser General Public
+ * License as published by the Free Software Foundation; either
+ * version 2.1 of the License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+ */
+
+%module qpol
+
+%{
+#include <sys/stat.h>
+#include <arpa/inet.h>
+#include <sepol/policydb.h>
+#include <sepol/policydb/policydb.h>
+#include "include/qpol/avrule_query.h"
+#include "include/qpol/bool_query.h"
+#include "include/qpol/class_perm_query.h"
+#include "include/qpol/cond_query.h"
+#include "include/qpol/constraint_query.h"
+#include "include/qpol/context_query.h"
+#include "include/qpol/fs_use_query.h"
+#include "include/qpol/genfscon_query.h"
+#include "include/qpol/isid_query.h"
+#include "include/qpol/iterator.h"
+#include "include/qpol/mls_query.h"
+#include "include/qpol/mlsrule_query.h"
+#include "include/qpol/module.h"
+#include "include/qpol/netifcon_query.h"
+#include "include/qpol/nodecon_query.h"
+#include "include/qpol/policy.h"
+#include "include/qpol/policy_extend.h"
+#include "include/qpol/portcon_query.h"
+#include "include/qpol/rbacrule_query.h"
+#include "include/qpol/role_query.h"
+#include "include/qpol/syn_rule_query.h"
+#include "include/qpol/terule_query.h"
+#include "include/qpol/type_query.h"
+#include "include/qpol/user_query.h"
+#include "include/qpol/util.h"
+#include "include/qpol/xen_query.h"
+
+/* Provide hooks so that language-specific modules can define the
+ * callback function, used by the handler in
+ * qpol_policy_open_from_file().
+ */
+SWIGEXPORT qpol_callback_fn_t qpol_swig_message_callback = NULL;
+SWIGEXPORT void * qpol_swig_message_callback_arg = NULL;
+
+%}
+
+%include exception.i
+%include stdint.i
+
+/* handle size_t as architecture dependent */
+#ifdef SWIGWORDSIZE64
+typedef uint64_t size_t;
+#else
+typedef uint32_t size_t;
+#endif
+
+%inline %{
+ /* cast void * to char * as it can't have a constructor */
+ const char * to_str(void *x) {
+ return (const char *)x;
+ }
+
+ /* cast a void * to int, while freeing the pointer */
+ int to_int_with_free(void *x) {
+ int i = *(int *)x;
+ free(x);
+ return i;
+ }
+%}
+%{
+/* C Bridge to Python logging callback */
+__attribute__ ((format(printf, 4, 0)))
+static void qpol_log_callback(void *varg,
+ const qpol_policy_t * p __attribute__ ((unused)),
+ int level,
+ const char *fmt,
+ va_list va_args)
+{
+ /* Expand to a full string to avoid any C format string
+ * or variable args handling when passing to Python
+ */
+
+ PyObject *py_callback, *rc;
+ char *str = NULL;
+
+ if(vasprintf(&str, fmt, va_args) < 0)
+ return;
+
+ py_callback = (PyObject *) varg;
+
+ /* this char* casting doesn't make sense, but this runs afoul of -Werror
+ * otherwise as the Python library doesn't do const char* */
+ rc = PyObject_CallFunction(py_callback, (char*)"(is)", level, str);
+ Py_XDECREF(rc);
+ free(str);
+}
+%}
+
+%pythoncode %{
+import logging
+from functools import wraps
+
+def QpolGenerator(cast):
+ """
+ A decorator which converts qpol iterators into Python generators.
+
+ Qpol iterators use void* to be generic about their contents.
+ The purpose of the _from_void functions below is to wrap
+ the pointer casting, hence the "cast" variable name here.
+
+ Decorator parameter:
+ cast A wrapper function which casts the qpol iterator return pointer
+ to the proper C data type pointer. The Python function
+ reference to the C Python extension is used, for example:
+
+ @QpolGenerator(_qpol.qpol_type_from_void)
+ """
+
+ def decorate(func):
+ @wraps(func)
+ def wrapper(*args, **kwargs):
+ qpol_iter = func(*args)
+ while not qpol_iter.isend():
+ yield cast(qpol_iter.item())
+ qpol_iter.next_()
+
+ return wrapper
+ return decorate
+
+def qpol_logger(level, msg):
+ """Log qpol messages via Python logging."""
+ logging.getLogger(__name__).debug(msg)
+
+def qpol_policy_factory(path):
+ """Factory function for qpol policy objects."""
+ # The main purpose here is to hook in the
+ # above logger callback.
+ return qpol_policy_t(path, 0, qpol_logger)
+%}
+
+/* qpol_policy */
+#define QPOL_POLICY_OPTION_NO_NEVERALLOWS 0x00000001
+#define QPOL_POLICY_OPTION_NO_RULES 0x00000002
+#define QPOL_POLICY_OPTION_MATCH_SYSTEM 0x00000004
+/* add maximum and minimum policy versions supported by the statically linked libsepol */
+%constant int QPOL_POLICY_MAX_VERSION = POLICYDB_VERSION_MAX;
+%constant int QPOL_POLICY_MIN_VERSION = POLICYDB_VERSION_MIN;
+typedef struct qpol_policy {} qpol_policy_t;
+typedef void (*qpol_callback_fn_t) (void *varg, struct qpol_policy * policy, int level, const char *fmt, va_list va_args);
+
+typedef enum qpol_capability
+{
+ QPOL_CAP_ATTRIB_NAMES,
+ QPOL_CAP_SYN_RULES,
+ QPOL_CAP_LINE_NUMBERS,
+ QPOL_CAP_CONDITIONALS,
+ QPOL_CAP_MLS,
+ QPOL_CAP_MODULES,
+ QPOL_CAP_RULES_LOADED,
+ QPOL_CAP_SOURCE,
+ QPOL_CAP_NEVERALLOW,
+ QPOL_CAP_POLCAPS,
+ QPOL_CAP_BOUNDS,
+ QPOL_CAP_DEFAULT_OBJECTS,
+ QPOL_CAP_DEFAULT_TYPE,
+ QPOL_CAP_PERMISSIVE,
+ QPOL_CAP_FILENAME_TRANS,
+ QPOL_CAP_ROLETRANS,
+ QPOL_CAP_XPERM_IOCTL
+} qpol_capability_e;
+%exception qpol_policy {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_SyntaxError, "Invalid policy.");
+ } else {
+ PyErr_SetFromErrnoWithFilename(PyExc_OSError, arg1);
+ }
+ return NULL;
+ }
+}
+%extend qpol_policy {
+ qpol_policy(const char *path, const int options, PyObject *py_callback) {
+ qpol_policy_t *p;
+
+ if (!PyCallable_Check(py_callback)) {
+ PyErr_SetString(PyExc_TypeError, "Callback parameter must be callable");
+ return NULL;
+ }
+
+ qpol_policy_open_from_file(path, &p, qpol_log_callback, (void*)py_callback, options);
+ return p;
+ }
+ ~qpol_policy() {
+ qpol_policy_destroy(&self);
+ };
+
+ int version () {
+ unsigned int v;
+ (void)qpol_policy_get_policy_version(self, &v); /* only error is on null parameters neither can be here */
+ return (int) v;
+ };
+
+ const char *handle_unknown () {
+ unsigned int h;
+ qpol_policy_get_policy_handle_unknown(self, &h);
+
+ switch (h) {
+ case SEPOL_DENY_UNKNOWN: return "deny";
+ case SEPOL_REJECT_UNKNOWN: return "reject";
+ case SEPOL_ALLOW_UNKNOWN: return "allow";
+ default: return "unknown";
+ }
+ };
+
+ /* This is whether SELinux or XEN policy */
+ const char *target_platform () {
+ int t;
+ (void)qpol_policy_get_target_platform(self, &t);
+ switch (t) {
+ case SEPOL_TARGET_SELINUX: return "selinux";
+ case SEPOL_TARGET_XEN: return "xen";
+ default: return "unknown";
+ }
+ };
+
+ int capability (qpol_capability_e cap) {
+ return qpol_policy_has_capability(self, cap);
+ };
+
+ %newobject type_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_type_from_void) %}
+ qpol_iterator_t *type_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_type_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t type_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_type_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject role_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_role_from_void) %}
+ qpol_iterator_t *role_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_role_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t role_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_role_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject level_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_level_from_void) %}
+ qpol_iterator_t *level_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_level_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t level_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_level_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject cat_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_cat_from_void) %}
+ qpol_iterator_t *cat_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_cat_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t cat_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_cat_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject user_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_user_from_void) %}
+ qpol_iterator_t *user_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_user_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t user_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_user_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+
+ %newobject bool_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_bool_from_void) %}
+ qpol_iterator_t *bool_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_bool_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t bool_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_bool_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject class_iter(char*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_class_from_void) %}
+ qpol_iterator_t *class_iter(char *perm=NULL) {
+ qpol_iterator_t *iter;
+ if (perm) {
+ if (qpol_perm_get_class_iter(self, perm, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class iterator");
+ }
+ } else {
+ if (qpol_policy_get_class_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t class_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_class_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject common_iter(char*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_common_from_void) %}
+ qpol_iterator_t *common_iter(char *perm=NULL) {
+ qpol_iterator_t *iter;
+ if (perm) {
+ if (qpol_perm_get_common_iter(self, perm, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get common iterator");
+ }
+ } else {
+ if (qpol_policy_get_common_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t common_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_common_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject fs_use_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_fs_use_from_void) %}
+ qpol_iterator_t *fs_use_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_fs_use_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t fs_use_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_fs_use_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject genfscon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_genfscon_from_void) %}
+ qpol_iterator_t *genfscon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_genfscon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t genfscon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_genfscon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject isid_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_isid_from_void) %}
+ qpol_iterator_t *isid_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_isid_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t isid_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_isid_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject netifcon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_netifcon_from_void) %}
+ qpol_iterator_t *netifcon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_netifcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t netifcon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_netifcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject nodecon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_nodecon_from_void) %}
+ qpol_iterator_t *nodecon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_nodecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t nodecon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_nodecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject portcon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_portcon_from_void) %}
+ qpol_iterator_t *portcon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_portcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t portcon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_portcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject constraint_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_constraint_from_void) %}
+ qpol_iterator_t *constraint_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_constraint_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t constraint_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_constraint_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject validatetrans_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_validatetrans_from_void) %}
+ qpol_iterator_t *validatetrans_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_validatetrans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t validatetrans_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_validatetrans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject role_allow_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_role_allow_from_void) %}
+ qpol_iterator_t *role_allow_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_role_allow_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t role_allow_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_role_allow_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject role_trans_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_role_trans_from_void) %}
+ qpol_iterator_t *role_trans_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_role_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t role_trans_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_role_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject range_trans_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_range_trans_from_void) %}
+ qpol_iterator_t *range_trans_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_range_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t range_trans_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_range_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject avrule_iter(int);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_avrule_from_void) %}
+ qpol_iterator_t *avrule_iter() {
+ qpol_iterator_t *iter;
+ uint32_t rule_types = QPOL_RULE_ALLOW | QPOL_RULE_AUDITALLOW | QPOL_RULE_DONTAUDIT;
+
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW))
+ rule_types |= QPOL_RULE_NEVERALLOW;
+
+ if (qpol_policy_get_avrule_iter(self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t avrule_allow_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_ALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ size_t avrule_auditallow_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_AUDITALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ size_t avrule_neverallow_count() {
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW)) {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_NEVERALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ } else {
+ return 0;
+ }
+ fail:
+ return 0;
+ };
+
+ size_t avrule_dontaudit_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_DONTAUDIT, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject avulex_iter(int);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_avrule_from_void) %}
+ qpol_iterator_t *avrulex_iter() {
+ qpol_iterator_t *iter;
+ uint32_t rule_types = QPOL_RULE_XPERMS_ALLOW | QPOL_RULE_XPERMS_AUDITALLOW | QPOL_RULE_XPERMS_DONTAUDIT;
+
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW))
+ rule_types |= QPOL_RULE_XPERMS_NEVERALLOW;
+
+ if (qpol_policy_get_avrule_iter(self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t avrule_allowx_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_ALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ size_t avrule_auditallowx_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_AUDITALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ size_t avrule_neverallowx_count() {
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW)) {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_NEVERALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ } else {
+ return 0;
+ }
+ fail:
+ return 0;
+ };
+
+ size_t avrule_dontauditx_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_DONTAUDIT, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject terule_iter(int);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_terule_from_void) %}
+ qpol_iterator_t *terule_iter() {
+ qpol_iterator_t *iter;
+ uint32_t rule_types = QPOL_RULE_TYPE_TRANS | QPOL_RULE_TYPE_CHANGE | QPOL_RULE_TYPE_MEMBER;
+
+ if (qpol_policy_get_terule_iter(self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t terule_trans_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_terule_iter(self, QPOL_RULE_TYPE_TRANS, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ size_t terule_change_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_terule_iter(self, QPOL_RULE_TYPE_CHANGE, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ size_t terule_member_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_terule_iter(self, QPOL_RULE_TYPE_MEMBER, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject cond_iter();
+ qpol_iterator_t *cond_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_cond_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t cond_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_cond_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject filename_trans_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_filename_trans_from_void) %}
+ qpol_iterator_t *filename_trans_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_filename_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t filename_trans_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_filename_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject permissive_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_type_from_void) %}
+ qpol_iterator_t *permissive_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_permissive_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t permissive_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_permissive_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject typebounds_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_typebounds_from_void) %}
+ qpol_iterator_t *typebounds_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_typebounds_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ %newobject polcap_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_polcap_from_void) %}
+ qpol_iterator_t *polcap_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_polcap_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t polcap_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_polcap_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject default_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_default_object_from_void) %}
+ qpol_iterator_t *default_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_default_object_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ %newobject iomemcon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_iomemcon_from_void) %}
+ qpol_iterator_t *iomemcon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_iomemcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+ size_t iomemcon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_iomemcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject ioportcon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_ioportcon_from_void) %}
+ qpol_iterator_t *ioportcon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_ioportcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+
+ size_t ioportcon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_ioportcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject pcidevicecon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_pcidevicecon_from_void) %}
+ qpol_iterator_t *pcidevicecon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_pcidevicecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+ size_t pcidevicecon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_pcidevicecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject pirqcon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_pirqcon_from_void) %}
+ qpol_iterator_t *pirqcon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_pirqcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+ size_t pirqcon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_pirqcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+
+ %newobject devicetreecon_iter();
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_devicetreecon_from_void) %}
+ qpol_iterator_t *devicetreecon_iter() {
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_devicetreecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ };
+ size_t devicetreecon_count() {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_devicetreecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ };
+};
+
+/* qpol iterator */
+typedef struct qpol_iterator {} qpol_iterator_t;
+%extend qpol_iterator {
+ /* user never directly creates, but SWIG expects a constructor */
+ qpol_iterator() {
+ SWIG_exception(SWIG_TypeError, "User may not create iterators difectly");
+ fail:
+ return NULL;
+ };
+ ~qpol_iterator() {
+ qpol_iterator_destroy(&self);
+ };
+ void *item() {
+ void *i;
+ if (qpol_iterator_get_item(self, &i)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get item");
+ }
+ return i;
+ fail:
+ return NULL;
+ };
+ void next_() {
+ if (qpol_iterator_next(self)) {
+ SWIG_exception(SWIG_RuntimeError, "Error advancing iterator");
+ }
+ fail:
+ return;
+ };
+ int isend() {
+ return qpol_iterator_end(self);
+ };
+ size_t size() {
+ size_t s;
+ if (qpol_iterator_get_size(self, &s)) {
+ SWIG_exception(SWIG_ValueError, "Could not get iterator size");
+ }
+ return s;
+ fail:
+ return 0;
+ };
+};
+
+/* qpol type */
+typedef struct qpol_type {} qpol_type_t;
+%extend qpol_type {
+ %exception qpol_type {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid type or attribute.");
+ return NULL;
+ }
+ }
+ qpol_type(qpol_policy_t *p, const char *name) {
+ const qpol_type_t *t;
+ qpol_policy_get_type_by_name(p, name, &t);
+ return (qpol_type_t*)t;
+ };
+ ~qpol_type() {
+ /* no op */
+ return;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_type_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type name");
+ }
+ return name;
+ fail:
+ return NULL;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_type_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type value");
+ }
+ fail:
+ return (int) v;
+ };
+ int isalias(qpol_policy_t *p) {
+ unsigned char i;
+ if (qpol_type_get_isalias(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether type is an alias");
+ }
+ fail:
+ return (int)i;
+ };
+ int isattr(qpol_policy_t *p) {
+ unsigned char i;
+ if (qpol_type_get_isattr(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether type is an attribute");
+ }
+ fail:
+ return (int)i;
+ };
+ int ispermissive(qpol_policy_t *p) {
+ unsigned char i;
+ if (qpol_type_get_ispermissive(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether type is permissive");
+ }
+ fail:
+ return (int)i;
+ };
+
+ %newobject type_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_type_from_void) %}
+ qpol_iterator_t *type_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ int retv = qpol_type_get_type_iter(p, self, &iter);
+ if (retv < 0) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get attribute types");
+ } else if (retv > 0) {
+ SWIG_exception(SWIG_TypeError, "Type is not an attribute");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject attr_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_type_from_void) %}
+ qpol_iterator_t *attr_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ int retv = qpol_type_get_attr_iter(p, self, &iter);
+ if (retv < 0) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get type attributes");
+ } else if (retv > 0) {
+ SWIG_exception(SWIG_TypeError, "Type is an attribute");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject alias_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *alias_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_type_get_alias_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get type aliases");
+ }
+ fail:
+ return iter;
+ };
+
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_permissive_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get permissive type name");
+ }
+ return name;
+ fail:
+ return NULL;
+ };
+ };
+%inline %{
+ qpol_type_t *qpol_type_from_void(void *x) {
+ return (qpol_type_t*)x;
+ };
+%}
+
+/* qpol role */
+typedef struct qpol_role {} qpol_role_t;
+%extend qpol_role {
+ %exception qpol_role {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid type or attribute.");
+ return NULL;
+ }
+ }
+ qpol_role(qpol_policy_t *p, const char *name) {
+ const qpol_role_t *r;
+ qpol_policy_get_role_by_name(p, name, &r);
+ return (qpol_role_t*)r;
+ };
+ ~qpol_role() {
+ /* no op */
+ return;
+ };
+ int value (qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_role_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role value");
+ }
+ fail:
+ return (int) v;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_role_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role name");
+ }
+ return name;
+ fail:
+ return NULL;
+ };
+
+ %newobject type_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_type_from_void) %}
+ qpol_iterator_t *type_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_role_get_type_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get role types");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject dominate_iter(qpol_policy_t*);
+ qpol_iterator_t *dominate_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_role_get_dominate_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get dominated roles");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_role_t *qpol_role_from_void(void *x) {
+ return (qpol_role_t*)x;
+ };
+%}
+
+/* qpol level */
+typedef struct qpol_level {} qpol_level_t;
+%extend qpol_level {
+ %exception qpol_level {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid level.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ qpol_level(qpol_policy_t *p, const char *name) {
+ const qpol_level_t *l;
+ qpol_policy_get_level_by_name(p, name, &l);
+ return (qpol_level_t*)l;
+ };
+
+ ~qpol_level() {
+ /* no op */
+ return;
+ };
+ int isalias(qpol_policy_t *p) {
+ unsigned char i;
+ if (qpol_level_get_isalias(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether level is an alias");
+ }
+ fail:
+ return (int)i;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_level_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get level sensitivity value");
+ }
+ fail:
+ return (int) v;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_level_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get level sensitivity name");
+ }
+ return name;
+ fail:
+ return NULL;
+ };
+
+ %newobject cat_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_cat_from_void) %}
+ qpol_iterator_t *cat_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_level_get_cat_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get level categories");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject alias_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *alias_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_level_get_alias_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get level aliases");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_level_t *qpol_level_from_void(void *x) {
+ return (qpol_level_t*)x;
+ };
+%}
+
+/* qpol cat */
+typedef struct qpol_cat {} qpol_cat_t;
+%extend qpol_cat {
+ %exception qpol_cat {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid category.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ qpol_cat(qpol_policy_t *p, const char *name) {
+ const qpol_cat_t *c;
+ qpol_policy_get_cat_by_name(p, name, &c);
+ return (qpol_cat_t*)c;
+ };
+
+ ~qpol_cat() {
+ /* no op */
+ return;
+ };
+ int isalias(qpol_policy_t *p) {
+ unsigned char i;
+ if (qpol_cat_get_isalias(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether category is an alias");
+ }
+ fail:
+ return (int)i;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_cat_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get category value");
+ }
+ fail:
+ return (int) v;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_cat_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get category name");
+ }
+ return name;
+ fail:
+ return NULL;
+ };
+ %newobject alias_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *alias_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_cat_get_alias_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get category aliases");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_cat_t *qpol_cat_from_void(void *x) {
+ return (qpol_cat_t*)x;
+ };
+%}
+
+/* qpol mls range */
+typedef struct qpol_mls_range {} qpol_mls_range_t;
+%extend qpol_mls_range {
+ /*
+ * TODO: determine how to conditionally destroy this range.
+ * It should only be destroyed if it was looked up (user-entered)
+ * Otherwise qpol will destroy the others when the policy closes.
+ */
+ %exception qpol_mls_range {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid range.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+
+ qpol_mls_range(qpol_policy_t *p, qpol_mls_level_t *l, qpol_mls_level_t *h) {
+ qpol_mls_range_t *range;
+ qpol_policy_get_mls_range_from_mls_levels(p, l, h, &range);
+ return range;
+ }
+
+ ~qpol_mls_range() {
+ /* no op */
+ return;
+ };
+ const qpol_mls_level_t *high_level(qpol_policy_t *p) {
+ const qpol_mls_level_t *l;
+ if (qpol_mls_range_get_high_level(p, self, &l)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range high levl");
+ }
+ fail:
+ return l;
+ };
+ const qpol_mls_level_t *low_level(qpol_policy_t *p) {
+ const qpol_mls_level_t *l;
+ if (qpol_mls_range_get_low_level(p, self, &l)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range low levl");
+ }
+ fail:
+ return l;
+ };
+};
+%inline %{
+ qpol_mls_range_t *qpol_mls_range_from_void(void *x) {
+ return (qpol_mls_range_t*)x;
+ };
+%}
+
+/* qpol semantic mls level */
+typedef struct qpol_semantic_level {} qpol_semantic_level_t;
+%extend qpol_semantic_level {
+ %exception qpol_semantic_level {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid sensitivity name.");
+ return NULL;
+ }
+ }
+
+ qpol_semantic_level(qpol_policy_t *p, const char *name) {
+ const qpol_semantic_level_t *l;
+ qpol_policy_get_semantic_level_by_name(p, name, &l);
+ return (qpol_semantic_level_t*)l;
+ };
+
+ ~qpol_semantic_level() {
+ qpol_semantic_level_destroy(self);
+ return;
+ };
+
+ %exception add_cats {
+ $action
+ if (result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid category name or category range.");
+ return NULL;
+ }
+ }
+ int add_cats(qpol_policy_t *p, const char *low, const char *high) {
+ return qpol_semantic_level_add_cats_by_name(p, self, low, high);
+ }
+};
+
+/* qpol mls level */
+typedef struct qpol_mls_level {} qpol_mls_level_t;
+%extend qpol_mls_level {
+ %exception qpol_mls_level {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid level.");
+ return NULL;
+ }
+ }
+
+ qpol_mls_level(qpol_policy_t *p, qpol_semantic_level_t *l) {
+ qpol_mls_level_t *level;
+ qpol_mls_level_from_semantic_level(p, l, &level);
+ return level;
+ }
+
+ ~qpol_mls_level() {
+ /* no op */
+ return;
+ };
+ const char *sens_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_mls_level_get_sens_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get level sensitivity name");
+ }
+ fail:
+ return name;
+ };
+
+ %newobject cat_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_cat_from_void) %}
+ qpol_iterator_t *cat_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_mls_level_get_cat_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get level categories");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_mls_level_t *qpol_mls_level_from_void(void *x) {
+ return (qpol_mls_level_t*)x;
+ };
+%}
+
+/* qpol user */
+typedef struct qpol_user {} qpol_user_t;
+%extend qpol_user {
+ %exception qpol_user {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid user.");
+ return NULL;
+ }
+ }
+ qpol_user(qpol_policy_t *p, const char *name) {
+ const qpol_user_t *u;
+ qpol_policy_get_user_by_name(p, name, &u);
+ return (qpol_user_t*)u;
+ };
+ ~qpol_user() {
+ /* no op */
+ return;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_user_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user value");
+ }
+ fail:
+ return (int) v;
+ };
+
+ %newobject role_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_role_from_void) %}
+ qpol_iterator_t *role_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_user_get_role_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ fail:
+ return iter;
+ };
+
+ const qpol_mls_range_t *range(qpol_policy_t *p) {
+ const qpol_mls_range_t *r;
+ if (qpol_user_get_range(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user range");
+ }
+ fail:
+ return r;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_user_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user name");
+ }
+ fail:
+ return name;
+ };
+ const qpol_mls_level_t *dfltlevel(qpol_policy_t *p) {
+ const qpol_mls_level_t *l;
+ if (qpol_user_get_dfltlevel(p, self, &l)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user default level");
+ }
+ fail:
+ return l;
+ };
+};
+%inline %{
+ qpol_user_t *qpol_user_from_void(void *x) {
+ return (qpol_user_t*)x;
+ };
+%}
+
+/* qpol bool */
+typedef struct qpol_bool {} qpol_bool_t;
+%extend qpol_bool {
+ qpol_bool(qpol_policy_t *p, const char *name) {
+ qpol_bool_t *b;
+ if (qpol_policy_get_bool_by_name(p, name, &b)) {
+ SWIG_exception(SWIG_RuntimeError, "Boolean does not exist");
+ }
+ fail:
+ return b;
+ };
+ ~qpol_bool() {
+ /* no op */
+ return;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_bool_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean value");
+ }
+ fail:
+ return (int) v;
+ };
+ int state(qpol_policy_t *p) {
+ int s;
+ if (qpol_bool_get_state(p, self, &s)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean state");
+ }
+ fail:
+ return s;
+ };
+
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_bool_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean name");
+ }
+ fail:
+ return name;
+ };
+};
+%inline %{
+ qpol_bool_t *qpol_bool_from_void(void *x) {
+ return (qpol_bool_t*)x;
+ };
+%}
+
+/* qpol context */
+typedef struct qpol_context {} qpol_context_t;
+%extend qpol_context {
+ qpol_context() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_context_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_context() {
+ /* no op */
+ return;
+ };
+ const qpol_user_t *user(qpol_policy_t *p) {
+ const qpol_user_t *u;
+ if (qpol_context_get_user(p, self, &u)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user from context");
+ }
+ fail:
+ return u;
+ };
+ const qpol_role_t *role(qpol_policy_t *p) {
+ const qpol_role_t *r;
+ if (qpol_context_get_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role from context");
+ }
+ fail:
+ return r;
+ };
+ const qpol_type_t *type_(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_context_get_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type from context");
+ }
+ fail:
+ return t;
+ };
+ const qpol_mls_range_t *range(qpol_policy_t *p) {
+ const qpol_mls_range_t *r;
+ if (qpol_context_get_range(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range from context");
+ }
+ fail:
+ return r;
+ };
+};
+%inline %{
+ qpol_context_t *qpol_context_from_void(void *x) {
+ return (qpol_context_t*)x;
+ };
+%}
+
+/* qpol class */
+typedef struct qpol_class {} qpol_class_t;
+%extend qpol_class {
+ %exception qpol_class {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid class.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ qpol_class(qpol_policy_t *p, const char *name) {
+ const qpol_class_t *c;
+ qpol_policy_get_class_by_name(p, name, &c);
+ return (qpol_class_t*)c;
+ };
+
+ ~qpol_class() {
+ /* no op */
+ return;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_class_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get value for class");
+ }
+ fail:
+ return (int) v;
+ };
+
+ %exception common {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Class does not inherit a common.");
+ return NULL;
+ }
+ }
+ const qpol_common_t *common(qpol_policy_t *p) {
+ const qpol_common_t *c;
+ if(qpol_class_get_common(p, self, &c)) {
+ SWIG_exception(SWIG_ValueError, "Could not get common for class");
+ }
+ fail:
+ return c;
+ };
+ %newobject perm_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *perm_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if(qpol_class_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class permissions");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject constraint_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_constraint_from_void) %}
+ qpol_iterator_t *constraint_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if(qpol_class_get_constraint_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class constraints");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject validatetrans_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_validatetrans_from_void) %}
+ qpol_iterator_t *validatetrans_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if(qpol_class_get_validatetrans_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class validatetrans statements");
+ }
+ fail:
+ return iter;
+ };
+
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_class_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class name");
+ }
+ fail:
+ return name;
+ };
+};
+%inline %{
+ qpol_class_t *qpol_class_from_void(void *x) {
+ return (qpol_class_t*)x;
+ };
+%}
+
+/* qpol common */
+typedef struct qpol_common {} qpol_common_t;
+%extend qpol_common {
+ %exception qpol_common {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid common.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ qpol_common(qpol_policy_t *p, const char *name) {
+ const qpol_common_t *c;
+ qpol_policy_get_common_by_name(p, name, &c);
+ return (qpol_common_t*)c;
+ };
+
+ ~qpol_common() {
+ /* no op */
+ return;
+ };
+ int value(qpol_policy_t *p) {
+ uint32_t v;
+ if (qpol_common_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get value for common");
+ }
+ fail:
+ return (int) v;
+ };
+
+ %newobject perm_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *perm_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if(qpol_common_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get common permissions");
+ }
+ fail:
+ return iter;
+ };
+
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_common_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get common name");
+ }
+ fail:
+ return name;
+ };
+};
+%inline %{
+ qpol_common_t *qpol_common_from_void(void *x) {
+ return (qpol_common_t*)x;
+ };
+%}
+
+/* qpol fs_use */
+/* The defines QPOL_FS_USE_XATTR through QPOL_FS_USE_NONE are
+ * copied from sepol/policydb/services.h.
+ * QPOL_FS_USE_PSID is an extension to support v12 policies. */
+#define QPOL_FS_USE_XATTR 1U
+#define QPOL_FS_USE_TRANS 2U
+#define QPOL_FS_USE_TASK 3U
+#define QPOL_FS_USE_GENFS 4U
+#define QPOL_FS_USE_NONE 5U
+#define QPOL_FS_USE_PSID 6U
+typedef struct qpol_fs_use {} qpol_fs_use_t;
+%extend qpol_fs_use {
+ qpol_fs_use(qpol_policy_t *p, const char *name) {
+ const qpol_fs_use_t *f;
+ if (qpol_policy_get_fs_use_by_name(p, name, &f)) {
+ SWIG_exception(SWIG_RuntimeError, "FS Use Statement does not exist");
+ }
+ fail:
+ return (qpol_fs_use_t*)f;
+ };
+ ~qpol_fs_use() {
+ /* no op */
+ return;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_fs_use_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system name");
+ }
+ fail:
+ return name;
+ };
+ int behavior(qpol_policy_t *p) {
+ uint32_t behav;
+ if (qpol_fs_use_get_behavior(p, self, &behav)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system labeling behavior");
+ }
+ fail:
+ return (int) behav;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ uint32_t behav;
+ const qpol_context_t *ctx = NULL;
+ qpol_fs_use_get_behavior(p, self, &behav);
+ if (behav == QPOL_FS_USE_PSID) {
+ SWIG_exception(SWIG_TypeError, "Cannot get context for fs_use_psid statements");
+ } else if (qpol_fs_use_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system context");
+ }
+ fail:
+ return ctx;
+ };
+};
+%inline %{
+ qpol_fs_use_t *qpol_fs_use_from_void(void *x) {
+ return (qpol_fs_use_t*)x;
+ };
+%}
+
+/* qpol genfscon */
+/* values from flask do not change */
+#define QPOL_CLASS_ALL 0U
+#define QPOL_CLASS_BLK_FILE 11U
+#define QPOL_CLASS_CHR_FILE 10U
+#define QPOL_CLASS_DIR 7U
+#define QPOL_CLASS_FIFO_FILE 13U
+#define QPOL_CLASS_FILE 6U
+#define QPOL_CLASS_LNK_FILE 9U
+#define QPOL_CLASS_SOCK_FILE 12U
+typedef struct qpol_genfscon {} qpol_genfscon_t;
+%extend qpol_genfscon {
+ qpol_genfscon(qpol_policy_t *p, const char *name, const char *path) {
+ qpol_genfscon_t *g;
+ if (qpol_policy_get_genfscon_by_name(p, name, path, &g)) {
+ SWIG_exception(SWIG_RuntimeError, "Genfscon statement does not exist");
+ }
+ fail:
+ return g;
+ };
+ ~qpol_genfscon() {
+ free(self);
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_genfscon_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system name");
+ }
+ fail:
+ return name;
+ };
+ const char *path(qpol_policy_t *p) {
+ const char *path;
+ if (qpol_genfscon_get_path(p, self, &path)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system path");
+ }
+ fail:
+ return path;
+ };
+ unsigned int object_class(qpol_policy_t *p) {
+ uint32_t cls;
+ if (qpol_genfscon_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get genfscon statement class");
+ }
+ switch (cls) {
+ case QPOL_CLASS_BLK_FILE: return S_IFBLK;
+ case QPOL_CLASS_CHR_FILE: return S_IFCHR;
+ case QPOL_CLASS_DIR: return S_IFDIR;
+ case QPOL_CLASS_FIFO_FILE: return S_IFIFO;
+ case QPOL_CLASS_FILE: return S_IFREG;
+ case QPOL_CLASS_LNK_FILE: return S_IFLNK;
+ case QPOL_CLASS_SOCK_FILE: return S_IFSOCK;
+ default: return 0; /* all file types */
+ }
+ fail:
+ return 0;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_genfscon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for genfscon statement");
+ }
+ fail:
+ return ctx;
+ };
+};
+%inline %{
+ qpol_genfscon_t *qpol_genfscon_from_void(void *x) {
+ return (qpol_genfscon_t*)x;
+ };
+%}
+
+/* qpol isid */
+typedef struct qpol_isid {} qpol_isid_t;
+%extend qpol_isid {
+ %exception qpol_isid {
+ $action
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid initial sid name.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ qpol_isid(qpol_policy_t *p, const char *name) {
+ const qpol_isid_t *i;
+ qpol_policy_get_isid_by_name(p, name, &i);
+ return (qpol_isid_t*)i;
+ };
+
+ ~qpol_isid() {
+ /* no op */
+ return;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_isid_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get name for initial sid");
+ }
+ fail:
+ return name;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_isid_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for initial sid");
+ }
+ fail:
+ return ctx;
+ };
+};
+%inline %{
+ qpol_isid_t *qpol_isid_from_void(void *x) {
+ return (qpol_isid_t*)x;
+ };
+%}
+
+/* qpol netifcon */
+typedef struct qpol_netifcon {} qpol_netifcon_t;
+%extend qpol_netifcon {
+ qpol_netifcon(qpol_policy_t *p, const char *name) {
+ const qpol_netifcon_t *n;
+ if (qpol_policy_get_netifcon_by_name(p, name, &n)) {
+ SWIG_exception(SWIG_RuntimeError, "Netifcon statement does not exist");
+ }
+ fail:
+ return (qpol_netifcon_t*)n;
+ };
+ ~qpol_netifcon() {
+ /* no op */
+ return;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_netifcon_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get name for netifcon statement");
+ }
+ fail:
+ return name;
+ };
+ const qpol_context_t *msg_con(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_netifcon_get_msg_con(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get message context for netifcon statement");
+ }
+ fail:
+ return ctx;
+ };
+ const qpol_context_t *if_con(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_netifcon_get_if_con(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get interface context for netifcon statement");
+ }
+ fail:
+ return ctx;
+ };
+};
+%inline %{
+ qpol_netifcon_t *qpol_netifcon_from_void(void *x) {
+ return (qpol_netifcon_t*)x;
+ };
+%}
+
+/* qpol nodecon */
+#define QPOL_IPV4 0
+#define QPOL_IPV6 1
+typedef struct qpol_nodecon {} qpol_nodecon_t;
+%extend qpol_nodecon {
+ qpol_nodecon(qpol_policy_t *p, int addr[4], int mask[4], int protocol) {
+ uint32_t a[4], m[4];
+ qpol_nodecon_t *n;
+ a[0] = (uint32_t) addr[0]; a[1] = (uint32_t) addr[1];
+ a[2] = (uint32_t) addr[2]; a[3] = (uint32_t) addr[3];
+ m[0] = (uint32_t) mask[0]; m[1] = (uint32_t) mask[1];
+ m[2] = (uint32_t) mask[2]; m[3] = (uint32_t) mask[3];
+ if (qpol_policy_get_nodecon_by_node(p, a, m, protocol, &n)) {
+ SWIG_exception(SWIG_RuntimeError, "Nodecon statement does not exist");
+ }
+ fail:
+ return n;
+ }
+ ~qpol_nodecon() {
+ free(self);
+ };
+ char *addr(qpol_policy_t *p) {
+ uint32_t *a;
+ unsigned char proto;
+ char *addr = NULL;
+
+ addr = malloc(INET6_ADDRSTRLEN * sizeof(char));
+ if(!addr)
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+
+ if (qpol_nodecon_get_addr(p, self, &a, &proto)) {
+ SWIG_exception(SWIG_ValueError, "Could not get address of nodecon statement");
+ }
+
+ if(proto == QPOL_IPV4) {
+ inet_ntop(AF_INET, a, addr, INET6_ADDRSTRLEN);
+ } else {
+ inet_ntop(AF_INET6, a, addr, INET6_ADDRSTRLEN);
+ }
+
+ fail:
+ return addr;
+ };
+ char *mask(qpol_policy_t *p) {
+ uint32_t *m;
+ unsigned char proto;
+ char *mask;
+ mask = malloc(INET6_ADDRSTRLEN * sizeof(char));
+ if (!mask)
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+
+ if (qpol_nodecon_get_mask(p, self, &m, &proto)) {
+ SWIG_exception(SWIG_ValueError, "Could not get mask of nodecon statement");
+ }
+
+ if(proto == QPOL_IPV4) {
+ inet_ntop(AF_INET, m, mask, INET6_ADDRSTRLEN);
+ } else {
+ inet_ntop(AF_INET6, m, mask, INET6_ADDRSTRLEN);
+ }
+ fail:
+ return mask;
+ };
+ int protocol(qpol_policy_t *p) {
+ unsigned char proto;
+ if (qpol_nodecon_get_protocol(p, self, &proto)) {
+ SWIG_exception(SWIG_ValueError, "Could not get protocol for nodecon statement");
+ }
+ fail:
+ if(proto == QPOL_IPV4) {
+ return AF_INET;
+ } else {
+ return AF_INET6;
+ }
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_nodecon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for nodecon statement");
+ }
+ fail:
+ return ctx;
+ };
+};
+%inline %{
+ qpol_nodecon_t *qpol_nodecon_from_void(void *x) {
+ return (qpol_nodecon_t*)x;
+ };
+%}
+
+/* qpol portcon */
+/* from netinet/in.h */
+#define IPPROTO_TCP 6
+#define IPPROTO_UDP 17
+typedef struct qpol_portcon {} qpol_portcon_t;
+%extend qpol_portcon {
+ qpol_portcon(qpol_policy_t *p, uint16_t low, uint16_t high, uint8_t protocol) {
+ const qpol_portcon_t *qp;
+ if (qpol_policy_get_portcon_by_port(p, low, high, protocol, &qp)) {
+ SWIG_exception(SWIG_RuntimeError, "Portcon statement does not exist");
+ }
+ fail:
+ return (qpol_portcon_t*)qp;
+ };
+ ~qpol_portcon() {
+ /* no op */
+ return;
+ };
+ uint16_t low_port(qpol_policy_t *p) {
+ uint16_t port = 0;
+ if(qpol_portcon_get_low_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get low port for portcon statement");
+ }
+ fail:
+ return port;
+ };
+ uint16_t high_port(qpol_policy_t *p) {
+ uint16_t port = 0;
+ if(qpol_portcon_get_high_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get high port for portcon statement");
+ }
+ fail:
+ return port;
+ };
+ uint8_t protocol(qpol_policy_t *p) {
+ uint8_t proto = 0;
+ if (qpol_portcon_get_protocol(p, self, &proto)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get protocol for portcon statement");
+ }
+ fail:
+ return proto;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_portcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for portcon statement");
+ }
+ fail:
+ return ctx;
+ };
+}
+%inline %{
+ qpol_portcon_t *qpol_portcon_from_void(void *x) {
+ return (qpol_portcon_t*)x;
+ };
+%}
+
+/* qpol constraint */
+typedef struct qpol_constraint {} qpol_constraint_t;
+%extend qpol_constraint {
+ qpol_constraint() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_constraint_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_constraint() {
+ free(self);
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_constraint_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for constraint");
+ }
+ fail:
+ return cls;
+ };
+
+ %newobject perm_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *perm_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_constraint_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject expr_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_constraint_expr_node_from_void) %}
+ qpol_iterator_t *expr_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_constraint_get_expr_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_constraint_t *qpol_constraint_from_void(void *x) {
+ return (qpol_constraint_t*)x;
+ };
+%}
+
+/* qpol validatetrans */
+typedef struct qpol_validatetrans {} qpol_validatetrans_t;
+%extend qpol_validatetrans {
+ qpol_validatetrans() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_validatetrans_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_validatetrans() {
+ free(self);
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_validatetrans_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for validatetrans");
+ }
+ fail:
+ return cls;
+ };
+ %newobject expr_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_constraint_expr_node_from_void) %}
+ qpol_iterator_t *expr_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_validatetrans_get_expr_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_validatetrans_t *qpol_validatetrans_from_void(void *x) {
+ return (qpol_validatetrans_t*)x;
+ };
+%}
+
+/* qpol constraint expression node */
+/* expr_type values */
+#define QPOL_CEXPR_TYPE_NOT 1
+#define QPOL_CEXPR_TYPE_AND 2
+#define QPOL_CEXPR_TYPE_OR 3
+#define QPOL_CEXPR_TYPE_ATTR 4
+#define QPOL_CEXPR_TYPE_NAMES 5
+/* symbol type values */
+#define QPOL_CEXPR_SYM_USER 1
+#define QPOL_CEXPR_SYM_ROLE 2
+#define QPOL_CEXPR_SYM_TYPE 4
+#define QPOL_CEXPR_SYM_TARGET 8
+#define QPOL_CEXPR_SYM_XTARGET 16
+#define QPOL_CEXPR_SYM_L1L2 32
+#define QPOL_CEXPR_SYM_L1H2 64
+#define QPOL_CEXPR_SYM_H1L2 128
+#define QPOL_CEXPR_SYM_H1H2 256
+#define QPOL_CEXPR_SYM_L1H1 512
+#define QPOL_CEXPR_SYM_L2H2 1024
+/* op values */
+#define QPOL_CEXPR_OP_EQ 1
+#define QPOL_CEXPR_OP_NEQ 2
+#define QPOL_CEXPR_OP_DOM 3
+#define QPOL_CEXPR_OP_DOMBY 4
+#define QPOL_CEXPR_OP_INCOMP 5
+typedef struct qpol_constraint_expr_node {} qpol_constraint_expr_node_t;
+%extend qpol_constraint_expr_node {
+ qpol_constraint_expr_node() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_constraint_expr_node_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_constraint_expr_node() {
+ /* no op */
+ return;
+ };
+ int expr_type(qpol_policy_t *p) {
+ uint32_t et;
+ if (qpol_constraint_expr_node_get_expr_type(p, self, &et)) {
+ SWIG_exception(SWIG_ValueError, "Could not get expression type for node");
+ }
+ fail:
+ return (int) et;
+ };
+ int sym_type(qpol_policy_t *p) {
+ uint32_t st;
+ if (qpol_constraint_expr_node_get_sym_type(p, self, &st)) {
+ SWIG_exception(SWIG_ValueError, "Could not get symbol type for node");
+ }
+ fail:
+ return (int) st;
+ };
+ int op(qpol_policy_t *p) {
+ uint32_t op;
+ if (qpol_constraint_expr_node_get_op(p, self, &op)) {
+ SWIG_exception(SWIG_ValueError, "Could not get operator for node");
+ }
+ fail:
+ return (int) op;
+ };
+ %newobject names_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *names_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_constraint_expr_node_get_names_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_constraint_expr_node_t *qpol_constraint_expr_node_from_void(void *x) {
+ return (qpol_constraint_expr_node_t*)x;
+ };
+%}
+
+/* qpol role allow */
+typedef struct qpol_role_allow {} qpol_role_allow_t;
+%extend qpol_role_allow {
+ qpol_role_allow() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_role_allow_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_role_allow() {
+ /* no op */
+ return;
+ };
+ %pythoncode %{
+ def rule_type(self,policy):
+ return "allow"
+ %}
+ const qpol_role_t *source_role(qpol_policy_t *p) {
+ const qpol_role_t *r;
+ if (qpol_role_allow_get_source_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for role allow rule");
+ }
+ fail:
+ return r;
+ };
+ const qpol_role_t *target_role(qpol_policy_t *p) {
+ const qpol_role_t *r;
+ if (qpol_role_allow_get_target_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for role allow rule");
+ }
+ fail:
+ return r;
+ };
+};
+%inline %{
+ qpol_role_allow_t *qpol_role_allow_from_void(void *x) {
+ return (qpol_role_allow_t*)x;
+ };
+%}
+
+/* qpol role trans */
+typedef struct qpol_role_trans {} qpol_role_trans_t;
+%extend qpol_role_trans {
+ qpol_role_trans() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_role_trans_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_role_trans() {
+ /* no op */
+ return;
+ };
+ %pythoncode %{
+ def rule_type(self,policy):
+ return "role_transition"
+ %}
+ const qpol_role_t *source_role(qpol_policy_t *p) {
+ const qpol_role_t *r;
+ if (qpol_role_trans_get_source_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for role_transition rule");
+ }
+ fail:
+ return r;
+ };
+ const qpol_type_t *target_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_role_trans_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for role_transition rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *c;
+ if (qpol_role_trans_get_object_class(p, self, &c)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for role_transition rule");
+ }
+ fail:
+ return c;
+ };
+ const qpol_role_t *default_role(qpol_policy_t *p) {
+ const qpol_role_t *r;
+ if (qpol_role_trans_get_default_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get default for role_transition rule");
+ }
+ fail:
+ return r;
+ };
+};
+%inline %{
+ qpol_role_trans_t *qpol_role_trans_from_void(void *x) {
+ return (qpol_role_trans_t*)x;
+ };
+%}
+
+/* qpol range trans */
+typedef struct qpol_range_trans {} qpol_range_trans_t;
+%extend qpol_range_trans {
+ qpol_range_trans() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_range_trans_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_range_trans() {
+ /* no op */
+ return;
+ };
+ %pythoncode %{
+ def rule_type(self,policy):
+ return "range_transition"
+ %}
+
+ const qpol_type_t *source_type (qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_range_trans_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for range_transition rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_type_t *target_type (qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_range_trans_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for range_transition rule"); }
+ fail:
+ return t;
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_range_trans_get_target_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for range_transition rule"); }
+ fail:
+ return cls;
+ };
+ const qpol_mls_range_t *range(qpol_policy_t *p) {
+ const qpol_mls_range_t *r;
+ if (qpol_range_trans_get_range(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range for range_transition rule");
+ }
+ fail:
+ return r;
+ };
+};
+%inline %{
+ qpol_range_trans_t *qpol_range_trans_from_void(void *x) {
+ return (qpol_range_trans_t*)x;
+ };
+%}
+
+/* qpol av rule */
+#define QPOL_RULE_ALLOW 0x0001
+#define QPOL_RULE_NEVERALLOW 0x0080
+#define QPOL_RULE_AUDITALLOW 0x0002
+#define QPOL_RULE_DONTAUDIT 0x0004
+#define QPOL_RULE_XPERMS_ALLOW 0x0100
+#define QPOL_RULE_XPERMS_AUDITALLOW 0x0200
+#define QPOL_RULE_XPERMS_DONTAUDIT 0x0400
+#define QPOL_RULE_XPERMS_NEVERALLOW 0x0800
+typedef struct qpol_avrule {} qpol_avrule_t;
+%extend qpol_avrule {
+ qpol_avrule() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_avrule_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_avrule() {
+ /* no op */
+ return;
+ };
+ const char * rule_type(qpol_policy_t *p) {
+ uint32_t rt;
+ if (qpol_avrule_get_rule_type(p, self, &rt)) {
+ SWIG_exception(SWIG_ValueError, "Could not get rule type for av rule");
+ }
+ switch (rt) {
+ case QPOL_RULE_ALLOW: return "allow"; break;
+ case QPOL_RULE_NEVERALLOW: return "neverallow"; break;
+ case QPOL_RULE_AUDITALLOW: return "auditallow"; break;
+ case QPOL_RULE_DONTAUDIT: return "dontaudit"; break;
+ case QPOL_RULE_XPERMS_ALLOW: return "allowxperm"; break;
+ case QPOL_RULE_XPERMS_NEVERALLOW: return "neverallowxperm"; break;
+ case QPOL_RULE_XPERMS_AUDITALLOW: return "auditallowxperm"; break;
+ case QPOL_RULE_XPERMS_DONTAUDIT: return "dontauditxperm"; break;
+ }
+ fail:
+ return NULL;
+ };
+ const qpol_type_t *source_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_avrule_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for av rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_type_t *target_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_avrule_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for av rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_avrule_get_object_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for av rule");
+ }
+ fail:
+ return cls;
+ };
+
+ %newobject perm_iter(qpol_policy_t *p);
+ %pythoncode %{ @QpolGenerator(_qpol.to_str) %}
+ qpol_iterator_t *perm_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_avrule_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+
+ /* TODO, do I need an exception (similar to cond) that is thrown if you ask this on a non extended avrule? Likewise for asking for prems an an extended rule */
+ %newobject xperm_iter(qpol_policy_t *p);
+ %pythoncode %{ @QpolGenerator(_qpol.to_int_with_free) %}
+ qpol_iterator_t *xperm_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_avrule_get_xperm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+ int is_extended(qpol_policy_t *p) {
+ uint32_t e;
+ if (qpol_avrule_get_is_extended(p, self, &e)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine if av rule is extended");
+ }
+ fail:
+ return (int) e;
+ };
+ const char * xperm_type(qpol_policy_t *p) {
+ char *xt;
+ if (qpol_avrule_get_xperm_type(p, self, &xt)) {
+ SWIG_exception(SWIG_ValueError, "Could not get xperm type for av rule");
+ }
+ fail:
+ return xt;
+ };
+
+ %exception cond {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ const qpol_cond_t *cond(qpol_policy_t *p) {
+ const qpol_cond_t *c;
+ qpol_avrule_get_cond(p, self, &c);
+ return c;
+ };
+ int is_enabled(qpol_policy_t *p) {
+ uint32_t e;
+ if (qpol_avrule_get_is_enabled(p, self, &e)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine if av rule is enabled");
+ }
+ fail:
+ return (int) e;
+ };
+
+ %exception which_list {
+ $action
+ if (result < 0) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ int which_list(qpol_policy_t *p) {
+ const qpol_cond_t *c;
+ uint32_t which = 0;
+ qpol_avrule_get_cond(p, self, &c);
+ if (c == NULL) {
+ return -1;
+ } else if (qpol_avrule_get_which_list(p, self, &which)) {
+ return -1;
+ }
+ return (int) which;
+ };
+ %newobject syn_avrule_iter(qpol_policy_t*);
+ qpol_iterator_t *syn_avrule_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_avrule_get_syn_avrule_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_avrule_t *qpol_avrule_from_void(void *x) {
+ return (qpol_avrule_t*)x;
+ };
+%}
+
+/* qpol te rule */
+#define QPOL_RULE_TYPE_TRANS 16
+#define QPOL_RULE_TYPE_CHANGE 64
+#define QPOL_RULE_TYPE_MEMBER 32
+typedef struct qpol_terule {} qpol_terule_t;
+%extend qpol_terule {
+ qpol_terule() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_terule_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_terule() {
+ /* no op */
+ return;
+ };
+ const char * rule_type(qpol_policy_t *p) {
+ uint32_t rt;
+ if (qpol_terule_get_rule_type(p, self, &rt)) {
+ SWIG_exception(SWIG_ValueError, "Could not get rule type for te rule");
+ }
+ switch (rt) {
+ case QPOL_RULE_TYPE_TRANS: return "type_transition"; break;
+ case QPOL_RULE_TYPE_CHANGE: return "type_change"; break;
+ case QPOL_RULE_TYPE_MEMBER: return "type_member"; break;
+ }
+ fail:
+ return NULL;
+ };
+ const qpol_type_t *source_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_terule_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for te rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_type_t *target_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_terule_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for te rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_terule_get_object_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for te rule");
+ }
+ fail:
+ return cls;
+ };
+ const qpol_type_t *default_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_terule_get_default_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get default for te rule");
+ }
+ fail:
+ return t;
+ };
+
+ %exception cond {
+ $action
+ if (!result) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ const qpol_cond_t *cond(qpol_policy_t *p) {
+ const qpol_cond_t *c;
+ qpol_terule_get_cond(p, self, &c);
+ return c;
+ };
+ int is_enabled(qpol_policy_t *p) {
+ uint32_t e;
+ if (qpol_terule_get_is_enabled(p, self, &e)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine if te rule is enabled");
+ }
+ fail:
+ return (int) e;
+ };
+
+ %exception which_list {
+ $action
+ if (result < 0) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ int which_list(qpol_policy_t *p) {
+ const qpol_cond_t *c;
+ uint32_t which = 0;
+ qpol_terule_get_cond(p, self, &c);
+ if (c == NULL) {
+ return -1;
+ } else if (qpol_terule_get_which_list(p, self, &which)) {
+ return -1;
+ }
+ return (int) which;
+ };
+
+ %newobject syn_terule_iter(qpol_policy_t*);
+ qpol_iterator_t *syn_terule_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_terule_get_syn_terule_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+};
+%inline %{
+ qpol_terule_t *qpol_terule_from_void(void *x) {
+ return (qpol_terule_t*)x;
+ };
+%}
+
+/* qpol conditional */
+typedef struct qpol_cond {} qpol_cond_t;
+%extend qpol_cond {
+ qpol_cond() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_cond_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_cond() {
+ /* no op */
+ return;
+ };
+
+ %newobject expr_node_iter(qpol_policy_t*);
+ %pythoncode %{ @QpolGenerator(_qpol.qpol_cond_expr_node_from_void) %}
+ qpol_iterator_t *expr_node_iter(qpol_policy_t *p) {
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_expr_node_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+
+ %newobject av_true_iter(qpol_policy_t*, int);
+ qpol_iterator_t *av_true_iter(qpol_policy_t *p, int rule_types) {
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_av_true_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+ %newobject av_false_iter(qpol_policy_t*, int);
+ qpol_iterator_t *av_false_iter(qpol_policy_t *p, int rule_types) {
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_av_false_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+ %newobject te_true_iter(qpol_policy_t*, int);
+ qpol_iterator_t *te_true_iter(qpol_policy_t *p, int rule_types) {
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_te_true_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+ %newobject te_false_iter(qpol_policy_t*, int);
+ qpol_iterator_t *te_false_iter(qpol_policy_t *p, int rule_types) {
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_te_false_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ };
+ int evaluate(qpol_policy_t *p) {
+ uint32_t e;
+ if (qpol_cond_eval(p, self, &e)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not evaluate conditional");
+ }
+ fail:
+ return (int) e;
+ };
+};
+%inline %{
+ qpol_cond_t *qpol_cond_from_void(void *x) {
+ return (qpol_cond_t*)x;
+ };
+%}
+
+/* qpol conditional expression node */
+#define QPOL_COND_EXPR_BOOL 1 /* plain bool */
+#define QPOL_COND_EXPR_NOT 2 /* !bool */
+#define QPOL_COND_EXPR_OR 3 /* bool || bool */
+#define QPOL_COND_EXPR_AND 4 /* bool && bool */
+#define QPOL_COND_EXPR_XOR 5 /* bool ^ bool */
+#define QPOL_COND_EXPR_EQ 6 /* bool == bool */
+#define QPOL_COND_EXPR_NEQ 7 /* bool != bool */
+typedef struct qpol_cond_expr_node {} qpol_cond_expr_node_t;
+%extend qpol_cond_expr_node {
+ qpol_cond_expr_node() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_cond_expr_node_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_cond_expr_node() {
+ /* no op */
+ return;
+ };
+ int expr_type(qpol_policy_t *p) {
+ uint32_t et;
+ if (qpol_cond_expr_node_get_expr_type(p, self, &et)) {
+ SWIG_exception(SWIG_ValueError, "Could not get node expression type");
+ }
+ fail:
+ return (int) et;
+ };
+ qpol_bool_t *get_boolean(qpol_policy_t *p) {
+ uint32_t et;
+ qpol_bool_t *b = NULL;
+ qpol_cond_expr_node_get_expr_type(p, self, &et);
+ if (et != QPOL_COND_EXPR_BOOL) {
+ SWIG_exception(SWIG_TypeError, "Node does not contain a boolean");
+ } else if (qpol_cond_expr_node_get_bool(p, self, &b)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean for node");
+ }
+ fail:
+ return b;
+ };
+};
+%inline %{
+ qpol_cond_expr_node_t *qpol_cond_expr_node_from_void(void *x) {
+ return (qpol_cond_expr_node_t*)x;
+ };
+%}
+
+/* qpol filename trans */
+typedef struct qpol_filename_trans {} qpol_filename_trans_t;
+%extend qpol_filename_trans {
+ qpol_filename_trans() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_filename_trans_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_filename_trans() {
+ /* no op */
+ return;
+ };
+ %pythoncode %{
+ def rule_type(self,policy):
+ return "type_transition"
+ %}
+
+ const qpol_type_t *source_type (qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_filename_trans_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for filename transition rule");
+ }
+ fail:
+ return t;
+ };
+ const qpol_type_t *target_type (qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_filename_trans_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for filename transition rule"); }
+ fail:
+ return t;
+ };
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_filename_trans_get_object_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for filename transition rule"); }
+ fail:
+ return cls;
+ };
+ const qpol_type_t *default_type(qpol_policy_t *p) {
+ const qpol_type_t *t;
+ if (qpol_filename_trans_get_default_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get default for filename transition rule");
+ }
+ fail:
+ return t;
+ };
+ const char *filename(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_filename_trans_get_filename(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file for filename transition rule");
+ }
+ fail:
+ return name;
+ };
+
+};
+%inline %{
+ qpol_filename_trans_t *qpol_filename_trans_from_void(void *x) {
+ return (qpol_filename_trans_t*)x;
+ };
+%}
+
+/* qpol polcap */
+typedef struct qpol_polcap {} qpol_polcap_t;
+%extend qpol_polcap {
+ qpol_polcap() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_polcap_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_polcap() {
+ /* no op */
+ return;
+ };
+ const char *name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_polcap_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get polcap name rule");
+ }
+ fail:
+ return name;
+ };
+
+};
+%inline %{
+ qpol_polcap_t *qpol_polcap_from_void(void *x) {
+ return (qpol_polcap_t*)x;
+ };
+%}
+
+/* qpol typebounds */
+typedef struct qpol_typebounds {} qpol_typebounds_t;
+%extend qpol_typebounds {
+ qpol_typebounds() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_typebounds_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_typebounds() {
+ /* no op */
+ return;
+ };
+ const char *parent_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_typebounds_get_parent_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get parent name");
+ }
+ fail:
+ return name;
+ };
+ const char *child_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_typebounds_get_child_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get child name");
+ }
+ fail:
+ return name;
+ };
+};
+%inline %{
+ qpol_typebounds_t *qpol_typebounds_from_void(void *x) {
+ return (qpol_typebounds_t*)x;
+ };
+%}
+
+/* qpol rolebounds */
+typedef struct qpol_rolebounds {} qpol_rolebounds_t;
+%extend qpol_rolebounds {
+ qpol_rolebounds() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_rolebounds_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_rolebounds() {
+ /* no op */
+ return;
+ };
+ const char *parent_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_rolebounds_get_parent_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get parent name");
+ }
+ fail:
+ return name;
+ };
+ const char *child_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_rolebounds_get_child_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get child name");
+ }
+ fail:
+ return name;
+ };
+};
+%inline %{
+ qpol_rolebounds_t *qpol_rolebounds_from_void(void *x) {
+ return (qpol_rolebounds_t*)x;
+ };
+%}
+
+/* qpol userbounds */
+typedef struct qpol_userbounds {} qpol_userbounds_t;
+%extend qpol_userbounds {
+ qpol_userbounds() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_userbounds_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_userbounds() {
+ /* no op */
+ return;
+ };
+ const char *parent_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_userbounds_get_parent_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get parent name");
+ }
+ fail:
+ return name;
+ };
+ const char *child_name(qpol_policy_t *p) {
+ const char *name;
+ if (qpol_userbounds_get_child_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get child name");
+ }
+ fail:
+ return name;
+ };
+};
+%inline %{
+ qpol_userbounds_t *qpol_userbounds_from_void(void *x) {
+ return (qpol_userbounds_t*)x;
+ };
+%}
+
+/* qpol default_object */
+typedef struct qpol_default_object {} qpol_default_object_t;
+%extend qpol_default_object {
+ qpol_default_object() {
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_default_object_t objects");
+ fail:
+ return NULL;
+ };
+ ~qpol_default_object() {
+ /* no op */
+ return;
+ };
+
+ %newobject object_class();
+ const qpol_class_t *object_class(qpol_policy_t *p) {
+ const qpol_class_t *cls;
+ if (qpol_default_object_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class");
+ }
+ fail:
+ return cls;
+ };
+
+ const char *user_default(qpol_policy_t *p) {
+ const char *value;
+ if (qpol_default_object_get_user_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user default");
+ }
+ fail:
+ return value;
+ };
+ const char *role_default(qpol_policy_t *p) {
+ const char *value;
+ if (qpol_default_object_get_role_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role default");
+ }
+ fail:
+ return value;
+ };
+ const char *type_default(qpol_policy_t *p) {
+ const char *value;
+ if (qpol_default_object_get_type_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type default");
+ }
+ fail:
+ return value;
+ };
+ const char *range_default(qpol_policy_t *p) {
+ const char *value;
+ if (qpol_default_object_get_range_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range defaults");
+ }
+ fail:
+ return value;
+ };
+};
+%inline %{
+ qpol_default_object_t *qpol_default_object_from_void(void *x) {
+ return (qpol_default_object_t*)x;
+ };
+%}
+
+/* qpol iomemcon */
+typedef struct qpol_iomemcon {} qpol_iomemcon_t;
+%extend qpol_iomemcon {
+ qpol_iomemcon(qpol_policy_t *p, uint64_t low, uint64_t high) {
+ const qpol_iomemcon_t *qp;
+ if (qpol_policy_get_iomemcon_by_addr(p, low, high, &qp)) {
+ SWIG_exception(SWIG_RuntimeError, "iomemcon statement does not exist");
+ }
+ fail:
+ return (qpol_iomemcon_t*)qp;
+ };
+ ~qpol_iomemcon() {
+ /* no op */
+ return;
+ };
+ uint64_t low_addr(qpol_policy_t *p) {
+ uint64_t addr = 0;
+ if(qpol_iomemcon_get_low_addr(p, self, &addr)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get low addr for iomemcon statement");
+ }
+ fail:
+ return addr;
+ };
+ uint64_t high_addr(qpol_policy_t *p) {
+ uint64_t addr = 0;
+ if(qpol_iomemcon_get_high_addr(p, self, &addr)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get high addr for iomemcon statement");
+ }
+ fail:
+ return addr;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_iomemcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for iomemcon statement");
+ }
+ fail:
+ return ctx;
+ };
+}
+%inline %{
+ qpol_iomemcon_t *qpol_iomemcon_from_void(void *x) {
+ return (qpol_iomemcon_t*)x;
+ };
+%}
+
+/* qpol ioportcon */
+typedef struct qpol_ioportcon {} qpol_ioportcon_t;
+%extend qpol_ioportcon {
+ qpol_ioportcon(qpol_policy_t *p, uint32_t low, uint32_t high) {
+ const qpol_ioportcon_t *qp;
+ if (qpol_policy_get_ioportcon_by_port(p, low, high, &qp)) {
+ SWIG_exception(SWIG_RuntimeError, "ioportcon statement does not exist");
+ }
+ fail:
+ return (qpol_ioportcon_t*)qp;
+ };
+ ~qpol_ioportcon() {
+ /* no op */
+ return;
+ };
+ uint32_t low_port(qpol_policy_t *p) {
+ uint32_t port = 0;
+ if(qpol_ioportcon_get_low_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get low port for ioportcon statement");
+ }
+ fail:
+ return port;
+ };
+ uint32_t high_port(qpol_policy_t *p) {
+ uint32_t port = 0;
+ if(qpol_ioportcon_get_high_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get high port for ioportcon statement");
+ }
+ fail:
+ return port;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_ioportcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for ioportcon statement");
+ }
+ fail:
+ return ctx;
+ };
+}
+%inline %{
+ qpol_ioportcon_t *qpol_ioportcon_from_void(void *x) {
+ return (qpol_ioportcon_t*)x;
+ };
+%}
+
+/* qpol pcidevicecon */
+typedef struct qpol_pcidevicecon {} qpol_pcidevicecon_t;
+%extend qpol_pcidevicecon {
+ qpol_pcidevicecon() {
+ SWIG_exception(SWIG_RuntimeError, "pcidevicecon statement does not exist");
+ fail:
+ return NULL;
+ };
+ ~qpol_pcidevicecon() {
+ return;
+ };
+ uint32_t device(qpol_policy_t *p) {
+ uint32_t device = 0;
+ if(qpol_pcidevicecon_get_device(p, self, &device)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get device for pcidevicecon statement");
+ }
+ fail:
+ return device;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_pcidevicecon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for pcidevicecon statement");
+ }
+ fail:
+ return ctx;
+ };
+}
+%inline %{
+ qpol_pcidevicecon_t *qpol_pcidevicecon_from_void(void *x) {
+ return (qpol_pcidevicecon_t*)x;
+ };
+%}
+
+/* qpol pirqcon */
+typedef struct qpol_pirqcon {} qpol_pirqcon_t;
+%extend qpol_pirqcon {
+ qpol_pirqcon() {
+ SWIG_exception(SWIG_RuntimeError, "pirqcon statement does not exist");
+ fail:
+ return NULL;
+ };
+ ~qpol_pirqcon() {
+ return;
+ };
+ uint32_t irq(qpol_policy_t *p) {
+ uint16_t irq = 0;
+ if(qpol_pirqcon_get_irq(p, self, &irq)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get irq for pirqcon statement");
+ }
+ fail:
+ return irq;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_pirqcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for pirqcon statement");
+ }
+ fail:
+ return ctx;
+ };
+}
+%inline %{
+ qpol_pirqcon_t *qpol_pirqcon_from_void(void *x) {
+ return (qpol_pirqcon_t*)x;
+ };
+%}
+
+/* qpol devicetreecon */
+typedef struct qpol_devicetreecon {} qpol_devicetreecon_t;
+%extend qpol_devicetreecon {
+ qpol_devicetreecon() {
+
+ SWIG_exception(SWIG_RuntimeError, "devicetreecon statement does not exist");
+
+ fail:
+ return NULL;
+ };
+ char *path(qpol_policy_t *p) {
+ char *path = NULL;
+ if(qpol_devicetreecon_get_path(p, self, &path)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get path for devicetreecon statement");
+ }
+ fail:
+ return path;
+ };
+ const qpol_context_t *context(qpol_policy_t *p) {
+ const qpol_context_t *ctx;
+ if (qpol_devicetreecon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for devicetreecon statement");
+ }
+ fail:
+ return ctx;
+ };
+}
+%inline %{
+ qpol_devicetreecon_t *qpol_devicetreecon_from_void(void *x) {
+ return (qpol_devicetreecon_t*)x;
+ };
+%}
+
diff --git a/lib/python2.7/site-packages/setools/policyrep/qpol.py b/lib/python2.7/site-packages/setools/policyrep/qpol.py
index 97e602b..d190a41 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/qpol.py
+++ b/lib/python2.7/site-packages/setools/policyrep/qpol.py
@@ -73,6 +73,10 @@ except AttributeError:
def to_str(*args):
return _qpol.to_str(*args)
to_str = _qpol.to_str
+
+def to_int_with_free(*args):
+ return _qpol.to_int_with_free(*args)
+to_int_with_free = _qpol.to_int_with_free
import logging
from functools import wraps
@@ -105,7 +109,7 @@ def QpolGenerator(cast):
def qpol_logger(level, msg):
"""Log qpol messages via Python logging."""
- logging.getLogger("libqpol").debug(msg)
+ logging.getLogger(__name__).debug(msg)
def qpol_policy_factory(path):
"""Factory function for qpol policy objects."""
@@ -132,6 +136,7 @@ class qpol_policy_t(_object):
__del__ = lambda self : None;
def version(self): return _qpol.qpol_policy_t_version(self)
def handle_unknown(self): return _qpol.qpol_policy_t_handle_unknown(self)
+ def target_platform(self): return _qpol.qpol_policy_t_target_platform(self)
def capability(self, *args): return _qpol.qpol_policy_t_capability(self, *args)
@QpolGenerator(_qpol.qpol_type_from_void)
def type_iter(self): return _qpol.qpol_policy_t_type_iter(self)
@@ -196,6 +201,12 @@ class qpol_policy_t(_object):
def avrule_auditallow_count(self): return _qpol.qpol_policy_t_avrule_auditallow_count(self)
def avrule_neverallow_count(self): return _qpol.qpol_policy_t_avrule_neverallow_count(self)
def avrule_dontaudit_count(self): return _qpol.qpol_policy_t_avrule_dontaudit_count(self)
+ @QpolGenerator(_qpol.qpol_avrule_from_void)
+ def avrulex_iter(self): return _qpol.qpol_policy_t_avrulex_iter(self)
+ def avrule_allowx_count(self): return _qpol.qpol_policy_t_avrule_allowx_count(self)
+ def avrule_auditallowx_count(self): return _qpol.qpol_policy_t_avrule_auditallowx_count(self)
+ def avrule_neverallowx_count(self): return _qpol.qpol_policy_t_avrule_neverallowx_count(self)
+ def avrule_dontauditx_count(self): return _qpol.qpol_policy_t_avrule_dontauditx_count(self)
@QpolGenerator(_qpol.qpol_terule_from_void)
def terule_iter(self): return _qpol.qpol_policy_t_terule_iter(self)
def terule_trans_count(self): return _qpol.qpol_policy_t_terule_trans_count(self)
@@ -209,13 +220,28 @@ class qpol_policy_t(_object):
@QpolGenerator(_qpol.qpol_type_from_void)
def permissive_iter(self): return _qpol.qpol_policy_t_permissive_iter(self)
def permissive_count(self): return _qpol.qpol_policy_t_permissive_count(self)
+ @QpolGenerator(_qpol.qpol_typebounds_from_void)
def typebounds_iter(self): return _qpol.qpol_policy_t_typebounds_iter(self)
- def typebounds_count(self): return _qpol.qpol_policy_t_typebounds_count(self)
@QpolGenerator(_qpol.qpol_polcap_from_void)
def polcap_iter(self): return _qpol.qpol_policy_t_polcap_iter(self)
def polcap_count(self): return _qpol.qpol_policy_t_polcap_count(self)
@QpolGenerator(_qpol.qpol_default_object_from_void)
def default_iter(self): return _qpol.qpol_policy_t_default_iter(self)
+ @QpolGenerator(_qpol.qpol_iomemcon_from_void)
+ def iomemcon_iter(self): return _qpol.qpol_policy_t_iomemcon_iter(self)
+ def iomemcon_count(self): return _qpol.qpol_policy_t_iomemcon_count(self)
+ @QpolGenerator(_qpol.qpol_ioportcon_from_void)
+ def ioportcon_iter(self): return _qpol.qpol_policy_t_ioportcon_iter(self)
+ def ioportcon_count(self): return _qpol.qpol_policy_t_ioportcon_count(self)
+ @QpolGenerator(_qpol.qpol_pcidevicecon_from_void)
+ def pcidevicecon_iter(self): return _qpol.qpol_policy_t_pcidevicecon_iter(self)
+ def pcidevicecon_count(self): return _qpol.qpol_policy_t_pcidevicecon_count(self)
+ @QpolGenerator(_qpol.qpol_pirqcon_from_void)
+ def pirqcon_iter(self): return _qpol.qpol_policy_t_pirqcon_iter(self)
+ def pirqcon_count(self): return _qpol.qpol_policy_t_pirqcon_count(self)
+ @QpolGenerator(_qpol.qpol_devicetreecon_from_void)
+ def devicetreecon_iter(self): return _qpol.qpol_policy_t_devicetreecon_iter(self)
+ def devicetreecon_count(self): return _qpol.qpol_policy_t_devicetreecon_count(self)
qpol_policy_t_swigregister = _qpol.qpol_policy_t_swigregister
qpol_policy_t_swigregister(qpol_policy_t)
@@ -235,6 +261,7 @@ QPOL_CAP_DEFAULT_TYPE = _qpol.QPOL_CAP_DEFAULT_TYPE
QPOL_CAP_PERMISSIVE = _qpol.QPOL_CAP_PERMISSIVE
QPOL_CAP_FILENAME_TRANS = _qpol.QPOL_CAP_FILENAME_TRANS
QPOL_CAP_ROLETRANS = _qpol.QPOL_CAP_ROLETRANS
+QPOL_CAP_XPERM_IOCTL = _qpol.QPOL_CAP_XPERM_IOCTL
class qpol_iterator_t(_object):
__swig_setmethods__ = {}
__setattr__ = lambda self, name, value: _swig_setattr(self, qpol_iterator_t, name, value)
@@ -861,6 +888,10 @@ QPOL_RULE_ALLOW = _qpol.QPOL_RULE_ALLOW
QPOL_RULE_NEVERALLOW = _qpol.QPOL_RULE_NEVERALLOW
QPOL_RULE_AUDITALLOW = _qpol.QPOL_RULE_AUDITALLOW
QPOL_RULE_DONTAUDIT = _qpol.QPOL_RULE_DONTAUDIT
+QPOL_RULE_XPERMS_ALLOW = _qpol.QPOL_RULE_XPERMS_ALLOW
+QPOL_RULE_XPERMS_AUDITALLOW = _qpol.QPOL_RULE_XPERMS_AUDITALLOW
+QPOL_RULE_XPERMS_DONTAUDIT = _qpol.QPOL_RULE_XPERMS_DONTAUDIT
+QPOL_RULE_XPERMS_NEVERALLOW = _qpol.QPOL_RULE_XPERMS_NEVERALLOW
class qpol_avrule_t(_object):
__swig_setmethods__ = {}
__setattr__ = lambda self, name, value: _swig_setattr(self, qpol_avrule_t, name, value)
@@ -879,6 +910,10 @@ class qpol_avrule_t(_object):
def object_class(self, *args): return _qpol.qpol_avrule_t_object_class(self, *args)
@QpolGenerator(_qpol.to_str)
def perm_iter(self, *args): return _qpol.qpol_avrule_t_perm_iter(self, *args)
+ @QpolGenerator(_qpol.to_int_with_free)
+ def xperm_iter(self, *args): return _qpol.qpol_avrule_t_xperm_iter(self, *args)
+ def is_extended(self, *args): return _qpol.qpol_avrule_t_is_extended(self, *args)
+ def xperm_type(self, *args): return _qpol.qpol_avrule_t_xperm_type(self, *args)
def cond(self, *args): return _qpol.qpol_avrule_t_cond(self, *args)
def is_enabled(self, *args): return _qpol.qpol_avrule_t_is_enabled(self, *args)
def which_list(self, *args): return _qpol.qpol_avrule_t_which_list(self, *args)
@@ -1109,6 +1144,113 @@ qpol_default_object_t_swigregister(qpol_default_object_t)
def qpol_default_object_from_void(*args):
return _qpol.qpol_default_object_from_void(*args)
qpol_default_object_from_void = _qpol.qpol_default_object_from_void
+class qpol_iomemcon_t(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, qpol_iomemcon_t, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, qpol_iomemcon_t, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _qpol.new_qpol_iomemcon_t(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _qpol.delete_qpol_iomemcon_t
+ __del__ = lambda self : None;
+ def low_addr(self, *args): return _qpol.qpol_iomemcon_t_low_addr(self, *args)
+ def high_addr(self, *args): return _qpol.qpol_iomemcon_t_high_addr(self, *args)
+ def context(self, *args): return _qpol.qpol_iomemcon_t_context(self, *args)
+qpol_iomemcon_t_swigregister = _qpol.qpol_iomemcon_t_swigregister
+qpol_iomemcon_t_swigregister(qpol_iomemcon_t)
+
+
+def qpol_iomemcon_from_void(*args):
+ return _qpol.qpol_iomemcon_from_void(*args)
+qpol_iomemcon_from_void = _qpol.qpol_iomemcon_from_void
+class qpol_ioportcon_t(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, qpol_ioportcon_t, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, qpol_ioportcon_t, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _qpol.new_qpol_ioportcon_t(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _qpol.delete_qpol_ioportcon_t
+ __del__ = lambda self : None;
+ def low_port(self, *args): return _qpol.qpol_ioportcon_t_low_port(self, *args)
+ def high_port(self, *args): return _qpol.qpol_ioportcon_t_high_port(self, *args)
+ def context(self, *args): return _qpol.qpol_ioportcon_t_context(self, *args)
+qpol_ioportcon_t_swigregister = _qpol.qpol_ioportcon_t_swigregister
+qpol_ioportcon_t_swigregister(qpol_ioportcon_t)
+
+
+def qpol_ioportcon_from_void(*args):
+ return _qpol.qpol_ioportcon_from_void(*args)
+qpol_ioportcon_from_void = _qpol.qpol_ioportcon_from_void
+class qpol_pcidevicecon_t(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, qpol_pcidevicecon_t, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, qpol_pcidevicecon_t, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _qpol.new_qpol_pcidevicecon_t()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _qpol.delete_qpol_pcidevicecon_t
+ __del__ = lambda self : None;
+ def device(self, *args): return _qpol.qpol_pcidevicecon_t_device(self, *args)
+ def context(self, *args): return _qpol.qpol_pcidevicecon_t_context(self, *args)
+qpol_pcidevicecon_t_swigregister = _qpol.qpol_pcidevicecon_t_swigregister
+qpol_pcidevicecon_t_swigregister(qpol_pcidevicecon_t)
+
+
+def qpol_pcidevicecon_from_void(*args):
+ return _qpol.qpol_pcidevicecon_from_void(*args)
+qpol_pcidevicecon_from_void = _qpol.qpol_pcidevicecon_from_void
+class qpol_pirqcon_t(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, qpol_pirqcon_t, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, qpol_pirqcon_t, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _qpol.new_qpol_pirqcon_t()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _qpol.delete_qpol_pirqcon_t
+ __del__ = lambda self : None;
+ def irq(self, *args): return _qpol.qpol_pirqcon_t_irq(self, *args)
+ def context(self, *args): return _qpol.qpol_pirqcon_t_context(self, *args)
+qpol_pirqcon_t_swigregister = _qpol.qpol_pirqcon_t_swigregister
+qpol_pirqcon_t_swigregister(qpol_pirqcon_t)
+
+
+def qpol_pirqcon_from_void(*args):
+ return _qpol.qpol_pirqcon_from_void(*args)
+qpol_pirqcon_from_void = _qpol.qpol_pirqcon_from_void
+class qpol_devicetreecon_t(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, qpol_devicetreecon_t, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, qpol_devicetreecon_t, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _qpol.new_qpol_devicetreecon_t()
+ try: self.this.append(this)
+ except: self.this = this
+ def path(self, *args): return _qpol.qpol_devicetreecon_t_path(self, *args)
+ def context(self, *args): return _qpol.qpol_devicetreecon_t_context(self, *args)
+ __swig_destroy__ = _qpol.delete_qpol_devicetreecon_t
+ __del__ = lambda self : None;
+qpol_devicetreecon_t_swigregister = _qpol.qpol_devicetreecon_t_swigregister
+qpol_devicetreecon_t_swigregister(qpol_devicetreecon_t)
+
+
+def qpol_devicetreecon_from_void(*args):
+ return _qpol.qpol_devicetreecon_from_void(*args)
+qpol_devicetreecon_from_void = _qpol.qpol_devicetreecon_from_void
# This file is compatible with both classic and new-style classes.
diff --git a/lib/python2.7/site-packages/setools/policyrep/qpol_wrap.c b/lib/python2.7/site-packages/setools/policyrep/qpol_wrap.c
new file mode 100644
index 0000000..7d239af
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/policyrep/qpol_wrap.c
@@ -0,0 +1,16972 @@
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 2.0.11
+ *
+ * This file is not intended to be easily readable and contains a number of
+ * coding conventions designed to improve portability and efficiency. Do not make
+ * changes to this file unless you know what you are doing--modify the SWIG
+ * interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+#define SWIGPYTHON
+#define SWIG_PYTHON_DIRECTOR_NO_VTABLE
+
+/* -----------------------------------------------------------------------------
+ * This section contains generic SWIG labels for method/variable
+ * declarations/attributes, and other compiler dependent labels.
+ * ----------------------------------------------------------------------------- */
+
+/* template workaround for compilers that cannot correctly implement the C++ standard */
+#ifndef SWIGTEMPLATEDISAMBIGUATOR
+# if defined(__SUNPRO_CC) && (__SUNPRO_CC <= 0x560)
+# define SWIGTEMPLATEDISAMBIGUATOR template
+# elif defined(__HP_aCC)
+/* Needed even with `aCC -AA' when `aCC -V' reports HP ANSI C++ B3910B A.03.55 */
+/* If we find a maximum version that requires this, the test would be __HP_aCC <= 35500 for A.03.55 */
+# define SWIGTEMPLATEDISAMBIGUATOR template
+# else
+# define SWIGTEMPLATEDISAMBIGUATOR
+# endif
+#endif
+
+/* inline attribute */
+#ifndef SWIGINLINE
+# if defined(__cplusplus) || (defined(__GNUC__) && !defined(__STRICT_ANSI__))
+# define SWIGINLINE inline
+# else
+# define SWIGINLINE
+# endif
+#endif
+
+/* attribute recognised by some compilers to avoid 'unused' warnings */
+#ifndef SWIGUNUSED
+# if defined(__GNUC__)
+# if !(defined(__cplusplus)) || (__GNUC__ > 3 || (__GNUC__ == 3 && __GNUC_MINOR__ >= 4))
+# define SWIGUNUSED __attribute__ ((__unused__))
+# else
+# define SWIGUNUSED
+# endif
+# elif defined(__ICC)
+# define SWIGUNUSED __attribute__ ((__unused__))
+# else
+# define SWIGUNUSED
+# endif
+#endif
+
+#ifndef SWIG_MSC_UNSUPPRESS_4505
+# if defined(_MSC_VER)
+# pragma warning(disable : 4505) /* unreferenced local function has been removed */
+# endif
+#endif
+
+#ifndef SWIGUNUSEDPARM
+# ifdef __cplusplus
+# define SWIGUNUSEDPARM(p)
+# else
+# define SWIGUNUSEDPARM(p) p SWIGUNUSED
+# endif
+#endif
+
+/* internal SWIG method */
+#ifndef SWIGINTERN
+# define SWIGINTERN static SWIGUNUSED
+#endif
+
+/* internal inline SWIG method */
+#ifndef SWIGINTERNINLINE
+# define SWIGINTERNINLINE SWIGINTERN SWIGINLINE
+#endif
+
+/* exporting methods */
+#if (__GNUC__ >= 4) || (__GNUC__ == 3 && __GNUC_MINOR__ >= 4)
+# ifndef GCC_HASCLASSVISIBILITY
+# define GCC_HASCLASSVISIBILITY
+# endif
+#endif
+
+#ifndef SWIGEXPORT
+# if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
+# if defined(STATIC_LINKED)
+# define SWIGEXPORT
+# else
+# define SWIGEXPORT __declspec(dllexport)
+# endif
+# else
+# if defined(__GNUC__) && defined(GCC_HASCLASSVISIBILITY)
+# define SWIGEXPORT __attribute__ ((visibility("default")))
+# else
+# define SWIGEXPORT
+# endif
+# endif
+#endif
+
+/* calling conventions for Windows */
+#ifndef SWIGSTDCALL
+# if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
+# define SWIGSTDCALL __stdcall
+# else
+# define SWIGSTDCALL
+# endif
+#endif
+
+/* Deal with Microsoft's attempt at deprecating C standard runtime functions */
+#if !defined(SWIG_NO_CRT_SECURE_NO_DEPRECATE) && defined(_MSC_VER) && !defined(_CRT_SECURE_NO_DEPRECATE)
+# define _CRT_SECURE_NO_DEPRECATE
+#endif
+
+/* Deal with Microsoft's attempt at deprecating methods in the standard C++ library */
+#if !defined(SWIG_NO_SCL_SECURE_NO_DEPRECATE) && defined(_MSC_VER) && !defined(_SCL_SECURE_NO_DEPRECATE)
+# define _SCL_SECURE_NO_DEPRECATE
+#endif
+
+
+
+#if defined(_DEBUG) && defined(SWIG_PYTHON_INTERPRETER_NO_DEBUG)
+/* Use debug wrappers with the Python release dll */
+# undef _DEBUG
+# include <Python.h>
+# define _DEBUG
+#else
+# include <Python.h>
+#endif
+
+/* -----------------------------------------------------------------------------
+ * swigrun.swg
+ *
+ * This file contains generic C API SWIG runtime support for pointer
+ * type checking.
+ * ----------------------------------------------------------------------------- */
+
+/* This should only be incremented when either the layout of swig_type_info changes,
+ or for whatever reason, the runtime changes incompatibly */
+#define SWIG_RUNTIME_VERSION "4"
+
+/* define SWIG_TYPE_TABLE_NAME as "SWIG_TYPE_TABLE" */
+#ifdef SWIG_TYPE_TABLE
+# define SWIG_QUOTE_STRING(x) #x
+# define SWIG_EXPAND_AND_QUOTE_STRING(x) SWIG_QUOTE_STRING(x)
+# define SWIG_TYPE_TABLE_NAME SWIG_EXPAND_AND_QUOTE_STRING(SWIG_TYPE_TABLE)
+#else
+# define SWIG_TYPE_TABLE_NAME
+#endif
+
+/*
+ You can use the SWIGRUNTIME and SWIGRUNTIMEINLINE macros for
+ creating a static or dynamic library from the SWIG runtime code.
+ In 99.9% of the cases, SWIG just needs to declare them as 'static'.
+
+ But only do this if strictly necessary, ie, if you have problems
+ with your compiler or suchlike.
+*/
+
+#ifndef SWIGRUNTIME
+# define SWIGRUNTIME SWIGINTERN
+#endif
+
+#ifndef SWIGRUNTIMEINLINE
+# define SWIGRUNTIMEINLINE SWIGRUNTIME SWIGINLINE
+#endif
+
+/* Generic buffer size */
+#ifndef SWIG_BUFFER_SIZE
+# define SWIG_BUFFER_SIZE 1024
+#endif
+
+/* Flags for pointer conversions */
+#define SWIG_POINTER_DISOWN 0x1
+#define SWIG_CAST_NEW_MEMORY 0x2
+
+/* Flags for new pointer objects */
+#define SWIG_POINTER_OWN 0x1
+
+
+/*
+ Flags/methods for returning states.
+
+ The SWIG conversion methods, as ConvertPtr, return an integer
+ that tells if the conversion was successful or not. And if not,
+ an error code can be returned (see swigerrors.swg for the codes).
+
+ Use the following macros/flags to set or process the returning
+ states.
+
+ In old versions of SWIG, code such as the following was usually written:
+
+ if (SWIG_ConvertPtr(obj,vptr,ty.flags) != -1) {
+ // success code
+ } else {
+ //fail code
+ }
+
+ Now you can be more explicit:
+
+ int res = SWIG_ConvertPtr(obj,vptr,ty.flags);
+ if (SWIG_IsOK(res)) {
+ // success code
+ } else {
+ // fail code
+ }
+
+ which is the same really, but now you can also do
+
+ Type *ptr;
+ int res = SWIG_ConvertPtr(obj,(void **)(&ptr),ty.flags);
+ if (SWIG_IsOK(res)) {
+ // success code
+ if (SWIG_IsNewObj(res) {
+ ...
+ delete *ptr;
+ } else {
+ ...
+ }
+ } else {
+ // fail code
+ }
+
+ I.e., now SWIG_ConvertPtr can return new objects and you can
+ identify the case and take care of the deallocation. Of course that
+ also requires SWIG_ConvertPtr to return new result values, such as
+
+ int SWIG_ConvertPtr(obj, ptr,...) {
+ if (<obj is ok>) {
+ if (<need new object>) {
+ *ptr = <ptr to new allocated object>;
+ return SWIG_NEWOBJ;
+ } else {
+ *ptr = <ptr to old object>;
+ return SWIG_OLDOBJ;
+ }
+ } else {
+ return SWIG_BADOBJ;
+ }
+ }
+
+ Of course, returning the plain '0(success)/-1(fail)' still works, but you can be
+ more explicit by returning SWIG_BADOBJ, SWIG_ERROR or any of the
+ SWIG errors code.
+
+ Finally, if the SWIG_CASTRANK_MODE is enabled, the result code
+ allows to return the 'cast rank', for example, if you have this
+
+ int food(double)
+ int fooi(int);
+
+ and you call
+
+ food(1) // cast rank '1' (1 -> 1.0)
+ fooi(1) // cast rank '0'
+
+ just use the SWIG_AddCast()/SWIG_CheckState()
+*/
+
+#define SWIG_OK (0)
+#define SWIG_ERROR (-1)
+#define SWIG_IsOK(r) (r >= 0)
+#define SWIG_ArgError(r) ((r != SWIG_ERROR) ? r : SWIG_TypeError)
+
+/* The CastRankLimit says how many bits are used for the cast rank */
+#define SWIG_CASTRANKLIMIT (1 << 8)
+/* The NewMask denotes the object was created (using new/malloc) */
+#define SWIG_NEWOBJMASK (SWIG_CASTRANKLIMIT << 1)
+/* The TmpMask is for in/out typemaps that use temporal objects */
+#define SWIG_TMPOBJMASK (SWIG_NEWOBJMASK << 1)
+/* Simple returning values */
+#define SWIG_BADOBJ (SWIG_ERROR)
+#define SWIG_OLDOBJ (SWIG_OK)
+#define SWIG_NEWOBJ (SWIG_OK | SWIG_NEWOBJMASK)
+#define SWIG_TMPOBJ (SWIG_OK | SWIG_TMPOBJMASK)
+/* Check, add and del mask methods */
+#define SWIG_AddNewMask(r) (SWIG_IsOK(r) ? (r | SWIG_NEWOBJMASK) : r)
+#define SWIG_DelNewMask(r) (SWIG_IsOK(r) ? (r & ~SWIG_NEWOBJMASK) : r)
+#define SWIG_IsNewObj(r) (SWIG_IsOK(r) && (r & SWIG_NEWOBJMASK))
+#define SWIG_AddTmpMask(r) (SWIG_IsOK(r) ? (r | SWIG_TMPOBJMASK) : r)
+#define SWIG_DelTmpMask(r) (SWIG_IsOK(r) ? (r & ~SWIG_TMPOBJMASK) : r)
+#define SWIG_IsTmpObj(r) (SWIG_IsOK(r) && (r & SWIG_TMPOBJMASK))
+
+/* Cast-Rank Mode */
+#if defined(SWIG_CASTRANK_MODE)
+# ifndef SWIG_TypeRank
+# define SWIG_TypeRank unsigned long
+# endif
+# ifndef SWIG_MAXCASTRANK /* Default cast allowed */
+# define SWIG_MAXCASTRANK (2)
+# endif
+# define SWIG_CASTRANKMASK ((SWIG_CASTRANKLIMIT) -1)
+# define SWIG_CastRank(r) (r & SWIG_CASTRANKMASK)
+SWIGINTERNINLINE int SWIG_AddCast(int r) {
+ return SWIG_IsOK(r) ? ((SWIG_CastRank(r) < SWIG_MAXCASTRANK) ? (r + 1) : SWIG_ERROR) : r;
+}
+SWIGINTERNINLINE int SWIG_CheckState(int r) {
+ return SWIG_IsOK(r) ? SWIG_CastRank(r) + 1 : 0;
+}
+#else /* no cast-rank mode */
+# define SWIG_AddCast(r) (r)
+# define SWIG_CheckState(r) (SWIG_IsOK(r) ? 1 : 0)
+#endif
+
+
+#include <string.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+typedef void *(*swig_converter_func)(void *, int *);
+typedef struct swig_type_info *(*swig_dycast_func)(void **);
+
+/* Structure to store information on one type */
+typedef struct swig_type_info {
+ const char *name; /* mangled name of this type */
+ const char *str; /* human readable name of this type */
+ swig_dycast_func dcast; /* dynamic cast function down a hierarchy */
+ struct swig_cast_info *cast; /* linked list of types that can cast into this type */
+ void *clientdata; /* language specific type data */
+ int owndata; /* flag if the structure owns the clientdata */
+} swig_type_info;
+
+/* Structure to store a type and conversion function used for casting */
+typedef struct swig_cast_info {
+ swig_type_info *type; /* pointer to type that is equivalent to this type */
+ swig_converter_func converter; /* function to cast the void pointers */
+ struct swig_cast_info *next; /* pointer to next cast in linked list */
+ struct swig_cast_info *prev; /* pointer to the previous cast */
+} swig_cast_info;
+
+/* Structure used to store module information
+ * Each module generates one structure like this, and the runtime collects
+ * all of these structures and stores them in a circularly linked list.*/
+typedef struct swig_module_info {
+ swig_type_info **types; /* Array of pointers to swig_type_info structures that are in this module */
+ size_t size; /* Number of types in this module */
+ struct swig_module_info *next; /* Pointer to next element in circularly linked list */
+ swig_type_info **type_initial; /* Array of initially generated type structures */
+ swig_cast_info **cast_initial; /* Array of initially generated casting structures */
+ void *clientdata; /* Language specific module data */
+} swig_module_info;
+
+/*
+ Compare two type names skipping the space characters, therefore
+ "char*" == "char *" and "Class<int>" == "Class<int >", etc.
+
+ Return 0 when the two name types are equivalent, as in
+ strncmp, but skipping ' '.
+*/
+SWIGRUNTIME int
+SWIG_TypeNameComp(const char *f1, const char *l1,
+ const char *f2, const char *l2) {
+ for (;(f1 != l1) && (f2 != l2); ++f1, ++f2) {
+ while ((*f1 == ' ') && (f1 != l1)) ++f1;
+ while ((*f2 == ' ') && (f2 != l2)) ++f2;
+ if (*f1 != *f2) return (*f1 > *f2) ? 1 : -1;
+ }
+ return (int)((l1 - f1) - (l2 - f2));
+}
+
+/*
+ Check type equivalence in a name list like <name1>|<name2>|...
+ Return 0 if equal, -1 if nb < tb, 1 if nb > tb
+*/
+SWIGRUNTIME int
+SWIG_TypeCmp(const char *nb, const char *tb) {
+ int equiv = 1;
+ const char* te = tb + strlen(tb);
+ const char* ne = nb;
+ while (equiv != 0 && *ne) {
+ for (nb = ne; *ne; ++ne) {
+ if (*ne == '|') break;
+ }
+ equiv = SWIG_TypeNameComp(nb, ne, tb, te);
+ if (*ne) ++ne;
+ }
+ return equiv;
+}
+
+/*
+ Check type equivalence in a name list like <name1>|<name2>|...
+ Return 0 if not equal, 1 if equal
+*/
+SWIGRUNTIME int
+SWIG_TypeEquiv(const char *nb, const char *tb) {
+ return SWIG_TypeCmp(nb, tb) == 0 ? 1 : 0;
+}
+
+/*
+ Check the typename
+*/
+SWIGRUNTIME swig_cast_info *
+SWIG_TypeCheck(const char *c, swig_type_info *ty) {
+ if (ty) {
+ swig_cast_info *iter = ty->cast;
+ while (iter) {
+ if (strcmp(iter->type->name, c) == 0) {
+ if (iter == ty->cast)
+ return iter;
+ /* Move iter to the top of the linked list */
+ iter->prev->next = iter->next;
+ if (iter->next)
+ iter->next->prev = iter->prev;
+ iter->next = ty->cast;
+ iter->prev = 0;
+ if (ty->cast) ty->cast->prev = iter;
+ ty->cast = iter;
+ return iter;
+ }
+ iter = iter->next;
+ }
+ }
+ return 0;
+}
+
+/*
+ Identical to SWIG_TypeCheck, except strcmp is replaced with a pointer comparison
+*/
+SWIGRUNTIME swig_cast_info *
+SWIG_TypeCheckStruct(swig_type_info *from, swig_type_info *ty) {
+ if (ty) {
+ swig_cast_info *iter = ty->cast;
+ while (iter) {
+ if (iter->type == from) {
+ if (iter == ty->cast)
+ return iter;
+ /* Move iter to the top of the linked list */
+ iter->prev->next = iter->next;
+ if (iter->next)
+ iter->next->prev = iter->prev;
+ iter->next = ty->cast;
+ iter->prev = 0;
+ if (ty->cast) ty->cast->prev = iter;
+ ty->cast = iter;
+ return iter;
+ }
+ iter = iter->next;
+ }
+ }
+ return 0;
+}
+
+/*
+ Cast a pointer up an inheritance hierarchy
+*/
+SWIGRUNTIMEINLINE void *
+SWIG_TypeCast(swig_cast_info *ty, void *ptr, int *newmemory) {
+ return ((!ty) || (!ty->converter)) ? ptr : (*ty->converter)(ptr, newmemory);
+}
+
+/*
+ Dynamic pointer casting. Down an inheritance hierarchy
+*/
+SWIGRUNTIME swig_type_info *
+SWIG_TypeDynamicCast(swig_type_info *ty, void **ptr) {
+ swig_type_info *lastty = ty;
+ if (!ty || !ty->dcast) return ty;
+ while (ty && (ty->dcast)) {
+ ty = (*ty->dcast)(ptr);
+ if (ty) lastty = ty;
+ }
+ return lastty;
+}
+
+/*
+ Return the name associated with this type
+*/
+SWIGRUNTIMEINLINE const char *
+SWIG_TypeName(const swig_type_info *ty) {
+ return ty->name;
+}
+
+/*
+ Return the pretty name associated with this type,
+ that is an unmangled type name in a form presentable to the user.
+*/
+SWIGRUNTIME const char *
+SWIG_TypePrettyName(const swig_type_info *type) {
+ /* The "str" field contains the equivalent pretty names of the
+ type, separated by vertical-bar characters. We choose
+ to print the last name, as it is often (?) the most
+ specific. */
+ if (!type) return NULL;
+ if (type->str != NULL) {
+ const char *last_name = type->str;
+ const char *s;
+ for (s = type->str; *s; s++)
+ if (*s == '|') last_name = s+1;
+ return last_name;
+ }
+ else
+ return type->name;
+}
+
+/*
+ Set the clientdata field for a type
+*/
+SWIGRUNTIME void
+SWIG_TypeClientData(swig_type_info *ti, void *clientdata) {
+ swig_cast_info *cast = ti->cast;
+ /* if (ti->clientdata == clientdata) return; */
+ ti->clientdata = clientdata;
+
+ while (cast) {
+ if (!cast->converter) {
+ swig_type_info *tc = cast->type;
+ if (!tc->clientdata) {
+ SWIG_TypeClientData(tc, clientdata);
+ }
+ }
+ cast = cast->next;
+ }
+}
+SWIGRUNTIME void
+SWIG_TypeNewClientData(swig_type_info *ti, void *clientdata) {
+ SWIG_TypeClientData(ti, clientdata);
+ ti->owndata = 1;
+}
+
+/*
+ Search for a swig_type_info structure only by mangled name
+ Search is a O(log #types)
+
+ We start searching at module start, and finish searching when start == end.
+ Note: if start == end at the beginning of the function, we go all the way around
+ the circular list.
+*/
+SWIGRUNTIME swig_type_info *
+SWIG_MangledTypeQueryModule(swig_module_info *start,
+ swig_module_info *end,
+ const char *name) {
+ swig_module_info *iter = start;
+ do {
+ if (iter->size) {
+ register size_t l = 0;
+ register size_t r = iter->size - 1;
+ do {
+ /* since l+r >= 0, we can (>> 1) instead (/ 2) */
+ register size_t i = (l + r) >> 1;
+ const char *iname = iter->types[i]->name;
+ if (iname) {
+ register int compare = strcmp(name, iname);
+ if (compare == 0) {
+ return iter->types[i];
+ } else if (compare < 0) {
+ if (i) {
+ r = i - 1;
+ } else {
+ break;
+ }
+ } else if (compare > 0) {
+ l = i + 1;
+ }
+ } else {
+ break; /* should never happen */
+ }
+ } while (l <= r);
+ }
+ iter = iter->next;
+ } while (iter != end);
+ return 0;
+}
+
+/*
+ Search for a swig_type_info structure for either a mangled name or a human readable name.
+ It first searches the mangled names of the types, which is a O(log #types)
+ If a type is not found it then searches the human readable names, which is O(#types).
+
+ We start searching at module start, and finish searching when start == end.
+ Note: if start == end at the beginning of the function, we go all the way around
+ the circular list.
+*/
+SWIGRUNTIME swig_type_info *
+SWIG_TypeQueryModule(swig_module_info *start,
+ swig_module_info *end,
+ const char *name) {
+ /* STEP 1: Search the name field using binary search */
+ swig_type_info *ret = SWIG_MangledTypeQueryModule(start, end, name);
+ if (ret) {
+ return ret;
+ } else {
+ /* STEP 2: If the type hasn't been found, do a complete search
+ of the str field (the human readable name) */
+ swig_module_info *iter = start;
+ do {
+ register size_t i = 0;
+ for (; i < iter->size; ++i) {
+ if (iter->types[i]->str && (SWIG_TypeEquiv(iter->types[i]->str, name)))
+ return iter->types[i];
+ }
+ iter = iter->next;
+ } while (iter != end);
+ }
+
+ /* neither found a match */
+ return 0;
+}
+
+/*
+ Pack binary data into a string
+*/
+SWIGRUNTIME char *
+SWIG_PackData(char *c, void *ptr, size_t sz) {
+ static const char hex[17] = "0123456789abcdef";
+ register const unsigned char *u = (unsigned char *) ptr;
+ register const unsigned char *eu = u + sz;
+ for (; u != eu; ++u) {
+ register unsigned char uu = *u;
+ *(c++) = hex[(uu & 0xf0) >> 4];
+ *(c++) = hex[uu & 0xf];
+ }
+ return c;
+}
+
+/*
+ Unpack binary data from a string
+*/
+SWIGRUNTIME const char *
+SWIG_UnpackData(const char *c, void *ptr, size_t sz) {
+ register unsigned char *u = (unsigned char *) ptr;
+ register const unsigned char *eu = u + sz;
+ for (; u != eu; ++u) {
+ register char d = *(c++);
+ register unsigned char uu;
+ if ((d >= '0') && (d <= '9'))
+ uu = ((d - '0') << 4);
+ else if ((d >= 'a') && (d <= 'f'))
+ uu = ((d - ('a'-10)) << 4);
+ else
+ return (char *) 0;
+ d = *(c++);
+ if ((d >= '0') && (d <= '9'))
+ uu |= (d - '0');
+ else if ((d >= 'a') && (d <= 'f'))
+ uu |= (d - ('a'-10));
+ else
+ return (char *) 0;
+ *u = uu;
+ }
+ return c;
+}
+
+/*
+ Pack 'void *' into a string buffer.
+*/
+SWIGRUNTIME char *
+SWIG_PackVoidPtr(char *buff, void *ptr, const char *name, size_t bsz) {
+ char *r = buff;
+ if ((2*sizeof(void *) + 2) > bsz) return 0;
+ *(r++) = '_';
+ r = SWIG_PackData(r,&ptr,sizeof(void *));
+ if (strlen(name) + 1 > (bsz - (r - buff))) return 0;
+ strcpy(r,name);
+ return buff;
+}
+
+SWIGRUNTIME const char *
+SWIG_UnpackVoidPtr(const char *c, void **ptr, const char *name) {
+ if (*c != '_') {
+ if (strcmp(c,"NULL") == 0) {
+ *ptr = (void *) 0;
+ return name;
+ } else {
+ return 0;
+ }
+ }
+ return SWIG_UnpackData(++c,ptr,sizeof(void *));
+}
+
+SWIGRUNTIME char *
+SWIG_PackDataName(char *buff, void *ptr, size_t sz, const char *name, size_t bsz) {
+ char *r = buff;
+ size_t lname = (name ? strlen(name) : 0);
+ if ((2*sz + 2 + lname) > bsz) return 0;
+ *(r++) = '_';
+ r = SWIG_PackData(r,ptr,sz);
+ if (lname) {
+ strncpy(r,name,lname+1);
+ } else {
+ *r = 0;
+ }
+ return buff;
+}
+
+SWIGRUNTIME const char *
+SWIG_UnpackDataName(const char *c, void *ptr, size_t sz, const char *name) {
+ if (*c != '_') {
+ if (strcmp(c,"NULL") == 0) {
+ memset(ptr,0,sz);
+ return name;
+ } else {
+ return 0;
+ }
+ }
+ return SWIG_UnpackData(++c,ptr,sz);
+}
+
+#ifdef __cplusplus
+}
+#endif
+
+/* Errors in SWIG */
+#define SWIG_UnknownError -1
+#define SWIG_IOError -2
+#define SWIG_RuntimeError -3
+#define SWIG_IndexError -4
+#define SWIG_TypeError -5
+#define SWIG_DivisionByZero -6
+#define SWIG_OverflowError -7
+#define SWIG_SyntaxError -8
+#define SWIG_ValueError -9
+#define SWIG_SystemError -10
+#define SWIG_AttributeError -11
+#define SWIG_MemoryError -12
+#define SWIG_NullReferenceError -13
+
+
+
+/* Compatibility macros for Python 3 */
+#if PY_VERSION_HEX >= 0x03000000
+
+#define PyClass_Check(obj) PyObject_IsInstance(obj, (PyObject *)&PyType_Type)
+#define PyInt_Check(x) PyLong_Check(x)
+#define PyInt_AsLong(x) PyLong_AsLong(x)
+#define PyInt_FromLong(x) PyLong_FromLong(x)
+#define PyInt_FromSize_t(x) PyLong_FromSize_t(x)
+#define PyString_Check(name) PyBytes_Check(name)
+#define PyString_FromString(x) PyUnicode_FromString(x)
+#define PyString_Format(fmt, args) PyUnicode_Format(fmt, args)
+#define PyString_AsString(str) PyBytes_AsString(str)
+#define PyString_Size(str) PyBytes_Size(str)
+#define PyString_InternFromString(key) PyUnicode_InternFromString(key)
+#define Py_TPFLAGS_HAVE_CLASS Py_TPFLAGS_BASETYPE
+#define PyString_AS_STRING(x) PyUnicode_AS_STRING(x)
+#define _PyLong_FromSsize_t(x) PyLong_FromSsize_t(x)
+
+#endif
+
+#ifndef Py_TYPE
+# define Py_TYPE(op) ((op)->ob_type)
+#endif
+
+/* SWIG APIs for compatibility of both Python 2 & 3 */
+
+#if PY_VERSION_HEX >= 0x03000000
+# define SWIG_Python_str_FromFormat PyUnicode_FromFormat
+#else
+# define SWIG_Python_str_FromFormat PyString_FromFormat
+#endif
+
+
+/* Warning: This function will allocate a new string in Python 3,
+ * so please call SWIG_Python_str_DelForPy3(x) to free the space.
+ */
+SWIGINTERN char*
+SWIG_Python_str_AsChar(PyObject *str)
+{
+#if PY_VERSION_HEX >= 0x03000000
+ char *cstr;
+ char *newstr;
+ Py_ssize_t len;
+ str = PyUnicode_AsUTF8String(str);
+ PyBytes_AsStringAndSize(str, &cstr, &len);
+ newstr = (char *) malloc(len+1);
+ memcpy(newstr, cstr, len+1);
+ Py_XDECREF(str);
+ return newstr;
+#else
+ return PyString_AsString(str);
+#endif
+}
+
+#if PY_VERSION_HEX >= 0x03000000
+# define SWIG_Python_str_DelForPy3(x) free( (void*) (x) )
+#else
+# define SWIG_Python_str_DelForPy3(x)
+#endif
+
+
+SWIGINTERN PyObject*
+SWIG_Python_str_FromChar(const char *c)
+{
+#if PY_VERSION_HEX >= 0x03000000
+ return PyUnicode_FromString(c);
+#else
+ return PyString_FromString(c);
+#endif
+}
+
+/* Add PyOS_snprintf for old Pythons */
+#if PY_VERSION_HEX < 0x02020000
+# if defined(_MSC_VER) || defined(__BORLANDC__) || defined(_WATCOM)
+# define PyOS_snprintf _snprintf
+# else
+# define PyOS_snprintf snprintf
+# endif
+#endif
+
+/* A crude PyString_FromFormat implementation for old Pythons */
+#if PY_VERSION_HEX < 0x02020000
+
+#ifndef SWIG_PYBUFFER_SIZE
+# define SWIG_PYBUFFER_SIZE 1024
+#endif
+
+static PyObject *
+PyString_FromFormat(const char *fmt, ...) {
+ va_list ap;
+ char buf[SWIG_PYBUFFER_SIZE * 2];
+ int res;
+ va_start(ap, fmt);
+ res = vsnprintf(buf, sizeof(buf), fmt, ap);
+ va_end(ap);
+ return (res < 0 || res >= (int)sizeof(buf)) ? 0 : PyString_FromString(buf);
+}
+#endif
+
+/* Add PyObject_Del for old Pythons */
+#if PY_VERSION_HEX < 0x01060000
+# define PyObject_Del(op) PyMem_DEL((op))
+#endif
+#ifndef PyObject_DEL
+# define PyObject_DEL PyObject_Del
+#endif
+
+/* A crude PyExc_StopIteration exception for old Pythons */
+#if PY_VERSION_HEX < 0x02020000
+# ifndef PyExc_StopIteration
+# define PyExc_StopIteration PyExc_RuntimeError
+# endif
+# ifndef PyObject_GenericGetAttr
+# define PyObject_GenericGetAttr 0
+# endif
+#endif
+
+/* Py_NotImplemented is defined in 2.1 and up. */
+#if PY_VERSION_HEX < 0x02010000
+# ifndef Py_NotImplemented
+# define Py_NotImplemented PyExc_RuntimeError
+# endif
+#endif
+
+/* A crude PyString_AsStringAndSize implementation for old Pythons */
+#if PY_VERSION_HEX < 0x02010000
+# ifndef PyString_AsStringAndSize
+# define PyString_AsStringAndSize(obj, s, len) {*s = PyString_AsString(obj); *len = *s ? strlen(*s) : 0;}
+# endif
+#endif
+
+/* PySequence_Size for old Pythons */
+#if PY_VERSION_HEX < 0x02000000
+# ifndef PySequence_Size
+# define PySequence_Size PySequence_Length
+# endif
+#endif
+
+/* PyBool_FromLong for old Pythons */
+#if PY_VERSION_HEX < 0x02030000
+static
+PyObject *PyBool_FromLong(long ok)
+{
+ PyObject *result = ok ? Py_True : Py_False;
+ Py_INCREF(result);
+ return result;
+}
+#endif
+
+/* Py_ssize_t for old Pythons */
+/* This code is as recommended by: */
+/* http://www.python.org/dev/peps/pep-0353/#conversion-guidelines */
+#if PY_VERSION_HEX < 0x02050000 && !defined(PY_SSIZE_T_MIN)
+typedef int Py_ssize_t;
+# define PY_SSIZE_T_MAX INT_MAX
+# define PY_SSIZE_T_MIN INT_MIN
+typedef inquiry lenfunc;
+typedef intargfunc ssizeargfunc;
+typedef intintargfunc ssizessizeargfunc;
+typedef intobjargproc ssizeobjargproc;
+typedef intintobjargproc ssizessizeobjargproc;
+typedef getreadbufferproc readbufferproc;
+typedef getwritebufferproc writebufferproc;
+typedef getsegcountproc segcountproc;
+typedef getcharbufferproc charbufferproc;
+static long PyNumber_AsSsize_t (PyObject *x, void *SWIGUNUSEDPARM(exc))
+{
+ long result = 0;
+ PyObject *i = PyNumber_Int(x);
+ if (i) {
+ result = PyInt_AsLong(i);
+ Py_DECREF(i);
+ }
+ return result;
+}
+#endif
+
+#if PY_VERSION_HEX < 0x02050000
+#define PyInt_FromSize_t(x) PyInt_FromLong((long)x)
+#endif
+
+#if PY_VERSION_HEX < 0x02040000
+#define Py_VISIT(op) \
+ do { \
+ if (op) { \
+ int vret = visit((op), arg); \
+ if (vret) \
+ return vret; \
+ } \
+ } while (0)
+#endif
+
+#if PY_VERSION_HEX < 0x02030000
+typedef struct {
+ PyTypeObject type;
+ PyNumberMethods as_number;
+ PyMappingMethods as_mapping;
+ PySequenceMethods as_sequence;
+ PyBufferProcs as_buffer;
+ PyObject *name, *slots;
+} PyHeapTypeObject;
+#endif
+
+#if PY_VERSION_HEX < 0x02030000
+typedef destructor freefunc;
+#endif
+
+#if ((PY_MAJOR_VERSION == 2 && PY_MINOR_VERSION > 6) || \
+ (PY_MAJOR_VERSION == 3 && PY_MINOR_VERSION > 0) || \
+ (PY_MAJOR_VERSION > 3))
+# define SWIGPY_USE_CAPSULE
+# define SWIGPY_CAPSULE_NAME ((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION ".type_pointer_capsule" SWIG_TYPE_TABLE_NAME)
+#endif
+
+#if PY_VERSION_HEX < 0x03020000
+#define PyDescr_TYPE(x) (((PyDescrObject *)(x))->d_type)
+#define PyDescr_NAME(x) (((PyDescrObject *)(x))->d_name)
+#endif
+
+/* -----------------------------------------------------------------------------
+ * error manipulation
+ * ----------------------------------------------------------------------------- */
+
+SWIGRUNTIME PyObject*
+SWIG_Python_ErrorType(int code) {
+ PyObject* type = 0;
+ switch(code) {
+ case SWIG_MemoryError:
+ type = PyExc_MemoryError;
+ break;
+ case SWIG_IOError:
+ type = PyExc_IOError;
+ break;
+ case SWIG_RuntimeError:
+ type = PyExc_RuntimeError;
+ break;
+ case SWIG_IndexError:
+ type = PyExc_IndexError;
+ break;
+ case SWIG_TypeError:
+ type = PyExc_TypeError;
+ break;
+ case SWIG_DivisionByZero:
+ type = PyExc_ZeroDivisionError;
+ break;
+ case SWIG_OverflowError:
+ type = PyExc_OverflowError;
+ break;
+ case SWIG_SyntaxError:
+ type = PyExc_SyntaxError;
+ break;
+ case SWIG_ValueError:
+ type = PyExc_ValueError;
+ break;
+ case SWIG_SystemError:
+ type = PyExc_SystemError;
+ break;
+ case SWIG_AttributeError:
+ type = PyExc_AttributeError;
+ break;
+ default:
+ type = PyExc_RuntimeError;
+ }
+ return type;
+}
+
+
+SWIGRUNTIME void
+SWIG_Python_AddErrorMsg(const char* mesg)
+{
+ PyObject *type = 0;
+ PyObject *value = 0;
+ PyObject *traceback = 0;
+
+ if (PyErr_Occurred()) PyErr_Fetch(&type, &value, &traceback);
+ if (value) {
+ char *tmp;
+ PyObject *old_str = PyObject_Str(value);
+ PyErr_Clear();
+ Py_XINCREF(type);
+
+ PyErr_Format(type, "%s %s", tmp = SWIG_Python_str_AsChar(old_str), mesg);
+ SWIG_Python_str_DelForPy3(tmp);
+ Py_DECREF(old_str);
+ Py_DECREF(value);
+ } else {
+ PyErr_SetString(PyExc_RuntimeError, mesg);
+ }
+}
+
+#if defined(SWIG_PYTHON_NO_THREADS)
+# if defined(SWIG_PYTHON_THREADS)
+# undef SWIG_PYTHON_THREADS
+# endif
+#endif
+#if defined(SWIG_PYTHON_THREADS) /* Threading support is enabled */
+# if !defined(SWIG_PYTHON_USE_GIL) && !defined(SWIG_PYTHON_NO_USE_GIL)
+# if (PY_VERSION_HEX >= 0x02030000) /* For 2.3 or later, use the PyGILState calls */
+# define SWIG_PYTHON_USE_GIL
+# endif
+# endif
+# if defined(SWIG_PYTHON_USE_GIL) /* Use PyGILState threads calls */
+# ifndef SWIG_PYTHON_INITIALIZE_THREADS
+# define SWIG_PYTHON_INITIALIZE_THREADS PyEval_InitThreads()
+# endif
+# ifdef __cplusplus /* C++ code */
+ class SWIG_Python_Thread_Block {
+ bool status;
+ PyGILState_STATE state;
+ public:
+ void end() { if (status) { PyGILState_Release(state); status = false;} }
+ SWIG_Python_Thread_Block() : status(true), state(PyGILState_Ensure()) {}
+ ~SWIG_Python_Thread_Block() { end(); }
+ };
+ class SWIG_Python_Thread_Allow {
+ bool status;
+ PyThreadState *save;
+ public:
+ void end() { if (status) { PyEval_RestoreThread(save); status = false; }}
+ SWIG_Python_Thread_Allow() : status(true), save(PyEval_SaveThread()) {}
+ ~SWIG_Python_Thread_Allow() { end(); }
+ };
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK SWIG_Python_Thread_Block _swig_thread_block
+# define SWIG_PYTHON_THREAD_END_BLOCK _swig_thread_block.end()
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW SWIG_Python_Thread_Allow _swig_thread_allow
+# define SWIG_PYTHON_THREAD_END_ALLOW _swig_thread_allow.end()
+# else /* C code */
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK PyGILState_STATE _swig_thread_block = PyGILState_Ensure()
+# define SWIG_PYTHON_THREAD_END_BLOCK PyGILState_Release(_swig_thread_block)
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW PyThreadState *_swig_thread_allow = PyEval_SaveThread()
+# define SWIG_PYTHON_THREAD_END_ALLOW PyEval_RestoreThread(_swig_thread_allow)
+# endif
+# else /* Old thread way, not implemented, user must provide it */
+# if !defined(SWIG_PYTHON_INITIALIZE_THREADS)
+# define SWIG_PYTHON_INITIALIZE_THREADS
+# endif
+# if !defined(SWIG_PYTHON_THREAD_BEGIN_BLOCK)
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK
+# endif
+# if !defined(SWIG_PYTHON_THREAD_END_BLOCK)
+# define SWIG_PYTHON_THREAD_END_BLOCK
+# endif
+# if !defined(SWIG_PYTHON_THREAD_BEGIN_ALLOW)
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW
+# endif
+# if !defined(SWIG_PYTHON_THREAD_END_ALLOW)
+# define SWIG_PYTHON_THREAD_END_ALLOW
+# endif
+# endif
+#else /* No thread support */
+# define SWIG_PYTHON_INITIALIZE_THREADS
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK
+# define SWIG_PYTHON_THREAD_END_BLOCK
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW
+# define SWIG_PYTHON_THREAD_END_ALLOW
+#endif
+
+/* -----------------------------------------------------------------------------
+ * Python API portion that goes into the runtime
+ * ----------------------------------------------------------------------------- */
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/* -----------------------------------------------------------------------------
+ * Constant declarations
+ * ----------------------------------------------------------------------------- */
+
+/* Constant Types */
+#define SWIG_PY_POINTER 4
+#define SWIG_PY_BINARY 5
+
+/* Constant information structure */
+typedef struct swig_const_info {
+ int type;
+ char *name;
+ long lvalue;
+ double dvalue;
+ void *pvalue;
+ swig_type_info **ptype;
+} swig_const_info;
+
+
+/* -----------------------------------------------------------------------------
+ * Wrapper of PyInstanceMethod_New() used in Python 3
+ * It is exported to the generated module, used for -fastproxy
+ * ----------------------------------------------------------------------------- */
+#if PY_VERSION_HEX >= 0x03000000
+SWIGRUNTIME PyObject* SWIG_PyInstanceMethod_New(PyObject *SWIGUNUSEDPARM(self), PyObject *func)
+{
+ return PyInstanceMethod_New(func);
+}
+#else
+SWIGRUNTIME PyObject* SWIG_PyInstanceMethod_New(PyObject *SWIGUNUSEDPARM(self), PyObject *SWIGUNUSEDPARM(func))
+{
+ return NULL;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+
+/* -----------------------------------------------------------------------------
+ * pyrun.swg
+ *
+ * This file contains the runtime support for Python modules
+ * and includes code for managing global variables and pointer
+ * type checking.
+ *
+ * ----------------------------------------------------------------------------- */
+
+/* Common SWIG API */
+
+/* for raw pointers */
+#define SWIG_Python_ConvertPtr(obj, pptr, type, flags) SWIG_Python_ConvertPtrAndOwn(obj, pptr, type, flags, 0)
+#define SWIG_ConvertPtr(obj, pptr, type, flags) SWIG_Python_ConvertPtr(obj, pptr, type, flags)
+#define SWIG_ConvertPtrAndOwn(obj,pptr,type,flags,own) SWIG_Python_ConvertPtrAndOwn(obj, pptr, type, flags, own)
+
+#ifdef SWIGPYTHON_BUILTIN
+#define SWIG_NewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(self, ptr, type, flags)
+#else
+#define SWIG_NewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(NULL, ptr, type, flags)
+#endif
+
+#define SWIG_InternalNewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(NULL, ptr, type, flags)
+
+#define SWIG_CheckImplicit(ty) SWIG_Python_CheckImplicit(ty)
+#define SWIG_AcquirePtr(ptr, src) SWIG_Python_AcquirePtr(ptr, src)
+#define swig_owntype int
+
+/* for raw packed data */
+#define SWIG_ConvertPacked(obj, ptr, sz, ty) SWIG_Python_ConvertPacked(obj, ptr, sz, ty)
+#define SWIG_NewPackedObj(ptr, sz, type) SWIG_Python_NewPackedObj(ptr, sz, type)
+
+/* for class or struct pointers */
+#define SWIG_ConvertInstance(obj, pptr, type, flags) SWIG_ConvertPtr(obj, pptr, type, flags)
+#define SWIG_NewInstanceObj(ptr, type, flags) SWIG_NewPointerObj(ptr, type, flags)
+
+/* for C or C++ function pointers */
+#define SWIG_ConvertFunctionPtr(obj, pptr, type) SWIG_Python_ConvertFunctionPtr(obj, pptr, type)
+#define SWIG_NewFunctionPtrObj(ptr, type) SWIG_Python_NewPointerObj(NULL, ptr, type, 0)
+
+/* for C++ member pointers, ie, member methods */
+#define SWIG_ConvertMember(obj, ptr, sz, ty) SWIG_Python_ConvertPacked(obj, ptr, sz, ty)
+#define SWIG_NewMemberObj(ptr, sz, type) SWIG_Python_NewPackedObj(ptr, sz, type)
+
+
+/* Runtime API */
+
+#define SWIG_GetModule(clientdata) SWIG_Python_GetModule(clientdata)
+#define SWIG_SetModule(clientdata, pointer) SWIG_Python_SetModule(pointer)
+#define SWIG_NewClientData(obj) SwigPyClientData_New(obj)
+
+#define SWIG_SetErrorObj SWIG_Python_SetErrorObj
+#define SWIG_SetErrorMsg SWIG_Python_SetErrorMsg
+#define SWIG_ErrorType(code) SWIG_Python_ErrorType(code)
+#define SWIG_Error(code, msg) SWIG_Python_SetErrorMsg(SWIG_ErrorType(code), msg)
+#define SWIG_fail goto fail
+
+
+/* Runtime API implementation */
+
+/* Error manipulation */
+
+SWIGINTERN void
+SWIG_Python_SetErrorObj(PyObject *errtype, PyObject *obj) {
+ SWIG_PYTHON_THREAD_BEGIN_BLOCK;
+ PyErr_SetObject(errtype, obj);
+ Py_DECREF(obj);
+ SWIG_PYTHON_THREAD_END_BLOCK;
+}
+
+SWIGINTERN void
+SWIG_Python_SetErrorMsg(PyObject *errtype, const char *msg) {
+ SWIG_PYTHON_THREAD_BEGIN_BLOCK;
+ PyErr_SetString(errtype, msg);
+ SWIG_PYTHON_THREAD_END_BLOCK;
+}
+
+#define SWIG_Python_Raise(obj, type, desc) SWIG_Python_SetErrorObj(SWIG_Python_ExceptionType(desc), obj)
+
+/* Set a constant value */
+
+#if defined(SWIGPYTHON_BUILTIN)
+
+SWIGINTERN void
+SwigPyBuiltin_AddPublicSymbol(PyObject *seq, const char *key) {
+ PyObject *s = PyString_InternFromString(key);
+ PyList_Append(seq, s);
+ Py_DECREF(s);
+}
+
+SWIGINTERN void
+SWIG_Python_SetConstant(PyObject *d, PyObject *public_interface, const char *name, PyObject *obj) {
+#if PY_VERSION_HEX < 0x02030000
+ PyDict_SetItemString(d, (char *)name, obj);
+#else
+ PyDict_SetItemString(d, name, obj);
+#endif
+ Py_DECREF(obj);
+ if (public_interface)
+ SwigPyBuiltin_AddPublicSymbol(public_interface, name);
+}
+
+#else
+
+SWIGINTERN void
+SWIG_Python_SetConstant(PyObject *d, const char *name, PyObject *obj) {
+#if PY_VERSION_HEX < 0x02030000
+ PyDict_SetItemString(d, (char *)name, obj);
+#else
+ PyDict_SetItemString(d, name, obj);
+#endif
+ Py_DECREF(obj);
+}
+
+#endif
+
+/* Append a value to the result obj */
+
+SWIGINTERN PyObject*
+SWIG_Python_AppendOutput(PyObject* result, PyObject* obj) {
+#if !defined(SWIG_PYTHON_OUTPUT_TUPLE)
+ if (!result) {
+ result = obj;
+ } else if (result == Py_None) {
+ Py_DECREF(result);
+ result = obj;
+ } else {
+ if (!PyList_Check(result)) {
+ PyObject *o2 = result;
+ result = PyList_New(1);
+ PyList_SetItem(result, 0, o2);
+ }
+ PyList_Append(result,obj);
+ Py_DECREF(obj);
+ }
+ return result;
+#else
+ PyObject* o2;
+ PyObject* o3;
+ if (!result) {
+ result = obj;
+ } else if (result == Py_None) {
+ Py_DECREF(result);
+ result = obj;
+ } else {
+ if (!PyTuple_Check(result)) {
+ o2 = result;
+ result = PyTuple_New(1);
+ PyTuple_SET_ITEM(result, 0, o2);
+ }
+ o3 = PyTuple_New(1);
+ PyTuple_SET_ITEM(o3, 0, obj);
+ o2 = result;
+ result = PySequence_Concat(o2, o3);
+ Py_DECREF(o2);
+ Py_DECREF(o3);
+ }
+ return result;
+#endif
+}
+
+/* Unpack the argument tuple */
+
+SWIGINTERN int
+SWIG_Python_UnpackTuple(PyObject *args, const char *name, Py_ssize_t min, Py_ssize_t max, PyObject **objs)
+{
+ if (!args) {
+ if (!min && !max) {
+ return 1;
+ } else {
+ PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got none",
+ name, (min == max ? "" : "at least "), (int)min);
+ return 0;
+ }
+ }
+ if (!PyTuple_Check(args)) {
+ if (min <= 1 && max >= 1) {
+ register int i;
+ objs[0] = args;
+ for (i = 1; i < max; ++i) {
+ objs[i] = 0;
+ }
+ return 2;
+ }
+ PyErr_SetString(PyExc_SystemError, "UnpackTuple() argument list is not a tuple");
+ return 0;
+ } else {
+ register Py_ssize_t l = PyTuple_GET_SIZE(args);
+ if (l < min) {
+ PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got %d",
+ name, (min == max ? "" : "at least "), (int)min, (int)l);
+ return 0;
+ } else if (l > max) {
+ PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got %d",
+ name, (min == max ? "" : "at most "), (int)max, (int)l);
+ return 0;
+ } else {
+ register int i;
+ for (i = 0; i < l; ++i) {
+ objs[i] = PyTuple_GET_ITEM(args, i);
+ }
+ for (; l < max; ++l) {
+ objs[l] = 0;
+ }
+ return i + 1;
+ }
+ }
+}
+
+/* A functor is a function object with one single object argument */
+#if PY_VERSION_HEX >= 0x02020000
+#define SWIG_Python_CallFunctor(functor, obj) PyObject_CallFunctionObjArgs(functor, obj, NULL);
+#else
+#define SWIG_Python_CallFunctor(functor, obj) PyObject_CallFunction(functor, "O", obj);
+#endif
+
+/*
+ Helper for static pointer initialization for both C and C++ code, for example
+ static PyObject *SWIG_STATIC_POINTER(MyVar) = NewSomething(...);
+*/
+#ifdef __cplusplus
+#define SWIG_STATIC_POINTER(var) var
+#else
+#define SWIG_STATIC_POINTER(var) var = 0; if (!var) var
+#endif
+
+/* -----------------------------------------------------------------------------
+ * Pointer declarations
+ * ----------------------------------------------------------------------------- */
+
+/* Flags for new pointer objects */
+#define SWIG_POINTER_NOSHADOW (SWIG_POINTER_OWN << 1)
+#define SWIG_POINTER_NEW (SWIG_POINTER_NOSHADOW | SWIG_POINTER_OWN)
+
+#define SWIG_POINTER_IMPLICIT_CONV (SWIG_POINTER_DISOWN << 1)
+
+#define SWIG_BUILTIN_TP_INIT (SWIG_POINTER_OWN << 2)
+#define SWIG_BUILTIN_INIT (SWIG_BUILTIN_TP_INIT | SWIG_POINTER_OWN)
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/* How to access Py_None */
+#if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
+# ifndef SWIG_PYTHON_NO_BUILD_NONE
+# ifndef SWIG_PYTHON_BUILD_NONE
+# define SWIG_PYTHON_BUILD_NONE
+# endif
+# endif
+#endif
+
+#ifdef SWIG_PYTHON_BUILD_NONE
+# ifdef Py_None
+# undef Py_None
+# define Py_None SWIG_Py_None()
+# endif
+SWIGRUNTIMEINLINE PyObject *
+_SWIG_Py_None(void)
+{
+ PyObject *none = Py_BuildValue((char*)"");
+ Py_DECREF(none);
+ return none;
+}
+SWIGRUNTIME PyObject *
+SWIG_Py_None(void)
+{
+ static PyObject *SWIG_STATIC_POINTER(none) = _SWIG_Py_None();
+ return none;
+}
+#endif
+
+/* The python void return value */
+
+SWIGRUNTIMEINLINE PyObject *
+SWIG_Py_Void(void)
+{
+ PyObject *none = Py_None;
+ Py_INCREF(none);
+ return none;
+}
+
+/* SwigPyClientData */
+
+typedef struct {
+ PyObject *klass;
+ PyObject *newraw;
+ PyObject *newargs;
+ PyObject *destroy;
+ int delargs;
+ int implicitconv;
+ PyTypeObject *pytype;
+} SwigPyClientData;
+
+SWIGRUNTIMEINLINE int
+SWIG_Python_CheckImplicit(swig_type_info *ty)
+{
+ SwigPyClientData *data = (SwigPyClientData *)ty->clientdata;
+ return data ? data->implicitconv : 0;
+}
+
+SWIGRUNTIMEINLINE PyObject *
+SWIG_Python_ExceptionType(swig_type_info *desc) {
+ SwigPyClientData *data = desc ? (SwigPyClientData *) desc->clientdata : 0;
+ PyObject *klass = data ? data->klass : 0;
+ return (klass ? klass : PyExc_RuntimeError);
+}
+
+
+SWIGRUNTIME SwigPyClientData *
+SwigPyClientData_New(PyObject* obj)
+{
+ if (!obj) {
+ return 0;
+ } else {
+ SwigPyClientData *data = (SwigPyClientData *)malloc(sizeof(SwigPyClientData));
+ /* the klass element */
+ data->klass = obj;
+ Py_INCREF(data->klass);
+ /* the newraw method and newargs arguments used to create a new raw instance */
+ if (PyClass_Check(obj)) {
+ data->newraw = 0;
+ data->newargs = obj;
+ Py_INCREF(obj);
+ } else {
+#if (PY_VERSION_HEX < 0x02020000)
+ data->newraw = 0;
+#else
+ data->newraw = PyObject_GetAttrString(data->klass, (char *)"__new__");
+#endif
+ if (data->newraw) {
+ Py_INCREF(data->newraw);
+ data->newargs = PyTuple_New(1);
+ PyTuple_SetItem(data->newargs, 0, obj);
+ } else {
+ data->newargs = obj;
+ }
+ Py_INCREF(data->newargs);
+ }
+ /* the destroy method, aka as the C++ delete method */
+ data->destroy = PyObject_GetAttrString(data->klass, (char *)"__swig_destroy__");
+ if (PyErr_Occurred()) {
+ PyErr_Clear();
+ data->destroy = 0;
+ }
+ if (data->destroy) {
+ int flags;
+ Py_INCREF(data->destroy);
+ flags = PyCFunction_GET_FLAGS(data->destroy);
+#ifdef METH_O
+ data->delargs = !(flags & (METH_O));
+#else
+ data->delargs = 0;
+#endif
+ } else {
+ data->delargs = 0;
+ }
+ data->implicitconv = 0;
+ data->pytype = 0;
+ return data;
+ }
+}
+
+SWIGRUNTIME void
+SwigPyClientData_Del(SwigPyClientData *data) {
+ Py_XDECREF(data->newraw);
+ Py_XDECREF(data->newargs);
+ Py_XDECREF(data->destroy);
+}
+
+/* =============== SwigPyObject =====================*/
+
+typedef struct {
+ PyObject_HEAD
+ void *ptr;
+ swig_type_info *ty;
+ int own;
+ PyObject *next;
+#ifdef SWIGPYTHON_BUILTIN
+ PyObject *dict;
+#endif
+} SwigPyObject;
+
+SWIGRUNTIME PyObject *
+SwigPyObject_long(SwigPyObject *v)
+{
+ return PyLong_FromVoidPtr(v->ptr);
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_format(const char* fmt, SwigPyObject *v)
+{
+ PyObject *res = NULL;
+ PyObject *args = PyTuple_New(1);
+ if (args) {
+ if (PyTuple_SetItem(args, 0, SwigPyObject_long(v)) == 0) {
+ PyObject *ofmt = SWIG_Python_str_FromChar(fmt);
+ if (ofmt) {
+#if PY_VERSION_HEX >= 0x03000000
+ res = PyUnicode_Format(ofmt,args);
+#else
+ res = PyString_Format(ofmt,args);
+#endif
+ Py_DECREF(ofmt);
+ }
+ Py_DECREF(args);
+ }
+ }
+ return res;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_oct(SwigPyObject *v)
+{
+ return SwigPyObject_format("%o",v);
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_hex(SwigPyObject *v)
+{
+ return SwigPyObject_format("%x",v);
+}
+
+SWIGRUNTIME PyObject *
+#ifdef METH_NOARGS
+SwigPyObject_repr(SwigPyObject *v)
+#else
+SwigPyObject_repr(SwigPyObject *v, PyObject *args)
+#endif
+{
+ const char *name = SWIG_TypePrettyName(v->ty);
+ PyObject *repr = SWIG_Python_str_FromFormat("<Swig Object of type '%s' at %p>", (name ? name : "unknown"), (void *)v);
+ if (v->next) {
+# ifdef METH_NOARGS
+ PyObject *nrep = SwigPyObject_repr((SwigPyObject *)v->next);
+# else
+ PyObject *nrep = SwigPyObject_repr((SwigPyObject *)v->next, args);
+# endif
+# if PY_VERSION_HEX >= 0x03000000
+ PyObject *joined = PyUnicode_Concat(repr, nrep);
+ Py_DecRef(repr);
+ Py_DecRef(nrep);
+ repr = joined;
+# else
+ PyString_ConcatAndDel(&repr,nrep);
+# endif
+ }
+ return repr;
+}
+
+SWIGRUNTIME int
+SwigPyObject_compare(SwigPyObject *v, SwigPyObject *w)
+{
+ void *i = v->ptr;
+ void *j = w->ptr;
+ return (i < j) ? -1 : ((i > j) ? 1 : 0);
+}
+
+/* Added for Python 3.x, would it also be useful for Python 2.x? */
+SWIGRUNTIME PyObject*
+SwigPyObject_richcompare(SwigPyObject *v, SwigPyObject *w, int op)
+{
+ PyObject* res;
+ if( op != Py_EQ && op != Py_NE ) {
+ Py_INCREF(Py_NotImplemented);
+ return Py_NotImplemented;
+ }
+ res = PyBool_FromLong( (SwigPyObject_compare(v, w)==0) == (op == Py_EQ) ? 1 : 0);
+ return res;
+}
+
+
+SWIGRUNTIME PyTypeObject* SwigPyObject_TypeOnce(void);
+
+#ifdef SWIGPYTHON_BUILTIN
+static swig_type_info *SwigPyObject_stype = 0;
+SWIGRUNTIME PyTypeObject*
+SwigPyObject_type(void) {
+ SwigPyClientData *cd;
+ assert(SwigPyObject_stype);
+ cd = (SwigPyClientData*) SwigPyObject_stype->clientdata;
+ assert(cd);
+ assert(cd->pytype);
+ return cd->pytype;
+}
+#else
+SWIGRUNTIME PyTypeObject*
+SwigPyObject_type(void) {
+ static PyTypeObject *SWIG_STATIC_POINTER(type) = SwigPyObject_TypeOnce();
+ return type;
+}
+#endif
+
+SWIGRUNTIMEINLINE int
+SwigPyObject_Check(PyObject *op) {
+#ifdef SWIGPYTHON_BUILTIN
+ PyTypeObject *target_tp = SwigPyObject_type();
+ if (PyType_IsSubtype(op->ob_type, target_tp))
+ return 1;
+ return (strcmp(op->ob_type->tp_name, "SwigPyObject") == 0);
+#else
+ return (Py_TYPE(op) == SwigPyObject_type())
+ || (strcmp(Py_TYPE(op)->tp_name,"SwigPyObject") == 0);
+#endif
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_New(void *ptr, swig_type_info *ty, int own);
+
+SWIGRUNTIME void
+SwigPyObject_dealloc(PyObject *v)
+{
+ SwigPyObject *sobj = (SwigPyObject *) v;
+ PyObject *next = sobj->next;
+ if (sobj->own == SWIG_POINTER_OWN) {
+ swig_type_info *ty = sobj->ty;
+ SwigPyClientData *data = ty ? (SwigPyClientData *) ty->clientdata : 0;
+ PyObject *destroy = data ? data->destroy : 0;
+ if (destroy) {
+ /* destroy is always a VARARGS method */
+ PyObject *res;
+ if (data->delargs) {
+ /* we need to create a temporary object to carry the destroy operation */
+ PyObject *tmp = SwigPyObject_New(sobj->ptr, ty, 0);
+ res = SWIG_Python_CallFunctor(destroy, tmp);
+ Py_DECREF(tmp);
+ } else {
+ PyCFunction meth = PyCFunction_GET_FUNCTION(destroy);
+ PyObject *mself = PyCFunction_GET_SELF(destroy);
+ res = ((*meth)(mself, v));
+ }
+ Py_XDECREF(res);
+ }
+#if !defined(SWIG_PYTHON_SILENT_MEMLEAK)
+ else {
+ const char *name = SWIG_TypePrettyName(ty);
+ printf("swig/python detected a memory leak of type '%s', no destructor found.\n", (name ? name : "unknown"));
+ }
+#endif
+ }
+ Py_XDECREF(next);
+ PyObject_DEL(v);
+}
+
+SWIGRUNTIME PyObject*
+SwigPyObject_append(PyObject* v, PyObject* next)
+{
+ SwigPyObject *sobj = (SwigPyObject *) v;
+#ifndef METH_O
+ PyObject *tmp = 0;
+ if (!PyArg_ParseTuple(next,(char *)"O:append", &tmp)) return NULL;
+ next = tmp;
+#endif
+ if (!SwigPyObject_Check(next)) {
+ return NULL;
+ }
+ sobj->next = next;
+ Py_INCREF(next);
+ return SWIG_Py_Void();
+}
+
+SWIGRUNTIME PyObject*
+#ifdef METH_NOARGS
+SwigPyObject_next(PyObject* v)
+#else
+SwigPyObject_next(PyObject* v, PyObject *SWIGUNUSEDPARM(args))
+#endif
+{
+ SwigPyObject *sobj = (SwigPyObject *) v;
+ if (sobj->next) {
+ Py_INCREF(sobj->next);
+ return sobj->next;
+ } else {
+ return SWIG_Py_Void();
+ }
+}
+
+SWIGINTERN PyObject*
+#ifdef METH_NOARGS
+SwigPyObject_disown(PyObject *v)
+#else
+SwigPyObject_disown(PyObject* v, PyObject *SWIGUNUSEDPARM(args))
+#endif
+{
+ SwigPyObject *sobj = (SwigPyObject *)v;
+ sobj->own = 0;
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject*
+#ifdef METH_NOARGS
+SwigPyObject_acquire(PyObject *v)
+#else
+SwigPyObject_acquire(PyObject* v, PyObject *SWIGUNUSEDPARM(args))
+#endif
+{
+ SwigPyObject *sobj = (SwigPyObject *)v;
+ sobj->own = SWIG_POINTER_OWN;
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject*
+SwigPyObject_own(PyObject *v, PyObject *args)
+{
+ PyObject *val = 0;
+#if (PY_VERSION_HEX < 0x02020000)
+ if (!PyArg_ParseTuple(args,(char *)"|O:own",&val))
+#elif (PY_VERSION_HEX < 0x02050000)
+ if (!PyArg_UnpackTuple(args, (char *)"own", 0, 1, &val))
+#else
+ if (!PyArg_UnpackTuple(args, "own", 0, 1, &val))
+#endif
+ {
+ return NULL;
+ }
+ else
+ {
+ SwigPyObject *sobj = (SwigPyObject *)v;
+ PyObject *obj = PyBool_FromLong(sobj->own);
+ if (val) {
+#ifdef METH_NOARGS
+ if (PyObject_IsTrue(val)) {
+ SwigPyObject_acquire(v);
+ } else {
+ SwigPyObject_disown(v);
+ }
+#else
+ if (PyObject_IsTrue(val)) {
+ SwigPyObject_acquire(v,args);
+ } else {
+ SwigPyObject_disown(v,args);
+ }
+#endif
+ }
+ return obj;
+ }
+}
+
+#ifdef METH_O
+static PyMethodDef
+swigobject_methods[] = {
+ {(char *)"disown", (PyCFunction)SwigPyObject_disown, METH_NOARGS, (char *)"releases ownership of the pointer"},
+ {(char *)"acquire", (PyCFunction)SwigPyObject_acquire, METH_NOARGS, (char *)"acquires ownership of the pointer"},
+ {(char *)"own", (PyCFunction)SwigPyObject_own, METH_VARARGS, (char *)"returns/sets ownership of the pointer"},
+ {(char *)"append", (PyCFunction)SwigPyObject_append, METH_O, (char *)"appends another 'this' object"},
+ {(char *)"next", (PyCFunction)SwigPyObject_next, METH_NOARGS, (char *)"returns the next 'this' object"},
+ {(char *)"__repr__",(PyCFunction)SwigPyObject_repr, METH_NOARGS, (char *)"returns object representation"},
+ {0, 0, 0, 0}
+};
+#else
+static PyMethodDef
+swigobject_methods[] = {
+ {(char *)"disown", (PyCFunction)SwigPyObject_disown, METH_VARARGS, (char *)"releases ownership of the pointer"},
+ {(char *)"acquire", (PyCFunction)SwigPyObject_acquire, METH_VARARGS, (char *)"aquires ownership of the pointer"},
+ {(char *)"own", (PyCFunction)SwigPyObject_own, METH_VARARGS, (char *)"returns/sets ownership of the pointer"},
+ {(char *)"append", (PyCFunction)SwigPyObject_append, METH_VARARGS, (char *)"appends another 'this' object"},
+ {(char *)"next", (PyCFunction)SwigPyObject_next, METH_VARARGS, (char *)"returns the next 'this' object"},
+ {(char *)"__repr__",(PyCFunction)SwigPyObject_repr, METH_VARARGS, (char *)"returns object representation"},
+ {0, 0, 0, 0}
+};
+#endif
+
+#if PY_VERSION_HEX < 0x02020000
+SWIGINTERN PyObject *
+SwigPyObject_getattr(SwigPyObject *sobj,char *name)
+{
+ return Py_FindMethod(swigobject_methods, (PyObject *)sobj, name);
+}
+#endif
+
+SWIGRUNTIME PyTypeObject*
+SwigPyObject_TypeOnce(void) {
+ static char swigobject_doc[] = "Swig object carries a C/C++ instance pointer";
+
+ static PyNumberMethods SwigPyObject_as_number = {
+ (binaryfunc)0, /*nb_add*/
+ (binaryfunc)0, /*nb_subtract*/
+ (binaryfunc)0, /*nb_multiply*/
+ /* nb_divide removed in Python 3 */
+#if PY_VERSION_HEX < 0x03000000
+ (binaryfunc)0, /*nb_divide*/
+#endif
+ (binaryfunc)0, /*nb_remainder*/
+ (binaryfunc)0, /*nb_divmod*/
+ (ternaryfunc)0,/*nb_power*/
+ (unaryfunc)0, /*nb_negative*/
+ (unaryfunc)0, /*nb_positive*/
+ (unaryfunc)0, /*nb_absolute*/
+ (inquiry)0, /*nb_nonzero*/
+ 0, /*nb_invert*/
+ 0, /*nb_lshift*/
+ 0, /*nb_rshift*/
+ 0, /*nb_and*/
+ 0, /*nb_xor*/
+ 0, /*nb_or*/
+#if PY_VERSION_HEX < 0x03000000
+ 0, /*nb_coerce*/
+#endif
+ (unaryfunc)SwigPyObject_long, /*nb_int*/
+#if PY_VERSION_HEX < 0x03000000
+ (unaryfunc)SwigPyObject_long, /*nb_long*/
+#else
+ 0, /*nb_reserved*/
+#endif
+ (unaryfunc)0, /*nb_float*/
+#if PY_VERSION_HEX < 0x03000000
+ (unaryfunc)SwigPyObject_oct, /*nb_oct*/
+ (unaryfunc)SwigPyObject_hex, /*nb_hex*/
+#endif
+#if PY_VERSION_HEX >= 0x03000000 /* 3.0 */
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_index, nb_inplace_divide removed */
+#elif PY_VERSION_HEX >= 0x02050000 /* 2.5.0 */
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_index */
+#elif PY_VERSION_HEX >= 0x02020000 /* 2.2.0 */
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_inplace_true_divide */
+#elif PY_VERSION_HEX >= 0x02000000 /* 2.0.0 */
+ 0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_inplace_or */
+#endif
+ };
+
+ static PyTypeObject swigpyobject_type;
+ static int type_init = 0;
+ if (!type_init) {
+ const PyTypeObject tmp = {
+ /* PyObject header changed in Python 3 */
+#if PY_VERSION_HEX >= 0x03000000
+ PyVarObject_HEAD_INIT(NULL, 0)
+#else
+ PyObject_HEAD_INIT(NULL)
+ 0, /* ob_size */
+#endif
+ (char *)"SwigPyObject", /* tp_name */
+ sizeof(SwigPyObject), /* tp_basicsize */
+ 0, /* tp_itemsize */
+ (destructor)SwigPyObject_dealloc, /* tp_dealloc */
+ 0, /* tp_print */
+#if PY_VERSION_HEX < 0x02020000
+ (getattrfunc)SwigPyObject_getattr, /* tp_getattr */
+#else
+ (getattrfunc)0, /* tp_getattr */
+#endif
+ (setattrfunc)0, /* tp_setattr */
+#if PY_VERSION_HEX >= 0x03000000
+ 0, /* tp_reserved in 3.0.1, tp_compare in 3.0.0 but not used */
+#else
+ (cmpfunc)SwigPyObject_compare, /* tp_compare */
+#endif
+ (reprfunc)SwigPyObject_repr, /* tp_repr */
+ &SwigPyObject_as_number, /* tp_as_number */
+ 0, /* tp_as_sequence */
+ 0, /* tp_as_mapping */
+ (hashfunc)0, /* tp_hash */
+ (ternaryfunc)0, /* tp_call */
+ 0, /* tp_str */
+ PyObject_GenericGetAttr, /* tp_getattro */
+ 0, /* tp_setattro */
+ 0, /* tp_as_buffer */
+ Py_TPFLAGS_DEFAULT, /* tp_flags */
+ swigobject_doc, /* tp_doc */
+ 0, /* tp_traverse */
+ 0, /* tp_clear */
+ (richcmpfunc)SwigPyObject_richcompare,/* tp_richcompare */
+ 0, /* tp_weaklistoffset */
+#if PY_VERSION_HEX >= 0x02020000
+ 0, /* tp_iter */
+ 0, /* tp_iternext */
+ swigobject_methods, /* tp_methods */
+ 0, /* tp_members */
+ 0, /* tp_getset */
+ 0, /* tp_base */
+ 0, /* tp_dict */
+ 0, /* tp_descr_get */
+ 0, /* tp_descr_set */
+ 0, /* tp_dictoffset */
+ 0, /* tp_init */
+ 0, /* tp_alloc */
+ 0, /* tp_new */
+ 0, /* tp_free */
+ 0, /* tp_is_gc */
+ 0, /* tp_bases */
+ 0, /* tp_mro */
+ 0, /* tp_cache */
+ 0, /* tp_subclasses */
+ 0, /* tp_weaklist */
+#endif
+#if PY_VERSION_HEX >= 0x02030000
+ 0, /* tp_del */
+#endif
+#if PY_VERSION_HEX >= 0x02060000
+ 0, /* tp_version */
+#endif
+#ifdef COUNT_ALLOCS
+ 0,0,0,0 /* tp_alloc -> tp_next */
+#endif
+ };
+ swigpyobject_type = tmp;
+ type_init = 1;
+#if PY_VERSION_HEX < 0x02020000
+ swigpyobject_type.ob_type = &PyType_Type;
+#else
+ if (PyType_Ready(&swigpyobject_type) < 0)
+ return NULL;
+#endif
+ }
+ return &swigpyobject_type;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_New(void *ptr, swig_type_info *ty, int own)
+{
+ SwigPyObject *sobj = PyObject_NEW(SwigPyObject, SwigPyObject_type());
+ if (sobj) {
+ sobj->ptr = ptr;
+ sobj->ty = ty;
+ sobj->own = own;
+ sobj->next = 0;
+ }
+ return (PyObject *)sobj;
+}
+
+/* -----------------------------------------------------------------------------
+ * Implements a simple Swig Packed type, and use it instead of string
+ * ----------------------------------------------------------------------------- */
+
+typedef struct {
+ PyObject_HEAD
+ void *pack;
+ swig_type_info *ty;
+ size_t size;
+} SwigPyPacked;
+
+SWIGRUNTIME int
+SwigPyPacked_print(SwigPyPacked *v, FILE *fp, int SWIGUNUSEDPARM(flags))
+{
+ char result[SWIG_BUFFER_SIZE];
+ fputs("<Swig Packed ", fp);
+ if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))) {
+ fputs("at ", fp);
+ fputs(result, fp);
+ }
+ fputs(v->ty->name,fp);
+ fputs(">", fp);
+ return 0;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyPacked_repr(SwigPyPacked *v)
+{
+ char result[SWIG_BUFFER_SIZE];
+ if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))) {
+ return SWIG_Python_str_FromFormat("<Swig Packed at %s%s>", result, v->ty->name);
+ } else {
+ return SWIG_Python_str_FromFormat("<Swig Packed %s>", v->ty->name);
+ }
+}
+
+SWIGRUNTIME PyObject *
+SwigPyPacked_str(SwigPyPacked *v)
+{
+ char result[SWIG_BUFFER_SIZE];
+ if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))){
+ return SWIG_Python_str_FromFormat("%s%s", result, v->ty->name);
+ } else {
+ return SWIG_Python_str_FromChar(v->ty->name);
+ }
+}
+
+SWIGRUNTIME int
+SwigPyPacked_compare(SwigPyPacked *v, SwigPyPacked *w)
+{
+ size_t i = v->size;
+ size_t j = w->size;
+ int s = (i < j) ? -1 : ((i > j) ? 1 : 0);
+ return s ? s : strncmp((char *)v->pack, (char *)w->pack, 2*v->size);
+}
+
+SWIGRUNTIME PyTypeObject* SwigPyPacked_TypeOnce(void);
+
+SWIGRUNTIME PyTypeObject*
+SwigPyPacked_type(void) {
+ static PyTypeObject *SWIG_STATIC_POINTER(type) = SwigPyPacked_TypeOnce();
+ return type;
+}
+
+SWIGRUNTIMEINLINE int
+SwigPyPacked_Check(PyObject *op) {
+ return ((op)->ob_type == SwigPyPacked_TypeOnce())
+ || (strcmp((op)->ob_type->tp_name,"SwigPyPacked") == 0);
+}
+
+SWIGRUNTIME void
+SwigPyPacked_dealloc(PyObject *v)
+{
+ if (SwigPyPacked_Check(v)) {
+ SwigPyPacked *sobj = (SwigPyPacked *) v;
+ free(sobj->pack);
+ }
+ PyObject_DEL(v);
+}
+
+SWIGRUNTIME PyTypeObject*
+SwigPyPacked_TypeOnce(void) {
+ static char swigpacked_doc[] = "Swig object carries a C/C++ instance pointer";
+ static PyTypeObject swigpypacked_type;
+ static int type_init = 0;
+ if (!type_init) {
+ const PyTypeObject tmp = {
+ /* PyObject header changed in Python 3 */
+#if PY_VERSION_HEX>=0x03000000
+ PyVarObject_HEAD_INIT(NULL, 0)
+#else
+ PyObject_HEAD_INIT(NULL)
+ 0, /* ob_size */
+#endif
+ (char *)"SwigPyPacked", /* tp_name */
+ sizeof(SwigPyPacked), /* tp_basicsize */
+ 0, /* tp_itemsize */
+ (destructor)SwigPyPacked_dealloc, /* tp_dealloc */
+ (printfunc)SwigPyPacked_print, /* tp_print */
+ (getattrfunc)0, /* tp_getattr */
+ (setattrfunc)0, /* tp_setattr */
+#if PY_VERSION_HEX>=0x03000000
+ 0, /* tp_reserved in 3.0.1 */
+#else
+ (cmpfunc)SwigPyPacked_compare, /* tp_compare */
+#endif
+ (reprfunc)SwigPyPacked_repr, /* tp_repr */
+ 0, /* tp_as_number */
+ 0, /* tp_as_sequence */
+ 0, /* tp_as_mapping */
+ (hashfunc)0, /* tp_hash */
+ (ternaryfunc)0, /* tp_call */
+ (reprfunc)SwigPyPacked_str, /* tp_str */
+ PyObject_GenericGetAttr, /* tp_getattro */
+ 0, /* tp_setattro */
+ 0, /* tp_as_buffer */
+ Py_TPFLAGS_DEFAULT, /* tp_flags */
+ swigpacked_doc, /* tp_doc */
+ 0, /* tp_traverse */
+ 0, /* tp_clear */
+ 0, /* tp_richcompare */
+ 0, /* tp_weaklistoffset */
+#if PY_VERSION_HEX >= 0x02020000
+ 0, /* tp_iter */
+ 0, /* tp_iternext */
+ 0, /* tp_methods */
+ 0, /* tp_members */
+ 0, /* tp_getset */
+ 0, /* tp_base */
+ 0, /* tp_dict */
+ 0, /* tp_descr_get */
+ 0, /* tp_descr_set */
+ 0, /* tp_dictoffset */
+ 0, /* tp_init */
+ 0, /* tp_alloc */
+ 0, /* tp_new */
+ 0, /* tp_free */
+ 0, /* tp_is_gc */
+ 0, /* tp_bases */
+ 0, /* tp_mro */
+ 0, /* tp_cache */
+ 0, /* tp_subclasses */
+ 0, /* tp_weaklist */
+#endif
+#if PY_VERSION_HEX >= 0x02030000
+ 0, /* tp_del */
+#endif
+#if PY_VERSION_HEX >= 0x02060000
+ 0, /* tp_version */
+#endif
+#ifdef COUNT_ALLOCS
+ 0,0,0,0 /* tp_alloc -> tp_next */
+#endif
+ };
+ swigpypacked_type = tmp;
+ type_init = 1;
+#if PY_VERSION_HEX < 0x02020000
+ swigpypacked_type.ob_type = &PyType_Type;
+#else
+ if (PyType_Ready(&swigpypacked_type) < 0)
+ return NULL;
+#endif
+ }
+ return &swigpypacked_type;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyPacked_New(void *ptr, size_t size, swig_type_info *ty)
+{
+ SwigPyPacked *sobj = PyObject_NEW(SwigPyPacked, SwigPyPacked_type());
+ if (sobj) {
+ void *pack = malloc(size);
+ if (pack) {
+ memcpy(pack, ptr, size);
+ sobj->pack = pack;
+ sobj->ty = ty;
+ sobj->size = size;
+ } else {
+ PyObject_DEL((PyObject *) sobj);
+ sobj = 0;
+ }
+ }
+ return (PyObject *) sobj;
+}
+
+SWIGRUNTIME swig_type_info *
+SwigPyPacked_UnpackData(PyObject *obj, void *ptr, size_t size)
+{
+ if (SwigPyPacked_Check(obj)) {
+ SwigPyPacked *sobj = (SwigPyPacked *)obj;
+ if (sobj->size != size) return 0;
+ memcpy(ptr, sobj->pack, size);
+ return sobj->ty;
+ } else {
+ return 0;
+ }
+}
+
+/* -----------------------------------------------------------------------------
+ * pointers/data manipulation
+ * ----------------------------------------------------------------------------- */
+
+SWIGRUNTIMEINLINE PyObject *
+_SWIG_This(void)
+{
+ return SWIG_Python_str_FromChar("this");
+}
+
+static PyObject *swig_this = NULL;
+
+SWIGRUNTIME PyObject *
+SWIG_This(void)
+{
+ if (swig_this == NULL)
+ swig_this = _SWIG_This();
+ return swig_this;
+}
+
+/* #define SWIG_PYTHON_SLOW_GETSET_THIS */
+
+/* TODO: I don't know how to implement the fast getset in Python 3 right now */
+#if PY_VERSION_HEX>=0x03000000
+#define SWIG_PYTHON_SLOW_GETSET_THIS
+#endif
+
+SWIGRUNTIME SwigPyObject *
+SWIG_Python_GetSwigThis(PyObject *pyobj)
+{
+ PyObject *obj;
+
+ if (SwigPyObject_Check(pyobj))
+ return (SwigPyObject *) pyobj;
+
+#ifdef SWIGPYTHON_BUILTIN
+ (void)obj;
+# ifdef PyWeakref_CheckProxy
+ if (PyWeakref_CheckProxy(pyobj)) {
+ pyobj = PyWeakref_GET_OBJECT(pyobj);
+ if (pyobj && SwigPyObject_Check(pyobj))
+ return (SwigPyObject*) pyobj;
+ }
+# endif
+ return NULL;
+#else
+
+ obj = 0;
+
+#if (!defined(SWIG_PYTHON_SLOW_GETSET_THIS) && (PY_VERSION_HEX >= 0x02030000))
+ if (PyInstance_Check(pyobj)) {
+ obj = _PyInstance_Lookup(pyobj, SWIG_This());
+ } else {
+ PyObject **dictptr = _PyObject_GetDictPtr(pyobj);
+ if (dictptr != NULL) {
+ PyObject *dict = *dictptr;
+ obj = dict ? PyDict_GetItem(dict, SWIG_This()) : 0;
+ } else {
+#ifdef PyWeakref_CheckProxy
+ if (PyWeakref_CheckProxy(pyobj)) {
+ PyObject *wobj = PyWeakref_GET_OBJECT(pyobj);
+ return wobj ? SWIG_Python_GetSwigThis(wobj) : 0;
+ }
+#endif
+ obj = PyObject_GetAttr(pyobj,SWIG_This());
+ if (obj) {
+ Py_DECREF(obj);
+ } else {
+ if (PyErr_Occurred()) PyErr_Clear();
+ return 0;
+ }
+ }
+ }
+#else
+ obj = PyObject_GetAttr(pyobj,SWIG_This());
+ if (obj) {
+ Py_DECREF(obj);
+ } else {
+ if (PyErr_Occurred()) PyErr_Clear();
+ return 0;
+ }
+#endif
+ if (obj && !SwigPyObject_Check(obj)) {
+ /* a PyObject is called 'this', try to get the 'real this'
+ SwigPyObject from it */
+ return SWIG_Python_GetSwigThis(obj);
+ }
+ return (SwigPyObject *)obj;
+#endif
+}
+
+/* Acquire a pointer value */
+
+SWIGRUNTIME int
+SWIG_Python_AcquirePtr(PyObject *obj, int own) {
+ if (own == SWIG_POINTER_OWN) {
+ SwigPyObject *sobj = SWIG_Python_GetSwigThis(obj);
+ if (sobj) {
+ int oldown = sobj->own;
+ sobj->own = own;
+ return oldown;
+ }
+ }
+ return 0;
+}
+
+/* Convert a pointer value */
+
+SWIGRUNTIME int
+SWIG_Python_ConvertPtrAndOwn(PyObject *obj, void **ptr, swig_type_info *ty, int flags, int *own) {
+ int res;
+ SwigPyObject *sobj;
+ int implicit_conv = (flags & SWIG_POINTER_IMPLICIT_CONV) != 0;
+
+ if (!obj)
+ return SWIG_ERROR;
+ if (obj == Py_None && !implicit_conv) {
+ if (ptr)
+ *ptr = 0;
+ return SWIG_OK;
+ }
+
+ res = SWIG_ERROR;
+
+ sobj = SWIG_Python_GetSwigThis(obj);
+ if (own)
+ *own = 0;
+ while (sobj) {
+ void *vptr = sobj->ptr;
+ if (ty) {
+ swig_type_info *to = sobj->ty;
+ if (to == ty) {
+ /* no type cast needed */
+ if (ptr) *ptr = vptr;
+ break;
+ } else {
+ swig_cast_info *tc = SWIG_TypeCheck(to->name,ty);
+ if (!tc) {
+ sobj = (SwigPyObject *)sobj->next;
+ } else {
+ if (ptr) {
+ int newmemory = 0;
+ *ptr = SWIG_TypeCast(tc,vptr,&newmemory);
+ if (newmemory == SWIG_CAST_NEW_MEMORY) {
+ assert(own); /* badly formed typemap which will lead to a memory leak - it must set and use own to delete *ptr */
+ if (own)
+ *own = *own | SWIG_CAST_NEW_MEMORY;
+ }
+ }
+ break;
+ }
+ }
+ } else {
+ if (ptr) *ptr = vptr;
+ break;
+ }
+ }
+ if (sobj) {
+ if (own)
+ *own = *own | sobj->own;
+ if (flags & SWIG_POINTER_DISOWN) {
+ sobj->own = 0;
+ }
+ res = SWIG_OK;
+ } else {
+ if (implicit_conv) {
+ SwigPyClientData *data = ty ? (SwigPyClientData *) ty->clientdata : 0;
+ if (data && !data->implicitconv) {
+ PyObject *klass = data->klass;
+ if (klass) {
+ PyObject *impconv;
+ data->implicitconv = 1; /* avoid recursion and call 'explicit' constructors*/
+ impconv = SWIG_Python_CallFunctor(klass, obj);
+ data->implicitconv = 0;
+ if (PyErr_Occurred()) {
+ PyErr_Clear();
+ impconv = 0;
+ }
+ if (impconv) {
+ SwigPyObject *iobj = SWIG_Python_GetSwigThis(impconv);
+ if (iobj) {
+ void *vptr;
+ res = SWIG_Python_ConvertPtrAndOwn((PyObject*)iobj, &vptr, ty, 0, 0);
+ if (SWIG_IsOK(res)) {
+ if (ptr) {
+ *ptr = vptr;
+ /* transfer the ownership to 'ptr' */
+ iobj->own = 0;
+ res = SWIG_AddCast(res);
+ res = SWIG_AddNewMask(res);
+ } else {
+ res = SWIG_AddCast(res);
+ }
+ }
+ }
+ Py_DECREF(impconv);
+ }
+ }
+ }
+ }
+ if (!SWIG_IsOK(res) && obj == Py_None) {
+ if (ptr)
+ *ptr = 0;
+ if (PyErr_Occurred())
+ PyErr_Clear();
+ res = SWIG_OK;
+ }
+ }
+ return res;
+}
+
+/* Convert a function ptr value */
+
+SWIGRUNTIME int
+SWIG_Python_ConvertFunctionPtr(PyObject *obj, void **ptr, swig_type_info *ty) {
+ if (!PyCFunction_Check(obj)) {
+ return SWIG_ConvertPtr(obj, ptr, ty, 0);
+ } else {
+ void *vptr = 0;
+
+ /* here we get the method pointer for callbacks */
+ const char *doc = (((PyCFunctionObject *)obj) -> m_ml -> ml_doc);
+ const char *desc = doc ? strstr(doc, "swig_ptr: ") : 0;
+ if (desc)
+ desc = ty ? SWIG_UnpackVoidPtr(desc + 10, &vptr, ty->name) : 0;
+ if (!desc)
+ return SWIG_ERROR;
+ if (ty) {
+ swig_cast_info *tc = SWIG_TypeCheck(desc,ty);
+ if (tc) {
+ int newmemory = 0;
+ *ptr = SWIG_TypeCast(tc,vptr,&newmemory);
+ assert(!newmemory); /* newmemory handling not yet implemented */
+ } else {
+ return SWIG_ERROR;
+ }
+ } else {
+ *ptr = vptr;
+ }
+ return SWIG_OK;
+ }
+}
+
+/* Convert a packed value value */
+
+SWIGRUNTIME int
+SWIG_Python_ConvertPacked(PyObject *obj, void *ptr, size_t sz, swig_type_info *ty) {
+ swig_type_info *to = SwigPyPacked_UnpackData(obj, ptr, sz);
+ if (!to) return SWIG_ERROR;
+ if (ty) {
+ if (to != ty) {
+ /* check type cast? */
+ swig_cast_info *tc = SWIG_TypeCheck(to->name,ty);
+ if (!tc) return SWIG_ERROR;
+ }
+ }
+ return SWIG_OK;
+}
+
+/* -----------------------------------------------------------------------------
+ * Create a new pointer object
+ * ----------------------------------------------------------------------------- */
+
+/*
+ Create a new instance object, without calling __init__, and set the
+ 'this' attribute.
+*/
+
+SWIGRUNTIME PyObject*
+SWIG_Python_NewShadowInstance(SwigPyClientData *data, PyObject *swig_this)
+{
+#if (PY_VERSION_HEX >= 0x02020000)
+ PyObject *inst = 0;
+ PyObject *newraw = data->newraw;
+ if (newraw) {
+ inst = PyObject_Call(newraw, data->newargs, NULL);
+ if (inst) {
+#if !defined(SWIG_PYTHON_SLOW_GETSET_THIS)
+ PyObject **dictptr = _PyObject_GetDictPtr(inst);
+ if (dictptr != NULL) {
+ PyObject *dict = *dictptr;
+ if (dict == NULL) {
+ dict = PyDict_New();
+ *dictptr = dict;
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ }
+ }
+#else
+ PyObject *key = SWIG_This();
+ PyObject_SetAttr(inst, key, swig_this);
+#endif
+ }
+ } else {
+#if PY_VERSION_HEX >= 0x03000000
+ inst = PyBaseObject_Type.tp_new((PyTypeObject*) data->newargs, Py_None, Py_None);
+ if (inst) {
+ PyObject_SetAttr(inst, SWIG_This(), swig_this);
+ Py_TYPE(inst)->tp_flags &= ~Py_TPFLAGS_VALID_VERSION_TAG;
+ }
+#else
+ PyObject *dict = PyDict_New();
+ if (dict) {
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ inst = PyInstance_NewRaw(data->newargs, dict);
+ Py_DECREF(dict);
+ }
+#endif
+ }
+ return inst;
+#else
+#if (PY_VERSION_HEX >= 0x02010000)
+ PyObject *inst = 0;
+ PyObject *dict = PyDict_New();
+ if (dict) {
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ inst = PyInstance_NewRaw(data->newargs, dict);
+ Py_DECREF(dict);
+ }
+ return (PyObject *) inst;
+#else
+ PyInstanceObject *inst = PyObject_NEW(PyInstanceObject, &PyInstance_Type);
+ if (inst == NULL) {
+ return NULL;
+ }
+ inst->in_class = (PyClassObject *)data->newargs;
+ Py_INCREF(inst->in_class);
+ inst->in_dict = PyDict_New();
+ if (inst->in_dict == NULL) {
+ Py_DECREF(inst);
+ return NULL;
+ }
+#ifdef Py_TPFLAGS_HAVE_WEAKREFS
+ inst->in_weakreflist = NULL;
+#endif
+#ifdef Py_TPFLAGS_GC
+ PyObject_GC_Init(inst);
+#endif
+ PyDict_SetItem(inst->in_dict, SWIG_This(), swig_this);
+ return (PyObject *) inst;
+#endif
+#endif
+}
+
+SWIGRUNTIME void
+SWIG_Python_SetSwigThis(PyObject *inst, PyObject *swig_this)
+{
+ PyObject *dict;
+#if (PY_VERSION_HEX >= 0x02020000) && !defined(SWIG_PYTHON_SLOW_GETSET_THIS)
+ PyObject **dictptr = _PyObject_GetDictPtr(inst);
+ if (dictptr != NULL) {
+ dict = *dictptr;
+ if (dict == NULL) {
+ dict = PyDict_New();
+ *dictptr = dict;
+ }
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ return;
+ }
+#endif
+ dict = PyObject_GetAttrString(inst, (char*)"__dict__");
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ Py_DECREF(dict);
+}
+
+
+SWIGINTERN PyObject *
+SWIG_Python_InitShadowInstance(PyObject *args) {
+ PyObject *obj[2];
+ if (!SWIG_Python_UnpackTuple(args, "swiginit", 2, 2, obj)) {
+ return NULL;
+ } else {
+ SwigPyObject *sthis = SWIG_Python_GetSwigThis(obj[0]);
+ if (sthis) {
+ SwigPyObject_append((PyObject*) sthis, obj[1]);
+ } else {
+ SWIG_Python_SetSwigThis(obj[0], obj[1]);
+ }
+ return SWIG_Py_Void();
+ }
+}
+
+/* Create a new pointer object */
+
+SWIGRUNTIME PyObject *
+SWIG_Python_NewPointerObj(PyObject *self, void *ptr, swig_type_info *type, int flags) {
+ SwigPyClientData *clientdata;
+ PyObject * robj;
+ int own;
+
+ if (!ptr)
+ return SWIG_Py_Void();
+
+ clientdata = type ? (SwigPyClientData *)(type->clientdata) : 0;
+ own = (flags & SWIG_POINTER_OWN) ? SWIG_POINTER_OWN : 0;
+ if (clientdata && clientdata->pytype) {
+ SwigPyObject *newobj;
+ if (flags & SWIG_BUILTIN_TP_INIT) {
+ newobj = (SwigPyObject*) self;
+ if (newobj->ptr) {
+ PyObject *next_self = clientdata->pytype->tp_alloc(clientdata->pytype, 0);
+ while (newobj->next)
+ newobj = (SwigPyObject *) newobj->next;
+ newobj->next = next_self;
+ newobj = (SwigPyObject *)next_self;
+ }
+ } else {
+ newobj = PyObject_New(SwigPyObject, clientdata->pytype);
+ }
+ if (newobj) {
+ newobj->ptr = ptr;
+ newobj->ty = type;
+ newobj->own = own;
+ newobj->next = 0;
+#ifdef SWIGPYTHON_BUILTIN
+ newobj->dict = 0;
+#endif
+ return (PyObject*) newobj;
+ }
+ return SWIG_Py_Void();
+ }
+
+ assert(!(flags & SWIG_BUILTIN_TP_INIT));
+
+ robj = SwigPyObject_New(ptr, type, own);
+ if (robj && clientdata && !(flags & SWIG_POINTER_NOSHADOW)) {
+ PyObject *inst = SWIG_Python_NewShadowInstance(clientdata, robj);
+ Py_DECREF(robj);
+ robj = inst;
+ }
+ return robj;
+}
+
+/* Create a new packed object */
+
+SWIGRUNTIMEINLINE PyObject *
+SWIG_Python_NewPackedObj(void *ptr, size_t sz, swig_type_info *type) {
+ return ptr ? SwigPyPacked_New((void *) ptr, sz, type) : SWIG_Py_Void();
+}
+
+/* -----------------------------------------------------------------------------*
+ * Get type list
+ * -----------------------------------------------------------------------------*/
+
+#ifdef SWIG_LINK_RUNTIME
+void *SWIG_ReturnGlobalTypeList(void *);
+#endif
+
+SWIGRUNTIME swig_module_info *
+SWIG_Python_GetModule(void *SWIGUNUSEDPARM(clientdata)) {
+ static void *type_pointer = (void *)0;
+ /* first check if module already created */
+ if (!type_pointer) {
+#ifdef SWIG_LINK_RUNTIME
+ type_pointer = SWIG_ReturnGlobalTypeList((void *)0);
+#else
+# ifdef SWIGPY_USE_CAPSULE
+ type_pointer = PyCapsule_Import(SWIGPY_CAPSULE_NAME, 0);
+# else
+ type_pointer = PyCObject_Import((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION,
+ (char*)"type_pointer" SWIG_TYPE_TABLE_NAME);
+# endif
+ if (PyErr_Occurred()) {
+ PyErr_Clear();
+ type_pointer = (void *)0;
+ }
+#endif
+ }
+ return (swig_module_info *) type_pointer;
+}
+
+#if PY_MAJOR_VERSION < 2
+/* PyModule_AddObject function was introduced in Python 2.0. The following function
+ is copied out of Python/modsupport.c in python version 2.3.4 */
+SWIGINTERN int
+PyModule_AddObject(PyObject *m, char *name, PyObject *o)
+{
+ PyObject *dict;
+ if (!PyModule_Check(m)) {
+ PyErr_SetString(PyExc_TypeError,
+ "PyModule_AddObject() needs module as first arg");
+ return SWIG_ERROR;
+ }
+ if (!o) {
+ PyErr_SetString(PyExc_TypeError,
+ "PyModule_AddObject() needs non-NULL value");
+ return SWIG_ERROR;
+ }
+
+ dict = PyModule_GetDict(m);
+ if (dict == NULL) {
+ /* Internal error -- modules must have a dict! */
+ PyErr_Format(PyExc_SystemError, "module '%s' has no __dict__",
+ PyModule_GetName(m));
+ return SWIG_ERROR;
+ }
+ if (PyDict_SetItemString(dict, name, o))
+ return SWIG_ERROR;
+ Py_DECREF(o);
+ return SWIG_OK;
+}
+#endif
+
+SWIGRUNTIME void
+#ifdef SWIGPY_USE_CAPSULE
+SWIG_Python_DestroyModule(PyObject *obj)
+#else
+SWIG_Python_DestroyModule(void *vptr)
+#endif
+{
+#ifdef SWIGPY_USE_CAPSULE
+ swig_module_info *swig_module = (swig_module_info *) PyCapsule_GetPointer(obj, SWIGPY_CAPSULE_NAME);
+#else
+ swig_module_info *swig_module = (swig_module_info *) vptr;
+#endif
+ swig_type_info **types = swig_module->types;
+ size_t i;
+ for (i =0; i < swig_module->size; ++i) {
+ swig_type_info *ty = types[i];
+ if (ty->owndata) {
+ SwigPyClientData *data = (SwigPyClientData *) ty->clientdata;
+ if (data) SwigPyClientData_Del(data);
+ }
+ }
+ Py_DECREF(SWIG_This());
+ swig_this = NULL;
+}
+
+SWIGRUNTIME void
+SWIG_Python_SetModule(swig_module_info *swig_module) {
+#if PY_VERSION_HEX >= 0x03000000
+ /* Add a dummy module object into sys.modules */
+ PyObject *module = PyImport_AddModule((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION);
+#else
+ static PyMethodDef swig_empty_runtime_method_table[] = { {NULL, NULL, 0, NULL} }; /* Sentinel */
+ PyObject *module = Py_InitModule((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION, swig_empty_runtime_method_table);
+#endif
+#ifdef SWIGPY_USE_CAPSULE
+ PyObject *pointer = PyCapsule_New((void *) swig_module, SWIGPY_CAPSULE_NAME, SWIG_Python_DestroyModule);
+ if (pointer && module) {
+ PyModule_AddObject(module, (char*)"type_pointer_capsule" SWIG_TYPE_TABLE_NAME, pointer);
+ } else {
+ Py_XDECREF(pointer);
+ }
+#else
+ PyObject *pointer = PyCObject_FromVoidPtr((void *) swig_module, SWIG_Python_DestroyModule);
+ if (pointer && module) {
+ PyModule_AddObject(module, (char*)"type_pointer" SWIG_TYPE_TABLE_NAME, pointer);
+ } else {
+ Py_XDECREF(pointer);
+ }
+#endif
+}
+
+/* The python cached type query */
+SWIGRUNTIME PyObject *
+SWIG_Python_TypeCache(void) {
+ static PyObject *SWIG_STATIC_POINTER(cache) = PyDict_New();
+ return cache;
+}
+
+SWIGRUNTIME swig_type_info *
+SWIG_Python_TypeQuery(const char *type)
+{
+ PyObject *cache = SWIG_Python_TypeCache();
+ PyObject *key = SWIG_Python_str_FromChar(type);
+ PyObject *obj = PyDict_GetItem(cache, key);
+ swig_type_info *descriptor;
+ if (obj) {
+#ifdef SWIGPY_USE_CAPSULE
+ descriptor = (swig_type_info *) PyCapsule_GetPointer(obj, NULL);
+#else
+ descriptor = (swig_type_info *) PyCObject_AsVoidPtr(obj);
+#endif
+ } else {
+ swig_module_info *swig_module = SWIG_GetModule(0);
+ descriptor = SWIG_TypeQueryModule(swig_module, swig_module, type);
+ if (descriptor) {
+#ifdef SWIGPY_USE_CAPSULE
+ obj = PyCapsule_New((void*) descriptor, NULL, NULL);
+#else
+ obj = PyCObject_FromVoidPtr(descriptor, NULL);
+#endif
+ PyDict_SetItem(cache, key, obj);
+ Py_DECREF(obj);
+ }
+ }
+ Py_DECREF(key);
+ return descriptor;
+}
+
+/*
+ For backward compatibility only
+*/
+#define SWIG_POINTER_EXCEPTION 0
+#define SWIG_arg_fail(arg) SWIG_Python_ArgFail(arg)
+#define SWIG_MustGetPtr(p, type, argnum, flags) SWIG_Python_MustGetPtr(p, type, argnum, flags)
+
+SWIGRUNTIME int
+SWIG_Python_AddErrMesg(const char* mesg, int infront)
+{
+ if (PyErr_Occurred()) {
+ PyObject *type = 0;
+ PyObject *value = 0;
+ PyObject *traceback = 0;
+ PyErr_Fetch(&type, &value, &traceback);
+ if (value) {
+ char *tmp;
+ PyObject *old_str = PyObject_Str(value);
+ Py_XINCREF(type);
+ PyErr_Clear();
+ if (infront) {
+ PyErr_Format(type, "%s %s", mesg, tmp = SWIG_Python_str_AsChar(old_str));
+ } else {
+ PyErr_Format(type, "%s %s", tmp = SWIG_Python_str_AsChar(old_str), mesg);
+ }
+ SWIG_Python_str_DelForPy3(tmp);
+ Py_DECREF(old_str);
+ }
+ return 1;
+ } else {
+ return 0;
+ }
+}
+
+SWIGRUNTIME int
+SWIG_Python_ArgFail(int argnum)
+{
+ if (PyErr_Occurred()) {
+ /* add information about failing argument */
+ char mesg[256];
+ PyOS_snprintf(mesg, sizeof(mesg), "argument number %d:", argnum);
+ return SWIG_Python_AddErrMesg(mesg, 1);
+ } else {
+ return 0;
+ }
+}
+
+SWIGRUNTIMEINLINE const char *
+SwigPyObject_GetDesc(PyObject *self)
+{
+ SwigPyObject *v = (SwigPyObject *)self;
+ swig_type_info *ty = v ? v->ty : 0;
+ return ty ? ty->str : "";
+}
+
+SWIGRUNTIME void
+SWIG_Python_TypeError(const char *type, PyObject *obj)
+{
+ if (type) {
+#if defined(SWIG_COBJECT_TYPES)
+ if (obj && SwigPyObject_Check(obj)) {
+ const char *otype = (const char *) SwigPyObject_GetDesc(obj);
+ if (otype) {
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected, 'SwigPyObject(%s)' is received",
+ type, otype);
+ return;
+ }
+ } else
+#endif
+ {
+ const char *otype = (obj ? obj->ob_type->tp_name : 0);
+ if (otype) {
+ PyObject *str = PyObject_Str(obj);
+ const char *cstr = str ? SWIG_Python_str_AsChar(str) : 0;
+ if (cstr) {
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected, '%s(%s)' is received",
+ type, otype, cstr);
+ SWIG_Python_str_DelForPy3(cstr);
+ } else {
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected, '%s' is received",
+ type, otype);
+ }
+ Py_XDECREF(str);
+ return;
+ }
+ }
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected", type);
+ } else {
+ PyErr_Format(PyExc_TypeError, "unexpected type is received");
+ }
+}
+
+
+/* Convert a pointer value, signal an exception on a type mismatch */
+SWIGRUNTIME void *
+SWIG_Python_MustGetPtr(PyObject *obj, swig_type_info *ty, int SWIGUNUSEDPARM(argnum), int flags) {
+ void *result;
+ if (SWIG_Python_ConvertPtr(obj, &result, ty, flags) == -1) {
+ PyErr_Clear();
+#if SWIG_POINTER_EXCEPTION
+ if (flags) {
+ SWIG_Python_TypeError(SWIG_TypePrettyName(ty), obj);
+ SWIG_Python_ArgFail(argnum);
+ }
+#endif
+ }
+ return result;
+}
+
+#ifdef SWIGPYTHON_BUILTIN
+SWIGRUNTIME int
+SWIG_Python_NonDynamicSetAttr(PyObject *obj, PyObject *name, PyObject *value) {
+ PyTypeObject *tp = obj->ob_type;
+ PyObject *descr;
+ PyObject *encoded_name;
+ descrsetfunc f;
+ int res = -1;
+
+# ifdef Py_USING_UNICODE
+ if (PyString_Check(name)) {
+ name = PyUnicode_Decode(PyString_AsString(name), PyString_Size(name), NULL, NULL);
+ if (!name)
+ return -1;
+ } else if (!PyUnicode_Check(name))
+# else
+ if (!PyString_Check(name))
+# endif
+ {
+ PyErr_Format(PyExc_TypeError, "attribute name must be string, not '%.200s'", name->ob_type->tp_name);
+ return -1;
+ } else {
+ Py_INCREF(name);
+ }
+
+ if (!tp->tp_dict) {
+ if (PyType_Ready(tp) < 0)
+ goto done;
+ }
+
+ descr = _PyType_Lookup(tp, name);
+ f = NULL;
+ if (descr != NULL)
+ f = descr->ob_type->tp_descr_set;
+ if (!f) {
+ if (PyString_Check(name)) {
+ encoded_name = name;
+ Py_INCREF(name);
+ } else {
+ encoded_name = PyUnicode_AsUTF8String(name);
+ }
+ PyErr_Format(PyExc_AttributeError, "'%.100s' object has no attribute '%.200s'", tp->tp_name, PyString_AsString(encoded_name));
+ Py_DECREF(encoded_name);
+ } else {
+ res = f(descr, obj, value);
+ }
+
+ done:
+ Py_DECREF(name);
+ return res;
+}
+#endif
+
+
+#ifdef __cplusplus
+}
+#endif
+
+
+
+#define SWIG_exception_fail(code, msg) do { SWIG_Error(code, msg); SWIG_fail; } while(0)
+
+#define SWIG_contract_assert(expr, msg) if (!(expr)) { SWIG_Error(SWIG_RuntimeError, msg); SWIG_fail; } else
+
+
+
+ #define SWIG_exception(code, msg) do { SWIG_Error(code, msg); SWIG_fail;; } while(0)
+
+
+/* -------- TYPES TABLE (BEGIN) -------- */
+
+#define SWIGTYPE_p_char swig_types[0]
+#define SWIGTYPE_p_int swig_types[1]
+#define SWIGTYPE_p_long_long swig_types[2]
+#define SWIGTYPE_p_qpol_avrule swig_types[3]
+#define SWIGTYPE_p_qpol_bool swig_types[4]
+#define SWIGTYPE_p_qpol_capability swig_types[5]
+#define SWIGTYPE_p_qpol_cat swig_types[6]
+#define SWIGTYPE_p_qpol_class swig_types[7]
+#define SWIGTYPE_p_qpol_common swig_types[8]
+#define SWIGTYPE_p_qpol_cond swig_types[9]
+#define SWIGTYPE_p_qpol_cond_expr_node swig_types[10]
+#define SWIGTYPE_p_qpol_constraint swig_types[11]
+#define SWIGTYPE_p_qpol_constraint_expr_node swig_types[12]
+#define SWIGTYPE_p_qpol_context swig_types[13]
+#define SWIGTYPE_p_qpol_default_object swig_types[14]
+#define SWIGTYPE_p_qpol_devicetreecon swig_types[15]
+#define SWIGTYPE_p_qpol_filename_trans swig_types[16]
+#define SWIGTYPE_p_qpol_fs_use swig_types[17]
+#define SWIGTYPE_p_qpol_genfscon swig_types[18]
+#define SWIGTYPE_p_qpol_iomemcon swig_types[19]
+#define SWIGTYPE_p_qpol_ioportcon swig_types[20]
+#define SWIGTYPE_p_qpol_isid swig_types[21]
+#define SWIGTYPE_p_qpol_iterator swig_types[22]
+#define SWIGTYPE_p_qpol_level swig_types[23]
+#define SWIGTYPE_p_qpol_mls_level swig_types[24]
+#define SWIGTYPE_p_qpol_mls_range swig_types[25]
+#define SWIGTYPE_p_qpol_netifcon swig_types[26]
+#define SWIGTYPE_p_qpol_nodecon swig_types[27]
+#define SWIGTYPE_p_qpol_pcidevicecon swig_types[28]
+#define SWIGTYPE_p_qpol_pirqcon swig_types[29]
+#define SWIGTYPE_p_qpol_polcap swig_types[30]
+#define SWIGTYPE_p_qpol_policy swig_types[31]
+#define SWIGTYPE_p_qpol_portcon swig_types[32]
+#define SWIGTYPE_p_qpol_range_trans swig_types[33]
+#define SWIGTYPE_p_qpol_role swig_types[34]
+#define SWIGTYPE_p_qpol_role_allow swig_types[35]
+#define SWIGTYPE_p_qpol_role_trans swig_types[36]
+#define SWIGTYPE_p_qpol_rolebounds swig_types[37]
+#define SWIGTYPE_p_qpol_semantic_level swig_types[38]
+#define SWIGTYPE_p_qpol_terule swig_types[39]
+#define SWIGTYPE_p_qpol_type swig_types[40]
+#define SWIGTYPE_p_qpol_typebounds swig_types[41]
+#define SWIGTYPE_p_qpol_user swig_types[42]
+#define SWIGTYPE_p_qpol_userbounds swig_types[43]
+#define SWIGTYPE_p_qpol_validatetrans swig_types[44]
+#define SWIGTYPE_p_short swig_types[45]
+#define SWIGTYPE_p_signed_char swig_types[46]
+#define SWIGTYPE_p_unsigned_char swig_types[47]
+#define SWIGTYPE_p_unsigned_int swig_types[48]
+#define SWIGTYPE_p_unsigned_long_long swig_types[49]
+#define SWIGTYPE_p_unsigned_short swig_types[50]
+#define SWIGTYPE_p_void swig_types[51]
+static swig_type_info *swig_types[53];
+static swig_module_info swig_module = {swig_types, 52, 0, 0, 0, 0};
+#define SWIG_TypeQuery(name) SWIG_TypeQueryModule(&swig_module, &swig_module, name)
+#define SWIG_MangledTypeQuery(name) SWIG_MangledTypeQueryModule(&swig_module, &swig_module, name)
+
+/* -------- TYPES TABLE (END) -------- */
+
+#if (PY_VERSION_HEX <= 0x02000000)
+# if !defined(SWIG_PYTHON_CLASSIC)
+# error "This python version requires swig to be run with the '-classic' option"
+# endif
+#endif
+
+/*-----------------------------------------------
+ @(target):= _qpol.so
+ ------------------------------------------------*/
+#if PY_VERSION_HEX >= 0x03000000
+# define SWIG_init PyInit__qpol
+
+#else
+# define SWIG_init init_qpol
+
+#endif
+#define SWIG_name "_qpol"
+
+#define SWIGVERSION 0x020011
+#define SWIG_VERSION SWIGVERSION
+
+
+#define SWIG_as_voidptr(a) (void *)((const void *)(a))
+#define SWIG_as_voidptrptr(a) ((void)SWIG_as_voidptr(*a),(void**)(a))
+
+
+#include <sys/stat.h>
+#include <arpa/inet.h>
+#include <sepol/policydb.h>
+#include <sepol/policydb/policydb.h>
+#include "include/qpol/avrule_query.h"
+#include "include/qpol/bool_query.h"
+#include "include/qpol/class_perm_query.h"
+#include "include/qpol/cond_query.h"
+#include "include/qpol/constraint_query.h"
+#include "include/qpol/context_query.h"
+#include "include/qpol/fs_use_query.h"
+#include "include/qpol/genfscon_query.h"
+#include "include/qpol/isid_query.h"
+#include "include/qpol/iterator.h"
+#include "include/qpol/mls_query.h"
+#include "include/qpol/mlsrule_query.h"
+#include "include/qpol/module.h"
+#include "include/qpol/netifcon_query.h"
+#include "include/qpol/nodecon_query.h"
+#include "include/qpol/policy.h"
+#include "include/qpol/policy_extend.h"
+#include "include/qpol/portcon_query.h"
+#include "include/qpol/rbacrule_query.h"
+#include "include/qpol/role_query.h"
+#include "include/qpol/syn_rule_query.h"
+#include "include/qpol/terule_query.h"
+#include "include/qpol/type_query.h"
+#include "include/qpol/user_query.h"
+#include "include/qpol/util.h"
+#include "include/qpol/xen_query.h"
+
+/* Provide hooks so that language-specific modules can define the
+ * callback function, used by the handler in
+ * qpol_policy_open_from_file().
+ */
+SWIGEXPORT qpol_callback_fn_t qpol_swig_message_callback = NULL;
+SWIGEXPORT void * qpol_swig_message_callback_arg = NULL;
+
+
+
+#include <stdint.h> // Use the C99 official header
+
+
+ /* cast void * to char * as it can't have a constructor */
+ const char * to_str(void *x) {
+ return (const char *)x;
+ }
+
+ /* cast a void * to int, while freeing the pointer */
+ int to_int_with_free(void *x) {
+ int i = *(int *)x;
+ free(x);
+ return i;
+ }
+
+
+SWIGINTERN swig_type_info*
+SWIG_pchar_descriptor(void)
+{
+ static int init = 0;
+ static swig_type_info* info = 0;
+ if (!init) {
+ info = SWIG_TypeQuery("_p_char");
+ init = 1;
+ }
+ return info;
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_FromCharPtrAndSize(const char* carray, size_t size)
+{
+ if (carray) {
+ if (size > INT_MAX) {
+ swig_type_info* pchar_descriptor = SWIG_pchar_descriptor();
+ return pchar_descriptor ?
+ SWIG_InternalNewPointerObj((char *)(carray), pchar_descriptor, 0) : SWIG_Py_Void();
+ } else {
+#if PY_VERSION_HEX >= 0x03000000
+ return PyUnicode_FromStringAndSize(carray, (int)(size));
+#else
+ return PyString_FromStringAndSize(carray, (int)(size));
+#endif
+ }
+ } else {
+ return SWIG_Py_Void();
+ }
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_FromCharPtr(const char *cptr)
+{
+ return SWIG_FromCharPtrAndSize(cptr, (cptr ? strlen(cptr) : 0));
+}
+
+
+SWIGINTERNINLINE PyObject*
+ SWIG_From_int (int value)
+{
+ return PyInt_FromLong((long) value);
+}
+
+
+/* C Bridge to Python logging callback */
+__attribute__ ((format(printf, 4, 0)))
+static void qpol_log_callback(void *varg,
+ const qpol_policy_t * p __attribute__ ((unused)),
+ int level,
+ const char *fmt,
+ va_list va_args)
+{
+ /* Expand to a full string to avoid any C format string
+ * or variable args handling when passing to Python
+ */
+
+ PyObject *py_callback, *rc;
+ char *str = NULL;
+
+ if(vasprintf(&str, fmt, va_args) < 0)
+ return;
+
+ py_callback = (PyObject *) varg;
+
+ /* this char* casting doesn't make sense, but this runs afoul of -Werror
+ * otherwise as the Python library doesn't do const char* */
+ rc = PyObject_CallFunction(py_callback, (char*)"(is)", level, str);
+ Py_XDECREF(rc);
+ free(str);
+}
+
+
+SWIGINTERN int
+SWIG_AsCharPtrAndSize(PyObject *obj, char** cptr, size_t* psize, int *alloc)
+{
+#if PY_VERSION_HEX>=0x03000000
+ if (PyUnicode_Check(obj))
+#else
+ if (PyString_Check(obj))
+#endif
+ {
+ char *cstr; Py_ssize_t len;
+#if PY_VERSION_HEX>=0x03000000
+ if (!alloc && cptr) {
+ /* We can't allow converting without allocation, since the internal
+ representation of string in Python 3 is UCS-2/UCS-4 but we require
+ a UTF-8 representation.
+ TODO(bhy) More detailed explanation */
+ return SWIG_RuntimeError;
+ }
+ obj = PyUnicode_AsUTF8String(obj);
+ PyBytes_AsStringAndSize(obj, &cstr, &len);
+ if(alloc) *alloc = SWIG_NEWOBJ;
+#else
+ PyString_AsStringAndSize(obj, &cstr, &len);
+#endif
+ if (cptr) {
+ if (alloc) {
+ /*
+ In python the user should not be able to modify the inner
+ string representation. To warranty that, if you define
+ SWIG_PYTHON_SAFE_CSTRINGS, a new/copy of the python string
+ buffer is always returned.
+
+ The default behavior is just to return the pointer value,
+ so, be careful.
+ */
+#if defined(SWIG_PYTHON_SAFE_CSTRINGS)
+ if (*alloc != SWIG_OLDOBJ)
+#else
+ if (*alloc == SWIG_NEWOBJ)
+#endif
+ {
+ *cptr = (char *)memcpy((char *)malloc((len + 1)*sizeof(char)), cstr, sizeof(char)*(len + 1));
+ *alloc = SWIG_NEWOBJ;
+ }
+ else {
+ *cptr = cstr;
+ *alloc = SWIG_OLDOBJ;
+ }
+ } else {
+ #if PY_VERSION_HEX>=0x03000000
+ assert(0); /* Should never reach here in Python 3 */
+ #endif
+ *cptr = SWIG_Python_str_AsChar(obj);
+ }
+ }
+ if (psize) *psize = len + 1;
+#if PY_VERSION_HEX>=0x03000000
+ Py_XDECREF(obj);
+#endif
+ return SWIG_OK;
+ } else {
+ swig_type_info* pchar_descriptor = SWIG_pchar_descriptor();
+ if (pchar_descriptor) {
+ void* vptr = 0;
+ if (SWIG_ConvertPtr(obj, &vptr, pchar_descriptor, 0) == SWIG_OK) {
+ if (cptr) *cptr = (char *) vptr;
+ if (psize) *psize = vptr ? (strlen((char *)vptr) + 1) : 0;
+ if (alloc) *alloc = SWIG_OLDOBJ;
+ return SWIG_OK;
+ }
+ }
+ }
+ return SWIG_TypeError;
+}
+
+
+
+
+
+#include <limits.h>
+#if !defined(SWIG_NO_LLONG_MAX)
+# if !defined(LLONG_MAX) && defined(__GNUC__) && defined (__LONG_LONG_MAX__)
+# define LLONG_MAX __LONG_LONG_MAX__
+# define LLONG_MIN (-LLONG_MAX - 1LL)
+# define ULLONG_MAX (LLONG_MAX * 2ULL + 1ULL)
+# endif
+#endif
+
+
+SWIGINTERN int
+SWIG_AsVal_double (PyObject *obj, double *val)
+{
+ int res = SWIG_TypeError;
+ if (PyFloat_Check(obj)) {
+ if (val) *val = PyFloat_AsDouble(obj);
+ return SWIG_OK;
+ } else if (PyInt_Check(obj)) {
+ if (val) *val = PyInt_AsLong(obj);
+ return SWIG_OK;
+ } else if (PyLong_Check(obj)) {
+ double v = PyLong_AsDouble(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ int dispatch = 0;
+ double d = PyFloat_AsDouble(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = d;
+ return SWIG_AddCast(SWIG_OK);
+ } else {
+ PyErr_Clear();
+ }
+ if (!dispatch) {
+ long v = PyLong_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_AddCast(SWIG_AddCast(SWIG_OK));
+ } else {
+ PyErr_Clear();
+ }
+ }
+ }
+#endif
+ return res;
+}
+
+
+#include <float.h>
+
+
+#include <math.h>
+
+
+SWIGINTERNINLINE int
+SWIG_CanCastAsInteger(double *d, double min, double max) {
+ double x = *d;
+ if ((min <= x && x <= max)) {
+ double fx = floor(x);
+ double cx = ceil(x);
+ double rd = ((x - fx) < 0.5) ? fx : cx; /* simple rint */
+ if ((errno == EDOM) || (errno == ERANGE)) {
+ errno = 0;
+ } else {
+ double summ, reps, diff;
+ if (rd < x) {
+ diff = x - rd;
+ } else if (rd > x) {
+ diff = rd - x;
+ } else {
+ return 1;
+ }
+ summ = rd + x;
+ reps = diff/summ;
+ if (reps < 8*DBL_EPSILON) {
+ *d = rd;
+ return 1;
+ }
+ }
+ }
+ return 0;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_long (PyObject *obj, long* val)
+{
+ if (PyInt_Check(obj)) {
+ if (val) *val = PyInt_AsLong(obj);
+ return SWIG_OK;
+ } else if (PyLong_Check(obj)) {
+ long v = PyLong_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ int dispatch = 0;
+ long v = PyInt_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_AddCast(SWIG_OK);
+ } else {
+ PyErr_Clear();
+ }
+ if (!dispatch) {
+ double d;
+ int res = SWIG_AddCast(SWIG_AsVal_double (obj,&d));
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, LONG_MIN, LONG_MAX)) {
+ if (val) *val = (long)(d);
+ return res;
+ }
+ }
+ }
+#endif
+ return SWIG_TypeError;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_int (PyObject * obj, int *val)
+{
+ long v;
+ int res = SWIG_AsVal_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v < INT_MIN || v > INT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = (int)(v);
+ }
+ }
+ return res;
+}
+
+SWIGINTERN struct qpol_policy *new_qpol_policy(char const *path,int const options,PyObject *py_callback){
+ qpol_policy_t *p;
+
+ if (!PyCallable_Check(py_callback)) {
+ PyErr_SetString(PyExc_TypeError, "Callback parameter must be callable");
+ return NULL;
+ }
+
+ qpol_policy_open_from_file(path, &p, qpol_log_callback, (void*)py_callback, options);
+ return p;
+ }
+SWIGINTERN void delete_qpol_policy(struct qpol_policy *self){
+ qpol_policy_destroy(&self);
+ }
+SWIGINTERN int qpol_policy_version(struct qpol_policy *self){
+ unsigned int v;
+ (void)qpol_policy_get_policy_version(self, &v); /* only error is on null parameters neither can be here */
+ return (int) v;
+ }
+SWIGINTERN char const *qpol_policy_handle_unknown(struct qpol_policy *self){
+ unsigned int h;
+ qpol_policy_get_policy_handle_unknown(self, &h);
+
+ switch (h) {
+ case SEPOL_DENY_UNKNOWN: return "deny";
+ case SEPOL_REJECT_UNKNOWN: return "reject";
+ case SEPOL_ALLOW_UNKNOWN: return "allow";
+ default: return "unknown";
+ }
+ }
+SWIGINTERN char const *qpol_policy_target_platform(struct qpol_policy *self){
+ int t;
+ (void)qpol_policy_get_target_platform(self, &t);
+ switch (t) {
+ case SEPOL_TARGET_SELINUX: return "selinux";
+ case SEPOL_TARGET_XEN: return "xen";
+ default: return "unknown";
+ }
+ }
+SWIGINTERN int qpol_policy_capability(struct qpol_policy *self,qpol_capability_e cap){
+ return qpol_policy_has_capability(self, cap);
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_type_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_type_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_type_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_type_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+
+ #define SWIG_From_long PyLong_FromLong
+
+
+SWIGINTERNINLINE PyObject*
+SWIG_From_unsigned_SS_long (unsigned long value)
+{
+ return (value > LONG_MAX) ?
+ PyLong_FromUnsignedLong(value) : PyLong_FromLong((long)(value));
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_size_t (size_t value)
+{
+ return SWIG_From_unsigned_SS_long ((unsigned long)(value));
+}
+
+SWIGINTERN qpol_iterator_t *qpol_policy_role_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_role_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_role_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_role_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_level_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_level_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_level_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_level_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_cat_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_cat_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_cat_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_cat_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_user_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_user_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_user_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_user_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_bool_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_bool_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_bool_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_bool_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_class_iter(struct qpol_policy *self,char *perm){
+ qpol_iterator_t *iter;
+ if (perm) {
+ if (qpol_perm_get_class_iter(self, perm, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class iterator");
+ }
+ } else {
+ if (qpol_policy_get_class_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_class_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_class_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_common_iter(struct qpol_policy *self,char *perm){
+ qpol_iterator_t *iter;
+ if (perm) {
+ if (qpol_perm_get_common_iter(self, perm, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get common iterator");
+ }
+ } else {
+ if (qpol_policy_get_common_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_common_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_common_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_fs_use_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_fs_use_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_fs_use_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_fs_use_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_genfscon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_genfscon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_genfscon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_genfscon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_isid_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_isid_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_isid_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_isid_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_netifcon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_netifcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_netifcon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_netifcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_nodecon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_nodecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_nodecon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_nodecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_portcon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_portcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_portcon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_portcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_constraint_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_constraint_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_constraint_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_constraint_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_validatetrans_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_validatetrans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_validatetrans_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_validatetrans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_role_allow_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_role_allow_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_role_allow_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_role_allow_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_role_trans_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_role_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_role_trans_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_role_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_range_trans_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_range_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_range_trans_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_range_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_avrule_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ uint32_t rule_types = QPOL_RULE_ALLOW | QPOL_RULE_AUDITALLOW | QPOL_RULE_DONTAUDIT;
+
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW))
+ rule_types |= QPOL_RULE_NEVERALLOW;
+
+ if (qpol_policy_get_avrule_iter(self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_avrule_allow_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_ALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_avrule_auditallow_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_AUDITALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_avrule_neverallow_count(struct qpol_policy *self){
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW)) {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_NEVERALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ } else {
+ return 0;
+ }
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_avrule_dontaudit_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_DONTAUDIT, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_avrulex_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ uint32_t rule_types = QPOL_RULE_XPERMS_ALLOW | QPOL_RULE_XPERMS_AUDITALLOW | QPOL_RULE_XPERMS_DONTAUDIT;
+
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW))
+ rule_types |= QPOL_RULE_XPERMS_NEVERALLOW;
+
+ if (qpol_policy_get_avrule_iter(self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_avrule_allowx_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_ALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_avrule_auditallowx_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_AUDITALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_avrule_neverallowx_count(struct qpol_policy *self){
+ if (qpol_policy_has_capability(self, QPOL_CAP_NEVERALLOW)) {
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_NEVERALLOW, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ } else {
+ return 0;
+ }
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_avrule_dontauditx_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_avrule_iter(self, QPOL_RULE_XPERMS_DONTAUDIT, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_terule_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ uint32_t rule_types = QPOL_RULE_TYPE_TRANS | QPOL_RULE_TYPE_CHANGE | QPOL_RULE_TYPE_MEMBER;
+
+ if (qpol_policy_get_terule_iter(self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_terule_trans_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_terule_iter(self, QPOL_RULE_TYPE_TRANS, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_terule_change_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_terule_iter(self, QPOL_RULE_TYPE_CHANGE, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN size_t qpol_policy_terule_member_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_terule_iter(self, QPOL_RULE_TYPE_MEMBER, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_cond_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_cond_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_cond_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_cond_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_filename_trans_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_filename_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_filename_trans_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_filename_trans_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_permissive_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_permissive_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_permissive_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_permissive_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_typebounds_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_typebounds_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_polcap_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_polcap_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_polcap_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_polcap_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_default_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_default_object_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_iomemcon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_iomemcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_iomemcon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_iomemcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_ioportcon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_ioportcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_ioportcon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_ioportcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_pcidevicecon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_pcidevicecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_pcidevicecon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_pcidevicecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_pirqcon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_pirqcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_pirqcon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_pirqcon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_iterator_t *qpol_policy_devicetreecon_iter(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ if (qpol_policy_get_devicetreecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ return iter;
+ fail:
+ return NULL;
+ }
+SWIGINTERN size_t qpol_policy_devicetreecon_count(struct qpol_policy *self){
+ qpol_iterator_t *iter;
+ size_t count = 0;
+ if (qpol_policy_get_devicetreecon_iter(self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ qpol_iterator_get_size(iter, &count);
+ return count;
+ fail:
+ return 0;
+ }
+SWIGINTERN struct qpol_iterator *new_qpol_iterator(void){
+ SWIG_exception(SWIG_TypeError, "User may not create iterators difectly");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_iterator(struct qpol_iterator *self){
+ qpol_iterator_destroy(&self);
+ }
+SWIGINTERN void *qpol_iterator_item(struct qpol_iterator *self){
+ void *i;
+ if (qpol_iterator_get_item(self, &i)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get item");
+ }
+ return i;
+ fail:
+ return NULL;
+ }
+SWIGINTERN void qpol_iterator_next_(struct qpol_iterator *self){
+ if (qpol_iterator_next(self)) {
+ SWIG_exception(SWIG_RuntimeError, "Error advancing iterator");
+ }
+ fail:
+ return;
+ }
+SWIGINTERN int qpol_iterator_isend(struct qpol_iterator *self){
+ return qpol_iterator_end(self);
+ }
+SWIGINTERN size_t qpol_iterator_size(struct qpol_iterator *self){
+ size_t s;
+ if (qpol_iterator_get_size(self, &s)) {
+ SWIG_exception(SWIG_ValueError, "Could not get iterator size");
+ }
+ return s;
+ fail:
+ return 0;
+ }
+SWIGINTERN struct qpol_type *new_qpol_type(qpol_policy_t *p,char const *name){
+ const qpol_type_t *t;
+ qpol_policy_get_type_by_name(p, name, &t);
+ return (qpol_type_t*)t;
+ }
+SWIGINTERN void delete_qpol_type(struct qpol_type *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_type_name(struct qpol_type *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_type_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type name");
+ }
+ return name;
+ fail:
+ return NULL;
+ }
+SWIGINTERN int qpol_type_value(struct qpol_type *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_type_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type value");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN int qpol_type_isalias(struct qpol_type *self,qpol_policy_t *p){
+ unsigned char i;
+ if (qpol_type_get_isalias(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether type is an alias");
+ }
+ fail:
+ return (int)i;
+ }
+SWIGINTERN int qpol_type_isattr(struct qpol_type *self,qpol_policy_t *p){
+ unsigned char i;
+ if (qpol_type_get_isattr(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether type is an attribute");
+ }
+ fail:
+ return (int)i;
+ }
+SWIGINTERN int qpol_type_ispermissive(struct qpol_type *self,qpol_policy_t *p){
+ unsigned char i;
+ if (qpol_type_get_ispermissive(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether type is permissive");
+ }
+ fail:
+ return (int)i;
+ }
+SWIGINTERN qpol_iterator_t *qpol_type_type_iter(struct qpol_type *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ int retv = qpol_type_get_type_iter(p, self, &iter);
+ if (retv < 0) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get attribute types");
+ } else if (retv > 0) {
+ SWIG_exception(SWIG_TypeError, "Type is not an attribute");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_type_attr_iter(struct qpol_type *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ int retv = qpol_type_get_attr_iter(p, self, &iter);
+ if (retv < 0) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get type attributes");
+ } else if (retv > 0) {
+ SWIG_exception(SWIG_TypeError, "Type is an attribute");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_type_alias_iter(struct qpol_type *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_type_get_alias_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get type aliases");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_type_t *qpol_type_from_void(void *x) {
+ return (qpol_type_t*)x;
+ };
+
+SWIGINTERN struct qpol_role *new_qpol_role(qpol_policy_t *p,char const *name){
+ const qpol_role_t *r;
+ qpol_policy_get_role_by_name(p, name, &r);
+ return (qpol_role_t*)r;
+ }
+SWIGINTERN void delete_qpol_role(struct qpol_role *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_role_value(struct qpol_role *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_role_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role value");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN char const *qpol_role_name(struct qpol_role *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_role_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role name");
+ }
+ return name;
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_iterator_t *qpol_role_type_iter(struct qpol_role *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_role_get_type_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get role types");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_role_dominate_iter(struct qpol_role *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_role_get_dominate_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get dominated roles");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_role_t *qpol_role_from_void(void *x) {
+ return (qpol_role_t*)x;
+ };
+
+SWIGINTERN struct qpol_level *new_qpol_level(qpol_policy_t *p,char const *name){
+ const qpol_level_t *l;
+ qpol_policy_get_level_by_name(p, name, &l);
+ return (qpol_level_t*)l;
+ }
+SWIGINTERN void delete_qpol_level(struct qpol_level *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_level_isalias(struct qpol_level *self,qpol_policy_t *p){
+ unsigned char i;
+ if (qpol_level_get_isalias(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether level is an alias");
+ }
+ fail:
+ return (int)i;
+ }
+SWIGINTERN int qpol_level_value(struct qpol_level *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_level_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get level sensitivity value");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN char const *qpol_level_name(struct qpol_level *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_level_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get level sensitivity name");
+ }
+ return name;
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_iterator_t *qpol_level_cat_iter(struct qpol_level *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_level_get_cat_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get level categories");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_level_alias_iter(struct qpol_level *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_level_get_alias_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get level aliases");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_level_t *qpol_level_from_void(void *x) {
+ return (qpol_level_t*)x;
+ };
+
+SWIGINTERN struct qpol_cat *new_qpol_cat(qpol_policy_t *p,char const *name){
+ const qpol_cat_t *c;
+ qpol_policy_get_cat_by_name(p, name, &c);
+ return (qpol_cat_t*)c;
+ }
+SWIGINTERN void delete_qpol_cat(struct qpol_cat *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_cat_isalias(struct qpol_cat *self,qpol_policy_t *p){
+ unsigned char i;
+ if (qpol_cat_get_isalias(p, self, &i)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine whether category is an alias");
+ }
+ fail:
+ return (int)i;
+ }
+SWIGINTERN int qpol_cat_value(struct qpol_cat *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_cat_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get category value");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN char const *qpol_cat_name(struct qpol_cat *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_cat_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get category name");
+ }
+ return name;
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_iterator_t *qpol_cat_alias_iter(struct qpol_cat *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_cat_get_alias_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get category aliases");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_cat_t *qpol_cat_from_void(void *x) {
+ return (qpol_cat_t*)x;
+ };
+
+SWIGINTERN struct qpol_mls_range *new_qpol_mls_range(qpol_policy_t *p,qpol_mls_level_t *l,qpol_mls_level_t *h){
+ qpol_mls_range_t *range;
+ qpol_policy_get_mls_range_from_mls_levels(p, l, h, &range);
+ return range;
+ }
+SWIGINTERN void delete_qpol_mls_range(struct qpol_mls_range *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_mls_level_t const *qpol_mls_range_high_level(struct qpol_mls_range *self,qpol_policy_t *p){
+ const qpol_mls_level_t *l;
+ if (qpol_mls_range_get_high_level(p, self, &l)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range high levl");
+ }
+ fail:
+ return l;
+ }
+SWIGINTERN qpol_mls_level_t const *qpol_mls_range_low_level(struct qpol_mls_range *self,qpol_policy_t *p){
+ const qpol_mls_level_t *l;
+ if (qpol_mls_range_get_low_level(p, self, &l)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range low levl");
+ }
+ fail:
+ return l;
+ }
+
+ qpol_mls_range_t *qpol_mls_range_from_void(void *x) {
+ return (qpol_mls_range_t*)x;
+ };
+
+SWIGINTERN struct qpol_semantic_level *new_qpol_semantic_level(qpol_policy_t *p,char const *name){
+ const qpol_semantic_level_t *l;
+ qpol_policy_get_semantic_level_by_name(p, name, &l);
+ return (qpol_semantic_level_t*)l;
+ }
+SWIGINTERN void delete_qpol_semantic_level(struct qpol_semantic_level *self){
+ qpol_semantic_level_destroy(self);
+ return;
+ }
+SWIGINTERN int qpol_semantic_level_add_cats(struct qpol_semantic_level *self,qpol_policy_t *p,char const *low,char const *high){
+ return qpol_semantic_level_add_cats_by_name(p, self, low, high);
+ }
+SWIGINTERN struct qpol_mls_level *new_qpol_mls_level(qpol_policy_t *p,qpol_semantic_level_t *l){
+ qpol_mls_level_t *level;
+ qpol_mls_level_from_semantic_level(p, l, &level);
+ return level;
+ }
+SWIGINTERN void delete_qpol_mls_level(struct qpol_mls_level *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_mls_level_sens_name(struct qpol_mls_level *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_mls_level_get_sens_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get level sensitivity name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN qpol_iterator_t *qpol_mls_level_cat_iter(struct qpol_mls_level *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_mls_level_get_cat_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get level categories");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_mls_level_t *qpol_mls_level_from_void(void *x) {
+ return (qpol_mls_level_t*)x;
+ };
+
+SWIGINTERN struct qpol_user *new_qpol_user(qpol_policy_t *p,char const *name){
+ const qpol_user_t *u;
+ qpol_policy_get_user_by_name(p, name, &u);
+ return (qpol_user_t*)u;
+ }
+SWIGINTERN void delete_qpol_user(struct qpol_user *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_user_value(struct qpol_user *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_user_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user value");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN qpol_iterator_t *qpol_user_role_iter(struct qpol_user *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_user_get_role_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of Memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_mls_range_t const *qpol_user_range(struct qpol_user *self,qpol_policy_t *p){
+ const qpol_mls_range_t *r;
+ if (qpol_user_get_range(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user range");
+ }
+ fail:
+ return r;
+ }
+SWIGINTERN char const *qpol_user_name(struct qpol_user *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_user_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN qpol_mls_level_t const *qpol_user_dfltlevel(struct qpol_user *self,qpol_policy_t *p){
+ const qpol_mls_level_t *l;
+ if (qpol_user_get_dfltlevel(p, self, &l)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user default level");
+ }
+ fail:
+ return l;
+ }
+
+ qpol_user_t *qpol_user_from_void(void *x) {
+ return (qpol_user_t*)x;
+ };
+
+SWIGINTERN struct qpol_bool *new_qpol_bool(qpol_policy_t *p,char const *name){
+ qpol_bool_t *b;
+ if (qpol_policy_get_bool_by_name(p, name, &b)) {
+ SWIG_exception(SWIG_RuntimeError, "Boolean does not exist");
+ }
+ fail:
+ return b;
+ }
+SWIGINTERN void delete_qpol_bool(struct qpol_bool *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_bool_value(struct qpol_bool *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_bool_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean value");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN int qpol_bool_state(struct qpol_bool *self,qpol_policy_t *p){
+ int s;
+ if (qpol_bool_get_state(p, self, &s)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean state");
+ }
+ fail:
+ return s;
+ }
+SWIGINTERN char const *qpol_bool_name(struct qpol_bool *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_bool_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean name");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_bool_t *qpol_bool_from_void(void *x) {
+ return (qpol_bool_t*)x;
+ };
+
+SWIGINTERN struct qpol_context *new_qpol_context(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_context_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_context(struct qpol_context *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_user_t const *qpol_context_user(struct qpol_context *self,qpol_policy_t *p){
+ const qpol_user_t *u;
+ if (qpol_context_get_user(p, self, &u)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user from context");
+ }
+ fail:
+ return u;
+ }
+SWIGINTERN qpol_role_t const *qpol_context_role(struct qpol_context *self,qpol_policy_t *p){
+ const qpol_role_t *r;
+ if (qpol_context_get_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role from context");
+ }
+ fail:
+ return r;
+ }
+SWIGINTERN qpol_type_t const *qpol_context_type_(struct qpol_context *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_context_get_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type from context");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_mls_range_t const *qpol_context_range(struct qpol_context *self,qpol_policy_t *p){
+ const qpol_mls_range_t *r;
+ if (qpol_context_get_range(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range from context");
+ }
+ fail:
+ return r;
+ }
+
+ qpol_context_t *qpol_context_from_void(void *x) {
+ return (qpol_context_t*)x;
+ };
+
+SWIGINTERN struct qpol_class *new_qpol_class(qpol_policy_t *p,char const *name){
+ const qpol_class_t *c;
+ qpol_policy_get_class_by_name(p, name, &c);
+ return (qpol_class_t*)c;
+ }
+SWIGINTERN void delete_qpol_class(struct qpol_class *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_class_value(struct qpol_class *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_class_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get value for class");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN qpol_common_t const *qpol_class_common(struct qpol_class *self,qpol_policy_t *p){
+ const qpol_common_t *c;
+ if(qpol_class_get_common(p, self, &c)) {
+ SWIG_exception(SWIG_ValueError, "Could not get common for class");
+ }
+ fail:
+ return c;
+ }
+SWIGINTERN qpol_iterator_t *qpol_class_perm_iter(struct qpol_class *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if(qpol_class_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class permissions");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_class_constraint_iter(struct qpol_class *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if(qpol_class_get_constraint_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class constraints");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_class_validatetrans_iter(struct qpol_class *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if(qpol_class_get_validatetrans_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get class validatetrans statements");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN char const *qpol_class_name(struct qpol_class *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_class_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class name");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_class_t *qpol_class_from_void(void *x) {
+ return (qpol_class_t*)x;
+ };
+
+SWIGINTERN struct qpol_common *new_qpol_common(qpol_policy_t *p,char const *name){
+ const qpol_common_t *c;
+ qpol_policy_get_common_by_name(p, name, &c);
+ return (qpol_common_t*)c;
+ }
+SWIGINTERN void delete_qpol_common(struct qpol_common *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_common_value(struct qpol_common *self,qpol_policy_t *p){
+ uint32_t v;
+ if (qpol_common_get_value(p, self, &v)) {
+ SWIG_exception(SWIG_ValueError, "Could not get value for common");
+ }
+ fail:
+ return (int) v;
+ }
+SWIGINTERN qpol_iterator_t *qpol_common_perm_iter(struct qpol_common *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if(qpol_common_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get common permissions");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN char const *qpol_common_name(struct qpol_common *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_common_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get common name");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_common_t *qpol_common_from_void(void *x) {
+ return (qpol_common_t*)x;
+ };
+
+
+SWIGINTERNINLINE PyObject*
+ SWIG_From_unsigned_SS_int (unsigned int value)
+{
+ return PyInt_FromSize_t((size_t) value);
+}
+
+SWIGINTERN struct qpol_fs_use *new_qpol_fs_use(qpol_policy_t *p,char const *name){
+ const qpol_fs_use_t *f;
+ if (qpol_policy_get_fs_use_by_name(p, name, &f)) {
+ SWIG_exception(SWIG_RuntimeError, "FS Use Statement does not exist");
+ }
+ fail:
+ return (qpol_fs_use_t*)f;
+ }
+SWIGINTERN void delete_qpol_fs_use(struct qpol_fs_use *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_fs_use_name(struct qpol_fs_use *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_fs_use_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN int qpol_fs_use_behavior(struct qpol_fs_use *self,qpol_policy_t *p){
+ uint32_t behav;
+ if (qpol_fs_use_get_behavior(p, self, &behav)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system labeling behavior");
+ }
+ fail:
+ return (int) behav;
+ }
+SWIGINTERN qpol_context_t const *qpol_fs_use_context(struct qpol_fs_use *self,qpol_policy_t *p){
+ uint32_t behav;
+ const qpol_context_t *ctx = NULL;
+ qpol_fs_use_get_behavior(p, self, &behav);
+ if (behav == 6U) {
+ SWIG_exception(SWIG_TypeError, "Cannot get context for fs_use_psid statements");
+ } else if (qpol_fs_use_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system context");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_fs_use_t *qpol_fs_use_from_void(void *x) {
+ return (qpol_fs_use_t*)x;
+ };
+
+SWIGINTERN struct qpol_genfscon *new_qpol_genfscon(qpol_policy_t *p,char const *name,char const *path){
+ qpol_genfscon_t *g;
+ if (qpol_policy_get_genfscon_by_name(p, name, path, &g)) {
+ SWIG_exception(SWIG_RuntimeError, "Genfscon statement does not exist");
+ }
+ fail:
+ return g;
+ }
+SWIGINTERN void delete_qpol_genfscon(struct qpol_genfscon *self){
+ free(self);
+ }
+SWIGINTERN char const *qpol_genfscon_name(struct qpol_genfscon *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_genfscon_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN char const *qpol_genfscon_path(struct qpol_genfscon *self,qpol_policy_t *p){
+ const char *path;
+ if (qpol_genfscon_get_path(p, self, &path)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file system path");
+ }
+ fail:
+ return path;
+ }
+SWIGINTERN unsigned int qpol_genfscon_object_class(struct qpol_genfscon *self,qpol_policy_t *p){
+ uint32_t cls;
+ if (qpol_genfscon_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get genfscon statement class");
+ }
+ switch (cls) {
+ case 11U: return S_IFBLK;
+ case 10U: return S_IFCHR;
+ case 7U: return S_IFDIR;
+ case 13U: return S_IFIFO;
+ case 6U: return S_IFREG;
+ case 9U: return S_IFLNK;
+ case 12U: return S_IFSOCK;
+ default: return 0; /* all file types */
+ }
+ fail:
+ return 0;
+ }
+SWIGINTERN qpol_context_t const *qpol_genfscon_context(struct qpol_genfscon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_genfscon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for genfscon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_genfscon_t *qpol_genfscon_from_void(void *x) {
+ return (qpol_genfscon_t*)x;
+ };
+
+SWIGINTERN struct qpol_isid *new_qpol_isid(qpol_policy_t *p,char const *name){
+ const qpol_isid_t *i;
+ qpol_policy_get_isid_by_name(p, name, &i);
+ return (qpol_isid_t*)i;
+ }
+SWIGINTERN void delete_qpol_isid(struct qpol_isid *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_isid_name(struct qpol_isid *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_isid_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get name for initial sid");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN qpol_context_t const *qpol_isid_context(struct qpol_isid *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_isid_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for initial sid");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_isid_t *qpol_isid_from_void(void *x) {
+ return (qpol_isid_t*)x;
+ };
+
+SWIGINTERN struct qpol_netifcon *new_qpol_netifcon(qpol_policy_t *p,char const *name){
+ const qpol_netifcon_t *n;
+ if (qpol_policy_get_netifcon_by_name(p, name, &n)) {
+ SWIG_exception(SWIG_RuntimeError, "Netifcon statement does not exist");
+ }
+ fail:
+ return (qpol_netifcon_t*)n;
+ }
+SWIGINTERN void delete_qpol_netifcon(struct qpol_netifcon *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_netifcon_name(struct qpol_netifcon *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_netifcon_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get name for netifcon statement");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN qpol_context_t const *qpol_netifcon_msg_con(struct qpol_netifcon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_netifcon_get_msg_con(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get message context for netifcon statement");
+ }
+ fail:
+ return ctx;
+ }
+SWIGINTERN qpol_context_t const *qpol_netifcon_if_con(struct qpol_netifcon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_netifcon_get_if_con(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get interface context for netifcon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_netifcon_t *qpol_netifcon_from_void(void *x) {
+ return (qpol_netifcon_t*)x;
+ };
+
+SWIGINTERN struct qpol_nodecon *new_qpol_nodecon(qpol_policy_t *p,int addr[4],int mask[4],int protocol){
+ uint32_t a[4], m[4];
+ qpol_nodecon_t *n;
+ a[0] = (uint32_t) addr[0]; a[1] = (uint32_t) addr[1];
+ a[2] = (uint32_t) addr[2]; a[3] = (uint32_t) addr[3];
+ m[0] = (uint32_t) mask[0]; m[1] = (uint32_t) mask[1];
+ m[2] = (uint32_t) mask[2]; m[3] = (uint32_t) mask[3];
+ if (qpol_policy_get_nodecon_by_node(p, a, m, protocol, &n)) {
+ SWIG_exception(SWIG_RuntimeError, "Nodecon statement does not exist");
+ }
+ fail:
+ return n;
+ }
+SWIGINTERN void delete_qpol_nodecon(struct qpol_nodecon *self){
+ free(self);
+ }
+SWIGINTERN char *qpol_nodecon_addr(struct qpol_nodecon *self,qpol_policy_t *p){
+ uint32_t *a;
+ unsigned char proto;
+ char *addr = NULL;
+
+ addr = malloc(INET6_ADDRSTRLEN * sizeof(char));
+ if(!addr)
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+
+ if (qpol_nodecon_get_addr(p, self, &a, &proto)) {
+ SWIG_exception(SWIG_ValueError, "Could not get address of nodecon statement");
+ }
+
+ if(proto == 0) {
+ inet_ntop(AF_INET, a, addr, INET6_ADDRSTRLEN);
+ } else {
+ inet_ntop(AF_INET6, a, addr, INET6_ADDRSTRLEN);
+ }
+
+ fail:
+ return addr;
+ }
+SWIGINTERN char *qpol_nodecon_mask(struct qpol_nodecon *self,qpol_policy_t *p){
+ uint32_t *m;
+ unsigned char proto;
+ char *mask;
+ mask = malloc(INET6_ADDRSTRLEN * sizeof(char));
+ if (!mask)
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+
+ if (qpol_nodecon_get_mask(p, self, &m, &proto)) {
+ SWIG_exception(SWIG_ValueError, "Could not get mask of nodecon statement");
+ }
+
+ if(proto == 0) {
+ inet_ntop(AF_INET, m, mask, INET6_ADDRSTRLEN);
+ } else {
+ inet_ntop(AF_INET6, m, mask, INET6_ADDRSTRLEN);
+ }
+ fail:
+ return mask;
+ }
+SWIGINTERN int qpol_nodecon_protocol(struct qpol_nodecon *self,qpol_policy_t *p){
+ unsigned char proto;
+ if (qpol_nodecon_get_protocol(p, self, &proto)) {
+ SWIG_exception(SWIG_ValueError, "Could not get protocol for nodecon statement");
+ }
+ fail:
+ if(proto == 0) {
+ return AF_INET;
+ } else {
+ return AF_INET6;
+ }
+ }
+SWIGINTERN qpol_context_t const *qpol_nodecon_context(struct qpol_nodecon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_nodecon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for nodecon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_nodecon_t *qpol_nodecon_from_void(void *x) {
+ return (qpol_nodecon_t*)x;
+ };
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_long (PyObject *obj, unsigned long *val)
+{
+#if PY_VERSION_HEX < 0x03000000
+ if (PyInt_Check(obj)) {
+ long v = PyInt_AsLong(obj);
+ if (v >= 0) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ return SWIG_OverflowError;
+ }
+ } else
+#endif
+ if (PyLong_Check(obj)) {
+ unsigned long v = PyLong_AsUnsignedLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+#if PY_VERSION_HEX >= 0x03000000
+ {
+ long v = PyLong_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (v < 0) {
+ return SWIG_OverflowError;
+ }
+ } else {
+ PyErr_Clear();
+ }
+ }
+#endif
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ int dispatch = 0;
+ unsigned long v = PyLong_AsUnsignedLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_AddCast(SWIG_OK);
+ } else {
+ PyErr_Clear();
+ }
+ if (!dispatch) {
+ double d;
+ int res = SWIG_AddCast(SWIG_AsVal_double (obj,&d));
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, 0, ULONG_MAX)) {
+ if (val) *val = (unsigned long)(d);
+ return res;
+ }
+ }
+ }
+#endif
+ return SWIG_TypeError;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_short (PyObject * obj, unsigned short *val)
+{
+ unsigned long v;
+ int res = SWIG_AsVal_unsigned_SS_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v > USHRT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = (unsigned short)(v);
+ }
+ }
+ return res;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_char (PyObject * obj, unsigned char *val)
+{
+ unsigned long v;
+ int res = SWIG_AsVal_unsigned_SS_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v > UCHAR_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = (unsigned char)(v);
+ }
+ }
+ return res;
+}
+
+SWIGINTERN struct qpol_portcon *new_qpol_portcon(qpol_policy_t *p,uint16_t low,uint16_t high,uint8_t protocol){
+ const qpol_portcon_t *qp;
+ if (qpol_policy_get_portcon_by_port(p, low, high, protocol, &qp)) {
+ SWIG_exception(SWIG_RuntimeError, "Portcon statement does not exist");
+ }
+ fail:
+ return (qpol_portcon_t*)qp;
+ }
+SWIGINTERN void delete_qpol_portcon(struct qpol_portcon *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN uint16_t qpol_portcon_low_port(struct qpol_portcon *self,qpol_policy_t *p){
+ uint16_t port = 0;
+ if(qpol_portcon_get_low_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get low port for portcon statement");
+ }
+ fail:
+ return port;
+ }
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_unsigned_SS_short (unsigned short value)
+{
+ return SWIG_From_unsigned_SS_long (value);
+}
+
+SWIGINTERN uint16_t qpol_portcon_high_port(struct qpol_portcon *self,qpol_policy_t *p){
+ uint16_t port = 0;
+ if(qpol_portcon_get_high_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get high port for portcon statement");
+ }
+ fail:
+ return port;
+ }
+SWIGINTERN uint8_t qpol_portcon_protocol(struct qpol_portcon *self,qpol_policy_t *p){
+ uint8_t proto = 0;
+ if (qpol_portcon_get_protocol(p, self, &proto)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get protocol for portcon statement");
+ }
+ fail:
+ return proto;
+ }
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_unsigned_SS_char (unsigned char value)
+{
+ return SWIG_From_unsigned_SS_long (value);
+}
+
+SWIGINTERN qpol_context_t const *qpol_portcon_context(struct qpol_portcon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_portcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for portcon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_portcon_t *qpol_portcon_from_void(void *x) {
+ return (qpol_portcon_t*)x;
+ };
+
+SWIGINTERN struct qpol_constraint *new_qpol_constraint(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_constraint_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_constraint(struct qpol_constraint *self){
+ free(self);
+ }
+SWIGINTERN qpol_class_t const *qpol_constraint_object_class(struct qpol_constraint *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_constraint_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for constraint");
+ }
+ fail:
+ return cls;
+ }
+SWIGINTERN qpol_iterator_t *qpol_constraint_perm_iter(struct qpol_constraint *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_constraint_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_constraint_expr_iter(struct qpol_constraint *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_constraint_get_expr_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_constraint_t *qpol_constraint_from_void(void *x) {
+ return (qpol_constraint_t*)x;
+ };
+
+SWIGINTERN struct qpol_validatetrans *new_qpol_validatetrans(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_validatetrans_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_validatetrans(struct qpol_validatetrans *self){
+ free(self);
+ }
+SWIGINTERN qpol_class_t const *qpol_validatetrans_object_class(struct qpol_validatetrans *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_validatetrans_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for validatetrans");
+ }
+ fail:
+ return cls;
+ }
+SWIGINTERN qpol_iterator_t *qpol_validatetrans_expr_iter(struct qpol_validatetrans *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_validatetrans_get_expr_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_validatetrans_t *qpol_validatetrans_from_void(void *x) {
+ return (qpol_validatetrans_t*)x;
+ };
+
+SWIGINTERN struct qpol_constraint_expr_node *new_qpol_constraint_expr_node(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_constraint_expr_node_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_constraint_expr_node(struct qpol_constraint_expr_node *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_constraint_expr_node_expr_type(struct qpol_constraint_expr_node *self,qpol_policy_t *p){
+ uint32_t et;
+ if (qpol_constraint_expr_node_get_expr_type(p, self, &et)) {
+ SWIG_exception(SWIG_ValueError, "Could not get expression type for node");
+ }
+ fail:
+ return (int) et;
+ }
+SWIGINTERN int qpol_constraint_expr_node_sym_type(struct qpol_constraint_expr_node *self,qpol_policy_t *p){
+ uint32_t st;
+ if (qpol_constraint_expr_node_get_sym_type(p, self, &st)) {
+ SWIG_exception(SWIG_ValueError, "Could not get symbol type for node");
+ }
+ fail:
+ return (int) st;
+ }
+SWIGINTERN int qpol_constraint_expr_node_op(struct qpol_constraint_expr_node *self,qpol_policy_t *p){
+ uint32_t op;
+ if (qpol_constraint_expr_node_get_op(p, self, &op)) {
+ SWIG_exception(SWIG_ValueError, "Could not get operator for node");
+ }
+ fail:
+ return (int) op;
+ }
+SWIGINTERN qpol_iterator_t *qpol_constraint_expr_node_names_iter(struct qpol_constraint_expr_node *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_constraint_expr_node_get_names_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_constraint_expr_node_t *qpol_constraint_expr_node_from_void(void *x) {
+ return (qpol_constraint_expr_node_t*)x;
+ };
+
+SWIGINTERN struct qpol_role_allow *new_qpol_role_allow(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_role_allow_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_role_allow(struct qpol_role_allow *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_role_t const *qpol_role_allow_source_role(struct qpol_role_allow *self,qpol_policy_t *p){
+ const qpol_role_t *r;
+ if (qpol_role_allow_get_source_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for role allow rule");
+ }
+ fail:
+ return r;
+ }
+SWIGINTERN qpol_role_t const *qpol_role_allow_target_role(struct qpol_role_allow *self,qpol_policy_t *p){
+ const qpol_role_t *r;
+ if (qpol_role_allow_get_target_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for role allow rule");
+ }
+ fail:
+ return r;
+ }
+
+ qpol_role_allow_t *qpol_role_allow_from_void(void *x) {
+ return (qpol_role_allow_t*)x;
+ };
+
+SWIGINTERN struct qpol_role_trans *new_qpol_role_trans(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_role_trans_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_role_trans(struct qpol_role_trans *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_role_t const *qpol_role_trans_source_role(struct qpol_role_trans *self,qpol_policy_t *p){
+ const qpol_role_t *r;
+ if (qpol_role_trans_get_source_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for role_transition rule");
+ }
+ fail:
+ return r;
+ }
+SWIGINTERN qpol_type_t const *qpol_role_trans_target_type(struct qpol_role_trans *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_role_trans_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for role_transition rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_class_t const *qpol_role_trans_object_class(struct qpol_role_trans *self,qpol_policy_t *p){
+ const qpol_class_t *c;
+ if (qpol_role_trans_get_object_class(p, self, &c)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for role_transition rule");
+ }
+ fail:
+ return c;
+ }
+SWIGINTERN qpol_role_t const *qpol_role_trans_default_role(struct qpol_role_trans *self,qpol_policy_t *p){
+ const qpol_role_t *r;
+ if (qpol_role_trans_get_default_role(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get default for role_transition rule");
+ }
+ fail:
+ return r;
+ }
+
+ qpol_role_trans_t *qpol_role_trans_from_void(void *x) {
+ return (qpol_role_trans_t*)x;
+ };
+
+SWIGINTERN struct qpol_range_trans *new_qpol_range_trans(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_range_trans_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_range_trans(struct qpol_range_trans *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_type_t const *qpol_range_trans_source_type(struct qpol_range_trans *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_range_trans_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for range_transition rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_type_t const *qpol_range_trans_target_type(struct qpol_range_trans *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_range_trans_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for range_transition rule"); }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_class_t const *qpol_range_trans_object_class(struct qpol_range_trans *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_range_trans_get_target_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for range_transition rule"); }
+ fail:
+ return cls;
+ }
+SWIGINTERN qpol_mls_range_t const *qpol_range_trans_range(struct qpol_range_trans *self,qpol_policy_t *p){
+ const qpol_mls_range_t *r;
+ if (qpol_range_trans_get_range(p, self, &r)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range for range_transition rule");
+ }
+ fail:
+ return r;
+ }
+
+ qpol_range_trans_t *qpol_range_trans_from_void(void *x) {
+ return (qpol_range_trans_t*)x;
+ };
+
+SWIGINTERN struct qpol_avrule *new_qpol_avrule(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_avrule_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_avrule(struct qpol_avrule *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_avrule_rule_type(struct qpol_avrule *self,qpol_policy_t *p){
+ uint32_t rt;
+ if (qpol_avrule_get_rule_type(p, self, &rt)) {
+ SWIG_exception(SWIG_ValueError, "Could not get rule type for av rule");
+ }
+ switch (rt) {
+ case 0x0001: return "allow"; break;
+ case 0x0080: return "neverallow"; break;
+ case 0x0002: return "auditallow"; break;
+ case 0x0004: return "dontaudit"; break;
+ case 0x0100: return "allowxperm"; break;
+ case 0x0800: return "neverallowxperm"; break;
+ case 0x0200: return "auditallowxperm"; break;
+ case 0x0400: return "dontauditxperm"; break;
+ }
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_type_t const *qpol_avrule_source_type(struct qpol_avrule *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_avrule_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for av rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_type_t const *qpol_avrule_target_type(struct qpol_avrule *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_avrule_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for av rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_class_t const *qpol_avrule_object_class(struct qpol_avrule *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_avrule_get_object_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for av rule");
+ }
+ fail:
+ return cls;
+ }
+SWIGINTERN qpol_iterator_t *qpol_avrule_perm_iter(struct qpol_avrule *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_avrule_get_perm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_avrule_xperm_iter(struct qpol_avrule *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_avrule_get_xperm_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN int qpol_avrule_is_extended(struct qpol_avrule *self,qpol_policy_t *p){
+ uint32_t e;
+ if (qpol_avrule_get_is_extended(p, self, &e)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine if av rule is extended");
+ }
+ fail:
+ return (int) e;
+ }
+SWIGINTERN char const *qpol_avrule_xperm_type(struct qpol_avrule *self,qpol_policy_t *p){
+ char *xt;
+ if (qpol_avrule_get_xperm_type(p, self, &xt)) {
+ SWIG_exception(SWIG_ValueError, "Could not get xperm type for av rule");
+ }
+ fail:
+ return xt;
+ }
+SWIGINTERN qpol_cond_t const *qpol_avrule_cond(struct qpol_avrule *self,qpol_policy_t *p){
+ const qpol_cond_t *c;
+ qpol_avrule_get_cond(p, self, &c);
+ return c;
+ }
+SWIGINTERN int qpol_avrule_is_enabled(struct qpol_avrule *self,qpol_policy_t *p){
+ uint32_t e;
+ if (qpol_avrule_get_is_enabled(p, self, &e)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine if av rule is enabled");
+ }
+ fail:
+ return (int) e;
+ }
+SWIGINTERN int qpol_avrule_which_list(struct qpol_avrule *self,qpol_policy_t *p){
+ const qpol_cond_t *c;
+ uint32_t which = 0;
+ qpol_avrule_get_cond(p, self, &c);
+ if (c == NULL) {
+ return -1;
+ } else if (qpol_avrule_get_which_list(p, self, &which)) {
+ return -1;
+ }
+ return (int) which;
+ }
+SWIGINTERN qpol_iterator_t *qpol_avrule_syn_avrule_iter(struct qpol_avrule *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_avrule_get_syn_avrule_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_avrule_t *qpol_avrule_from_void(void *x) {
+ return (qpol_avrule_t*)x;
+ };
+
+SWIGINTERN struct qpol_terule *new_qpol_terule(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_terule_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_terule(struct qpol_terule *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_terule_rule_type(struct qpol_terule *self,qpol_policy_t *p){
+ uint32_t rt;
+ if (qpol_terule_get_rule_type(p, self, &rt)) {
+ SWIG_exception(SWIG_ValueError, "Could not get rule type for te rule");
+ }
+ switch (rt) {
+ case 16: return "type_transition"; break;
+ case 64: return "type_change"; break;
+ case 32: return "type_member"; break;
+ }
+ fail:
+ return NULL;
+ }
+SWIGINTERN qpol_type_t const *qpol_terule_source_type(struct qpol_terule *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_terule_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for te rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_type_t const *qpol_terule_target_type(struct qpol_terule *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_terule_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for te rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_class_t const *qpol_terule_object_class(struct qpol_terule *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_terule_get_object_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for te rule");
+ }
+ fail:
+ return cls;
+ }
+SWIGINTERN qpol_type_t const *qpol_terule_default_type(struct qpol_terule *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_terule_get_default_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get default for te rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_cond_t const *qpol_terule_cond(struct qpol_terule *self,qpol_policy_t *p){
+ const qpol_cond_t *c;
+ qpol_terule_get_cond(p, self, &c);
+ return c;
+ }
+SWIGINTERN int qpol_terule_is_enabled(struct qpol_terule *self,qpol_policy_t *p){
+ uint32_t e;
+ if (qpol_terule_get_is_enabled(p, self, &e)) {
+ SWIG_exception(SWIG_ValueError, "Could not determine if te rule is enabled");
+ }
+ fail:
+ return (int) e;
+ }
+SWIGINTERN int qpol_terule_which_list(struct qpol_terule *self,qpol_policy_t *p){
+ const qpol_cond_t *c;
+ uint32_t which = 0;
+ qpol_terule_get_cond(p, self, &c);
+ if (c == NULL) {
+ return -1;
+ } else if (qpol_terule_get_which_list(p, self, &which)) {
+ return -1;
+ }
+ return (int) which;
+ }
+SWIGINTERN qpol_iterator_t *qpol_terule_syn_terule_iter(struct qpol_terule *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_terule_get_syn_terule_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+
+ qpol_terule_t *qpol_terule_from_void(void *x) {
+ return (qpol_terule_t*)x;
+ };
+
+SWIGINTERN struct qpol_cond *new_qpol_cond(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_cond_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_cond(struct qpol_cond *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_iterator_t *qpol_cond_expr_node_iter(struct qpol_cond *self,qpol_policy_t *p){
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_expr_node_iter(p, self, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_cond_av_true_iter(struct qpol_cond *self,qpol_policy_t *p,int rule_types){
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_av_true_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_cond_av_false_iter(struct qpol_cond *self,qpol_policy_t *p,int rule_types){
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_av_false_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_cond_te_true_iter(struct qpol_cond *self,qpol_policy_t *p,int rule_types){
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_te_true_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN qpol_iterator_t *qpol_cond_te_false_iter(struct qpol_cond *self,qpol_policy_t *p,int rule_types){
+ qpol_iterator_t *iter;
+ if (qpol_cond_get_te_false_iter(p, self, rule_types, &iter)) {
+ SWIG_exception(SWIG_MemoryError, "Out of memory");
+ }
+ fail:
+ return iter;
+ }
+SWIGINTERN int qpol_cond_evaluate(struct qpol_cond *self,qpol_policy_t *p){
+ uint32_t e;
+ if (qpol_cond_eval(p, self, &e)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not evaluate conditional");
+ }
+ fail:
+ return (int) e;
+ }
+
+ qpol_cond_t *qpol_cond_from_void(void *x) {
+ return (qpol_cond_t*)x;
+ };
+
+SWIGINTERN struct qpol_cond_expr_node *new_qpol_cond_expr_node(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_cond_expr_node_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_cond_expr_node(struct qpol_cond_expr_node *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN int qpol_cond_expr_node_expr_type(struct qpol_cond_expr_node *self,qpol_policy_t *p){
+ uint32_t et;
+ if (qpol_cond_expr_node_get_expr_type(p, self, &et)) {
+ SWIG_exception(SWIG_ValueError, "Could not get node expression type");
+ }
+ fail:
+ return (int) et;
+ }
+SWIGINTERN qpol_bool_t *qpol_cond_expr_node_get_boolean(struct qpol_cond_expr_node *self,qpol_policy_t *p){
+ uint32_t et;
+ qpol_bool_t *b = NULL;
+ qpol_cond_expr_node_get_expr_type(p, self, &et);
+ if (et != 1) {
+ SWIG_exception(SWIG_TypeError, "Node does not contain a boolean");
+ } else if (qpol_cond_expr_node_get_bool(p, self, &b)) {
+ SWIG_exception(SWIG_ValueError, "Could not get boolean for node");
+ }
+ fail:
+ return b;
+ }
+
+ qpol_cond_expr_node_t *qpol_cond_expr_node_from_void(void *x) {
+ return (qpol_cond_expr_node_t*)x;
+ };
+
+SWIGINTERN struct qpol_filename_trans *new_qpol_filename_trans(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_filename_trans_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_filename_trans(struct qpol_filename_trans *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_type_t const *qpol_filename_trans_source_type(struct qpol_filename_trans *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_filename_trans_get_source_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get source for filename transition rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_type_t const *qpol_filename_trans_target_type(struct qpol_filename_trans *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_filename_trans_get_target_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get target for filename transition rule"); }
+ fail:
+ return t;
+ }
+SWIGINTERN qpol_class_t const *qpol_filename_trans_object_class(struct qpol_filename_trans *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_filename_trans_get_object_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class for filename transition rule"); }
+ fail:
+ return cls;
+ }
+SWIGINTERN qpol_type_t const *qpol_filename_trans_default_type(struct qpol_filename_trans *self,qpol_policy_t *p){
+ const qpol_type_t *t;
+ if (qpol_filename_trans_get_default_type(p, self, &t)) {
+ SWIG_exception(SWIG_ValueError, "Could not get default for filename transition rule");
+ }
+ fail:
+ return t;
+ }
+SWIGINTERN char const *qpol_filename_trans_filename(struct qpol_filename_trans *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_filename_trans_get_filename(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get file for filename transition rule");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_filename_trans_t *qpol_filename_trans_from_void(void *x) {
+ return (qpol_filename_trans_t*)x;
+ };
+
+SWIGINTERN struct qpol_polcap *new_qpol_polcap(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_polcap_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_polcap(struct qpol_polcap *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_polcap_name(struct qpol_polcap *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_polcap_get_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get polcap name rule");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_polcap_t *qpol_polcap_from_void(void *x) {
+ return (qpol_polcap_t*)x;
+ };
+
+SWIGINTERN struct qpol_typebounds *new_qpol_typebounds(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_typebounds_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_typebounds(struct qpol_typebounds *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_typebounds_parent_name(struct qpol_typebounds *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_typebounds_get_parent_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get parent name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN char const *qpol_typebounds_child_name(struct qpol_typebounds *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_typebounds_get_child_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get child name");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_typebounds_t *qpol_typebounds_from_void(void *x) {
+ return (qpol_typebounds_t*)x;
+ };
+
+SWIGINTERN struct qpol_rolebounds *new_qpol_rolebounds(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_rolebounds_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_rolebounds(struct qpol_rolebounds *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_rolebounds_parent_name(struct qpol_rolebounds *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_rolebounds_get_parent_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get parent name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN char const *qpol_rolebounds_child_name(struct qpol_rolebounds *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_rolebounds_get_child_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get child name");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_rolebounds_t *qpol_rolebounds_from_void(void *x) {
+ return (qpol_rolebounds_t*)x;
+ };
+
+SWIGINTERN struct qpol_userbounds *new_qpol_userbounds(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_userbounds_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_userbounds(struct qpol_userbounds *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN char const *qpol_userbounds_parent_name(struct qpol_userbounds *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_userbounds_get_parent_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get parent name");
+ }
+ fail:
+ return name;
+ }
+SWIGINTERN char const *qpol_userbounds_child_name(struct qpol_userbounds *self,qpol_policy_t *p){
+ const char *name;
+ if (qpol_userbounds_get_child_name(p, self, &name)) {
+ SWIG_exception(SWIG_ValueError, "Could not get child name");
+ }
+ fail:
+ return name;
+ }
+
+ qpol_userbounds_t *qpol_userbounds_from_void(void *x) {
+ return (qpol_userbounds_t*)x;
+ };
+
+SWIGINTERN struct qpol_default_object *new_qpol_default_object(void){
+ SWIG_exception(SWIG_RuntimeError, "Cannot directly create qpol_default_object_t objects");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_default_object(struct qpol_default_object *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN qpol_class_t const *qpol_default_object_object_class(struct qpol_default_object *self,qpol_policy_t *p){
+ const qpol_class_t *cls;
+ if (qpol_default_object_get_class(p, self, &cls)) {
+ SWIG_exception(SWIG_ValueError, "Could not get class");
+ }
+ fail:
+ return cls;
+ }
+SWIGINTERN char const *qpol_default_object_user_default(struct qpol_default_object *self,qpol_policy_t *p){
+ const char *value;
+ if (qpol_default_object_get_user_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get user default");
+ }
+ fail:
+ return value;
+ }
+SWIGINTERN char const *qpol_default_object_role_default(struct qpol_default_object *self,qpol_policy_t *p){
+ const char *value;
+ if (qpol_default_object_get_role_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get role default");
+ }
+ fail:
+ return value;
+ }
+SWIGINTERN char const *qpol_default_object_type_default(struct qpol_default_object *self,qpol_policy_t *p){
+ const char *value;
+ if (qpol_default_object_get_type_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get type default");
+ }
+ fail:
+ return value;
+ }
+SWIGINTERN char const *qpol_default_object_range_default(struct qpol_default_object *self,qpol_policy_t *p){
+ const char *value;
+ if (qpol_default_object_get_range_default(p, self, &value)) {
+ SWIG_exception(SWIG_ValueError, "Could not get range defaults");
+ }
+ fail:
+ return value;
+ }
+
+ qpol_default_object_t *qpol_default_object_from_void(void *x) {
+ return (qpol_default_object_t*)x;
+ };
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_long_SS_long (PyObject *obj, unsigned long long *val)
+{
+ int res = SWIG_TypeError;
+ if (PyLong_Check(obj)) {
+ unsigned long long v = PyLong_AsUnsignedLongLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ } else {
+ unsigned long v;
+ res = SWIG_AsVal_unsigned_SS_long (obj,&v);
+ if (SWIG_IsOK(res)) {
+ if (val) *val = v;
+ return res;
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ const double mant_max = 1LL << DBL_MANT_DIG;
+ double d;
+ res = SWIG_AsVal_double (obj,&d);
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, 0, mant_max)) {
+ if (val) *val = (unsigned long long)(d);
+ return SWIG_AddCast(res);
+ }
+ res = SWIG_TypeError;
+ }
+#endif
+ return res;
+}
+
+SWIGINTERN struct qpol_iomemcon *new_qpol_iomemcon(qpol_policy_t *p,uint64_t low,uint64_t high){
+ const qpol_iomemcon_t *qp;
+ if (qpol_policy_get_iomemcon_by_addr(p, low, high, &qp)) {
+ SWIG_exception(SWIG_RuntimeError, "iomemcon statement does not exist");
+ }
+ fail:
+ return (qpol_iomemcon_t*)qp;
+ }
+SWIGINTERN void delete_qpol_iomemcon(struct qpol_iomemcon *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN uint64_t qpol_iomemcon_low_addr(struct qpol_iomemcon *self,qpol_policy_t *p){
+ uint64_t addr = 0;
+ if(qpol_iomemcon_get_low_addr(p, self, &addr)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get low addr for iomemcon statement");
+ }
+ fail:
+ return addr;
+ }
+
+SWIGINTERNINLINE PyObject*
+SWIG_From_long_SS_long (long long value)
+{
+ return ((value < LONG_MIN) || (value > LONG_MAX)) ?
+ PyLong_FromLongLong(value) : PyLong_FromLong((long)(value));
+}
+
+
+SWIGINTERNINLINE PyObject*
+SWIG_From_unsigned_SS_long_SS_long (unsigned long long value)
+{
+ return (value > LONG_MAX) ?
+ PyLong_FromUnsignedLongLong(value) : PyLong_FromLong((long)(value));
+}
+
+SWIGINTERN uint64_t qpol_iomemcon_high_addr(struct qpol_iomemcon *self,qpol_policy_t *p){
+ uint64_t addr = 0;
+ if(qpol_iomemcon_get_high_addr(p, self, &addr)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get high addr for iomemcon statement");
+ }
+ fail:
+ return addr;
+ }
+SWIGINTERN qpol_context_t const *qpol_iomemcon_context(struct qpol_iomemcon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_iomemcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for iomemcon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_iomemcon_t *qpol_iomemcon_from_void(void *x) {
+ return (qpol_iomemcon_t*)x;
+ };
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_int (PyObject * obj, unsigned int *val)
+{
+ unsigned long v;
+ int res = SWIG_AsVal_unsigned_SS_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v > UINT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = (unsigned int)(v);
+ }
+ }
+ return res;
+}
+
+SWIGINTERN struct qpol_ioportcon *new_qpol_ioportcon(qpol_policy_t *p,uint32_t low,uint32_t high){
+ const qpol_ioportcon_t *qp;
+ if (qpol_policy_get_ioportcon_by_port(p, low, high, &qp)) {
+ SWIG_exception(SWIG_RuntimeError, "ioportcon statement does not exist");
+ }
+ fail:
+ return (qpol_ioportcon_t*)qp;
+ }
+SWIGINTERN void delete_qpol_ioportcon(struct qpol_ioportcon *self){
+ /* no op */
+ return;
+ }
+SWIGINTERN uint32_t qpol_ioportcon_low_port(struct qpol_ioportcon *self,qpol_policy_t *p){
+ uint32_t port = 0;
+ if(qpol_ioportcon_get_low_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get low port for ioportcon statement");
+ }
+ fail:
+ return port;
+ }
+SWIGINTERN uint32_t qpol_ioportcon_high_port(struct qpol_ioportcon *self,qpol_policy_t *p){
+ uint32_t port = 0;
+ if(qpol_ioportcon_get_high_port(p, self, &port)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get high port for ioportcon statement");
+ }
+ fail:
+ return port;
+ }
+SWIGINTERN qpol_context_t const *qpol_ioportcon_context(struct qpol_ioportcon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_ioportcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for ioportcon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_ioportcon_t *qpol_ioportcon_from_void(void *x) {
+ return (qpol_ioportcon_t*)x;
+ };
+
+SWIGINTERN struct qpol_pcidevicecon *new_qpol_pcidevicecon(void){
+ SWIG_exception(SWIG_RuntimeError, "pcidevicecon statement does not exist");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_pcidevicecon(struct qpol_pcidevicecon *self){
+ return;
+ }
+SWIGINTERN uint32_t qpol_pcidevicecon_device(struct qpol_pcidevicecon *self,qpol_policy_t *p){
+ uint32_t device = 0;
+ if(qpol_pcidevicecon_get_device(p, self, &device)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get device for pcidevicecon statement");
+ }
+ fail:
+ return device;
+ }
+SWIGINTERN qpol_context_t const *qpol_pcidevicecon_context(struct qpol_pcidevicecon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_pcidevicecon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for pcidevicecon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_pcidevicecon_t *qpol_pcidevicecon_from_void(void *x) {
+ return (qpol_pcidevicecon_t*)x;
+ };
+
+SWIGINTERN struct qpol_pirqcon *new_qpol_pirqcon(void){
+ SWIG_exception(SWIG_RuntimeError, "pirqcon statement does not exist");
+ fail:
+ return NULL;
+ }
+SWIGINTERN void delete_qpol_pirqcon(struct qpol_pirqcon *self){
+ return;
+ }
+SWIGINTERN uint32_t qpol_pirqcon_irq(struct qpol_pirqcon *self,qpol_policy_t *p){
+ uint16_t irq = 0;
+ if(qpol_pirqcon_get_irq(p, self, &irq)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get irq for pirqcon statement");
+ }
+ fail:
+ return irq;
+ }
+SWIGINTERN qpol_context_t const *qpol_pirqcon_context(struct qpol_pirqcon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_pirqcon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for pirqcon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_pirqcon_t *qpol_pirqcon_from_void(void *x) {
+ return (qpol_pirqcon_t*)x;
+ };
+
+SWIGINTERN struct qpol_devicetreecon *new_qpol_devicetreecon(void){
+
+ SWIG_exception(SWIG_RuntimeError, "devicetreecon statement does not exist");
+
+ fail:
+ return NULL;
+ }
+SWIGINTERN char *qpol_devicetreecon_path(struct qpol_devicetreecon *self,qpol_policy_t *p){
+ char *path = NULL;
+ if(qpol_devicetreecon_get_path(p, self, &path)) {
+ SWIG_exception(SWIG_RuntimeError, "Could not get path for devicetreecon statement");
+ }
+ fail:
+ return path;
+ }
+SWIGINTERN qpol_context_t const *qpol_devicetreecon_context(struct qpol_devicetreecon *self,qpol_policy_t *p){
+ const qpol_context_t *ctx;
+ if (qpol_devicetreecon_get_context(p, self, &ctx)) {
+ SWIG_exception(SWIG_ValueError, "Could not get context for devicetreecon statement");
+ }
+ fail:
+ return ctx;
+ }
+
+ qpol_devicetreecon_t *qpol_devicetreecon_from_void(void *x) {
+ return (qpol_devicetreecon_t*)x;
+ };
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+SWIGINTERN PyObject *_wrap_to_str(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:to_str",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "to_str" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (char *)to_str(arg1);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_to_int_with_free(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:to_int_with_free",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "to_int_with_free" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (int)to_int_with_free(arg1);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_policy_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ char *arg1 = (char *) 0 ;
+ int arg2 ;
+ PyObject *arg3 = (PyObject *) 0 ;
+ int res1 ;
+ char *buf1 = 0 ;
+ int alloc1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ struct qpol_policy *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:new_qpol_policy_t",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_policy_t" "', argument " "1"" of type '" "char const *""'");
+ }
+ arg1 = (char *)(buf1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "new_qpol_policy_t" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = (int)(val2);
+ arg3 = obj2;
+ {
+ result = (struct qpol_policy *)new_qpol_policy((char const *)arg1,arg2,arg3);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_SyntaxError, "Invalid policy.");
+ } else {
+ PyErr_SetFromErrnoWithFilename(PyExc_OSError, arg1);
+ }
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_policy, SWIG_POINTER_NEW | 0 );
+ if (alloc1 == SWIG_NEWOBJ) free((char*)buf1);
+ return resultobj;
+fail:
+ if (alloc1 == SWIG_NEWOBJ) free((char*)buf1);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_policy_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_policy_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_policy_t" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ delete_qpol_policy(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_version(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_version",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_version" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (int)qpol_policy_version(arg1);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_handle_unknown(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_handle_unknown",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_handle_unknown" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (char *)qpol_policy_handle_unknown(arg1);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_target_platform(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_target_platform",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_target_platform" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (char *)qpol_policy_target_platform(arg1);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_capability(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ qpol_capability_e arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_policy_t_capability",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_capability" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "qpol_policy_t_capability" "', argument " "2"" of type '" "qpol_capability_e""'");
+ }
+ arg2 = (qpol_capability_e)(val2);
+ result = (int)qpol_policy_capability(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_type_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_type_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_type_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_type_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_type_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_type_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_type_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_type_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_role_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_role_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_role_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_role_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_role_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_role_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_role_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_role_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_level_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_level_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_level_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_level_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_level_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_level_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_level_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_level_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_cat_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_cat_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_cat_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_cat_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_cat_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_cat_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_cat_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_cat_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_user_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_user_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_user_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_user_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_user_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_user_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_user_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_user_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_bool_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_bool_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_bool_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_bool_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_bool_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_bool_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_bool_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_bool_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_class_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ char *arg2 = (char *) NULL ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O|O:qpol_policy_t_class_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_class_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ if (obj1) {
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_policy_t_class_iter" "', argument " "2"" of type '" "char *""'");
+ }
+ arg2 = (char *)(buf2);
+ }
+ result = (qpol_iterator_t *)qpol_policy_class_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_class_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_class_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_class_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_class_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_common_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ char *arg2 = (char *) NULL ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O|O:qpol_policy_t_common_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_common_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ if (obj1) {
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_policy_t_common_iter" "', argument " "2"" of type '" "char *""'");
+ }
+ arg2 = (char *)(buf2);
+ }
+ result = (qpol_iterator_t *)qpol_policy_common_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_common_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_common_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_common_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_common_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_fs_use_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_fs_use_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_fs_use_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_fs_use_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_fs_use_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_fs_use_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_fs_use_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_fs_use_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_genfscon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_genfscon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_genfscon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_genfscon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_genfscon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_genfscon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_genfscon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_genfscon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_isid_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_isid_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_isid_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_isid_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_isid_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_isid_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_isid_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_isid_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_netifcon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_netifcon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_netifcon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_netifcon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_netifcon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_netifcon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_netifcon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_netifcon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_nodecon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_nodecon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_nodecon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_nodecon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_nodecon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_nodecon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_nodecon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_nodecon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_portcon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_portcon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_portcon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_portcon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_portcon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_portcon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_portcon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_portcon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_constraint_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_constraint_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_constraint_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_constraint_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_constraint_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_constraint_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_constraint_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_constraint_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_validatetrans_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_validatetrans_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_validatetrans_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_validatetrans_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_validatetrans_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_validatetrans_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_validatetrans_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_validatetrans_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_role_allow_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_role_allow_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_role_allow_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_role_allow_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_role_allow_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_role_allow_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_role_allow_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_role_allow_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_role_trans_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_role_trans_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_role_trans_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_role_trans_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_role_trans_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_role_trans_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_role_trans_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_role_trans_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_range_trans_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_range_trans_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_range_trans_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_range_trans_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_range_trans_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_range_trans_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_range_trans_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_range_trans_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_avrule_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_allow_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_allow_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_allow_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_allow_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_auditallow_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_auditallow_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_auditallow_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_auditallow_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_neverallow_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_neverallow_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_neverallow_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_neverallow_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_dontaudit_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_dontaudit_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_dontaudit_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_dontaudit_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrulex_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrulex_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrulex_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_avrulex_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_allowx_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_allowx_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_allowx_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_allowx_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_auditallowx_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_auditallowx_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_auditallowx_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_auditallowx_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_neverallowx_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_neverallowx_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_neverallowx_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_neverallowx_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_avrule_dontauditx_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_avrule_dontauditx_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_avrule_dontauditx_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_avrule_dontauditx_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_terule_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_terule_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_terule_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_terule_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_terule_trans_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_terule_trans_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_terule_trans_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_terule_trans_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_terule_change_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_terule_change_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_terule_change_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_terule_change_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_terule_member_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_terule_member_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_terule_member_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_terule_member_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_cond_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_cond_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_cond_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_cond_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_cond_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_cond_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_cond_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_cond_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_filename_trans_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_filename_trans_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_filename_trans_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_filename_trans_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_filename_trans_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_filename_trans_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_filename_trans_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_filename_trans_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_permissive_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_permissive_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_permissive_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_permissive_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_permissive_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_permissive_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_permissive_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_permissive_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_typebounds_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_typebounds_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_typebounds_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_typebounds_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_polcap_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_polcap_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_polcap_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_polcap_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_polcap_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_polcap_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_polcap_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_polcap_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_default_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_default_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_default_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_default_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_iomemcon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_iomemcon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_iomemcon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_iomemcon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_iomemcon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_iomemcon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_iomemcon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_iomemcon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_ioportcon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_ioportcon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_ioportcon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_ioportcon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_ioportcon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_ioportcon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_ioportcon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_ioportcon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_pcidevicecon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_pcidevicecon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_pcidevicecon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_pcidevicecon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_pcidevicecon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_pcidevicecon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_pcidevicecon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_pcidevicecon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_pirqcon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_pirqcon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_pirqcon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_pirqcon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_pirqcon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_pirqcon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_pirqcon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_pirqcon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_devicetreecon_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_devicetreecon_iter",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_devicetreecon_iter" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (qpol_iterator_t *)qpol_policy_devicetreecon_iter(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_policy_t_devicetreecon_count(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_policy *arg1 = (struct qpol_policy *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_policy_t_devicetreecon_count",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_policy_t_devicetreecon_count" "', argument " "1"" of type '" "struct qpol_policy *""'");
+ }
+ arg1 = (struct qpol_policy *)(argp1);
+ result = (size_t)qpol_policy_devicetreecon_count(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_policy_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_policy, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_qpol_iterator_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iterator *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_iterator_t")) SWIG_fail;
+ result = (struct qpol_iterator *)new_qpol_iterator();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_iterator_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iterator *arg1 = (struct qpol_iterator *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_iterator_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iterator, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_iterator_t" "', argument " "1"" of type '" "struct qpol_iterator *""'");
+ }
+ arg1 = (struct qpol_iterator *)(argp1);
+ delete_qpol_iterator(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iterator_t_item(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iterator *arg1 = (struct qpol_iterator *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ void *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_iterator_t_item",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iterator_t_item" "', argument " "1"" of type '" "struct qpol_iterator *""'");
+ }
+ arg1 = (struct qpol_iterator *)(argp1);
+ result = (void *)qpol_iterator_item(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_void, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iterator_t_next_(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iterator *arg1 = (struct qpol_iterator *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_iterator_t_next_",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iterator_t_next_" "', argument " "1"" of type '" "struct qpol_iterator *""'");
+ }
+ arg1 = (struct qpol_iterator *)(argp1);
+ qpol_iterator_next_(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iterator_t_isend(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iterator *arg1 = (struct qpol_iterator *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_iterator_t_isend",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iterator_t_isend" "', argument " "1"" of type '" "struct qpol_iterator *""'");
+ }
+ arg1 = (struct qpol_iterator *)(argp1);
+ result = (int)qpol_iterator_isend(arg1);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iterator_t_size(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iterator *arg1 = (struct qpol_iterator *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ size_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_iterator_t_size",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iterator, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iterator_t_size" "', argument " "1"" of type '" "struct qpol_iterator *""'");
+ }
+ arg1 = (struct qpol_iterator *)(argp1);
+ result = (size_t)qpol_iterator_size(arg1);
+ resultobj = SWIG_From_size_t((size_t)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_iterator_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_iterator, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_qpol_type_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_type *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_type_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_type_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_type_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_type *)new_qpol_type(arg1,(char const *)arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid type or attribute.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_type_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_type_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_type_t" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ delete_qpol_type(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_name" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_type_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_value" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_type_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_isalias(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_isalias",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_isalias" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_isalias" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_type_isalias(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_isattr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_isattr",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_isattr" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_isattr" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_type_isattr(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_ispermissive(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_ispermissive",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_ispermissive" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_ispermissive" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_type_ispermissive(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_type_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_type_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_type_iter" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_type_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_type_type_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_attr_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_attr_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_attr_iter" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_attr_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_type_attr_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_type_t_alias_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_type *arg1 = (struct qpol_type *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_type_t_alias_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_type, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_t_alias_iter" "', argument " "1"" of type '" "struct qpol_type *""'");
+ }
+ arg1 = (struct qpol_type *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_type_t_alias_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_type_alias_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_type_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_type, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_type_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_type_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_type_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_type_t *)qpol_type_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_role_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_role *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_role_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_role_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_role_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_role *)new_qpol_role(arg1,(char const *)arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid type or attribute.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_role_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role *arg1 = (struct qpol_role *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_role_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_role_t" "', argument " "1"" of type '" "struct qpol_role *""'");
+ }
+ arg1 = (struct qpol_role *)(argp1);
+ delete_qpol_role(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role *arg1 = (struct qpol_role *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_t_value" "', argument " "1"" of type '" "struct qpol_role *""'");
+ }
+ arg1 = (struct qpol_role *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_role_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role *arg1 = (struct qpol_role *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_t_name" "', argument " "1"" of type '" "struct qpol_role *""'");
+ }
+ arg1 = (struct qpol_role *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_role_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_t_type_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role *arg1 = (struct qpol_role *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_t_type_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_t_type_iter" "', argument " "1"" of type '" "struct qpol_role *""'");
+ }
+ arg1 = (struct qpol_role *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_t_type_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_role_type_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_t_dominate_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role *arg1 = (struct qpol_role *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_t_dominate_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_t_dominate_iter" "', argument " "1"" of type '" "struct qpol_role *""'");
+ }
+ arg1 = (struct qpol_role *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_t_dominate_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_role_dominate_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_role_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_role, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_role_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_role_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_role_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_role_t *)qpol_role_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_level_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_level *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_level_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_level_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_level_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_level *)new_qpol_level(arg1,(char const *)arg2);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid level.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_level, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_level_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_level *arg1 = (struct qpol_level *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_level_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_level, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_level_t" "', argument " "1"" of type '" "struct qpol_level *""'");
+ }
+ arg1 = (struct qpol_level *)(argp1);
+ delete_qpol_level(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_level_t_isalias(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_level *arg1 = (struct qpol_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_level_t_isalias",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_level_t_isalias" "', argument " "1"" of type '" "struct qpol_level *""'");
+ }
+ arg1 = (struct qpol_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_level_t_isalias" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_level_isalias(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_level_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_level *arg1 = (struct qpol_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_level_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_level_t_value" "', argument " "1"" of type '" "struct qpol_level *""'");
+ }
+ arg1 = (struct qpol_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_level_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_level_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_level_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_level *arg1 = (struct qpol_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_level_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_level_t_name" "', argument " "1"" of type '" "struct qpol_level *""'");
+ }
+ arg1 = (struct qpol_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_level_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_level_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_level_t_cat_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_level *arg1 = (struct qpol_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_level_t_cat_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_level_t_cat_iter" "', argument " "1"" of type '" "struct qpol_level *""'");
+ }
+ arg1 = (struct qpol_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_level_t_cat_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_level_cat_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_level_t_alias_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_level *arg1 = (struct qpol_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_level_t_alias_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_level_t_alias_iter" "', argument " "1"" of type '" "struct qpol_level *""'");
+ }
+ arg1 = (struct qpol_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_level_t_alias_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_level_alias_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_level_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_level, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_level_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_level_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_level_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_level_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_level_t *)qpol_level_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_level, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_cat_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_cat *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_cat_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_cat_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_cat_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_cat *)new_qpol_cat(arg1,(char const *)arg2);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid category.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cat, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_cat_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cat *arg1 = (struct qpol_cat *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_cat_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cat, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_cat_t" "', argument " "1"" of type '" "struct qpol_cat *""'");
+ }
+ arg1 = (struct qpol_cat *)(argp1);
+ delete_qpol_cat(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cat_t_isalias(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cat *arg1 = (struct qpol_cat *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cat_t_isalias",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cat, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cat_t_isalias" "', argument " "1"" of type '" "struct qpol_cat *""'");
+ }
+ arg1 = (struct qpol_cat *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cat_t_isalias" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_cat_isalias(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cat_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cat *arg1 = (struct qpol_cat *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cat_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cat, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cat_t_value" "', argument " "1"" of type '" "struct qpol_cat *""'");
+ }
+ arg1 = (struct qpol_cat *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cat_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_cat_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cat_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cat *arg1 = (struct qpol_cat *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cat_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cat, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cat_t_name" "', argument " "1"" of type '" "struct qpol_cat *""'");
+ }
+ arg1 = (struct qpol_cat *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cat_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_cat_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cat_t_alias_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cat *arg1 = (struct qpol_cat *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cat_t_alias_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cat, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cat_t_alias_iter" "', argument " "1"" of type '" "struct qpol_cat *""'");
+ }
+ arg1 = (struct qpol_cat *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cat_t_alias_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_cat_alias_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_cat_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_cat, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_cat_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_cat_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_cat_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cat_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_cat_t *)qpol_cat_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cat, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_mls_range_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ qpol_mls_level_t *arg2 = (qpol_mls_level_t *) 0 ;
+ qpol_mls_level_t *arg3 = (qpol_mls_level_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ void *argp3 = 0 ;
+ int res3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ struct qpol_mls_range *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:new_qpol_mls_range_t",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_mls_range_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_mls_range_t" "', argument " "2"" of type '" "qpol_mls_level_t *""'");
+ }
+ arg2 = (qpol_mls_level_t *)(argp2);
+ res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_qpol_mls_range_t" "', argument " "3"" of type '" "qpol_mls_level_t *""'");
+ }
+ arg3 = (qpol_mls_level_t *)(argp3);
+ {
+ result = (struct qpol_mls_range *)new_qpol_mls_range(arg1,arg2,arg3);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid range.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_range, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_mls_range_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_mls_range *arg1 = (struct qpol_mls_range *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_mls_range_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_mls_range, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_mls_range_t" "', argument " "1"" of type '" "struct qpol_mls_range *""'");
+ }
+ arg1 = (struct qpol_mls_range *)(argp1);
+ delete_qpol_mls_range(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_mls_range_t_high_level(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_mls_range *arg1 = (struct qpol_mls_range *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_mls_level_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_mls_range_t_high_level",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_mls_range, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_mls_range_t_high_level" "', argument " "1"" of type '" "struct qpol_mls_range *""'");
+ }
+ arg1 = (struct qpol_mls_range *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_mls_range_t_high_level" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_mls_level_t *)qpol_mls_range_high_level(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_mls_range_t_low_level(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_mls_range *arg1 = (struct qpol_mls_range *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_mls_level_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_mls_range_t_low_level",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_mls_range, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_mls_range_t_low_level" "', argument " "1"" of type '" "struct qpol_mls_range *""'");
+ }
+ arg1 = (struct qpol_mls_range *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_mls_range_t_low_level" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_mls_level_t *)qpol_mls_range_low_level(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_mls_range_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_mls_range, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_mls_range_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_mls_range_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_mls_range_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_mls_range_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_mls_range_t *)qpol_mls_range_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_range, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_semantic_level_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_semantic_level *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_semantic_level_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_semantic_level_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_semantic_level_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_semantic_level *)new_qpol_semantic_level(arg1,(char const *)arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid sensitivity name.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_semantic_level, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_semantic_level_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_semantic_level *arg1 = (struct qpol_semantic_level *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_semantic_level_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_semantic_level, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_semantic_level_t" "', argument " "1"" of type '" "struct qpol_semantic_level *""'");
+ }
+ arg1 = (struct qpol_semantic_level *)(argp1);
+ delete_qpol_semantic_level(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_semantic_level_t_add_cats(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_semantic_level *arg1 = (struct qpol_semantic_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:qpol_semantic_level_t_add_cats",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_semantic_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_semantic_level_t_add_cats" "', argument " "1"" of type '" "struct qpol_semantic_level *""'");
+ }
+ arg1 = (struct qpol_semantic_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_semantic_level_t_add_cats" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "qpol_semantic_level_t_add_cats" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = (char *)(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "qpol_semantic_level_t_add_cats" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = (char *)(buf4);
+ {
+ result = (int)qpol_semantic_level_add_cats(arg1,arg2,(char const *)arg3,(char const *)arg4);
+ if (result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid category name or category range.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_From_int((int)(result));
+ if (alloc3 == SWIG_NEWOBJ) free((char*)buf3);
+ if (alloc4 == SWIG_NEWOBJ) free((char*)buf4);
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) free((char*)buf3);
+ if (alloc4 == SWIG_NEWOBJ) free((char*)buf4);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_semantic_level_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_semantic_level, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_qpol_mls_level_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ qpol_semantic_level_t *arg2 = (qpol_semantic_level_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_mls_level *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_mls_level_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_mls_level_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_semantic_level, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_mls_level_t" "', argument " "2"" of type '" "qpol_semantic_level_t *""'");
+ }
+ arg2 = (qpol_semantic_level_t *)(argp2);
+ {
+ result = (struct qpol_mls_level *)new_qpol_mls_level(arg1,arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid level.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_level, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_mls_level_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_mls_level *arg1 = (struct qpol_mls_level *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_mls_level_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_mls_level, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_mls_level_t" "', argument " "1"" of type '" "struct qpol_mls_level *""'");
+ }
+ arg1 = (struct qpol_mls_level *)(argp1);
+ delete_qpol_mls_level(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_mls_level_t_sens_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_mls_level *arg1 = (struct qpol_mls_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_mls_level_t_sens_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_mls_level_t_sens_name" "', argument " "1"" of type '" "struct qpol_mls_level *""'");
+ }
+ arg1 = (struct qpol_mls_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_mls_level_t_sens_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_mls_level_sens_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_mls_level_t_cat_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_mls_level *arg1 = (struct qpol_mls_level *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_mls_level_t_cat_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_mls_level_t_cat_iter" "', argument " "1"" of type '" "struct qpol_mls_level *""'");
+ }
+ arg1 = (struct qpol_mls_level *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_mls_level_t_cat_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_mls_level_cat_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_mls_level_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_mls_level, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_mls_level_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_mls_level_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_mls_level_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_mls_level_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_mls_level_t *)qpol_mls_level_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_user_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_user *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_user_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_user_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_user_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_user *)new_qpol_user(arg1,(char const *)arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Invalid user.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_user, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_user_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_user *arg1 = (struct qpol_user *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_user_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_user, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_user_t" "', argument " "1"" of type '" "struct qpol_user *""'");
+ }
+ arg1 = (struct qpol_user *)(argp1);
+ delete_qpol_user(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_user_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_user *arg1 = (struct qpol_user *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_user_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_user, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_user_t_value" "', argument " "1"" of type '" "struct qpol_user *""'");
+ }
+ arg1 = (struct qpol_user *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_user_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_user_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_user_t_role_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_user *arg1 = (struct qpol_user *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_user_t_role_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_user, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_user_t_role_iter" "', argument " "1"" of type '" "struct qpol_user *""'");
+ }
+ arg1 = (struct qpol_user *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_user_t_role_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_user_role_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_user_t_range(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_user *arg1 = (struct qpol_user *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_mls_range_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_user_t_range",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_user, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_user_t_range" "', argument " "1"" of type '" "struct qpol_user *""'");
+ }
+ arg1 = (struct qpol_user *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_user_t_range" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_mls_range_t *)qpol_user_range(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_range, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_user_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_user *arg1 = (struct qpol_user *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_user_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_user, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_user_t_name" "', argument " "1"" of type '" "struct qpol_user *""'");
+ }
+ arg1 = (struct qpol_user *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_user_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_user_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_user_t_dfltlevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_user *arg1 = (struct qpol_user *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_mls_level_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_user_t_dfltlevel",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_user, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_user_t_dfltlevel" "', argument " "1"" of type '" "struct qpol_user *""'");
+ }
+ arg1 = (struct qpol_user *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_user_t_dfltlevel" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_mls_level_t *)qpol_user_dfltlevel(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_level, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_user_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_user, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_user_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_user_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_user_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_user_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_user_t *)qpol_user_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_user, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_bool_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_bool *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_bool_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_bool_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_bool_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ result = (struct qpol_bool *)new_qpol_bool(arg1,(char const *)arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_bool, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_bool_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_bool *arg1 = (struct qpol_bool *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_bool_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_bool, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_bool_t" "', argument " "1"" of type '" "struct qpol_bool *""'");
+ }
+ arg1 = (struct qpol_bool *)(argp1);
+ delete_qpol_bool(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_bool_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_bool *arg1 = (struct qpol_bool *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_bool_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_bool, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_bool_t_value" "', argument " "1"" of type '" "struct qpol_bool *""'");
+ }
+ arg1 = (struct qpol_bool *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_bool_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_bool_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_bool_t_state(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_bool *arg1 = (struct qpol_bool *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_bool_t_state",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_bool, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_bool_t_state" "', argument " "1"" of type '" "struct qpol_bool *""'");
+ }
+ arg1 = (struct qpol_bool *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_bool_t_state" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_bool_state(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_bool_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_bool *arg1 = (struct qpol_bool *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_bool_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_bool, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_bool_t_name" "', argument " "1"" of type '" "struct qpol_bool *""'");
+ }
+ arg1 = (struct qpol_bool *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_bool_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_bool_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_bool_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_bool, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_bool_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_bool_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_bool_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_bool_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_bool_t *)qpol_bool_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_bool, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_context_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_context *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_context_t")) SWIG_fail;
+ result = (struct qpol_context *)new_qpol_context();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_context_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_context *arg1 = (struct qpol_context *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_context_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_context, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_context_t" "', argument " "1"" of type '" "struct qpol_context *""'");
+ }
+ arg1 = (struct qpol_context *)(argp1);
+ delete_qpol_context(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_context_t_user(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_context *arg1 = (struct qpol_context *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_user_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_context_t_user",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_context, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_context_t_user" "', argument " "1"" of type '" "struct qpol_context *""'");
+ }
+ arg1 = (struct qpol_context *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_context_t_user" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_user_t *)qpol_context_user(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_user, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_context_t_role(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_context *arg1 = (struct qpol_context *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_role_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_context_t_role",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_context, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_context_t_role" "', argument " "1"" of type '" "struct qpol_context *""'");
+ }
+ arg1 = (struct qpol_context *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_context_t_role" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_role_t *)qpol_context_role(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_context_t_type_(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_context *arg1 = (struct qpol_context *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_context_t_type_",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_context, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_context_t_type_" "', argument " "1"" of type '" "struct qpol_context *""'");
+ }
+ arg1 = (struct qpol_context *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_context_t_type_" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_context_type_(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_context_t_range(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_context *arg1 = (struct qpol_context *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_mls_range_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_context_t_range",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_context, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_context_t_range" "', argument " "1"" of type '" "struct qpol_context *""'");
+ }
+ arg1 = (struct qpol_context *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_context_t_range" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_mls_range_t *)qpol_context_range(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_range, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_context_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_context, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_context_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_context_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_context_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_context_t *)qpol_context_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_class_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_class *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_class_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_class_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_class_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_class *)new_qpol_class(arg1,(char const *)arg2);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid class.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_class_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_class_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_class_t" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ delete_qpol_class(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_class_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_class_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_t_value" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_class_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_class_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_class_t_common(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_common_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_class_t_common",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_t_common" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_class_t_common" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ {
+ result = (qpol_common_t *)qpol_class_common(arg1,arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_ValueError, "Class does not inherit a common.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_common, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_class_t_perm_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_class_t_perm_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_t_perm_iter" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_class_t_perm_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_class_perm_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_class_t_constraint_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_class_t_constraint_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_t_constraint_iter" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_class_t_constraint_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_class_constraint_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_class_t_validatetrans_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_class_t_validatetrans_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_t_validatetrans_iter" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_class_t_validatetrans_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_class_validatetrans_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_class_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_class *arg1 = (struct qpol_class *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_class_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_class, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_t_name" "', argument " "1"" of type '" "struct qpol_class *""'");
+ }
+ arg1 = (struct qpol_class *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_class_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_class_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_class_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_class, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_class_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_class_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_class_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_class_t *)qpol_class_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_common_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_common *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_common_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_common_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_common_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_common *)new_qpol_common(arg1,(char const *)arg2);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid common.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_common, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_common_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_common *arg1 = (struct qpol_common *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_common_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_common, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_common_t" "', argument " "1"" of type '" "struct qpol_common *""'");
+ }
+ arg1 = (struct qpol_common *)(argp1);
+ delete_qpol_common(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_common_t_value(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_common *arg1 = (struct qpol_common *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_common_t_value",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_common, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_common_t_value" "', argument " "1"" of type '" "struct qpol_common *""'");
+ }
+ arg1 = (struct qpol_common *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_common_t_value" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_common_value(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_common_t_perm_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_common *arg1 = (struct qpol_common *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_common_t_perm_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_common, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_common_t_perm_iter" "', argument " "1"" of type '" "struct qpol_common *""'");
+ }
+ arg1 = (struct qpol_common *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_common_t_perm_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_common_perm_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_common_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_common *arg1 = (struct qpol_common *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_common_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_common, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_common_t_name" "', argument " "1"" of type '" "struct qpol_common *""'");
+ }
+ arg1 = (struct qpol_common *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_common_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_common_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_common_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_common, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_common_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_common_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_common_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_common_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_common_t *)qpol_common_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_common, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_fs_use_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_fs_use *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_fs_use_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_fs_use_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_fs_use_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ result = (struct qpol_fs_use *)new_qpol_fs_use(arg1,(char const *)arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_fs_use, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_fs_use_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_fs_use *arg1 = (struct qpol_fs_use *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_fs_use_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_fs_use, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_fs_use_t" "', argument " "1"" of type '" "struct qpol_fs_use *""'");
+ }
+ arg1 = (struct qpol_fs_use *)(argp1);
+ delete_qpol_fs_use(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_fs_use_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_fs_use *arg1 = (struct qpol_fs_use *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_fs_use_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_fs_use, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_fs_use_t_name" "', argument " "1"" of type '" "struct qpol_fs_use *""'");
+ }
+ arg1 = (struct qpol_fs_use *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_fs_use_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_fs_use_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_fs_use_t_behavior(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_fs_use *arg1 = (struct qpol_fs_use *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_fs_use_t_behavior",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_fs_use, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_fs_use_t_behavior" "', argument " "1"" of type '" "struct qpol_fs_use *""'");
+ }
+ arg1 = (struct qpol_fs_use *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_fs_use_t_behavior" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_fs_use_behavior(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_fs_use_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_fs_use *arg1 = (struct qpol_fs_use *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_fs_use_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_fs_use, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_fs_use_t_context" "', argument " "1"" of type '" "struct qpol_fs_use *""'");
+ }
+ arg1 = (struct qpol_fs_use *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_fs_use_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_fs_use_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_fs_use_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_fs_use, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_fs_use_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_fs_use_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_fs_use_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_fs_use_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_fs_use_t *)qpol_fs_use_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_fs_use, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_genfscon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ struct qpol_genfscon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:new_qpol_genfscon_t",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_genfscon_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_genfscon_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_qpol_genfscon_t" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = (char *)(buf3);
+ result = (struct qpol_genfscon *)new_qpol_genfscon(arg1,(char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_genfscon, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ if (alloc3 == SWIG_NEWOBJ) free((char*)buf3);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ if (alloc3 == SWIG_NEWOBJ) free((char*)buf3);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_genfscon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_genfscon *arg1 = (struct qpol_genfscon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_genfscon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_genfscon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_genfscon_t" "', argument " "1"" of type '" "struct qpol_genfscon *""'");
+ }
+ arg1 = (struct qpol_genfscon *)(argp1);
+ delete_qpol_genfscon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_genfscon_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_genfscon *arg1 = (struct qpol_genfscon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_genfscon_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_genfscon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_genfscon_t_name" "', argument " "1"" of type '" "struct qpol_genfscon *""'");
+ }
+ arg1 = (struct qpol_genfscon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_genfscon_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_genfscon_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_genfscon_t_path(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_genfscon *arg1 = (struct qpol_genfscon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_genfscon_t_path",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_genfscon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_genfscon_t_path" "', argument " "1"" of type '" "struct qpol_genfscon *""'");
+ }
+ arg1 = (struct qpol_genfscon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_genfscon_t_path" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_genfscon_path(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_genfscon_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_genfscon *arg1 = (struct qpol_genfscon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_genfscon_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_genfscon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_genfscon_t_object_class" "', argument " "1"" of type '" "struct qpol_genfscon *""'");
+ }
+ arg1 = (struct qpol_genfscon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_genfscon_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (unsigned int)qpol_genfscon_object_class(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_int((unsigned int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_genfscon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_genfscon *arg1 = (struct qpol_genfscon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_genfscon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_genfscon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_genfscon_t_context" "', argument " "1"" of type '" "struct qpol_genfscon *""'");
+ }
+ arg1 = (struct qpol_genfscon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_genfscon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_genfscon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_genfscon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_genfscon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_genfscon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_genfscon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_genfscon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_genfscon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_genfscon_t *)qpol_genfscon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_genfscon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_isid_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_isid *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_isid_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_isid_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_isid_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ {
+ result = (struct qpol_isid *)new_qpol_isid(arg1,(char const *)arg2);
+ if (!result) {
+ if (errno == EINVAL) {
+ PyErr_SetString(PyExc_ValueError, "Invalid initial sid name.");
+ } else {
+ PyErr_SetFromErrno(PyExc_OSError);
+ }
+
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_isid, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_isid_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_isid *arg1 = (struct qpol_isid *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_isid_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_isid, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_isid_t" "', argument " "1"" of type '" "struct qpol_isid *""'");
+ }
+ arg1 = (struct qpol_isid *)(argp1);
+ delete_qpol_isid(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_isid_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_isid *arg1 = (struct qpol_isid *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_isid_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_isid, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_isid_t_name" "', argument " "1"" of type '" "struct qpol_isid *""'");
+ }
+ arg1 = (struct qpol_isid *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_isid_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_isid_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_isid_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_isid *arg1 = (struct qpol_isid *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_isid_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_isid, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_isid_t_context" "', argument " "1"" of type '" "struct qpol_isid *""'");
+ }
+ arg1 = (struct qpol_isid *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_isid_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_isid_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_isid_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_isid, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_isid_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_isid_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_isid_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_isid_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_isid_t *)qpol_isid_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_isid, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_netifcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ struct qpol_netifcon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_qpol_netifcon_t",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_netifcon_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_netifcon_t" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = (char *)(buf2);
+ result = (struct qpol_netifcon *)new_qpol_netifcon(arg1,(char const *)arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_netifcon, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) free((char*)buf2);
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_netifcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_netifcon *arg1 = (struct qpol_netifcon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_netifcon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_netifcon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_netifcon_t" "', argument " "1"" of type '" "struct qpol_netifcon *""'");
+ }
+ arg1 = (struct qpol_netifcon *)(argp1);
+ delete_qpol_netifcon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_netifcon_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_netifcon *arg1 = (struct qpol_netifcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_netifcon_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_netifcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_netifcon_t_name" "', argument " "1"" of type '" "struct qpol_netifcon *""'");
+ }
+ arg1 = (struct qpol_netifcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_netifcon_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_netifcon_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_netifcon_t_msg_con(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_netifcon *arg1 = (struct qpol_netifcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_netifcon_t_msg_con",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_netifcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_netifcon_t_msg_con" "', argument " "1"" of type '" "struct qpol_netifcon *""'");
+ }
+ arg1 = (struct qpol_netifcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_netifcon_t_msg_con" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_netifcon_msg_con(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_netifcon_t_if_con(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_netifcon *arg1 = (struct qpol_netifcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_netifcon_t_if_con",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_netifcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_netifcon_t_if_con" "', argument " "1"" of type '" "struct qpol_netifcon *""'");
+ }
+ arg1 = (struct qpol_netifcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_netifcon_t_if_con" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_netifcon_if_con(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_netifcon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_netifcon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_netifcon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_netifcon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_netifcon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_netifcon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_netifcon_t *)qpol_netifcon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_netifcon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_nodecon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ int *arg2 ;
+ int *arg3 ;
+ int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ void *argp3 = 0 ;
+ int res3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ struct qpol_nodecon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:new_qpol_nodecon_t",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_nodecon_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_int, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_qpol_nodecon_t" "', argument " "2"" of type '" "int [4]""'");
+ }
+ arg2 = (int *)(argp2);
+ res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_int, 0 | 0 );
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_qpol_nodecon_t" "', argument " "3"" of type '" "int [4]""'");
+ }
+ arg3 = (int *)(argp3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "new_qpol_nodecon_t" "', argument " "4"" of type '" "int""'");
+ }
+ arg4 = (int)(val4);
+ result = (struct qpol_nodecon *)new_qpol_nodecon(arg1,arg2,arg3,arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_nodecon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_nodecon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_nodecon *arg1 = (struct qpol_nodecon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_nodecon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_nodecon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_nodecon_t" "', argument " "1"" of type '" "struct qpol_nodecon *""'");
+ }
+ arg1 = (struct qpol_nodecon *)(argp1);
+ delete_qpol_nodecon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_nodecon_t_addr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_nodecon *arg1 = (struct qpol_nodecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_nodecon_t_addr",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_nodecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_nodecon_t_addr" "', argument " "1"" of type '" "struct qpol_nodecon *""'");
+ }
+ arg1 = (struct qpol_nodecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_nodecon_t_addr" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_nodecon_addr(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_nodecon_t_mask(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_nodecon *arg1 = (struct qpol_nodecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_nodecon_t_mask",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_nodecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_nodecon_t_mask" "', argument " "1"" of type '" "struct qpol_nodecon *""'");
+ }
+ arg1 = (struct qpol_nodecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_nodecon_t_mask" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_nodecon_mask(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_nodecon_t_protocol(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_nodecon *arg1 = (struct qpol_nodecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_nodecon_t_protocol",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_nodecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_nodecon_t_protocol" "', argument " "1"" of type '" "struct qpol_nodecon *""'");
+ }
+ arg1 = (struct qpol_nodecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_nodecon_t_protocol" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_nodecon_protocol(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_nodecon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_nodecon *arg1 = (struct qpol_nodecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_nodecon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_nodecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_nodecon_t_context" "', argument " "1"" of type '" "struct qpol_nodecon *""'");
+ }
+ arg1 = (struct qpol_nodecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_nodecon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_nodecon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_nodecon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_nodecon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_nodecon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_nodecon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_nodecon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_nodecon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_nodecon_t *)qpol_nodecon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_nodecon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_portcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ uint16_t arg2 ;
+ uint16_t arg3 ;
+ uint8_t arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned short val2 ;
+ int ecode2 = 0 ;
+ unsigned short val3 ;
+ int ecode3 = 0 ;
+ unsigned char val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ struct qpol_portcon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:new_qpol_portcon_t",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_portcon_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "new_qpol_portcon_t" "', argument " "2"" of type '" "uint16_t""'");
+ }
+ arg2 = (uint16_t)(val2);
+ ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "new_qpol_portcon_t" "', argument " "3"" of type '" "uint16_t""'");
+ }
+ arg3 = (uint16_t)(val3);
+ ecode4 = SWIG_AsVal_unsigned_SS_char(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "new_qpol_portcon_t" "', argument " "4"" of type '" "uint8_t""'");
+ }
+ arg4 = (uint8_t)(val4);
+ result = (struct qpol_portcon *)new_qpol_portcon(arg1,arg2,arg3,arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_portcon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_portcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_portcon *arg1 = (struct qpol_portcon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_portcon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_portcon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_portcon_t" "', argument " "1"" of type '" "struct qpol_portcon *""'");
+ }
+ arg1 = (struct qpol_portcon *)(argp1);
+ delete_qpol_portcon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_portcon_t_low_port(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_portcon *arg1 = (struct qpol_portcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint16_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_portcon_t_low_port",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_portcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_portcon_t_low_port" "', argument " "1"" of type '" "struct qpol_portcon *""'");
+ }
+ arg1 = (struct qpol_portcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_portcon_t_low_port" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint16_t)qpol_portcon_low_port(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_short((unsigned short)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_portcon_t_high_port(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_portcon *arg1 = (struct qpol_portcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint16_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_portcon_t_high_port",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_portcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_portcon_t_high_port" "', argument " "1"" of type '" "struct qpol_portcon *""'");
+ }
+ arg1 = (struct qpol_portcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_portcon_t_high_port" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint16_t)qpol_portcon_high_port(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_short((unsigned short)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_portcon_t_protocol(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_portcon *arg1 = (struct qpol_portcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint8_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_portcon_t_protocol",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_portcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_portcon_t_protocol" "', argument " "1"" of type '" "struct qpol_portcon *""'");
+ }
+ arg1 = (struct qpol_portcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_portcon_t_protocol" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint8_t)qpol_portcon_protocol(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_char((unsigned char)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_portcon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_portcon *arg1 = (struct qpol_portcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_portcon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_portcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_portcon_t_context" "', argument " "1"" of type '" "struct qpol_portcon *""'");
+ }
+ arg1 = (struct qpol_portcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_portcon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_portcon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_portcon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_portcon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_portcon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_portcon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_portcon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_portcon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_portcon_t *)qpol_portcon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_portcon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_constraint_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_constraint_t")) SWIG_fail;
+ result = (struct qpol_constraint *)new_qpol_constraint();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_constraint, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_constraint_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint *arg1 = (struct qpol_constraint *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_constraint_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_constraint_t" "', argument " "1"" of type '" "struct qpol_constraint *""'");
+ }
+ arg1 = (struct qpol_constraint *)(argp1);
+ delete_qpol_constraint(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint *arg1 = (struct qpol_constraint *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_t_object_class" "', argument " "1"" of type '" "struct qpol_constraint *""'");
+ }
+ arg1 = (struct qpol_constraint *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_constraint_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_t_perm_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint *arg1 = (struct qpol_constraint *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_t_perm_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_t_perm_iter" "', argument " "1"" of type '" "struct qpol_constraint *""'");
+ }
+ arg1 = (struct qpol_constraint *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_t_perm_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_constraint_perm_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_t_expr_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint *arg1 = (struct qpol_constraint *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_t_expr_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_t_expr_iter" "', argument " "1"" of type '" "struct qpol_constraint *""'");
+ }
+ arg1 = (struct qpol_constraint *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_t_expr_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_constraint_expr_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_constraint_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_constraint, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_constraint_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_constraint_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_constraint_t *)qpol_constraint_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_constraint, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_validatetrans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_validatetrans *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_validatetrans_t")) SWIG_fail;
+ result = (struct qpol_validatetrans *)new_qpol_validatetrans();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_validatetrans, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_validatetrans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_validatetrans *arg1 = (struct qpol_validatetrans *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_validatetrans_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_validatetrans, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_validatetrans_t" "', argument " "1"" of type '" "struct qpol_validatetrans *""'");
+ }
+ arg1 = (struct qpol_validatetrans *)(argp1);
+ delete_qpol_validatetrans(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_validatetrans_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_validatetrans *arg1 = (struct qpol_validatetrans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_validatetrans_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_validatetrans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_validatetrans_t_object_class" "', argument " "1"" of type '" "struct qpol_validatetrans *""'");
+ }
+ arg1 = (struct qpol_validatetrans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_validatetrans_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_validatetrans_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_validatetrans_t_expr_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_validatetrans *arg1 = (struct qpol_validatetrans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_validatetrans_t_expr_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_validatetrans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_validatetrans_t_expr_iter" "', argument " "1"" of type '" "struct qpol_validatetrans *""'");
+ }
+ arg1 = (struct qpol_validatetrans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_validatetrans_t_expr_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_validatetrans_expr_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_validatetrans_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_validatetrans, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_validatetrans_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_validatetrans_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_validatetrans_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_validatetrans_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_validatetrans_t *)qpol_validatetrans_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_validatetrans, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_constraint_expr_node_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint_expr_node *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_constraint_expr_node_t")) SWIG_fail;
+ result = (struct qpol_constraint_expr_node *)new_qpol_constraint_expr_node();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_constraint_expr_node, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_constraint_expr_node_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint_expr_node *arg1 = (struct qpol_constraint_expr_node *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_constraint_expr_node_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint_expr_node, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_constraint_expr_node_t" "', argument " "1"" of type '" "struct qpol_constraint_expr_node *""'");
+ }
+ arg1 = (struct qpol_constraint_expr_node *)(argp1);
+ delete_qpol_constraint_expr_node(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_expr_node_t_expr_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint_expr_node *arg1 = (struct qpol_constraint_expr_node *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_expr_node_t_expr_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint_expr_node, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_expr_node_t_expr_type" "', argument " "1"" of type '" "struct qpol_constraint_expr_node *""'");
+ }
+ arg1 = (struct qpol_constraint_expr_node *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_expr_node_t_expr_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_constraint_expr_node_expr_type(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_expr_node_t_sym_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint_expr_node *arg1 = (struct qpol_constraint_expr_node *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_expr_node_t_sym_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint_expr_node, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_expr_node_t_sym_type" "', argument " "1"" of type '" "struct qpol_constraint_expr_node *""'");
+ }
+ arg1 = (struct qpol_constraint_expr_node *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_expr_node_t_sym_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_constraint_expr_node_sym_type(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_expr_node_t_op(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint_expr_node *arg1 = (struct qpol_constraint_expr_node *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_expr_node_t_op",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint_expr_node, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_expr_node_t_op" "', argument " "1"" of type '" "struct qpol_constraint_expr_node *""'");
+ }
+ arg1 = (struct qpol_constraint_expr_node *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_expr_node_t_op" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_constraint_expr_node_op(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_expr_node_t_names_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_constraint_expr_node *arg1 = (struct qpol_constraint_expr_node *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_constraint_expr_node_t_names_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_constraint_expr_node, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_expr_node_t_names_iter" "', argument " "1"" of type '" "struct qpol_constraint_expr_node *""'");
+ }
+ arg1 = (struct qpol_constraint_expr_node *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_constraint_expr_node_t_names_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_constraint_expr_node_names_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_constraint_expr_node_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_constraint_expr_node, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_constraint_expr_node_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_constraint_expr_node_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_constraint_expr_node_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_constraint_expr_node_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_constraint_expr_node_t *)qpol_constraint_expr_node_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_constraint_expr_node, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_role_allow_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_allow *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_role_allow_t")) SWIG_fail;
+ result = (struct qpol_role_allow *)new_qpol_role_allow();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role_allow, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_role_allow_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_allow *arg1 = (struct qpol_role_allow *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_role_allow_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_allow, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_role_allow_t" "', argument " "1"" of type '" "struct qpol_role_allow *""'");
+ }
+ arg1 = (struct qpol_role_allow *)(argp1);
+ delete_qpol_role_allow(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_allow_t_source_role(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_allow *arg1 = (struct qpol_role_allow *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_role_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_allow_t_source_role",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_allow, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_allow_t_source_role" "', argument " "1"" of type '" "struct qpol_role_allow *""'");
+ }
+ arg1 = (struct qpol_role_allow *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_allow_t_source_role" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_role_t *)qpol_role_allow_source_role(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_allow_t_target_role(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_allow *arg1 = (struct qpol_role_allow *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_role_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_allow_t_target_role",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_allow, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_allow_t_target_role" "', argument " "1"" of type '" "struct qpol_role_allow *""'");
+ }
+ arg1 = (struct qpol_role_allow *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_allow_t_target_role" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_role_t *)qpol_role_allow_target_role(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_role_allow_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_role_allow, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_role_allow_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_role_allow_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_role_allow_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_allow_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_role_allow_t *)qpol_role_allow_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role_allow, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_role_trans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_trans *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_role_trans_t")) SWIG_fail;
+ result = (struct qpol_role_trans *)new_qpol_role_trans();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role_trans, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_role_trans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_trans *arg1 = (struct qpol_role_trans *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_role_trans_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_trans, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_role_trans_t" "', argument " "1"" of type '" "struct qpol_role_trans *""'");
+ }
+ arg1 = (struct qpol_role_trans *)(argp1);
+ delete_qpol_role_trans(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_trans_t_source_role(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_trans *arg1 = (struct qpol_role_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_role_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_trans_t_source_role",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_trans_t_source_role" "', argument " "1"" of type '" "struct qpol_role_trans *""'");
+ }
+ arg1 = (struct qpol_role_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_trans_t_source_role" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_role_t *)qpol_role_trans_source_role(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_trans_t_target_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_trans *arg1 = (struct qpol_role_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_trans_t_target_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_trans_t_target_type" "', argument " "1"" of type '" "struct qpol_role_trans *""'");
+ }
+ arg1 = (struct qpol_role_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_trans_t_target_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_role_trans_target_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_trans_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_trans *arg1 = (struct qpol_role_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_trans_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_trans_t_object_class" "', argument " "1"" of type '" "struct qpol_role_trans *""'");
+ }
+ arg1 = (struct qpol_role_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_trans_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_role_trans_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_role_trans_t_default_role(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_role_trans *arg1 = (struct qpol_role_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_role_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_role_trans_t_default_role",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_role_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_trans_t_default_role" "', argument " "1"" of type '" "struct qpol_role_trans *""'");
+ }
+ arg1 = (struct qpol_role_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_role_trans_t_default_role" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_role_t *)qpol_role_trans_default_role(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_role_trans_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_role_trans, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_role_trans_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_role_trans_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_role_trans_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_role_trans_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_role_trans_t *)qpol_role_trans_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_role_trans, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_range_trans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_range_trans *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_range_trans_t")) SWIG_fail;
+ result = (struct qpol_range_trans *)new_qpol_range_trans();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_range_trans, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_range_trans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_range_trans *arg1 = (struct qpol_range_trans *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_range_trans_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_range_trans, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_range_trans_t" "', argument " "1"" of type '" "struct qpol_range_trans *""'");
+ }
+ arg1 = (struct qpol_range_trans *)(argp1);
+ delete_qpol_range_trans(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_range_trans_t_source_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_range_trans *arg1 = (struct qpol_range_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_range_trans_t_source_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_range_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_range_trans_t_source_type" "', argument " "1"" of type '" "struct qpol_range_trans *""'");
+ }
+ arg1 = (struct qpol_range_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_range_trans_t_source_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_range_trans_source_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_range_trans_t_target_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_range_trans *arg1 = (struct qpol_range_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_range_trans_t_target_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_range_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_range_trans_t_target_type" "', argument " "1"" of type '" "struct qpol_range_trans *""'");
+ }
+ arg1 = (struct qpol_range_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_range_trans_t_target_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_range_trans_target_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_range_trans_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_range_trans *arg1 = (struct qpol_range_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_range_trans_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_range_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_range_trans_t_object_class" "', argument " "1"" of type '" "struct qpol_range_trans *""'");
+ }
+ arg1 = (struct qpol_range_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_range_trans_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_range_trans_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_range_trans_t_range(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_range_trans *arg1 = (struct qpol_range_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_mls_range_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_range_trans_t_range",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_range_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_range_trans_t_range" "', argument " "1"" of type '" "struct qpol_range_trans *""'");
+ }
+ arg1 = (struct qpol_range_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_range_trans_t_range" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_mls_range_t *)qpol_range_trans_range(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_mls_range, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_range_trans_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_range_trans, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_range_trans_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_range_trans_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_range_trans_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_range_trans_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_range_trans_t *)qpol_range_trans_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_range_trans, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_avrule_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_avrule_t")) SWIG_fail;
+ result = (struct qpol_avrule *)new_qpol_avrule();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_avrule, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_avrule_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_avrule_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_avrule_t" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ delete_qpol_avrule(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_rule_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_rule_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_rule_type" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_rule_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_avrule_rule_type(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_source_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_source_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_source_type" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_source_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_avrule_source_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_target_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_target_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_target_type" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_target_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_avrule_target_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_object_class" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_avrule_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_perm_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_perm_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_perm_iter" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_perm_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_avrule_perm_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_xperm_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_xperm_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_xperm_iter" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_xperm_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_avrule_xperm_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_is_extended(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_is_extended",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_is_extended" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_is_extended" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_avrule_is_extended(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_xperm_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_xperm_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_xperm_type" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_xperm_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_avrule_xperm_type(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_cond(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_cond_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_cond",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_cond" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_cond" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ {
+ result = (qpol_cond_t *)qpol_avrule_cond(arg1,arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cond, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_is_enabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_is_enabled",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_is_enabled" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_is_enabled" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_avrule_is_enabled(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_which_list(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_which_list",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_which_list" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_which_list" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ {
+ result = (int)qpol_avrule_which_list(arg1,arg2);
+ if (result < 0) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_t_syn_avrule_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_avrule *arg1 = (struct qpol_avrule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_avrule_t_syn_avrule_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_t_syn_avrule_iter" "', argument " "1"" of type '" "struct qpol_avrule *""'");
+ }
+ arg1 = (struct qpol_avrule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_avrule_t_syn_avrule_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_avrule_syn_avrule_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_avrule_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_avrule, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_avrule_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_avrule_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_avrule_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_avrule_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_avrule_t *)qpol_avrule_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_avrule, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_terule_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_terule_t")) SWIG_fail;
+ result = (struct qpol_terule *)new_qpol_terule();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_terule, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_terule_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_terule_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_terule_t" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ delete_qpol_terule(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_rule_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_rule_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_rule_type" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_rule_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_terule_rule_type(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_source_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_source_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_source_type" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_source_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_terule_source_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_target_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_target_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_target_type" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_target_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_terule_target_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_object_class" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_terule_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_default_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_default_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_default_type" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_default_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_terule_default_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_cond(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_cond_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_cond",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_cond" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_cond" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ {
+ result = (qpol_cond_t *)qpol_terule_cond(arg1,arg2);
+ if (!result) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cond, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_is_enabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_is_enabled",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_is_enabled" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_is_enabled" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_terule_is_enabled(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_which_list(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_which_list",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_which_list" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_which_list" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ {
+ result = (int)qpol_terule_which_list(arg1,arg2);
+ if (result < 0) {
+ PyErr_SetString(PyExc_AttributeError, "Rule is not conditional.");
+ return NULL;
+ }
+ }
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_terule_t_syn_terule_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_terule *arg1 = (struct qpol_terule *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_terule_t_syn_terule_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_terule, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_t_syn_terule_iter" "', argument " "1"" of type '" "struct qpol_terule *""'");
+ }
+ arg1 = (struct qpol_terule *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_terule_t_syn_terule_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_terule_syn_terule_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_terule_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_terule, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_terule_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_terule_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_terule_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_terule_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_terule_t *)qpol_terule_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_terule, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_cond_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_cond_t")) SWIG_fail;
+ result = (struct qpol_cond *)new_qpol_cond();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cond, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_cond_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_cond_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_cond_t" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ delete_qpol_cond(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_t_expr_node_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cond_t_expr_node_iter",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_t_expr_node_iter" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_t_expr_node_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_iterator_t *)qpol_cond_expr_node_iter(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_t_av_true_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:qpol_cond_t_av_true_iter",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_t_av_true_iter" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_t_av_true_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "qpol_cond_t_av_true_iter" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = (int)(val3);
+ result = (qpol_iterator_t *)qpol_cond_av_true_iter(arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_t_av_false_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:qpol_cond_t_av_false_iter",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_t_av_false_iter" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_t_av_false_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "qpol_cond_t_av_false_iter" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = (int)(val3);
+ result = (qpol_iterator_t *)qpol_cond_av_false_iter(arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_t_te_true_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:qpol_cond_t_te_true_iter",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_t_te_true_iter" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_t_te_true_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "qpol_cond_t_te_true_iter" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = (int)(val3);
+ result = (qpol_iterator_t *)qpol_cond_te_true_iter(arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_t_te_false_iter(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ qpol_iterator_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:qpol_cond_t_te_false_iter",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_t_te_false_iter" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_t_te_false_iter" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "qpol_cond_t_te_false_iter" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = (int)(val3);
+ result = (qpol_iterator_t *)qpol_cond_te_false_iter(arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iterator, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_t_evaluate(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond *arg1 = (struct qpol_cond *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cond_t_evaluate",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_t_evaluate" "', argument " "1"" of type '" "struct qpol_cond *""'");
+ }
+ arg1 = (struct qpol_cond *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_t_evaluate" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_cond_evaluate(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_cond_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_cond, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_cond_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_cond_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_cond_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_cond_t *)qpol_cond_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cond, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_cond_expr_node_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond_expr_node *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_cond_expr_node_t")) SWIG_fail;
+ result = (struct qpol_cond_expr_node *)new_qpol_cond_expr_node();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cond_expr_node, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_cond_expr_node_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond_expr_node *arg1 = (struct qpol_cond_expr_node *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_cond_expr_node_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond_expr_node, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_cond_expr_node_t" "', argument " "1"" of type '" "struct qpol_cond_expr_node *""'");
+ }
+ arg1 = (struct qpol_cond_expr_node *)(argp1);
+ delete_qpol_cond_expr_node(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_expr_node_t_expr_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond_expr_node *arg1 = (struct qpol_cond_expr_node *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cond_expr_node_t_expr_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond_expr_node, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_expr_node_t_expr_type" "', argument " "1"" of type '" "struct qpol_cond_expr_node *""'");
+ }
+ arg1 = (struct qpol_cond_expr_node *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_expr_node_t_expr_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (int)qpol_cond_expr_node_expr_type(arg1,arg2);
+ resultobj = SWIG_From_int((int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_cond_expr_node_t_get_boolean(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_cond_expr_node *arg1 = (struct qpol_cond_expr_node *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_bool_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_cond_expr_node_t_get_boolean",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_cond_expr_node, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_expr_node_t_get_boolean" "', argument " "1"" of type '" "struct qpol_cond_expr_node *""'");
+ }
+ arg1 = (struct qpol_cond_expr_node *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_cond_expr_node_t_get_boolean" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_bool_t *)qpol_cond_expr_node_get_boolean(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_bool, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_cond_expr_node_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_cond_expr_node, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_cond_expr_node_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_cond_expr_node_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_cond_expr_node_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_cond_expr_node_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_cond_expr_node_t *)qpol_cond_expr_node_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_cond_expr_node, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_filename_trans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_filename_trans_t")) SWIG_fail;
+ result = (struct qpol_filename_trans *)new_qpol_filename_trans();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_filename_trans, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_filename_trans_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *arg1 = (struct qpol_filename_trans *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_filename_trans_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_filename_trans, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_filename_trans_t" "', argument " "1"" of type '" "struct qpol_filename_trans *""'");
+ }
+ arg1 = (struct qpol_filename_trans *)(argp1);
+ delete_qpol_filename_trans(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_filename_trans_t_source_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *arg1 = (struct qpol_filename_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_filename_trans_t_source_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_filename_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_filename_trans_t_source_type" "', argument " "1"" of type '" "struct qpol_filename_trans *""'");
+ }
+ arg1 = (struct qpol_filename_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_filename_trans_t_source_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_filename_trans_source_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_filename_trans_t_target_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *arg1 = (struct qpol_filename_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_filename_trans_t_target_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_filename_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_filename_trans_t_target_type" "', argument " "1"" of type '" "struct qpol_filename_trans *""'");
+ }
+ arg1 = (struct qpol_filename_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_filename_trans_t_target_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_filename_trans_target_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_filename_trans_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *arg1 = (struct qpol_filename_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_filename_trans_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_filename_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_filename_trans_t_object_class" "', argument " "1"" of type '" "struct qpol_filename_trans *""'");
+ }
+ arg1 = (struct qpol_filename_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_filename_trans_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_filename_trans_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_filename_trans_t_default_type(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *arg1 = (struct qpol_filename_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_type_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_filename_trans_t_default_type",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_filename_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_filename_trans_t_default_type" "', argument " "1"" of type '" "struct qpol_filename_trans *""'");
+ }
+ arg1 = (struct qpol_filename_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_filename_trans_t_default_type" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_type_t *)qpol_filename_trans_default_type(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_type, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_filename_trans_t_filename(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_filename_trans *arg1 = (struct qpol_filename_trans *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_filename_trans_t_filename",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_filename_trans, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_filename_trans_t_filename" "', argument " "1"" of type '" "struct qpol_filename_trans *""'");
+ }
+ arg1 = (struct qpol_filename_trans *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_filename_trans_t_filename" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_filename_trans_filename(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_filename_trans_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_filename_trans, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_filename_trans_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_filename_trans_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_filename_trans_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_filename_trans_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_filename_trans_t *)qpol_filename_trans_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_filename_trans, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_polcap_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_polcap *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_polcap_t")) SWIG_fail;
+ result = (struct qpol_polcap *)new_qpol_polcap();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_polcap, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_polcap_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_polcap *arg1 = (struct qpol_polcap *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_polcap_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_polcap, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_polcap_t" "', argument " "1"" of type '" "struct qpol_polcap *""'");
+ }
+ arg1 = (struct qpol_polcap *)(argp1);
+ delete_qpol_polcap(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_polcap_t_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_polcap *arg1 = (struct qpol_polcap *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_polcap_t_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_polcap, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_polcap_t_name" "', argument " "1"" of type '" "struct qpol_polcap *""'");
+ }
+ arg1 = (struct qpol_polcap *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_polcap_t_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_polcap_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_polcap_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_polcap, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_polcap_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_polcap_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_polcap_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_polcap_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_polcap_t *)qpol_polcap_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_polcap, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_typebounds_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_typebounds *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_typebounds_t")) SWIG_fail;
+ result = (struct qpol_typebounds *)new_qpol_typebounds();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_typebounds, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_typebounds_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_typebounds *arg1 = (struct qpol_typebounds *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_typebounds_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_typebounds, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_typebounds_t" "', argument " "1"" of type '" "struct qpol_typebounds *""'");
+ }
+ arg1 = (struct qpol_typebounds *)(argp1);
+ delete_qpol_typebounds(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_typebounds_t_parent_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_typebounds *arg1 = (struct qpol_typebounds *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_typebounds_t_parent_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_typebounds, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_typebounds_t_parent_name" "', argument " "1"" of type '" "struct qpol_typebounds *""'");
+ }
+ arg1 = (struct qpol_typebounds *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_typebounds_t_parent_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_typebounds_parent_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_typebounds_t_child_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_typebounds *arg1 = (struct qpol_typebounds *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_typebounds_t_child_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_typebounds, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_typebounds_t_child_name" "', argument " "1"" of type '" "struct qpol_typebounds *""'");
+ }
+ arg1 = (struct qpol_typebounds *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_typebounds_t_child_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_typebounds_child_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_typebounds_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_typebounds, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_typebounds_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_typebounds_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_typebounds_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_typebounds_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_typebounds_t *)qpol_typebounds_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_typebounds, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_rolebounds_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_rolebounds *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_rolebounds_t")) SWIG_fail;
+ result = (struct qpol_rolebounds *)new_qpol_rolebounds();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_rolebounds, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_rolebounds_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_rolebounds *arg1 = (struct qpol_rolebounds *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_rolebounds_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_rolebounds, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_rolebounds_t" "', argument " "1"" of type '" "struct qpol_rolebounds *""'");
+ }
+ arg1 = (struct qpol_rolebounds *)(argp1);
+ delete_qpol_rolebounds(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_rolebounds_t_parent_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_rolebounds *arg1 = (struct qpol_rolebounds *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_rolebounds_t_parent_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_rolebounds, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_rolebounds_t_parent_name" "', argument " "1"" of type '" "struct qpol_rolebounds *""'");
+ }
+ arg1 = (struct qpol_rolebounds *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_rolebounds_t_parent_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_rolebounds_parent_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_rolebounds_t_child_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_rolebounds *arg1 = (struct qpol_rolebounds *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_rolebounds_t_child_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_rolebounds, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_rolebounds_t_child_name" "', argument " "1"" of type '" "struct qpol_rolebounds *""'");
+ }
+ arg1 = (struct qpol_rolebounds *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_rolebounds_t_child_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_rolebounds_child_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_rolebounds_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_rolebounds, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_rolebounds_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_rolebounds_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_rolebounds_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_rolebounds_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_rolebounds_t *)qpol_rolebounds_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_rolebounds, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_userbounds_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_userbounds *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_userbounds_t")) SWIG_fail;
+ result = (struct qpol_userbounds *)new_qpol_userbounds();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_userbounds, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_userbounds_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_userbounds *arg1 = (struct qpol_userbounds *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_userbounds_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_userbounds, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_userbounds_t" "', argument " "1"" of type '" "struct qpol_userbounds *""'");
+ }
+ arg1 = (struct qpol_userbounds *)(argp1);
+ delete_qpol_userbounds(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_userbounds_t_parent_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_userbounds *arg1 = (struct qpol_userbounds *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_userbounds_t_parent_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_userbounds, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_userbounds_t_parent_name" "', argument " "1"" of type '" "struct qpol_userbounds *""'");
+ }
+ arg1 = (struct qpol_userbounds *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_userbounds_t_parent_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_userbounds_parent_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_userbounds_t_child_name(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_userbounds *arg1 = (struct qpol_userbounds *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_userbounds_t_child_name",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_userbounds, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_userbounds_t_child_name" "', argument " "1"" of type '" "struct qpol_userbounds *""'");
+ }
+ arg1 = (struct qpol_userbounds *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_userbounds_t_child_name" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_userbounds_child_name(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_userbounds_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_userbounds, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_userbounds_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_userbounds_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_userbounds_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_userbounds_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_userbounds_t *)qpol_userbounds_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_userbounds, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_default_object_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_default_object_t")) SWIG_fail;
+ result = (struct qpol_default_object *)new_qpol_default_object();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_default_object, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_default_object_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *arg1 = (struct qpol_default_object *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_default_object_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_default_object, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_default_object_t" "', argument " "1"" of type '" "struct qpol_default_object *""'");
+ }
+ arg1 = (struct qpol_default_object *)(argp1);
+ delete_qpol_default_object(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_default_object_t_object_class(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *arg1 = (struct qpol_default_object *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_class_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_default_object_t_object_class",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_default_object, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_default_object_t_object_class" "', argument " "1"" of type '" "struct qpol_default_object *""'");
+ }
+ arg1 = (struct qpol_default_object *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_default_object_t_object_class" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_class_t *)qpol_default_object_object_class(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_class, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_default_object_t_user_default(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *arg1 = (struct qpol_default_object *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_default_object_t_user_default",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_default_object, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_default_object_t_user_default" "', argument " "1"" of type '" "struct qpol_default_object *""'");
+ }
+ arg1 = (struct qpol_default_object *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_default_object_t_user_default" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_default_object_user_default(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_default_object_t_role_default(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *arg1 = (struct qpol_default_object *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_default_object_t_role_default",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_default_object, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_default_object_t_role_default" "', argument " "1"" of type '" "struct qpol_default_object *""'");
+ }
+ arg1 = (struct qpol_default_object *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_default_object_t_role_default" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_default_object_role_default(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_default_object_t_type_default(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *arg1 = (struct qpol_default_object *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_default_object_t_type_default",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_default_object, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_default_object_t_type_default" "', argument " "1"" of type '" "struct qpol_default_object *""'");
+ }
+ arg1 = (struct qpol_default_object *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_default_object_t_type_default" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_default_object_type_default(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_default_object_t_range_default(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_default_object *arg1 = (struct qpol_default_object *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_default_object_t_range_default",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_default_object, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_default_object_t_range_default" "', argument " "1"" of type '" "struct qpol_default_object *""'");
+ }
+ arg1 = (struct qpol_default_object *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_default_object_t_range_default" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_default_object_range_default(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_default_object_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_default_object, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_default_object_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_default_object_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_default_object_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_default_object_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_default_object_t *)qpol_default_object_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_default_object, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_iomemcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ uint64_t arg2 ;
+ uint64_t arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ unsigned long long val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ struct qpol_iomemcon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:new_qpol_iomemcon_t",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_iomemcon_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "new_qpol_iomemcon_t" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = (uint64_t)(val2);
+ ecode3 = SWIG_AsVal_unsigned_SS_long_SS_long(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "new_qpol_iomemcon_t" "', argument " "3"" of type '" "uint64_t""'");
+ }
+ arg3 = (uint64_t)(val3);
+ result = (struct qpol_iomemcon *)new_qpol_iomemcon(arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iomemcon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_iomemcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iomemcon *arg1 = (struct qpol_iomemcon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_iomemcon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iomemcon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_iomemcon_t" "', argument " "1"" of type '" "struct qpol_iomemcon *""'");
+ }
+ arg1 = (struct qpol_iomemcon *)(argp1);
+ delete_qpol_iomemcon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iomemcon_t_low_addr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iomemcon *arg1 = (struct qpol_iomemcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_iomemcon_t_low_addr",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iomemcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iomemcon_t_low_addr" "', argument " "1"" of type '" "struct qpol_iomemcon *""'");
+ }
+ arg1 = (struct qpol_iomemcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_iomemcon_t_low_addr" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint64_t)qpol_iomemcon_low_addr(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_long_SS_long((unsigned long long)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iomemcon_t_high_addr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iomemcon *arg1 = (struct qpol_iomemcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_iomemcon_t_high_addr",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iomemcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iomemcon_t_high_addr" "', argument " "1"" of type '" "struct qpol_iomemcon *""'");
+ }
+ arg1 = (struct qpol_iomemcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_iomemcon_t_high_addr" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint64_t)qpol_iomemcon_high_addr(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_long_SS_long((unsigned long long)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_iomemcon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_iomemcon *arg1 = (struct qpol_iomemcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_iomemcon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_iomemcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iomemcon_t_context" "', argument " "1"" of type '" "struct qpol_iomemcon *""'");
+ }
+ arg1 = (struct qpol_iomemcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_iomemcon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_iomemcon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_iomemcon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_iomemcon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_iomemcon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_iomemcon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_iomemcon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_iomemcon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_iomemcon_t *)qpol_iomemcon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_iomemcon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_ioportcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ qpol_policy_t *arg1 = (qpol_policy_t *) 0 ;
+ uint32_t arg2 ;
+ uint32_t arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ struct qpol_ioportcon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:new_qpol_ioportcon_t",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_qpol_ioportcon_t" "', argument " "1"" of type '" "qpol_policy_t *""'");
+ }
+ arg1 = (qpol_policy_t *)(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "new_qpol_ioportcon_t" "', argument " "2"" of type '" "uint32_t""'");
+ }
+ arg2 = (uint32_t)(val2);
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "new_qpol_ioportcon_t" "', argument " "3"" of type '" "uint32_t""'");
+ }
+ arg3 = (uint32_t)(val3);
+ result = (struct qpol_ioportcon *)new_qpol_ioportcon(arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_ioportcon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_ioportcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_ioportcon *arg1 = (struct qpol_ioportcon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_ioportcon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_ioportcon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_ioportcon_t" "', argument " "1"" of type '" "struct qpol_ioportcon *""'");
+ }
+ arg1 = (struct qpol_ioportcon *)(argp1);
+ delete_qpol_ioportcon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_ioportcon_t_low_port(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_ioportcon *arg1 = (struct qpol_ioportcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint32_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_ioportcon_t_low_port",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_ioportcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_ioportcon_t_low_port" "', argument " "1"" of type '" "struct qpol_ioportcon *""'");
+ }
+ arg1 = (struct qpol_ioportcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_ioportcon_t_low_port" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint32_t)qpol_ioportcon_low_port(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_int((unsigned int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_ioportcon_t_high_port(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_ioportcon *arg1 = (struct qpol_ioportcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint32_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_ioportcon_t_high_port",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_ioportcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_ioportcon_t_high_port" "', argument " "1"" of type '" "struct qpol_ioportcon *""'");
+ }
+ arg1 = (struct qpol_ioportcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_ioportcon_t_high_port" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint32_t)qpol_ioportcon_high_port(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_int((unsigned int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_ioportcon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_ioportcon *arg1 = (struct qpol_ioportcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_ioportcon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_ioportcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_ioportcon_t_context" "', argument " "1"" of type '" "struct qpol_ioportcon *""'");
+ }
+ arg1 = (struct qpol_ioportcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_ioportcon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_ioportcon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_ioportcon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_ioportcon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_ioportcon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_ioportcon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_ioportcon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_ioportcon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_ioportcon_t *)qpol_ioportcon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_ioportcon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_pcidevicecon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pcidevicecon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_pcidevicecon_t")) SWIG_fail;
+ result = (struct qpol_pcidevicecon *)new_qpol_pcidevicecon();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_pcidevicecon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_pcidevicecon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pcidevicecon *arg1 = (struct qpol_pcidevicecon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_pcidevicecon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_pcidevicecon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_pcidevicecon_t" "', argument " "1"" of type '" "struct qpol_pcidevicecon *""'");
+ }
+ arg1 = (struct qpol_pcidevicecon *)(argp1);
+ delete_qpol_pcidevicecon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_pcidevicecon_t_device(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pcidevicecon *arg1 = (struct qpol_pcidevicecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint32_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_pcidevicecon_t_device",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_pcidevicecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_pcidevicecon_t_device" "', argument " "1"" of type '" "struct qpol_pcidevicecon *""'");
+ }
+ arg1 = (struct qpol_pcidevicecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_pcidevicecon_t_device" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint32_t)qpol_pcidevicecon_device(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_int((unsigned int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_pcidevicecon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pcidevicecon *arg1 = (struct qpol_pcidevicecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_pcidevicecon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_pcidevicecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_pcidevicecon_t_context" "', argument " "1"" of type '" "struct qpol_pcidevicecon *""'");
+ }
+ arg1 = (struct qpol_pcidevicecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_pcidevicecon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_pcidevicecon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_pcidevicecon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_pcidevicecon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_pcidevicecon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_pcidevicecon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_pcidevicecon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_pcidevicecon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_pcidevicecon_t *)qpol_pcidevicecon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_pcidevicecon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_pirqcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pirqcon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_pirqcon_t")) SWIG_fail;
+ result = (struct qpol_pirqcon *)new_qpol_pirqcon();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_pirqcon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_pirqcon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pirqcon *arg1 = (struct qpol_pirqcon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_pirqcon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_pirqcon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_pirqcon_t" "', argument " "1"" of type '" "struct qpol_pirqcon *""'");
+ }
+ arg1 = (struct qpol_pirqcon *)(argp1);
+ delete_qpol_pirqcon(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_pirqcon_t_irq(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pirqcon *arg1 = (struct qpol_pirqcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ uint32_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_pirqcon_t_irq",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_pirqcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_pirqcon_t_irq" "', argument " "1"" of type '" "struct qpol_pirqcon *""'");
+ }
+ arg1 = (struct qpol_pirqcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_pirqcon_t_irq" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (uint32_t)qpol_pirqcon_irq(arg1,arg2);
+ resultobj = SWIG_From_unsigned_SS_int((unsigned int)(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_pirqcon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_pirqcon *arg1 = (struct qpol_pirqcon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_pirqcon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_pirqcon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_pirqcon_t_context" "', argument " "1"" of type '" "struct qpol_pirqcon *""'");
+ }
+ arg1 = (struct qpol_pirqcon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_pirqcon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_pirqcon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_pirqcon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_pirqcon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_pirqcon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_pirqcon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_pirqcon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_pirqcon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_pirqcon_t *)qpol_pirqcon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_pirqcon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_new_qpol_devicetreecon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_devicetreecon *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_qpol_devicetreecon_t")) SWIG_fail;
+ result = (struct qpol_devicetreecon *)new_qpol_devicetreecon();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_devicetreecon, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_devicetreecon_t_path(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_devicetreecon *arg1 = (struct qpol_devicetreecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_devicetreecon_t_path",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_devicetreecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_devicetreecon_t_path" "', argument " "1"" of type '" "struct qpol_devicetreecon *""'");
+ }
+ arg1 = (struct qpol_devicetreecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_devicetreecon_t_path" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (char *)qpol_devicetreecon_path(arg1,arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_qpol_devicetreecon_t_context(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_devicetreecon *arg1 = (struct qpol_devicetreecon *) 0 ;
+ qpol_policy_t *arg2 = (qpol_policy_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ qpol_context_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:qpol_devicetreecon_t_context",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_devicetreecon, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_devicetreecon_t_context" "', argument " "1"" of type '" "struct qpol_devicetreecon *""'");
+ }
+ arg1 = (struct qpol_devicetreecon *)(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_qpol_policy, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "qpol_devicetreecon_t_context" "', argument " "2"" of type '" "qpol_policy_t *""'");
+ }
+ arg2 = (qpol_policy_t *)(argp2);
+ result = (qpol_context_t *)qpol_devicetreecon_context(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_context, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_qpol_devicetreecon_t(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ struct qpol_devicetreecon *arg1 = (struct qpol_devicetreecon *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_qpol_devicetreecon_t",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_qpol_devicetreecon, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_qpol_devicetreecon_t" "', argument " "1"" of type '" "struct qpol_devicetreecon *""'");
+ }
+ arg1 = (struct qpol_devicetreecon *)(argp1);
+ free((char *) arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *qpol_devicetreecon_t_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_qpol_devicetreecon, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_qpol_devicetreecon_from_void(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ int res1 ;
+ PyObject * obj0 = 0 ;
+ qpol_devicetreecon_t *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:qpol_devicetreecon_from_void",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "qpol_devicetreecon_from_void" "', argument " "1"" of type '" "void *""'");
+ }
+ result = (qpol_devicetreecon_t *)qpol_devicetreecon_from_void(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_qpol_devicetreecon, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+static PyMethodDef SwigMethods[] = {
+ { (char *)"SWIG_PyInstanceMethod_New", (PyCFunction)SWIG_PyInstanceMethod_New, METH_O, NULL},
+ { (char *)"to_str", _wrap_to_str, METH_VARARGS, NULL},
+ { (char *)"to_int_with_free", _wrap_to_int_with_free, METH_VARARGS, NULL},
+ { (char *)"new_qpol_policy_t", _wrap_new_qpol_policy_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_policy_t", _wrap_delete_qpol_policy_t, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_version", _wrap_qpol_policy_t_version, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_handle_unknown", _wrap_qpol_policy_t_handle_unknown, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_target_platform", _wrap_qpol_policy_t_target_platform, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_capability", _wrap_qpol_policy_t_capability, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_type_iter", _wrap_qpol_policy_t_type_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_type_count", _wrap_qpol_policy_t_type_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_role_iter", _wrap_qpol_policy_t_role_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_role_count", _wrap_qpol_policy_t_role_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_level_iter", _wrap_qpol_policy_t_level_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_level_count", _wrap_qpol_policy_t_level_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_cat_iter", _wrap_qpol_policy_t_cat_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_cat_count", _wrap_qpol_policy_t_cat_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_user_iter", _wrap_qpol_policy_t_user_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_user_count", _wrap_qpol_policy_t_user_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_bool_iter", _wrap_qpol_policy_t_bool_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_bool_count", _wrap_qpol_policy_t_bool_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_class_iter", _wrap_qpol_policy_t_class_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_class_count", _wrap_qpol_policy_t_class_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_common_iter", _wrap_qpol_policy_t_common_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_common_count", _wrap_qpol_policy_t_common_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_fs_use_iter", _wrap_qpol_policy_t_fs_use_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_fs_use_count", _wrap_qpol_policy_t_fs_use_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_genfscon_iter", _wrap_qpol_policy_t_genfscon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_genfscon_count", _wrap_qpol_policy_t_genfscon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_isid_iter", _wrap_qpol_policy_t_isid_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_isid_count", _wrap_qpol_policy_t_isid_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_netifcon_iter", _wrap_qpol_policy_t_netifcon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_netifcon_count", _wrap_qpol_policy_t_netifcon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_nodecon_iter", _wrap_qpol_policy_t_nodecon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_nodecon_count", _wrap_qpol_policy_t_nodecon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_portcon_iter", _wrap_qpol_policy_t_portcon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_portcon_count", _wrap_qpol_policy_t_portcon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_constraint_iter", _wrap_qpol_policy_t_constraint_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_constraint_count", _wrap_qpol_policy_t_constraint_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_validatetrans_iter", _wrap_qpol_policy_t_validatetrans_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_validatetrans_count", _wrap_qpol_policy_t_validatetrans_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_role_allow_iter", _wrap_qpol_policy_t_role_allow_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_role_allow_count", _wrap_qpol_policy_t_role_allow_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_role_trans_iter", _wrap_qpol_policy_t_role_trans_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_role_trans_count", _wrap_qpol_policy_t_role_trans_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_range_trans_iter", _wrap_qpol_policy_t_range_trans_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_range_trans_count", _wrap_qpol_policy_t_range_trans_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_iter", _wrap_qpol_policy_t_avrule_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_allow_count", _wrap_qpol_policy_t_avrule_allow_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_auditallow_count", _wrap_qpol_policy_t_avrule_auditallow_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_neverallow_count", _wrap_qpol_policy_t_avrule_neverallow_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_dontaudit_count", _wrap_qpol_policy_t_avrule_dontaudit_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrulex_iter", _wrap_qpol_policy_t_avrulex_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_allowx_count", _wrap_qpol_policy_t_avrule_allowx_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_auditallowx_count", _wrap_qpol_policy_t_avrule_auditallowx_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_neverallowx_count", _wrap_qpol_policy_t_avrule_neverallowx_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_avrule_dontauditx_count", _wrap_qpol_policy_t_avrule_dontauditx_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_terule_iter", _wrap_qpol_policy_t_terule_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_terule_trans_count", _wrap_qpol_policy_t_terule_trans_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_terule_change_count", _wrap_qpol_policy_t_terule_change_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_terule_member_count", _wrap_qpol_policy_t_terule_member_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_cond_iter", _wrap_qpol_policy_t_cond_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_cond_count", _wrap_qpol_policy_t_cond_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_filename_trans_iter", _wrap_qpol_policy_t_filename_trans_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_filename_trans_count", _wrap_qpol_policy_t_filename_trans_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_permissive_iter", _wrap_qpol_policy_t_permissive_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_permissive_count", _wrap_qpol_policy_t_permissive_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_typebounds_iter", _wrap_qpol_policy_t_typebounds_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_polcap_iter", _wrap_qpol_policy_t_polcap_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_polcap_count", _wrap_qpol_policy_t_polcap_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_default_iter", _wrap_qpol_policy_t_default_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_iomemcon_iter", _wrap_qpol_policy_t_iomemcon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_iomemcon_count", _wrap_qpol_policy_t_iomemcon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_ioportcon_iter", _wrap_qpol_policy_t_ioportcon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_ioportcon_count", _wrap_qpol_policy_t_ioportcon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_pcidevicecon_iter", _wrap_qpol_policy_t_pcidevicecon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_pcidevicecon_count", _wrap_qpol_policy_t_pcidevicecon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_pirqcon_iter", _wrap_qpol_policy_t_pirqcon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_pirqcon_count", _wrap_qpol_policy_t_pirqcon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_devicetreecon_iter", _wrap_qpol_policy_t_devicetreecon_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_devicetreecon_count", _wrap_qpol_policy_t_devicetreecon_count, METH_VARARGS, NULL},
+ { (char *)"qpol_policy_t_swigregister", qpol_policy_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_qpol_iterator_t", _wrap_new_qpol_iterator_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_iterator_t", _wrap_delete_qpol_iterator_t, METH_VARARGS, NULL},
+ { (char *)"qpol_iterator_t_item", _wrap_qpol_iterator_t_item, METH_VARARGS, NULL},
+ { (char *)"qpol_iterator_t_next_", _wrap_qpol_iterator_t_next_, METH_VARARGS, NULL},
+ { (char *)"qpol_iterator_t_isend", _wrap_qpol_iterator_t_isend, METH_VARARGS, NULL},
+ { (char *)"qpol_iterator_t_size", _wrap_qpol_iterator_t_size, METH_VARARGS, NULL},
+ { (char *)"qpol_iterator_t_swigregister", qpol_iterator_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_qpol_type_t", _wrap_new_qpol_type_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_type_t", _wrap_delete_qpol_type_t, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_name", _wrap_qpol_type_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_value", _wrap_qpol_type_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_isalias", _wrap_qpol_type_t_isalias, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_isattr", _wrap_qpol_type_t_isattr, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_ispermissive", _wrap_qpol_type_t_ispermissive, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_type_iter", _wrap_qpol_type_t_type_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_attr_iter", _wrap_qpol_type_t_attr_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_alias_iter", _wrap_qpol_type_t_alias_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_type_t_swigregister", qpol_type_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_type_from_void", _wrap_qpol_type_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_role_t", _wrap_new_qpol_role_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_role_t", _wrap_delete_qpol_role_t, METH_VARARGS, NULL},
+ { (char *)"qpol_role_t_value", _wrap_qpol_role_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_role_t_name", _wrap_qpol_role_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_role_t_type_iter", _wrap_qpol_role_t_type_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_role_t_dominate_iter", _wrap_qpol_role_t_dominate_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_role_t_swigregister", qpol_role_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_role_from_void", _wrap_qpol_role_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_level_t", _wrap_new_qpol_level_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_level_t", _wrap_delete_qpol_level_t, METH_VARARGS, NULL},
+ { (char *)"qpol_level_t_isalias", _wrap_qpol_level_t_isalias, METH_VARARGS, NULL},
+ { (char *)"qpol_level_t_value", _wrap_qpol_level_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_level_t_name", _wrap_qpol_level_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_level_t_cat_iter", _wrap_qpol_level_t_cat_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_level_t_alias_iter", _wrap_qpol_level_t_alias_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_level_t_swigregister", qpol_level_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_level_from_void", _wrap_qpol_level_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_cat_t", _wrap_new_qpol_cat_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_cat_t", _wrap_delete_qpol_cat_t, METH_VARARGS, NULL},
+ { (char *)"qpol_cat_t_isalias", _wrap_qpol_cat_t_isalias, METH_VARARGS, NULL},
+ { (char *)"qpol_cat_t_value", _wrap_qpol_cat_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_cat_t_name", _wrap_qpol_cat_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_cat_t_alias_iter", _wrap_qpol_cat_t_alias_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_cat_t_swigregister", qpol_cat_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_cat_from_void", _wrap_qpol_cat_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_mls_range_t", _wrap_new_qpol_mls_range_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_mls_range_t", _wrap_delete_qpol_mls_range_t, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_range_t_high_level", _wrap_qpol_mls_range_t_high_level, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_range_t_low_level", _wrap_qpol_mls_range_t_low_level, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_range_t_swigregister", qpol_mls_range_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_range_from_void", _wrap_qpol_mls_range_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_semantic_level_t", _wrap_new_qpol_semantic_level_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_semantic_level_t", _wrap_delete_qpol_semantic_level_t, METH_VARARGS, NULL},
+ { (char *)"qpol_semantic_level_t_add_cats", _wrap_qpol_semantic_level_t_add_cats, METH_VARARGS, NULL},
+ { (char *)"qpol_semantic_level_t_swigregister", qpol_semantic_level_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_qpol_mls_level_t", _wrap_new_qpol_mls_level_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_mls_level_t", _wrap_delete_qpol_mls_level_t, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_level_t_sens_name", _wrap_qpol_mls_level_t_sens_name, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_level_t_cat_iter", _wrap_qpol_mls_level_t_cat_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_level_t_swigregister", qpol_mls_level_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_mls_level_from_void", _wrap_qpol_mls_level_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_user_t", _wrap_new_qpol_user_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_user_t", _wrap_delete_qpol_user_t, METH_VARARGS, NULL},
+ { (char *)"qpol_user_t_value", _wrap_qpol_user_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_user_t_role_iter", _wrap_qpol_user_t_role_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_user_t_range", _wrap_qpol_user_t_range, METH_VARARGS, NULL},
+ { (char *)"qpol_user_t_name", _wrap_qpol_user_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_user_t_dfltlevel", _wrap_qpol_user_t_dfltlevel, METH_VARARGS, NULL},
+ { (char *)"qpol_user_t_swigregister", qpol_user_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_user_from_void", _wrap_qpol_user_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_bool_t", _wrap_new_qpol_bool_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_bool_t", _wrap_delete_qpol_bool_t, METH_VARARGS, NULL},
+ { (char *)"qpol_bool_t_value", _wrap_qpol_bool_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_bool_t_state", _wrap_qpol_bool_t_state, METH_VARARGS, NULL},
+ { (char *)"qpol_bool_t_name", _wrap_qpol_bool_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_bool_t_swigregister", qpol_bool_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_bool_from_void", _wrap_qpol_bool_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_context_t", _wrap_new_qpol_context_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_context_t", _wrap_delete_qpol_context_t, METH_VARARGS, NULL},
+ { (char *)"qpol_context_t_user", _wrap_qpol_context_t_user, METH_VARARGS, NULL},
+ { (char *)"qpol_context_t_role", _wrap_qpol_context_t_role, METH_VARARGS, NULL},
+ { (char *)"qpol_context_t_type_", _wrap_qpol_context_t_type_, METH_VARARGS, NULL},
+ { (char *)"qpol_context_t_range", _wrap_qpol_context_t_range, METH_VARARGS, NULL},
+ { (char *)"qpol_context_t_swigregister", qpol_context_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_context_from_void", _wrap_qpol_context_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_class_t", _wrap_new_qpol_class_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_class_t", _wrap_delete_qpol_class_t, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_value", _wrap_qpol_class_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_common", _wrap_qpol_class_t_common, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_perm_iter", _wrap_qpol_class_t_perm_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_constraint_iter", _wrap_qpol_class_t_constraint_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_validatetrans_iter", _wrap_qpol_class_t_validatetrans_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_name", _wrap_qpol_class_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_class_t_swigregister", qpol_class_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_class_from_void", _wrap_qpol_class_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_common_t", _wrap_new_qpol_common_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_common_t", _wrap_delete_qpol_common_t, METH_VARARGS, NULL},
+ { (char *)"qpol_common_t_value", _wrap_qpol_common_t_value, METH_VARARGS, NULL},
+ { (char *)"qpol_common_t_perm_iter", _wrap_qpol_common_t_perm_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_common_t_name", _wrap_qpol_common_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_common_t_swigregister", qpol_common_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_common_from_void", _wrap_qpol_common_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_fs_use_t", _wrap_new_qpol_fs_use_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_fs_use_t", _wrap_delete_qpol_fs_use_t, METH_VARARGS, NULL},
+ { (char *)"qpol_fs_use_t_name", _wrap_qpol_fs_use_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_fs_use_t_behavior", _wrap_qpol_fs_use_t_behavior, METH_VARARGS, NULL},
+ { (char *)"qpol_fs_use_t_context", _wrap_qpol_fs_use_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_fs_use_t_swigregister", qpol_fs_use_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_fs_use_from_void", _wrap_qpol_fs_use_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_genfscon_t", _wrap_new_qpol_genfscon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_genfscon_t", _wrap_delete_qpol_genfscon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_genfscon_t_name", _wrap_qpol_genfscon_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_genfscon_t_path", _wrap_qpol_genfscon_t_path, METH_VARARGS, NULL},
+ { (char *)"qpol_genfscon_t_object_class", _wrap_qpol_genfscon_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_genfscon_t_context", _wrap_qpol_genfscon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_genfscon_t_swigregister", qpol_genfscon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_genfscon_from_void", _wrap_qpol_genfscon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_isid_t", _wrap_new_qpol_isid_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_isid_t", _wrap_delete_qpol_isid_t, METH_VARARGS, NULL},
+ { (char *)"qpol_isid_t_name", _wrap_qpol_isid_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_isid_t_context", _wrap_qpol_isid_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_isid_t_swigregister", qpol_isid_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_isid_from_void", _wrap_qpol_isid_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_netifcon_t", _wrap_new_qpol_netifcon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_netifcon_t", _wrap_delete_qpol_netifcon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_netifcon_t_name", _wrap_qpol_netifcon_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_netifcon_t_msg_con", _wrap_qpol_netifcon_t_msg_con, METH_VARARGS, NULL},
+ { (char *)"qpol_netifcon_t_if_con", _wrap_qpol_netifcon_t_if_con, METH_VARARGS, NULL},
+ { (char *)"qpol_netifcon_t_swigregister", qpol_netifcon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_netifcon_from_void", _wrap_qpol_netifcon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_nodecon_t", _wrap_new_qpol_nodecon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_nodecon_t", _wrap_delete_qpol_nodecon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_nodecon_t_addr", _wrap_qpol_nodecon_t_addr, METH_VARARGS, NULL},
+ { (char *)"qpol_nodecon_t_mask", _wrap_qpol_nodecon_t_mask, METH_VARARGS, NULL},
+ { (char *)"qpol_nodecon_t_protocol", _wrap_qpol_nodecon_t_protocol, METH_VARARGS, NULL},
+ { (char *)"qpol_nodecon_t_context", _wrap_qpol_nodecon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_nodecon_t_swigregister", qpol_nodecon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_nodecon_from_void", _wrap_qpol_nodecon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_portcon_t", _wrap_new_qpol_portcon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_portcon_t", _wrap_delete_qpol_portcon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_portcon_t_low_port", _wrap_qpol_portcon_t_low_port, METH_VARARGS, NULL},
+ { (char *)"qpol_portcon_t_high_port", _wrap_qpol_portcon_t_high_port, METH_VARARGS, NULL},
+ { (char *)"qpol_portcon_t_protocol", _wrap_qpol_portcon_t_protocol, METH_VARARGS, NULL},
+ { (char *)"qpol_portcon_t_context", _wrap_qpol_portcon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_portcon_t_swigregister", qpol_portcon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_portcon_from_void", _wrap_qpol_portcon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_constraint_t", _wrap_new_qpol_constraint_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_constraint_t", _wrap_delete_qpol_constraint_t, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_t_object_class", _wrap_qpol_constraint_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_t_perm_iter", _wrap_qpol_constraint_t_perm_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_t_expr_iter", _wrap_qpol_constraint_t_expr_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_t_swigregister", qpol_constraint_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_from_void", _wrap_qpol_constraint_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_validatetrans_t", _wrap_new_qpol_validatetrans_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_validatetrans_t", _wrap_delete_qpol_validatetrans_t, METH_VARARGS, NULL},
+ { (char *)"qpol_validatetrans_t_object_class", _wrap_qpol_validatetrans_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_validatetrans_t_expr_iter", _wrap_qpol_validatetrans_t_expr_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_validatetrans_t_swigregister", qpol_validatetrans_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_validatetrans_from_void", _wrap_qpol_validatetrans_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_constraint_expr_node_t", _wrap_new_qpol_constraint_expr_node_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_constraint_expr_node_t", _wrap_delete_qpol_constraint_expr_node_t, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_expr_node_t_expr_type", _wrap_qpol_constraint_expr_node_t_expr_type, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_expr_node_t_sym_type", _wrap_qpol_constraint_expr_node_t_sym_type, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_expr_node_t_op", _wrap_qpol_constraint_expr_node_t_op, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_expr_node_t_names_iter", _wrap_qpol_constraint_expr_node_t_names_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_expr_node_t_swigregister", qpol_constraint_expr_node_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_constraint_expr_node_from_void", _wrap_qpol_constraint_expr_node_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_role_allow_t", _wrap_new_qpol_role_allow_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_role_allow_t", _wrap_delete_qpol_role_allow_t, METH_VARARGS, NULL},
+ { (char *)"qpol_role_allow_t_source_role", _wrap_qpol_role_allow_t_source_role, METH_VARARGS, NULL},
+ { (char *)"qpol_role_allow_t_target_role", _wrap_qpol_role_allow_t_target_role, METH_VARARGS, NULL},
+ { (char *)"qpol_role_allow_t_swigregister", qpol_role_allow_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_role_allow_from_void", _wrap_qpol_role_allow_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_role_trans_t", _wrap_new_qpol_role_trans_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_role_trans_t", _wrap_delete_qpol_role_trans_t, METH_VARARGS, NULL},
+ { (char *)"qpol_role_trans_t_source_role", _wrap_qpol_role_trans_t_source_role, METH_VARARGS, NULL},
+ { (char *)"qpol_role_trans_t_target_type", _wrap_qpol_role_trans_t_target_type, METH_VARARGS, NULL},
+ { (char *)"qpol_role_trans_t_object_class", _wrap_qpol_role_trans_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_role_trans_t_default_role", _wrap_qpol_role_trans_t_default_role, METH_VARARGS, NULL},
+ { (char *)"qpol_role_trans_t_swigregister", qpol_role_trans_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_role_trans_from_void", _wrap_qpol_role_trans_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_range_trans_t", _wrap_new_qpol_range_trans_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_range_trans_t", _wrap_delete_qpol_range_trans_t, METH_VARARGS, NULL},
+ { (char *)"qpol_range_trans_t_source_type", _wrap_qpol_range_trans_t_source_type, METH_VARARGS, NULL},
+ { (char *)"qpol_range_trans_t_target_type", _wrap_qpol_range_trans_t_target_type, METH_VARARGS, NULL},
+ { (char *)"qpol_range_trans_t_object_class", _wrap_qpol_range_trans_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_range_trans_t_range", _wrap_qpol_range_trans_t_range, METH_VARARGS, NULL},
+ { (char *)"qpol_range_trans_t_swigregister", qpol_range_trans_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_range_trans_from_void", _wrap_qpol_range_trans_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_avrule_t", _wrap_new_qpol_avrule_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_avrule_t", _wrap_delete_qpol_avrule_t, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_rule_type", _wrap_qpol_avrule_t_rule_type, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_source_type", _wrap_qpol_avrule_t_source_type, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_target_type", _wrap_qpol_avrule_t_target_type, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_object_class", _wrap_qpol_avrule_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_perm_iter", _wrap_qpol_avrule_t_perm_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_xperm_iter", _wrap_qpol_avrule_t_xperm_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_is_extended", _wrap_qpol_avrule_t_is_extended, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_xperm_type", _wrap_qpol_avrule_t_xperm_type, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_cond", _wrap_qpol_avrule_t_cond, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_is_enabled", _wrap_qpol_avrule_t_is_enabled, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_which_list", _wrap_qpol_avrule_t_which_list, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_syn_avrule_iter", _wrap_qpol_avrule_t_syn_avrule_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_t_swigregister", qpol_avrule_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_avrule_from_void", _wrap_qpol_avrule_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_terule_t", _wrap_new_qpol_terule_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_terule_t", _wrap_delete_qpol_terule_t, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_rule_type", _wrap_qpol_terule_t_rule_type, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_source_type", _wrap_qpol_terule_t_source_type, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_target_type", _wrap_qpol_terule_t_target_type, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_object_class", _wrap_qpol_terule_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_default_type", _wrap_qpol_terule_t_default_type, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_cond", _wrap_qpol_terule_t_cond, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_is_enabled", _wrap_qpol_terule_t_is_enabled, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_which_list", _wrap_qpol_terule_t_which_list, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_syn_terule_iter", _wrap_qpol_terule_t_syn_terule_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_t_swigregister", qpol_terule_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_terule_from_void", _wrap_qpol_terule_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_cond_t", _wrap_new_qpol_cond_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_cond_t", _wrap_delete_qpol_cond_t, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_expr_node_iter", _wrap_qpol_cond_t_expr_node_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_av_true_iter", _wrap_qpol_cond_t_av_true_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_av_false_iter", _wrap_qpol_cond_t_av_false_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_te_true_iter", _wrap_qpol_cond_t_te_true_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_te_false_iter", _wrap_qpol_cond_t_te_false_iter, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_evaluate", _wrap_qpol_cond_t_evaluate, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_t_swigregister", qpol_cond_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_from_void", _wrap_qpol_cond_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_cond_expr_node_t", _wrap_new_qpol_cond_expr_node_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_cond_expr_node_t", _wrap_delete_qpol_cond_expr_node_t, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_expr_node_t_expr_type", _wrap_qpol_cond_expr_node_t_expr_type, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_expr_node_t_get_boolean", _wrap_qpol_cond_expr_node_t_get_boolean, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_expr_node_t_swigregister", qpol_cond_expr_node_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_cond_expr_node_from_void", _wrap_qpol_cond_expr_node_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_filename_trans_t", _wrap_new_qpol_filename_trans_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_filename_trans_t", _wrap_delete_qpol_filename_trans_t, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_t_source_type", _wrap_qpol_filename_trans_t_source_type, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_t_target_type", _wrap_qpol_filename_trans_t_target_type, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_t_object_class", _wrap_qpol_filename_trans_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_t_default_type", _wrap_qpol_filename_trans_t_default_type, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_t_filename", _wrap_qpol_filename_trans_t_filename, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_t_swigregister", qpol_filename_trans_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_filename_trans_from_void", _wrap_qpol_filename_trans_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_polcap_t", _wrap_new_qpol_polcap_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_polcap_t", _wrap_delete_qpol_polcap_t, METH_VARARGS, NULL},
+ { (char *)"qpol_polcap_t_name", _wrap_qpol_polcap_t_name, METH_VARARGS, NULL},
+ { (char *)"qpol_polcap_t_swigregister", qpol_polcap_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_polcap_from_void", _wrap_qpol_polcap_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_typebounds_t", _wrap_new_qpol_typebounds_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_typebounds_t", _wrap_delete_qpol_typebounds_t, METH_VARARGS, NULL},
+ { (char *)"qpol_typebounds_t_parent_name", _wrap_qpol_typebounds_t_parent_name, METH_VARARGS, NULL},
+ { (char *)"qpol_typebounds_t_child_name", _wrap_qpol_typebounds_t_child_name, METH_VARARGS, NULL},
+ { (char *)"qpol_typebounds_t_swigregister", qpol_typebounds_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_typebounds_from_void", _wrap_qpol_typebounds_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_rolebounds_t", _wrap_new_qpol_rolebounds_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_rolebounds_t", _wrap_delete_qpol_rolebounds_t, METH_VARARGS, NULL},
+ { (char *)"qpol_rolebounds_t_parent_name", _wrap_qpol_rolebounds_t_parent_name, METH_VARARGS, NULL},
+ { (char *)"qpol_rolebounds_t_child_name", _wrap_qpol_rolebounds_t_child_name, METH_VARARGS, NULL},
+ { (char *)"qpol_rolebounds_t_swigregister", qpol_rolebounds_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_rolebounds_from_void", _wrap_qpol_rolebounds_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_userbounds_t", _wrap_new_qpol_userbounds_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_userbounds_t", _wrap_delete_qpol_userbounds_t, METH_VARARGS, NULL},
+ { (char *)"qpol_userbounds_t_parent_name", _wrap_qpol_userbounds_t_parent_name, METH_VARARGS, NULL},
+ { (char *)"qpol_userbounds_t_child_name", _wrap_qpol_userbounds_t_child_name, METH_VARARGS, NULL},
+ { (char *)"qpol_userbounds_t_swigregister", qpol_userbounds_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_userbounds_from_void", _wrap_qpol_userbounds_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_default_object_t", _wrap_new_qpol_default_object_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_default_object_t", _wrap_delete_qpol_default_object_t, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_t_object_class", _wrap_qpol_default_object_t_object_class, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_t_user_default", _wrap_qpol_default_object_t_user_default, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_t_role_default", _wrap_qpol_default_object_t_role_default, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_t_type_default", _wrap_qpol_default_object_t_type_default, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_t_range_default", _wrap_qpol_default_object_t_range_default, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_t_swigregister", qpol_default_object_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_default_object_from_void", _wrap_qpol_default_object_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_iomemcon_t", _wrap_new_qpol_iomemcon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_iomemcon_t", _wrap_delete_qpol_iomemcon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_iomemcon_t_low_addr", _wrap_qpol_iomemcon_t_low_addr, METH_VARARGS, NULL},
+ { (char *)"qpol_iomemcon_t_high_addr", _wrap_qpol_iomemcon_t_high_addr, METH_VARARGS, NULL},
+ { (char *)"qpol_iomemcon_t_context", _wrap_qpol_iomemcon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_iomemcon_t_swigregister", qpol_iomemcon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_iomemcon_from_void", _wrap_qpol_iomemcon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_ioportcon_t", _wrap_new_qpol_ioportcon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_ioportcon_t", _wrap_delete_qpol_ioportcon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_ioportcon_t_low_port", _wrap_qpol_ioportcon_t_low_port, METH_VARARGS, NULL},
+ { (char *)"qpol_ioportcon_t_high_port", _wrap_qpol_ioportcon_t_high_port, METH_VARARGS, NULL},
+ { (char *)"qpol_ioportcon_t_context", _wrap_qpol_ioportcon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_ioportcon_t_swigregister", qpol_ioportcon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_ioportcon_from_void", _wrap_qpol_ioportcon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_pcidevicecon_t", _wrap_new_qpol_pcidevicecon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_pcidevicecon_t", _wrap_delete_qpol_pcidevicecon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_pcidevicecon_t_device", _wrap_qpol_pcidevicecon_t_device, METH_VARARGS, NULL},
+ { (char *)"qpol_pcidevicecon_t_context", _wrap_qpol_pcidevicecon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_pcidevicecon_t_swigregister", qpol_pcidevicecon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_pcidevicecon_from_void", _wrap_qpol_pcidevicecon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_pirqcon_t", _wrap_new_qpol_pirqcon_t, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_pirqcon_t", _wrap_delete_qpol_pirqcon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_pirqcon_t_irq", _wrap_qpol_pirqcon_t_irq, METH_VARARGS, NULL},
+ { (char *)"qpol_pirqcon_t_context", _wrap_qpol_pirqcon_t_context, METH_VARARGS, NULL},
+ { (char *)"qpol_pirqcon_t_swigregister", qpol_pirqcon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_pirqcon_from_void", _wrap_qpol_pirqcon_from_void, METH_VARARGS, NULL},
+ { (char *)"new_qpol_devicetreecon_t", _wrap_new_qpol_devicetreecon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_devicetreecon_t_path", _wrap_qpol_devicetreecon_t_path, METH_VARARGS, NULL},
+ { (char *)"qpol_devicetreecon_t_context", _wrap_qpol_devicetreecon_t_context, METH_VARARGS, NULL},
+ { (char *)"delete_qpol_devicetreecon_t", _wrap_delete_qpol_devicetreecon_t, METH_VARARGS, NULL},
+ { (char *)"qpol_devicetreecon_t_swigregister", qpol_devicetreecon_t_swigregister, METH_VARARGS, NULL},
+ { (char *)"qpol_devicetreecon_from_void", _wrap_qpol_devicetreecon_from_void, METH_VARARGS, NULL},
+ { NULL, NULL, 0, NULL }
+};
+
+
+/* -------- TYPE CONVERSION AND EQUIVALENCE RULES (BEGIN) -------- */
+
+static swig_type_info _swigt__p_char = {"_p_char", "char *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_int = {"_p_int", "intptr_t *|int *|int_least32_t *|int_fast32_t *|int32_t *|int_fast16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_long_long = {"_p_long_long", "int_least64_t *|int_fast64_t *|int64_t *|long long *|intmax_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_avrule = {"_p_qpol_avrule", "qpol_avrule_t *|struct qpol_avrule *|qpol_avrule *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_bool = {"_p_qpol_bool", "struct qpol_bool *|qpol_bool *|qpol_bool_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_capability = {"_p_qpol_capability", "qpol_capability_e *|enum qpol_capability *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_cat = {"_p_qpol_cat", "qpol_cat_t *|struct qpol_cat *|qpol_cat *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_class = {"_p_qpol_class", "qpol_class_t *|struct qpol_class *|qpol_class *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_common = {"_p_qpol_common", "qpol_common_t *|struct qpol_common *|qpol_common *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_cond = {"_p_qpol_cond", "qpol_cond_t *|struct qpol_cond *|qpol_cond *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_cond_expr_node = {"_p_qpol_cond_expr_node", "struct qpol_cond_expr_node *|qpol_cond_expr_node_t *|qpol_cond_expr_node *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_constraint = {"_p_qpol_constraint", "qpol_constraint_t *|struct qpol_constraint *|qpol_constraint *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_constraint_expr_node = {"_p_qpol_constraint_expr_node", "struct qpol_constraint_expr_node *|qpol_constraint_expr_node_t *|qpol_constraint_expr_node *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_context = {"_p_qpol_context", "struct qpol_context *|qpol_context *|qpol_context_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_default_object = {"_p_qpol_default_object", "qpol_default_object_t *|struct qpol_default_object *|qpol_default_object *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_devicetreecon = {"_p_qpol_devicetreecon", "qpol_devicetreecon_t *|struct qpol_devicetreecon *|qpol_devicetreecon *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_filename_trans = {"_p_qpol_filename_trans", "struct qpol_filename_trans *|qpol_filename_trans *|qpol_filename_trans_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_fs_use = {"_p_qpol_fs_use", "struct qpol_fs_use *|qpol_fs_use *|qpol_fs_use_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_genfscon = {"_p_qpol_genfscon", "qpol_genfscon_t *|struct qpol_genfscon *|qpol_genfscon *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_iomemcon = {"_p_qpol_iomemcon", "qpol_iomemcon_t *|struct qpol_iomemcon *|qpol_iomemcon *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_ioportcon = {"_p_qpol_ioportcon", "struct qpol_ioportcon *|qpol_ioportcon *|qpol_ioportcon_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_isid = {"_p_qpol_isid", "struct qpol_isid *|qpol_isid *|qpol_isid_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_iterator = {"_p_qpol_iterator", "struct qpol_iterator *|qpol_iterator *|qpol_iterator_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_level = {"_p_qpol_level", "qpol_level_t *|struct qpol_level *|qpol_level *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_mls_level = {"_p_qpol_mls_level", "qpol_mls_level_t *|struct qpol_mls_level *|qpol_mls_level *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_mls_range = {"_p_qpol_mls_range", "struct qpol_mls_range *|qpol_mls_range *|qpol_mls_range_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_netifcon = {"_p_qpol_netifcon", "qpol_netifcon_t *|struct qpol_netifcon *|qpol_netifcon *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_nodecon = {"_p_qpol_nodecon", "qpol_nodecon_t *|struct qpol_nodecon *|qpol_nodecon *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_pcidevicecon = {"_p_qpol_pcidevicecon", "qpol_pcidevicecon_t *|struct qpol_pcidevicecon *|qpol_pcidevicecon *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_pirqcon = {"_p_qpol_pirqcon", "struct qpol_pirqcon *|qpol_pirqcon *|qpol_pirqcon_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_polcap = {"_p_qpol_polcap", "struct qpol_polcap *|qpol_polcap *|qpol_polcap_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_policy = {"_p_qpol_policy", "qpol_policy_t *|struct qpol_policy *|qpol_policy *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_portcon = {"_p_qpol_portcon", "struct qpol_portcon *|qpol_portcon *|qpol_portcon_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_range_trans = {"_p_qpol_range_trans", "struct qpol_range_trans *|qpol_range_trans *|qpol_range_trans_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_role = {"_p_qpol_role", "struct qpol_role *|qpol_role_t *|qpol_role *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_role_allow = {"_p_qpol_role_allow", "struct qpol_role_allow *|qpol_role_allow *|qpol_role_allow_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_role_trans = {"_p_qpol_role_trans", "struct qpol_role_trans *|qpol_role_trans *|qpol_role_trans_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_rolebounds = {"_p_qpol_rolebounds", "qpol_rolebounds_t *|struct qpol_rolebounds *|qpol_rolebounds *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_semantic_level = {"_p_qpol_semantic_level", "qpol_semantic_level_t *|struct qpol_semantic_level *|qpol_semantic_level *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_terule = {"_p_qpol_terule", "qpol_terule_t *|struct qpol_terule *|qpol_terule *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_type = {"_p_qpol_type", "struct qpol_type *|qpol_type *|qpol_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_typebounds = {"_p_qpol_typebounds", "qpol_typebounds_t *|struct qpol_typebounds *|qpol_typebounds *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_user = {"_p_qpol_user", "struct qpol_user *|qpol_user *|qpol_user_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_userbounds = {"_p_qpol_userbounds", "qpol_userbounds_t *|struct qpol_userbounds *|qpol_userbounds *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_qpol_validatetrans = {"_p_qpol_validatetrans", "struct qpol_validatetrans *|qpol_validatetrans *|qpol_validatetrans_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_short = {"_p_short", "short *|int_least16_t *|int16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_signed_char = {"_p_signed_char", "signed char *|int_least8_t *|int_fast8_t *|int8_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_char = {"_p_unsigned_char", "unsigned char *|uint_least8_t *|uint_fast8_t *|uint8_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_int = {"_p_unsigned_int", "uintptr_t *|uint_least32_t *|uint_fast32_t *|uint32_t *|size_t *|unsigned int *|uint_fast16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_long_long = {"_p_unsigned_long_long", "uint_least64_t *|uint_fast64_t *|uint64_t *|unsigned long long *|uintmax_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_short = {"_p_unsigned_short", "unsigned short *|uint_least16_t *|uint16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_void = {"_p_void", "void *", 0, 0, (void*)0, 0};
+
+static swig_type_info *swig_type_initial[] = {
+ &_swigt__p_char,
+ &_swigt__p_int,
+ &_swigt__p_long_long,
+ &_swigt__p_qpol_avrule,
+ &_swigt__p_qpol_bool,
+ &_swigt__p_qpol_capability,
+ &_swigt__p_qpol_cat,
+ &_swigt__p_qpol_class,
+ &_swigt__p_qpol_common,
+ &_swigt__p_qpol_cond,
+ &_swigt__p_qpol_cond_expr_node,
+ &_swigt__p_qpol_constraint,
+ &_swigt__p_qpol_constraint_expr_node,
+ &_swigt__p_qpol_context,
+ &_swigt__p_qpol_default_object,
+ &_swigt__p_qpol_devicetreecon,
+ &_swigt__p_qpol_filename_trans,
+ &_swigt__p_qpol_fs_use,
+ &_swigt__p_qpol_genfscon,
+ &_swigt__p_qpol_iomemcon,
+ &_swigt__p_qpol_ioportcon,
+ &_swigt__p_qpol_isid,
+ &_swigt__p_qpol_iterator,
+ &_swigt__p_qpol_level,
+ &_swigt__p_qpol_mls_level,
+ &_swigt__p_qpol_mls_range,
+ &_swigt__p_qpol_netifcon,
+ &_swigt__p_qpol_nodecon,
+ &_swigt__p_qpol_pcidevicecon,
+ &_swigt__p_qpol_pirqcon,
+ &_swigt__p_qpol_polcap,
+ &_swigt__p_qpol_policy,
+ &_swigt__p_qpol_portcon,
+ &_swigt__p_qpol_range_trans,
+ &_swigt__p_qpol_role,
+ &_swigt__p_qpol_role_allow,
+ &_swigt__p_qpol_role_trans,
+ &_swigt__p_qpol_rolebounds,
+ &_swigt__p_qpol_semantic_level,
+ &_swigt__p_qpol_terule,
+ &_swigt__p_qpol_type,
+ &_swigt__p_qpol_typebounds,
+ &_swigt__p_qpol_user,
+ &_swigt__p_qpol_userbounds,
+ &_swigt__p_qpol_validatetrans,
+ &_swigt__p_short,
+ &_swigt__p_signed_char,
+ &_swigt__p_unsigned_char,
+ &_swigt__p_unsigned_int,
+ &_swigt__p_unsigned_long_long,
+ &_swigt__p_unsigned_short,
+ &_swigt__p_void,
+};
+
+static swig_cast_info _swigc__p_char[] = { {&_swigt__p_char, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_int[] = { {&_swigt__p_int, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_long_long[] = { {&_swigt__p_long_long, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_avrule[] = { {&_swigt__p_qpol_avrule, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_bool[] = { {&_swigt__p_qpol_bool, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_capability[] = { {&_swigt__p_qpol_capability, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_cat[] = { {&_swigt__p_qpol_cat, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_class[] = { {&_swigt__p_qpol_class, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_common[] = { {&_swigt__p_qpol_common, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_cond[] = { {&_swigt__p_qpol_cond, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_cond_expr_node[] = { {&_swigt__p_qpol_cond_expr_node, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_constraint[] = { {&_swigt__p_qpol_constraint, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_constraint_expr_node[] = { {&_swigt__p_qpol_constraint_expr_node, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_context[] = { {&_swigt__p_qpol_context, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_default_object[] = { {&_swigt__p_qpol_default_object, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_devicetreecon[] = { {&_swigt__p_qpol_devicetreecon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_filename_trans[] = { {&_swigt__p_qpol_filename_trans, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_fs_use[] = { {&_swigt__p_qpol_fs_use, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_genfscon[] = { {&_swigt__p_qpol_genfscon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_iomemcon[] = { {&_swigt__p_qpol_iomemcon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_ioportcon[] = { {&_swigt__p_qpol_ioportcon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_isid[] = { {&_swigt__p_qpol_isid, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_iterator[] = { {&_swigt__p_qpol_iterator, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_level[] = { {&_swigt__p_qpol_level, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_mls_level[] = { {&_swigt__p_qpol_mls_level, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_mls_range[] = { {&_swigt__p_qpol_mls_range, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_netifcon[] = { {&_swigt__p_qpol_netifcon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_nodecon[] = { {&_swigt__p_qpol_nodecon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_pcidevicecon[] = { {&_swigt__p_qpol_pcidevicecon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_pirqcon[] = { {&_swigt__p_qpol_pirqcon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_polcap[] = { {&_swigt__p_qpol_polcap, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_policy[] = { {&_swigt__p_qpol_policy, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_portcon[] = { {&_swigt__p_qpol_portcon, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_range_trans[] = { {&_swigt__p_qpol_range_trans, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_role[] = { {&_swigt__p_qpol_role, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_role_allow[] = { {&_swigt__p_qpol_role_allow, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_role_trans[] = { {&_swigt__p_qpol_role_trans, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_rolebounds[] = { {&_swigt__p_qpol_rolebounds, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_semantic_level[] = { {&_swigt__p_qpol_semantic_level, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_terule[] = { {&_swigt__p_qpol_terule, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_type[] = { {&_swigt__p_qpol_type, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_typebounds[] = { {&_swigt__p_qpol_typebounds, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_user[] = { {&_swigt__p_qpol_user, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_userbounds[] = { {&_swigt__p_qpol_userbounds, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_qpol_validatetrans[] = { {&_swigt__p_qpol_validatetrans, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_short[] = { {&_swigt__p_short, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_signed_char[] = { {&_swigt__p_signed_char, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_char[] = { {&_swigt__p_unsigned_char, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_int[] = { {&_swigt__p_unsigned_int, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_long_long[] = { {&_swigt__p_unsigned_long_long, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_short[] = { {&_swigt__p_unsigned_short, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_void[] = { {&_swigt__p_void, 0, 0, 0},{0, 0, 0, 0}};
+
+static swig_cast_info *swig_cast_initial[] = {
+ _swigc__p_char,
+ _swigc__p_int,
+ _swigc__p_long_long,
+ _swigc__p_qpol_avrule,
+ _swigc__p_qpol_bool,
+ _swigc__p_qpol_capability,
+ _swigc__p_qpol_cat,
+ _swigc__p_qpol_class,
+ _swigc__p_qpol_common,
+ _swigc__p_qpol_cond,
+ _swigc__p_qpol_cond_expr_node,
+ _swigc__p_qpol_constraint,
+ _swigc__p_qpol_constraint_expr_node,
+ _swigc__p_qpol_context,
+ _swigc__p_qpol_default_object,
+ _swigc__p_qpol_devicetreecon,
+ _swigc__p_qpol_filename_trans,
+ _swigc__p_qpol_fs_use,
+ _swigc__p_qpol_genfscon,
+ _swigc__p_qpol_iomemcon,
+ _swigc__p_qpol_ioportcon,
+ _swigc__p_qpol_isid,
+ _swigc__p_qpol_iterator,
+ _swigc__p_qpol_level,
+ _swigc__p_qpol_mls_level,
+ _swigc__p_qpol_mls_range,
+ _swigc__p_qpol_netifcon,
+ _swigc__p_qpol_nodecon,
+ _swigc__p_qpol_pcidevicecon,
+ _swigc__p_qpol_pirqcon,
+ _swigc__p_qpol_polcap,
+ _swigc__p_qpol_policy,
+ _swigc__p_qpol_portcon,
+ _swigc__p_qpol_range_trans,
+ _swigc__p_qpol_role,
+ _swigc__p_qpol_role_allow,
+ _swigc__p_qpol_role_trans,
+ _swigc__p_qpol_rolebounds,
+ _swigc__p_qpol_semantic_level,
+ _swigc__p_qpol_terule,
+ _swigc__p_qpol_type,
+ _swigc__p_qpol_typebounds,
+ _swigc__p_qpol_user,
+ _swigc__p_qpol_userbounds,
+ _swigc__p_qpol_validatetrans,
+ _swigc__p_short,
+ _swigc__p_signed_char,
+ _swigc__p_unsigned_char,
+ _swigc__p_unsigned_int,
+ _swigc__p_unsigned_long_long,
+ _swigc__p_unsigned_short,
+ _swigc__p_void,
+};
+
+
+/* -------- TYPE CONVERSION AND EQUIVALENCE RULES (END) -------- */
+
+static swig_const_info swig_const_table[] = {
+{0, 0, 0, 0.0, 0, 0}};
+
+#ifdef __cplusplus
+}
+#endif
+/* -----------------------------------------------------------------------------
+ * Type initialization:
+ * This problem is tough by the requirement that no dynamic
+ * memory is used. Also, since swig_type_info structures store pointers to
+ * swig_cast_info structures and swig_cast_info structures store pointers back
+ * to swig_type_info structures, we need some lookup code at initialization.
+ * The idea is that swig generates all the structures that are needed.
+ * The runtime then collects these partially filled structures.
+ * The SWIG_InitializeModule function takes these initial arrays out of
+ * swig_module, and does all the lookup, filling in the swig_module.types
+ * array with the correct data and linking the correct swig_cast_info
+ * structures together.
+ *
+ * The generated swig_type_info structures are assigned staticly to an initial
+ * array. We just loop through that array, and handle each type individually.
+ * First we lookup if this type has been already loaded, and if so, use the
+ * loaded structure instead of the generated one. Then we have to fill in the
+ * cast linked list. The cast data is initially stored in something like a
+ * two-dimensional array. Each row corresponds to a type (there are the same
+ * number of rows as there are in the swig_type_initial array). Each entry in
+ * a column is one of the swig_cast_info structures for that type.
+ * The cast_initial array is actually an array of arrays, because each row has
+ * a variable number of columns. So to actually build the cast linked list,
+ * we find the array of casts associated with the type, and loop through it
+ * adding the casts to the list. The one last trick we need to do is making
+ * sure the type pointer in the swig_cast_info struct is correct.
+ *
+ * First off, we lookup the cast->type name to see if it is already loaded.
+ * There are three cases to handle:
+ * 1) If the cast->type has already been loaded AND the type we are adding
+ * casting info to has not been loaded (it is in this module), THEN we
+ * replace the cast->type pointer with the type pointer that has already
+ * been loaded.
+ * 2) If BOTH types (the one we are adding casting info to, and the
+ * cast->type) are loaded, THEN the cast info has already been loaded by
+ * the previous module so we just ignore it.
+ * 3) Finally, if cast->type has not already been loaded, then we add that
+ * swig_cast_info to the linked list (because the cast->type) pointer will
+ * be correct.
+ * ----------------------------------------------------------------------------- */
+
+#ifdef __cplusplus
+extern "C" {
+#if 0
+} /* c-mode */
+#endif
+#endif
+
+#if 0
+#define SWIGRUNTIME_DEBUG
+#endif
+
+
+SWIGRUNTIME void
+SWIG_InitializeModule(void *clientdata) {
+ size_t i;
+ swig_module_info *module_head, *iter;
+ int found, init;
+
+ /* check to see if the circular list has been setup, if not, set it up */
+ if (swig_module.next==0) {
+ /* Initialize the swig_module */
+ swig_module.type_initial = swig_type_initial;
+ swig_module.cast_initial = swig_cast_initial;
+ swig_module.next = &swig_module;
+ init = 1;
+ } else {
+ init = 0;
+ }
+
+ /* Try and load any already created modules */
+ module_head = SWIG_GetModule(clientdata);
+ if (!module_head) {
+ /* This is the first module loaded for this interpreter */
+ /* so set the swig module into the interpreter */
+ SWIG_SetModule(clientdata, &swig_module);
+ module_head = &swig_module;
+ } else {
+ /* the interpreter has loaded a SWIG module, but has it loaded this one? */
+ found=0;
+ iter=module_head;
+ do {
+ if (iter==&swig_module) {
+ found=1;
+ break;
+ }
+ iter=iter->next;
+ } while (iter!= module_head);
+
+ /* if the is found in the list, then all is done and we may leave */
+ if (found) return;
+ /* otherwise we must add out module into the list */
+ swig_module.next = module_head->next;
+ module_head->next = &swig_module;
+ }
+
+ /* When multiple interpreters are used, a module could have already been initialized in
+ a different interpreter, but not yet have a pointer in this interpreter.
+ In this case, we do not want to continue adding types... everything should be
+ set up already */
+ if (init == 0) return;
+
+ /* Now work on filling in swig_module.types */
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: size %d\n", swig_module.size);
+#endif
+ for (i = 0; i < swig_module.size; ++i) {
+ swig_type_info *type = 0;
+ swig_type_info *ret;
+ swig_cast_info *cast;
+
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: type %d %s\n", i, swig_module.type_initial[i]->name);
+#endif
+
+ /* if there is another module already loaded */
+ if (swig_module.next != &swig_module) {
+ type = SWIG_MangledTypeQueryModule(swig_module.next, &swig_module, swig_module.type_initial[i]->name);
+ }
+ if (type) {
+ /* Overwrite clientdata field */
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: found type %s\n", type->name);
+#endif
+ if (swig_module.type_initial[i]->clientdata) {
+ type->clientdata = swig_module.type_initial[i]->clientdata;
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: found and overwrite type %s \n", type->name);
+#endif
+ }
+ } else {
+ type = swig_module.type_initial[i];
+ }
+
+ /* Insert casting types */
+ cast = swig_module.cast_initial[i];
+ while (cast->type) {
+ /* Don't need to add information already in the list */
+ ret = 0;
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: look cast %s\n", cast->type->name);
+#endif
+ if (swig_module.next != &swig_module) {
+ ret = SWIG_MangledTypeQueryModule(swig_module.next, &swig_module, cast->type->name);
+#ifdef SWIGRUNTIME_DEBUG
+ if (ret) printf("SWIG_InitializeModule: found cast %s\n", ret->name);
+#endif
+ }
+ if (ret) {
+ if (type == swig_module.type_initial[i]) {
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: skip old type %s\n", ret->name);
+#endif
+ cast->type = ret;
+ ret = 0;
+ } else {
+ /* Check for casting already in the list */
+ swig_cast_info *ocast = SWIG_TypeCheck(ret->name, type);
+#ifdef SWIGRUNTIME_DEBUG
+ if (ocast) printf("SWIG_InitializeModule: skip old cast %s\n", ret->name);
+#endif
+ if (!ocast) ret = 0;
+ }
+ }
+
+ if (!ret) {
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: adding cast %s\n", cast->type->name);
+#endif
+ if (type->cast) {
+ type->cast->prev = cast;
+ cast->next = type->cast;
+ }
+ type->cast = cast;
+ }
+ cast++;
+ }
+ /* Set entry in modules->types array equal to the type */
+ swig_module.types[i] = type;
+ }
+ swig_module.types[i] = 0;
+
+#ifdef SWIGRUNTIME_DEBUG
+ printf("**** SWIG_InitializeModule: Cast List ******\n");
+ for (i = 0; i < swig_module.size; ++i) {
+ int j = 0;
+ swig_cast_info *cast = swig_module.cast_initial[i];
+ printf("SWIG_InitializeModule: type %d %s\n", i, swig_module.type_initial[i]->name);
+ while (cast->type) {
+ printf("SWIG_InitializeModule: cast type %s\n", cast->type->name);
+ cast++;
+ ++j;
+ }
+ printf("---- Total casts: %d\n",j);
+ }
+ printf("**** SWIG_InitializeModule: Cast List ******\n");
+#endif
+}
+
+/* This function will propagate the clientdata field of type to
+* any new swig_type_info structures that have been added into the list
+* of equivalent types. It is like calling
+* SWIG_TypeClientData(type, clientdata) a second time.
+*/
+SWIGRUNTIME void
+SWIG_PropagateClientData(void) {
+ size_t i;
+ swig_cast_info *equiv;
+ static int init_run = 0;
+
+ if (init_run) return;
+ init_run = 1;
+
+ for (i = 0; i < swig_module.size; i++) {
+ if (swig_module.types[i]->clientdata) {
+ equiv = swig_module.types[i]->cast;
+ while (equiv) {
+ if (!equiv->converter) {
+ if (equiv->type && !equiv->type->clientdata)
+ SWIG_TypeClientData(equiv->type, swig_module.types[i]->clientdata);
+ }
+ equiv = equiv->next;
+ }
+ }
+ }
+}
+
+#ifdef __cplusplus
+#if 0
+{
+ /* c-mode */
+#endif
+}
+#endif
+
+
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+ /* Python-specific SWIG API */
+#define SWIG_newvarlink() SWIG_Python_newvarlink()
+#define SWIG_addvarlink(p, name, get_attr, set_attr) SWIG_Python_addvarlink(p, name, get_attr, set_attr)
+#define SWIG_InstallConstants(d, constants) SWIG_Python_InstallConstants(d, constants)
+
+ /* -----------------------------------------------------------------------------
+ * global variable support code.
+ * ----------------------------------------------------------------------------- */
+
+ typedef struct swig_globalvar {
+ char *name; /* Name of global variable */
+ PyObject *(*get_attr)(void); /* Return the current value */
+ int (*set_attr)(PyObject *); /* Set the value */
+ struct swig_globalvar *next;
+ } swig_globalvar;
+
+ typedef struct swig_varlinkobject {
+ PyObject_HEAD
+ swig_globalvar *vars;
+ } swig_varlinkobject;
+
+ SWIGINTERN PyObject *
+ swig_varlink_repr(swig_varlinkobject *SWIGUNUSEDPARM(v)) {
+#if PY_VERSION_HEX >= 0x03000000
+ return PyUnicode_InternFromString("<Swig global variables>");
+#else
+ return PyString_FromString("<Swig global variables>");
+#endif
+ }
+
+ SWIGINTERN PyObject *
+ swig_varlink_str(swig_varlinkobject *v) {
+#if PY_VERSION_HEX >= 0x03000000
+ PyObject *str = PyUnicode_InternFromString("(");
+ PyObject *tail;
+ PyObject *joined;
+ swig_globalvar *var;
+ for (var = v->vars; var; var=var->next) {
+ tail = PyUnicode_FromString(var->name);
+ joined = PyUnicode_Concat(str, tail);
+ Py_DecRef(str);
+ Py_DecRef(tail);
+ str = joined;
+ if (var->next) {
+ tail = PyUnicode_InternFromString(", ");
+ joined = PyUnicode_Concat(str, tail);
+ Py_DecRef(str);
+ Py_DecRef(tail);
+ str = joined;
+ }
+ }
+ tail = PyUnicode_InternFromString(")");
+ joined = PyUnicode_Concat(str, tail);
+ Py_DecRef(str);
+ Py_DecRef(tail);
+ str = joined;
+#else
+ PyObject *str = PyString_FromString("(");
+ swig_globalvar *var;
+ for (var = v->vars; var; var=var->next) {
+ PyString_ConcatAndDel(&str,PyString_FromString(var->name));
+ if (var->next) PyString_ConcatAndDel(&str,PyString_FromString(", "));
+ }
+ PyString_ConcatAndDel(&str,PyString_FromString(")"));
+#endif
+ return str;
+ }
+
+ SWIGINTERN int
+ swig_varlink_print(swig_varlinkobject *v, FILE *fp, int SWIGUNUSEDPARM(flags)) {
+ char *tmp;
+ PyObject *str = swig_varlink_str(v);
+ fprintf(fp,"Swig global variables ");
+ fprintf(fp,"%s\n", tmp = SWIG_Python_str_AsChar(str));
+ SWIG_Python_str_DelForPy3(tmp);
+ Py_DECREF(str);
+ return 0;
+ }
+
+ SWIGINTERN void
+ swig_varlink_dealloc(swig_varlinkobject *v) {
+ swig_globalvar *var = v->vars;
+ while (var) {
+ swig_globalvar *n = var->next;
+ free(var->name);
+ free(var);
+ var = n;
+ }
+ }
+
+ SWIGINTERN PyObject *
+ swig_varlink_getattr(swig_varlinkobject *v, char *n) {
+ PyObject *res = NULL;
+ swig_globalvar *var = v->vars;
+ while (var) {
+ if (strcmp(var->name,n) == 0) {
+ res = (*var->get_attr)();
+ break;
+ }
+ var = var->next;
+ }
+ if (res == NULL && !PyErr_Occurred()) {
+ PyErr_SetString(PyExc_NameError,"Unknown C global variable");
+ }
+ return res;
+ }
+
+ SWIGINTERN int
+ swig_varlink_setattr(swig_varlinkobject *v, char *n, PyObject *p) {
+ int res = 1;
+ swig_globalvar *var = v->vars;
+ while (var) {
+ if (strcmp(var->name,n) == 0) {
+ res = (*var->set_attr)(p);
+ break;
+ }
+ var = var->next;
+ }
+ if (res == 1 && !PyErr_Occurred()) {
+ PyErr_SetString(PyExc_NameError,"Unknown C global variable");
+ }
+ return res;
+ }
+
+ SWIGINTERN PyTypeObject*
+ swig_varlink_type(void) {
+ static char varlink__doc__[] = "Swig var link object";
+ static PyTypeObject varlink_type;
+ static int type_init = 0;
+ if (!type_init) {
+ const PyTypeObject tmp = {
+ /* PyObject header changed in Python 3 */
+#if PY_VERSION_HEX >= 0x03000000
+ PyVarObject_HEAD_INIT(NULL, 0)
+#else
+ PyObject_HEAD_INIT(NULL)
+ 0, /* ob_size */
+#endif
+ (char *)"swigvarlink", /* tp_name */
+ sizeof(swig_varlinkobject), /* tp_basicsize */
+ 0, /* tp_itemsize */
+ (destructor) swig_varlink_dealloc, /* tp_dealloc */
+ (printfunc) swig_varlink_print, /* tp_print */
+ (getattrfunc) swig_varlink_getattr, /* tp_getattr */
+ (setattrfunc) swig_varlink_setattr, /* tp_setattr */
+ 0, /* tp_compare */
+ (reprfunc) swig_varlink_repr, /* tp_repr */
+ 0, /* tp_as_number */
+ 0, /* tp_as_sequence */
+ 0, /* tp_as_mapping */
+ 0, /* tp_hash */
+ 0, /* tp_call */
+ (reprfunc) swig_varlink_str, /* tp_str */
+ 0, /* tp_getattro */
+ 0, /* tp_setattro */
+ 0, /* tp_as_buffer */
+ 0, /* tp_flags */
+ varlink__doc__, /* tp_doc */
+ 0, /* tp_traverse */
+ 0, /* tp_clear */
+ 0, /* tp_richcompare */
+ 0, /* tp_weaklistoffset */
+#if PY_VERSION_HEX >= 0x02020000
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0, /* tp_iter -> tp_weaklist */
+#endif
+#if PY_VERSION_HEX >= 0x02030000
+ 0, /* tp_del */
+#endif
+#if PY_VERSION_HEX >= 0x02060000
+ 0, /* tp_version */
+#endif
+#ifdef COUNT_ALLOCS
+ 0,0,0,0 /* tp_alloc -> tp_next */
+#endif
+ };
+ varlink_type = tmp;
+ type_init = 1;
+#if PY_VERSION_HEX < 0x02020000
+ varlink_type.ob_type = &PyType_Type;
+#else
+ if (PyType_Ready(&varlink_type) < 0)
+ return NULL;
+#endif
+ }
+ return &varlink_type;
+ }
+
+ /* Create a variable linking object for use later */
+ SWIGINTERN PyObject *
+ SWIG_Python_newvarlink(void) {
+ swig_varlinkobject *result = PyObject_NEW(swig_varlinkobject, swig_varlink_type());
+ if (result) {
+ result->vars = 0;
+ }
+ return ((PyObject*) result);
+ }
+
+ SWIGINTERN void
+ SWIG_Python_addvarlink(PyObject *p, char *name, PyObject *(*get_attr)(void), int (*set_attr)(PyObject *p)) {
+ swig_varlinkobject *v = (swig_varlinkobject *) p;
+ swig_globalvar *gv = (swig_globalvar *) malloc(sizeof(swig_globalvar));
+ if (gv) {
+ size_t size = strlen(name)+1;
+ gv->name = (char *)malloc(size);
+ if (gv->name) {
+ strncpy(gv->name,name,size);
+ gv->get_attr = get_attr;
+ gv->set_attr = set_attr;
+ gv->next = v->vars;
+ }
+ }
+ v->vars = gv;
+ }
+
+ SWIGINTERN PyObject *
+ SWIG_globals(void) {
+ static PyObject *_SWIG_globals = 0;
+ if (!_SWIG_globals) _SWIG_globals = SWIG_newvarlink();
+ return _SWIG_globals;
+ }
+
+ /* -----------------------------------------------------------------------------
+ * constants/methods manipulation
+ * ----------------------------------------------------------------------------- */
+
+ /* Install Constants */
+ SWIGINTERN void
+ SWIG_Python_InstallConstants(PyObject *d, swig_const_info constants[]) {
+ PyObject *obj = 0;
+ size_t i;
+ for (i = 0; constants[i].type; ++i) {
+ switch(constants[i].type) {
+ case SWIG_PY_POINTER:
+ obj = SWIG_InternalNewPointerObj(constants[i].pvalue, *(constants[i]).ptype,0);
+ break;
+ case SWIG_PY_BINARY:
+ obj = SWIG_NewPackedObj(constants[i].pvalue, constants[i].lvalue, *(constants[i].ptype));
+ break;
+ default:
+ obj = 0;
+ break;
+ }
+ if (obj) {
+ PyDict_SetItemString(d, constants[i].name, obj);
+ Py_DECREF(obj);
+ }
+ }
+ }
+
+ /* -----------------------------------------------------------------------------*/
+ /* Fix SwigMethods to carry the callback ptrs when needed */
+ /* -----------------------------------------------------------------------------*/
+
+ SWIGINTERN void
+ SWIG_Python_FixMethods(PyMethodDef *methods,
+ swig_const_info *const_table,
+ swig_type_info **types,
+ swig_type_info **types_initial) {
+ size_t i;
+ for (i = 0; methods[i].ml_name; ++i) {
+ const char *c = methods[i].ml_doc;
+ if (c && (c = strstr(c, "swig_ptr: "))) {
+ int j;
+ swig_const_info *ci = 0;
+ const char *name = c + 10;
+ for (j = 0; const_table[j].type; ++j) {
+ if (strncmp(const_table[j].name, name,
+ strlen(const_table[j].name)) == 0) {
+ ci = &(const_table[j]);
+ break;
+ }
+ }
+ if (ci) {
+ void *ptr = (ci->type == SWIG_PY_POINTER) ? ci->pvalue : 0;
+ if (ptr) {
+ size_t shift = (ci->ptype) - types;
+ swig_type_info *ty = types_initial[shift];
+ size_t ldoc = (c - methods[i].ml_doc);
+ size_t lptr = strlen(ty->name)+2*sizeof(void*)+2;
+ char *ndoc = (char*)malloc(ldoc + lptr + 10);
+ if (ndoc) {
+ char *buff = ndoc;
+ strncpy(buff, methods[i].ml_doc, ldoc);
+ buff += ldoc;
+ strncpy(buff, "swig_ptr: ", 10);
+ buff += 10;
+ SWIG_PackVoidPtr(buff, ptr, ty->name, lptr);
+ methods[i].ml_doc = ndoc;
+ }
+ }
+ }
+ }
+ }
+ }
+
+#ifdef __cplusplus
+}
+#endif
+
+/* -----------------------------------------------------------------------------*
+ * Partial Init method
+ * -----------------------------------------------------------------------------*/
+
+#ifdef __cplusplus
+extern "C"
+#endif
+
+SWIGEXPORT
+#if PY_VERSION_HEX >= 0x03000000
+PyObject*
+#else
+void
+#endif
+SWIG_init(void) {
+ PyObject *m, *d, *md;
+#if PY_VERSION_HEX >= 0x03000000
+ static struct PyModuleDef SWIG_module = {
+# if PY_VERSION_HEX >= 0x03020000
+ PyModuleDef_HEAD_INIT,
+# else
+ {
+ PyObject_HEAD_INIT(NULL)
+ NULL, /* m_init */
+ 0, /* m_index */
+ NULL, /* m_copy */
+ },
+# endif
+ (char *) SWIG_name,
+ NULL,
+ -1,
+ SwigMethods,
+ NULL,
+ NULL,
+ NULL,
+ NULL
+ };
+#endif
+
+#if defined(SWIGPYTHON_BUILTIN)
+ static SwigPyClientData SwigPyObject_clientdata = {
+ 0, 0, 0, 0, 0, 0, 0
+ };
+ static PyGetSetDef this_getset_def = {
+ (char *)"this", &SwigPyBuiltin_ThisClosure, NULL, NULL, NULL
+ };
+ static SwigPyGetSet thisown_getset_closure = {
+ (PyCFunction) SwigPyObject_own,
+ (PyCFunction) SwigPyObject_own
+ };
+ static PyGetSetDef thisown_getset_def = {
+ (char *)"thisown", SwigPyBuiltin_GetterClosure, SwigPyBuiltin_SetterClosure, NULL, &thisown_getset_closure
+ };
+ PyObject *metatype_args;
+ PyTypeObject *builtin_pytype;
+ int builtin_base_count;
+ swig_type_info *builtin_basetype;
+ PyObject *tuple;
+ PyGetSetDescrObject *static_getset;
+ PyTypeObject *metatype;
+ SwigPyClientData *cd;
+ PyObject *public_interface, *public_symbol;
+ PyObject *this_descr;
+ PyObject *thisown_descr;
+ int i;
+
+ (void)builtin_pytype;
+ (void)builtin_base_count;
+ (void)builtin_basetype;
+ (void)tuple;
+ (void)static_getset;
+
+ /* metatype is used to implement static member variables. */
+ metatype_args = Py_BuildValue("(s(O){})", "SwigPyObjectType", &PyType_Type);
+ assert(metatype_args);
+ metatype = (PyTypeObject *) PyType_Type.tp_call((PyObject *) &PyType_Type, metatype_args, NULL);
+ assert(metatype);
+ Py_DECREF(metatype_args);
+ metatype->tp_setattro = (setattrofunc) &SwigPyObjectType_setattro;
+ assert(PyType_Ready(metatype) >= 0);
+#endif
+
+ /* Fix SwigMethods to carry the callback ptrs when needed */
+ SWIG_Python_FixMethods(SwigMethods, swig_const_table, swig_types, swig_type_initial);
+
+#if PY_VERSION_HEX >= 0x03000000
+ m = PyModule_Create(&SWIG_module);
+#else
+ m = Py_InitModule((char *) SWIG_name, SwigMethods);
+#endif
+ md = d = PyModule_GetDict(m);
+ (void)md;
+
+ SWIG_InitializeModule(0);
+
+#ifdef SWIGPYTHON_BUILTIN
+ SwigPyObject_stype = SWIG_MangledTypeQuery("_p_SwigPyObject");
+ assert(SwigPyObject_stype);
+ cd = (SwigPyClientData*) SwigPyObject_stype->clientdata;
+ if (!cd) {
+ SwigPyObject_stype->clientdata = &SwigPyObject_clientdata;
+ SwigPyObject_clientdata.pytype = SwigPyObject_TypeOnce();
+ } else if (SwigPyObject_TypeOnce()->tp_basicsize != cd->pytype->tp_basicsize) {
+ PyErr_SetString(PyExc_RuntimeError, "Import error: attempted to load two incompatible swig-generated modules.");
+# if PY_VERSION_HEX >= 0x03000000
+ return NULL;
+# else
+ return;
+# endif
+ }
+
+ /* All objects have a 'this' attribute */
+ this_descr = PyDescr_NewGetSet(SwigPyObject_type(), &this_getset_def);
+ (void)this_descr;
+
+ /* All objects have a 'thisown' attribute */
+ thisown_descr = PyDescr_NewGetSet(SwigPyObject_type(), &thisown_getset_def);
+ (void)thisown_descr;
+
+ public_interface = PyList_New(0);
+ public_symbol = 0;
+ (void)public_symbol;
+
+ PyDict_SetItemString(md, "__all__", public_interface);
+ Py_DECREF(public_interface);
+ for (i = 0; SwigMethods[i].ml_name != NULL; ++i)
+ SwigPyBuiltin_AddPublicSymbol(public_interface, SwigMethods[i].ml_name);
+ for (i = 0; swig_const_table[i].name != 0; ++i)
+ SwigPyBuiltin_AddPublicSymbol(public_interface, swig_const_table[i].name);
+#endif
+
+ SWIG_InstallConstants(d,swig_const_table);
+
+ SWIG_Python_SetConstant(d, "QPOL_POLICY_OPTION_NO_NEVERALLOWS",SWIG_From_int((int)(0x00000001)));
+ SWIG_Python_SetConstant(d, "QPOL_POLICY_OPTION_NO_RULES",SWIG_From_int((int)(0x00000002)));
+ SWIG_Python_SetConstant(d, "QPOL_POLICY_OPTION_MATCH_SYSTEM",SWIG_From_int((int)(0x00000004)));
+ SWIG_Python_SetConstant(d, "QPOL_POLICY_MAX_VERSION",SWIG_From_int((int)(POLICYDB_VERSION_MAX)));
+ SWIG_Python_SetConstant(d, "QPOL_POLICY_MIN_VERSION",SWIG_From_int((int)(POLICYDB_VERSION_MIN)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_ATTRIB_NAMES",SWIG_From_int((int)(QPOL_CAP_ATTRIB_NAMES)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_SYN_RULES",SWIG_From_int((int)(QPOL_CAP_SYN_RULES)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_LINE_NUMBERS",SWIG_From_int((int)(QPOL_CAP_LINE_NUMBERS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_CONDITIONALS",SWIG_From_int((int)(QPOL_CAP_CONDITIONALS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_MLS",SWIG_From_int((int)(QPOL_CAP_MLS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_MODULES",SWIG_From_int((int)(QPOL_CAP_MODULES)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_RULES_LOADED",SWIG_From_int((int)(QPOL_CAP_RULES_LOADED)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_SOURCE",SWIG_From_int((int)(QPOL_CAP_SOURCE)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_NEVERALLOW",SWIG_From_int((int)(QPOL_CAP_NEVERALLOW)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_POLCAPS",SWIG_From_int((int)(QPOL_CAP_POLCAPS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_BOUNDS",SWIG_From_int((int)(QPOL_CAP_BOUNDS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_DEFAULT_OBJECTS",SWIG_From_int((int)(QPOL_CAP_DEFAULT_OBJECTS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_DEFAULT_TYPE",SWIG_From_int((int)(QPOL_CAP_DEFAULT_TYPE)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_PERMISSIVE",SWIG_From_int((int)(QPOL_CAP_PERMISSIVE)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_FILENAME_TRANS",SWIG_From_int((int)(QPOL_CAP_FILENAME_TRANS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_ROLETRANS",SWIG_From_int((int)(QPOL_CAP_ROLETRANS)));
+ SWIG_Python_SetConstant(d, "QPOL_CAP_XPERM_IOCTL",SWIG_From_int((int)(QPOL_CAP_XPERM_IOCTL)));
+ SWIG_Python_SetConstant(d, "QPOL_FS_USE_XATTR",SWIG_From_unsigned_SS_int((unsigned int)(1U)));
+ SWIG_Python_SetConstant(d, "QPOL_FS_USE_TRANS",SWIG_From_unsigned_SS_int((unsigned int)(2U)));
+ SWIG_Python_SetConstant(d, "QPOL_FS_USE_TASK",SWIG_From_unsigned_SS_int((unsigned int)(3U)));
+ SWIG_Python_SetConstant(d, "QPOL_FS_USE_GENFS",SWIG_From_unsigned_SS_int((unsigned int)(4U)));
+ SWIG_Python_SetConstant(d, "QPOL_FS_USE_NONE",SWIG_From_unsigned_SS_int((unsigned int)(5U)));
+ SWIG_Python_SetConstant(d, "QPOL_FS_USE_PSID",SWIG_From_unsigned_SS_int((unsigned int)(6U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_ALL",SWIG_From_unsigned_SS_int((unsigned int)(0U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_BLK_FILE",SWIG_From_unsigned_SS_int((unsigned int)(11U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_CHR_FILE",SWIG_From_unsigned_SS_int((unsigned int)(10U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_DIR",SWIG_From_unsigned_SS_int((unsigned int)(7U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_FIFO_FILE",SWIG_From_unsigned_SS_int((unsigned int)(13U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_FILE",SWIG_From_unsigned_SS_int((unsigned int)(6U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_LNK_FILE",SWIG_From_unsigned_SS_int((unsigned int)(9U)));
+ SWIG_Python_SetConstant(d, "QPOL_CLASS_SOCK_FILE",SWIG_From_unsigned_SS_int((unsigned int)(12U)));
+ SWIG_Python_SetConstant(d, "QPOL_IPV4",SWIG_From_int((int)(0)));
+ SWIG_Python_SetConstant(d, "QPOL_IPV6",SWIG_From_int((int)(1)));
+ SWIG_Python_SetConstant(d, "IPPROTO_TCP",SWIG_From_int((int)(6)));
+ SWIG_Python_SetConstant(d, "IPPROTO_UDP",SWIG_From_int((int)(17)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_TYPE_NOT",SWIG_From_int((int)(1)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_TYPE_AND",SWIG_From_int((int)(2)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_TYPE_OR",SWIG_From_int((int)(3)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_TYPE_ATTR",SWIG_From_int((int)(4)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_TYPE_NAMES",SWIG_From_int((int)(5)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_USER",SWIG_From_int((int)(1)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_ROLE",SWIG_From_int((int)(2)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_TYPE",SWIG_From_int((int)(4)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_TARGET",SWIG_From_int((int)(8)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_XTARGET",SWIG_From_int((int)(16)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_L1L2",SWIG_From_int((int)(32)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_L1H2",SWIG_From_int((int)(64)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_H1L2",SWIG_From_int((int)(128)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_H1H2",SWIG_From_int((int)(256)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_L1H1",SWIG_From_int((int)(512)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_SYM_L2H2",SWIG_From_int((int)(1024)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_OP_EQ",SWIG_From_int((int)(1)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_OP_NEQ",SWIG_From_int((int)(2)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_OP_DOM",SWIG_From_int((int)(3)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_OP_DOMBY",SWIG_From_int((int)(4)));
+ SWIG_Python_SetConstant(d, "QPOL_CEXPR_OP_INCOMP",SWIG_From_int((int)(5)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_ALLOW",SWIG_From_int((int)(0x0001)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_NEVERALLOW",SWIG_From_int((int)(0x0080)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_AUDITALLOW",SWIG_From_int((int)(0x0002)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_DONTAUDIT",SWIG_From_int((int)(0x0004)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_XPERMS_ALLOW",SWIG_From_int((int)(0x0100)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_XPERMS_AUDITALLOW",SWIG_From_int((int)(0x0200)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_XPERMS_DONTAUDIT",SWIG_From_int((int)(0x0400)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_XPERMS_NEVERALLOW",SWIG_From_int((int)(0x0800)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_TYPE_TRANS",SWIG_From_int((int)(16)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_TYPE_CHANGE",SWIG_From_int((int)(64)));
+ SWIG_Python_SetConstant(d, "QPOL_RULE_TYPE_MEMBER",SWIG_From_int((int)(32)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_BOOL",SWIG_From_int((int)(1)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_NOT",SWIG_From_int((int)(2)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_OR",SWIG_From_int((int)(3)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_AND",SWIG_From_int((int)(4)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_XOR",SWIG_From_int((int)(5)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_EQ",SWIG_From_int((int)(6)));
+ SWIG_Python_SetConstant(d, "QPOL_COND_EXPR_NEQ",SWIG_From_int((int)(7)));
+#if PY_VERSION_HEX >= 0x03000000
+ return m;
+#else
+ return;
+#endif
+}
+
diff --git a/lib/python2.7/site-packages/setools/policyrep/rbacrule.py b/lib/python2.7/site-packages/setools/policyrep/rbacrule.py
index d327775..e923162 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/rbacrule.py
+++ b/lib/python2.7/site-packages/setools/policyrep/rbacrule.py
@@ -45,12 +45,12 @@ def expanded_rbac_rule_factory(original, source, target):
target The target type of the expanded rule.
"""
- if isinstance(original, RoleAllow):
+ if isinstance(original, (ExpandedRoleAllow, ExpandedRoleTransition)):
+ return original
+ elif isinstance(original, RoleAllow):
rule = ExpandedRoleAllow(original.policy, original.qpol_symbol)
elif isinstance(original, RoleTransition):
rule = ExpandedRoleTransition(original.policy, original.qpol_symbol)
- elif isinstance(original, (ExpandedRoleAllow, ExpandedRoleTransition)):
- return original
else:
raise TypeError("The original rule must be an RBAC rule class.")
diff --git a/lib/python2.7/site-packages/setools/policyrep/role.py b/lib/python2.7/site-packages/setools/policyrep/role.py
index 1d9fbe1..1d9fbe1 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/role.py
+++ b/lib/python2.7/site-packages/setools/policyrep/role.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/rule.py b/lib/python2.7/site-packages/setools/policyrep/rule.py
index b7a6a9d..be6e8d0 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/rule.py
+++ b/lib/python2.7/site-packages/setools/policyrep/rule.py
@@ -25,6 +25,8 @@ class PolicyRule(symbol.PolicySymbol):
"""This is base class for policy rules."""
+ extended = False
+
def __str__(self):
raise NotImplementedError
diff --git a/lib/python2.7/site-packages/setools/policyrep/symbol.py b/lib/python2.7/site-packages/setools/policyrep/symbol.py
index 556cc2d..556cc2d 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/symbol.py
+++ b/lib/python2.7/site-packages/setools/policyrep/symbol.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/terule.py b/lib/python2.7/site-packages/setools/policyrep/terule.py
index 7fe56cc..fd5b1e1 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/terule.py
+++ b/lib/python2.7/site-packages/setools/policyrep/terule.py
@@ -29,7 +29,10 @@ def te_rule_factory(policy, symbol):
"""Factory function for creating TE rule objects."""
if isinstance(symbol, qpol.qpol_avrule_t):
- return AVRule(policy, symbol)
+ if symbol.is_extended(policy):
+ return AVRuleXperm(policy, symbol)
+ else:
+ return AVRule(policy, symbol)
elif isinstance(symbol, (qpol.qpol_terule_t, qpol.qpol_filename_trans_t)):
return TERule(policy, symbol)
else:
@@ -45,12 +48,14 @@ def expanded_te_rule_factory(original, source, target):
target The target type of the expanded rule.
"""
- if isinstance(original, AVRule):
+ if isinstance(original, (ExpandedAVRule, ExpandedAVRuleXperm, ExpandedTERule)):
+ return original
+ elif isinstance(original, AVRuleXperm):
+ rule = ExpandedAVRuleXperm(original.policy, original.qpol_symbol)
+ elif isinstance(original, AVRule):
rule = ExpandedAVRule(original.policy, original.qpol_symbol)
elif isinstance(original, TERule):
rule = ExpandedTERule(original.policy, original.qpol_symbol)
- elif isinstance(original, (ExpandedAVRule, ExpandedTERule)):
- return original
else:
raise TypeError("The original rule must be a TE rule class.")
@@ -63,7 +68,8 @@ def expanded_te_rule_factory(original, source, target):
def validate_ruletype(t):
"""Validate TE Rule types."""
if t not in ["allow", "auditallow", "dontaudit", "neverallow",
- "type_transition", "type_member", "type_change"]:
+ "type_transition", "type_member", "type_change",
+ "allowxperm", "auditallowxperm", "dontauditxperm", "neverallowxperm"]:
raise exception.InvalidTERuleType("{0} is not a valid TE rule type.".format(t))
return t
@@ -92,10 +98,7 @@ class BaseTERule(rule.PolicyRule):
"""The rule's conditional expression."""
try:
return boolcond.condexpr_factory(self.policy, self.qpol_symbol.cond(self.policy))
- except (AttributeError, ValueError):
- # AttributeError: name filetrans rules cannot be conditional
- # so no member function
- # ValueError: The rule is not conditional
+ except AttributeError:
raise exception.RuleNotConditional
@property
@@ -103,10 +106,7 @@ class BaseTERule(rule.PolicyRule):
"""The conditional block of the rule (T/F)"""
try:
return bool(self.qpol_symbol.which_list(self.policy))
- except (AttributeError, ValueError):
- # AttributeError: name filetrans rules cannot be conditional
- # so no member function
- # ValueError: The rule is not conditional
+ except AttributeError:
raise exception.RuleNotConditional
def expand(self):
@@ -125,9 +125,8 @@ class AVRule(BaseTERule):
except AttributeError:
self._rule_string = "{0.ruletype} {0.source} {0.target}:{0.tclass} ".format(self)
- perms = self.perms
-
# allow/dontaudit/auditallow/neverallow rules
+ perms = self.perms
if len(perms) > 1:
self._rule_string += "{{ {0} }};".format(' '.join(perms))
else:
@@ -156,6 +155,96 @@ class AVRule(BaseTERule):
raise exception.RuleUseError("{0} rules do not have file names".format(self.ruletype))
+class ioctlSet(set):
+
+ """
+ A set with overridden string functions which compresses
+ the output into ioctl ranges instead of individual elements.
+ """
+
+ def __format__(self, spec):
+ """
+ String formating.
+
+ The standard formatting (no specification) will render the
+ ranges of ioctls, space separated.
+
+ The , option by itself will render the ranges of ioctls,
+ comma separated
+
+ Any other combination of formatting options will fall back
+ to set's formatting behavior.
+ """
+
+ # generate short permission notation
+ perms = sorted(self)
+ shortlist = []
+ for _, i in itertools.groupby(perms, key=lambda k, c=itertools.count(): k - next(c)):
+ group = list(i)
+ if len(group) > 1:
+ shortlist.append("{0:#06x}-{1:#06x}".format(group[0], group[-1]))
+ else:
+ shortlist.append("{0:#06x}".format(group[0]))
+
+ if not spec:
+ return " ".join(shortlist)
+ elif spec == ",":
+ return ", ".join(shortlist)
+ else:
+ return super(ioctlSet, self).__format__(spec)
+
+ def __str__(self):
+ return "{0}".format(self)
+
+ def __repr__(self):
+ return "{{ {0:,} }}".format(self)
+
+ def ranges(self):
+ """
+ Return the number of ranges in the set. Main use
+ is to determine if brackets need to be used in
+ string output.
+ """
+ return sum(1 for (_a, _b) in itertools.groupby(
+ sorted(self), key=lambda k, c=itertools.count(): k - next(c)))
+
+
+class AVRuleXperm(AVRule):
+
+ """An extended permission access vector type enforcement rule."""
+
+ extended = True
+
+ def __hash__(self):
+ return hash("{0.ruletype}|{0.source}|{0.target}|{0.tclass}|{0.xperm_type}".format(self))
+
+ def __str__(self):
+ try:
+ return self._rule_string
+ except AttributeError:
+ self._rule_string = "{0.ruletype} {0.source} {0.target}:{0.tclass} {0.xperm_type} ". \
+ format(self)
+
+ # generate short permission notation
+ perms = self.perms
+ if perms.ranges() > 1:
+ self._rule_string += "{{ {0} }};".format(perms)
+ else:
+ self._rule_string += "{0};".format(perms)
+
+ return self._rule_string
+
+ @property
+ def perms(self):
+ """The rule's extended permission set."""
+ return ioctlSet(self.qpol_symbol.xperm_iter(self.policy))
+
+ @property
+ def xperm_type(self):
+ """The standard permission extended by these permissions (e.g. ioctl)."""
+ return self.qpol_symbol.xperm_type(self.policy)
+
+
class TERule(BaseTERule):
"""A type_* type enforcement rule."""
@@ -229,6 +318,15 @@ class ExpandedAVRule(AVRule):
origin = None
+class ExpandedAVRuleXperm(AVRuleXperm):
+
+ """An expanded extended permission access vector type enforcement rule."""
+
+ source = None
+ target = None
+ origin = None
+
+
class ExpandedTERule(TERule):
"""An expanded type_* type enforcement rule."""
diff --git a/lib/python2.7/site-packages/setools/policyrep/typeattr.py b/lib/python2.7/site-packages/setools/policyrep/typeattr.py
index a52c69a..b219c59 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/typeattr.py
+++ b/lib/python2.7/site-packages/setools/policyrep/typeattr.py
@@ -159,16 +159,19 @@ class TypeAttribute(BaseType):
def attributes(self):
"""Generator that yields all attributes for this type."""
- raise TypeError("{0} is an attribute, thus does not have attributes.".format(self))
+ raise exception.SymbolUseError("{0} is an attribute, thus does not have attributes.".
+ format(self))
def aliases(self):
"""Generator that yields all aliases for this type."""
- raise TypeError("{0} is an attribute, thus does not have aliases.".format(self))
+ raise exception.SymbolUseError("{0} is an attribute, thus does not have aliases.".
+ format(self))
@property
def ispermissive(self):
"""(T/F) the type is permissive."""
- raise TypeError("{0} is an attribute, thus cannot be permissive.".format(self))
+ raise exception.SymbolUseError("{0} is an attribute, thus cannot be permissive.".
+ format(self))
def statement(self):
return "attribute {0};".format(self)
diff --git a/lib/python2.7/site-packages/setools/policyrep/user.py b/lib/python2.7/site-packages/setools/policyrep/user.py
index 94f81bc..94f81bc 100644..100755
--- a/lib/python2.7/site-packages/setools/policyrep/user.py
+++ b/lib/python2.7/site-packages/setools/policyrep/user.py
diff --git a/lib/python2.7/site-packages/setools/policyrep/xencontext.py b/lib/python2.7/site-packages/setools/policyrep/xencontext.py
new file mode 100644
index 0000000..fe78ec7
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/policyrep/xencontext.py
@@ -0,0 +1,191 @@
+# Derived from netcontext.py
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+from collections import namedtuple
+
+from . import qpol
+from . import symbol
+from . import context
+
+addr_range = namedtuple("memory_range", ["low", "high"])
+port_range = namedtuple("port_range", ["low", "high"])
+
+
+def iomemcon_factory(policy, name):
+ """Factory function for creating iomemcon objects."""
+
+ if not isinstance(name, qpol.qpol_iomemcon_t):
+ raise NotImplementedError
+
+ return Iomemcon(policy, name)
+
+
+def ioportcon_factory(policy, name):
+ """Factory function for creating ioportcon objects."""
+
+ if not isinstance(name, qpol.qpol_ioportcon_t):
+ raise NotImplementedError
+
+ return Ioportcon(policy, name)
+
+
+def pirqcon_factory(policy, name):
+ """Factory function for creating pirqcon objects."""
+
+ if not isinstance(name, qpol.qpol_pirqcon_t):
+ raise NotImplementedError
+
+ return Pirqcon(policy, name)
+
+
+def pcidevicecon_factory(policy, name):
+ """Factory function for creating pcidevicecon objects."""
+
+ if not isinstance(name, qpol.qpol_pcidevicecon_t):
+ raise NotImplementedError
+
+ return Pcidevicecon(policy, name)
+
+
+def devicetreecon_factory(policy, name):
+ """Factory function for creating devicetreecon objects."""
+
+ if not isinstance(name, qpol.qpol_devicetreecon_t):
+ raise NotImplementedError
+
+ return Devicetreecon(policy, name)
+
+
+class XenContext(symbol.PolicySymbol):
+
+ """Base class for in-policy xen labeling rules."""
+
+ def __str__(self):
+ raise NotImplementedError
+
+ @property
+ def context(self):
+ """The context for this statement."""
+ return context.context_factory(self.policy, self.qpol_symbol.context(self.policy))
+
+ def statement(self):
+ return str(self)
+
+
+class Iomemcon(XenContext):
+
+ """A iomemcon statement."""
+
+ def __str__(self):
+ low, high = self.addr
+
+ if low == high:
+ return "iomemcon {0} {1}".format(low, self.context)
+ else:
+ return "iomemcon {0}-{1} {2}".format(low, high, self.context)
+
+ @property
+ def addr(self):
+ """
+ The memory range for this iomemcon.
+
+ Return: Tuple(low, high)
+ low The low memory of the range.
+ high The high memory of the range.
+ """
+ low = self.qpol_symbol.low_addr(self.policy)
+ high = self.qpol_symbol.high_addr(self.policy)
+ return addr_range(low, high)
+
+
+class Ioportcon(XenContext):
+
+ """A ioportcon statement."""
+
+ def __str__(self):
+ low, high = self.ports
+
+ if low == high:
+ return "ioportcon {0} {1}".format(low, self.context)
+ else:
+ return "ioportcon {0}-{1} {2}".format(low, high, self.context)
+
+ @property
+ def ports(self):
+ """
+ The port range for this ioportcon.
+
+ Return: Tuple(low, high)
+ low The low port of the range.
+ high The high port of the range.
+ """
+
+ low = self.qpol_symbol.low_port(self.policy)
+ high = self.qpol_symbol.high_port(self.policy)
+ return port_range(low, high)
+
+
+class Pcidevicecon(XenContext):
+
+ """A pcidevicecon statement."""
+
+ def __str__(self):
+ return "pcidevicecon {0.device} {0.context}".format(self)
+
+ @property
+ def device(self):
+ """
+ The device for this pcidevicecon.
+
+ Return: The PCI device ID.
+ """
+ return self.qpol_symbol.device(self.policy)
+
+
+class Pirqcon(XenContext):
+
+ """A pirqcon statement."""
+
+ def __str__(self):
+ return "pirqcon {0.irq} {0.context}".format(self)
+
+ @property
+ def irq(self):
+ """
+ The irq for this pirqcon.
+
+ Return: The irq.
+ """
+ return self.qpol_symbol.irq(self.policy)
+
+
+class Devicetreecon(XenContext):
+
+ """A devicetreecon statement."""
+
+ def __str__(self):
+ return "devicetreecon {0.path} {0.context}".format(self)
+
+ @property
+ def path(self):
+ """
+ The path for this devicetreecon.
+
+ Return: The device path name.
+ """
+ return self.qpol_symbol.path(self.policy)
diff --git a/lib/python2.7/site-packages/setools/portconquery.py b/lib/python2.7/site-packages/setools/portconquery.py
index 798a828..0b9627a 100644..100755
--- a/lib/python2.7/site-packages/setools/portconquery.py
+++ b/lib/python2.7/site-packages/setools/portconquery.py
@@ -19,11 +19,13 @@
import logging
from socket import IPPROTO_TCP, IPPROTO_UDP
-from . import contextquery
-from .policyrep.netcontext import port_range
+from .mixins import MatchContext
+from .query import PolicyQuery
+from .policyrep import port_range, PortconProtocol
+from .util import match_range
-class PortconQuery(contextquery.ContextQuery):
+class PortconQuery(MatchContext, PolicyQuery):
"""
Port context query.
@@ -105,30 +107,26 @@ class PortconQuery(contextquery.ContextQuery):
@protocol.setter
def protocol(self, value):
if value:
- if not (value == IPPROTO_TCP or value == IPPROTO_UDP):
- raise ValueError(
- "The protocol must be {0} for TCP or {1} for UDP.".
- format(IPPROTO_TCP, IPPROTO_UDP))
-
- self._protocol = value
+ self._protocol = PortconProtocol(value)
else:
self._protocol = None
+ def __init__(self, policy, **kwargs):
+ super(PortconQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching portcons."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating portcon results from {0.policy}".format(self))
self.log.debug("Ports: {0.ports}, overlap: {0.ports_overlap}, "
"subset: {0.ports_subset}, superset: {0.ports_superset}, "
"proper: {0.ports_proper}".format(self))
- self.log.debug("User: {0.user!r}, regex: {0.user_regex}".format(self))
- self.log.debug("Role: {0.role!r}, regex: {0.role_regex}".format(self))
- self.log.debug("Type: {0.type_!r}, regex: {0.type_regex}".format(self))
- self.log.debug("Range: {0.range_!r}, subset: {0.range_subset}, overlap: {0.range_overlap}, "
- "superset: {0.range_superset}, proper: {0.range_proper}".format(self))
+ self.log.debug("Protocol: {0.protocol!r}".format(self))
+ self._match_context_debug(self.log)
for portcon in self.policy.portcons():
- if self.ports and not self._match_range(
+ if self.ports and not match_range(
portcon.ports,
self.ports,
self.ports_subset,
diff --git a/lib/python2.7/site-packages/setools/query.py b/lib/python2.7/site-packages/setools/query.py
index 358a095..4cf589e 100644..100755
--- a/lib/python2.7/site-packages/setools/query.py
+++ b/lib/python2.7/site-packages/setools/query.py
@@ -24,8 +24,6 @@ class PolicyQuery(object):
"""Base class for SELinux policy queries."""
def __init__(self, policy, **kwargs):
- self.log = logging.getLogger(self.__class__.__name__)
-
self.policy = policy
# keys are sorted in reverse order so regex settings
@@ -40,150 +38,6 @@ class PolicyQuery(object):
setattr(self, name, kwargs[name])
- @staticmethod
- def _match_regex(obj, criteria, regex):
- """
- Match the object with optional regular expression.
-
- Parameters:
- obj The object to match.
- criteria The criteria to match.
- regex If regular expression matching should be used.
- """
-
- if regex:
- return bool(criteria.search(str(obj)))
- else:
- return obj == criteria
-
- @staticmethod
- def _match_set(obj, criteria, equal):
- """
- Match the object (a set) with optional set equality.
-
- Parameters:
- obj The object to match. (a set)
- criteria The criteria to match. (a set)
- equal If set equality should be used. Otherwise
- any set intersection will match.
- """
-
- if equal:
- return obj == criteria
- else:
- return bool(obj.intersection(criteria))
-
- @staticmethod
- def _match_in_set(obj, criteria, regex):
- """
- Match if the criteria is in the list, with optional
- regular expression matching.
-
- Parameters:
- obj The object to match.
- criteria The criteria to match.
- regex If regular expression matching should be used.
- """
-
- if regex:
- return [m for m in obj if criteria.search(str(m))]
- else:
- return criteria in obj
-
- @staticmethod
- def _match_indirect_regex(obj, criteria, indirect, regex):
- """
- Match the object with optional regular expression and indirection.
-
- Parameters:
- obj The object to match.
- criteria The criteria to match.
- regex If regular expression matching should be used.
- indirect If object indirection should be used, e.g.
- expanding an attribute.
- """
-
- if indirect:
- return PolicyQuery._match_in_set((obj.expand()), criteria, regex)
- else:
- return PolicyQuery._match_regex(obj, criteria, regex)
-
- @staticmethod
- def _match_regex_or_set(obj, criteria, equal, regex):
- """
- Match the object (a set) with either set comparisons
- (equality or intersection) or by regex matching of the
- set members. Regular expression matching will override
- the set equality option.
-
- Parameters:
- obj The object to match. (a set)
- criteria The criteria to match.
- equal If set equality should be used. Otherwise
- any set intersection will match. Ignored
- if regular expression matching is used.
- regex If regular expression matching should be used.
- """
-
- if regex:
- return [m for m in obj if criteria.search(str(m))]
- else:
- return PolicyQuery._match_set(obj, set(criteria), equal)
-
- @staticmethod
- def _match_range(obj, criteria, subset, overlap, superset, proper):
- """
- Match ranges of objects.
-
- obj An object with attributes named "low" and "high", representing the range.
- criteria An object with attributes named "low" and "high", representing the criteria.
- subset If true, the criteria will match if it is a subset obj's range.
- overlap If true, the criteria will match if it overlaps any of the obj's range.
- superset If true, the criteria will match if it is a superset of the obj's range.
- proper If true, use proper superset/subset operations.
- No effect if not using set operations.
- """
-
- if overlap:
- return ((obj.low <= criteria.low <= obj.high) or (
- obj.low <= criteria.high <= obj.high) or (
- criteria.low <= obj.low and obj.high <= criteria.high))
- elif subset:
- if proper:
- return ((obj.low < criteria.low and criteria.high <= obj.high) or (
- obj.low <= criteria.low and criteria.high < obj.high))
- else:
- return obj.low <= criteria.low and criteria.high <= obj.high
- elif superset:
- if proper:
- return ((criteria.low < obj.low and obj.high <= criteria.high) or (
- criteria.low <= obj.low and obj.high < criteria.high))
- else:
- return (criteria.low <= obj.low and obj.high <= criteria.high)
- else:
- return criteria.low == obj.low and obj.high == criteria.high
-
- @staticmethod
- def _match_level(obj, criteria, dom, domby, incomp):
- """
- Match the an MLS level.
-
- obj The level to match.
- criteria The criteria to match. (a level)
- dom If true, the criteria will match if it dominates obj.
- domby If true, the criteria will match if it is dominated by obj.
- incomp If true, the criteria will match if it is incomparable to obj.
- """
-
- if dom:
- return (criteria >= obj)
- elif domby:
- return (criteria <= obj)
- elif incomp:
- return (criteria ^ obj)
- else:
- return (criteria == obj)
-
def results(self):
"""
Generator which returns the matches for the query. This method
diff --git a/lib/python2.7/site-packages/setools/rbacrulequery.py b/lib/python2.7/site-packages/setools/rbacrulequery.py
index 5e9a139..2a8e260 100644..100755
--- a/lib/python2.7/site-packages/setools/rbacrulequery.py
+++ b/lib/python2.7/site-packages/setools/rbacrulequery.py
@@ -22,6 +22,7 @@ import re
from . import mixins, query
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
from .policyrep.exception import InvalidType, RuleUseError
+from .util import match_indirect_regex
class RBACRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
@@ -82,15 +83,19 @@ class RBACRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
except InvalidType:
self._target = self.policy.lookup_role(value)
+ def __init__(self, policy, **kwargs):
+ super(RBACRuleQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching RBAC rules."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating RBAC rule results from {0.policy}".format(self))
self.log.debug("Ruletypes: {0.ruletype}".format(self))
self.log.debug("Source: {0.source!r}, indirect: {0.source_indirect}, "
"regex: {0.source_regex}".format(self))
self.log.debug("Target: {0.target!r}, indirect: {0.target_indirect}, "
"regex: {0.target_regex}".format(self))
- self.log.debug("Class: {0.tclass!r}, regex: {0.tclass_regex}".format(self))
+ self._match_object_class_debug(self.log)
self.log.debug("Default: {0.default!r}, regex: {0.default_regex}".format(self))
for rule in self.policy.rbacrules():
@@ -104,7 +109,7 @@ class RBACRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
#
# Matching on source role
#
- if self.source and not self._match_indirect_regex(
+ if self.source and not match_indirect_regex(
rule.source,
self.source,
self.source_indirect,
@@ -114,7 +119,7 @@ class RBACRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
#
# Matching on target type (role_transition)/role(allow)
#
- if self.target and not self._match_indirect_regex(
+ if self.target and not match_indirect_regex(
rule.target,
self.target,
self.target_indirect,
@@ -135,9 +140,13 @@ class RBACRuleQuery(mixins.MatchObjClass, query.PolicyQuery):
#
if self.default:
try:
- if not self._match_regex(
+ # because default role is always a single
+ # role, hard-code indirect to True
+ # so the criteria can be an attribute
+ if not match_indirect_regex(
rule.default,
self.default,
+ True,
self.default_regex):
continue
except RuleUseError:
diff --git a/lib/python2.7/site-packages/setools/rolequery.py b/lib/python2.7/site-packages/setools/rolequery.py
index 37de123..a7e9006 100644..100755
--- a/lib/python2.7/site-packages/setools/rolequery.py
+++ b/lib/python2.7/site-packages/setools/rolequery.py
@@ -19,11 +19,13 @@
import logging
import re
-from . import compquery
from .descriptors import CriteriaSetDescriptor
+from .mixins import MatchName
+from .query import PolicyQuery
+from .util import match_regex_or_set
-class RoleQuery(compquery.ComponentQuery):
+class RoleQuery(MatchName, PolicyQuery):
"""
Query SELinux policy roles.
@@ -49,10 +51,14 @@ class RoleQuery(compquery.ComponentQuery):
types_equal = False
types_regex = False
+ def __init__(self, policy, **kwargs):
+ super(RoleQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching roles."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+ self.log.info("Generating role results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
self.log.debug("Types: {0.types!r}, regex: {0.types_regex}, "
"eq: {0.types_equal}".format(self))
@@ -60,7 +66,7 @@ class RoleQuery(compquery.ComponentQuery):
if not self._match_name(r):
continue
- if self.types and not self._match_regex_or_set(
+ if self.types and not match_regex_or_set(
set(r.types()),
self.types,
self.types_equal,
diff --git a/lib/python2.7/site-packages/setools/sensitivityquery.py b/lib/python2.7/site-packages/setools/sensitivityquery.py
index a102836..5b10796 100644..100755
--- a/lib/python2.7/site-packages/setools/sensitivityquery.py
+++ b/lib/python2.7/site-packages/setools/sensitivityquery.py
@@ -18,12 +18,13 @@
#
import logging
-from . import compquery
-from . import mixins
from .descriptors import CriteriaDescriptor
+from .mixins import MatchAlias, MatchName
+from .query import PolicyQuery
+from .util import match_level
-class SensitivityQuery(mixins.MatchAlias, compquery.ComponentQuery):
+class SensitivityQuery(MatchAlias, MatchName, PolicyQuery):
"""
Query MLS Sensitivities
@@ -49,11 +50,15 @@ class SensitivityQuery(mixins.MatchAlias, compquery.ComponentQuery):
sens_dom = False
sens_domby = False
+ def __init__(self, policy, **kwargs):
+ super(SensitivityQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching sensitivities."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
- self.log.debug("Alias: {0.alias}, regex: {0.alias_regex}".format(self))
+ self.log.info("Generating sensitivity results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
+ self._match_alias_debug(self.log)
self.log.debug("Sens: {0.sens!r}, dom: {0.sens_dom}, domby: {0.sens_domby}".format(self))
for s in self.policy.sensitivities():
@@ -63,7 +68,7 @@ class SensitivityQuery(mixins.MatchAlias, compquery.ComponentQuery):
if not self._match_alias(s):
continue
- if self.sens and not self._match_level(
+ if self.sens and not match_level(
s,
self.sens,
self.sens_dom,
diff --git a/lib/python2.7/site-packages/setools/terulequery.py b/lib/python2.7/site-packages/setools/terulequery.py
index eff8df1..9935e4e 100644..100755
--- a/lib/python2.7/site-packages/setools/terulequery.py
+++ b/lib/python2.7/site-packages/setools/terulequery.py
@@ -21,7 +21,9 @@ import re
from . import mixins, query
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .policyrep import ioctlSet
from .policyrep.exception import RuleUseError, RuleNotConditional
+from .util import match_regex, match_indirect_regex, match_regex_or_set
class TERuleQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuery):
@@ -87,23 +89,54 @@ class TERuleQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuer
target = CriteriaDescriptor("target_regex", "lookup_type_or_attr")
target_regex = False
target_indirect = True
- default = CriteriaDescriptor("default_regex", "lookup_type")
+ default = CriteriaDescriptor("default_regex", "lookup_type_or_attr")
default_regex = False
boolean = CriteriaSetDescriptor("boolean_regex", "lookup_boolean")
boolean_regex = False
boolean_equal = False
+ _xperms = None
+ xperms_equal = False
+
+ @property
+ def xperms(self):
+ return self._xperms
+
+ @xperms.setter
+ def xperms(self, value):
+ if value:
+ pending_xperms = ioctlSet()
+
+ for low, high in value:
+ if not (0 <= low <= 0xffff):
+ raise ValueError("{0:#07x} is not a valid ioctl.".format(low))
+
+ if not (0 <= high <= 0xffff):
+ raise ValueError("{0:#07x} is not a valid ioctl.".format(high))
+
+ if high < low:
+ high, low = low, high
+
+ pending_xperms.update(i for i in range(low, high+1))
+
+ self._xperms = pending_xperms
+ else:
+ self._xperms = None
+
+ def __init__(self, policy, **kwargs):
+ super(TERuleQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
def results(self):
"""Generator which yields all matching TE rules."""
- self.log.info("Generating results from {0.policy}".format(self))
+ self.log.info("Generating TE rule results from {0.policy}".format(self))
self.log.debug("Ruletypes: {0.ruletype}".format(self))
self.log.debug("Source: {0.source!r}, indirect: {0.source_indirect}, "
"regex: {0.source_regex}".format(self))
self.log.debug("Target: {0.target!r}, indirect: {0.target_indirect}, "
"regex: {0.target_regex}".format(self))
- self.log.debug("Class: {0.tclass!r}, regex: {0.tclass_regex}".format(self))
- self.log.debug("Perms: {0.perms!r}, regex: {0.perms_regex}, eq: {0.perms_equal}".
- format(self))
+ self._match_object_class_debug(self.log)
+ self._match_perms_debug(self.log)
+ self.log.debug("Xperms: {0.xperms!r}, eq: {0.xperms_equal}".format(self))
self.log.debug("Default: {0.default!r}, regex: {0.default_regex}".format(self))
self.log.debug("Boolean: {0.boolean!r}, eq: {0.boolean_equal}, "
"regex: {0.boolean_regex}".format(self))
@@ -119,7 +152,7 @@ class TERuleQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuer
#
# Matching on source type
#
- if self.source and not self._match_indirect_regex(
+ if self.source and not match_indirect_regex(
rule.source,
self.source,
self.source_indirect,
@@ -129,7 +162,7 @@ class TERuleQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuer
#
# Matching on target type
#
- if self.target and not self._match_indirect_regex(
+ if self.target and not match_indirect_regex(
rule.target,
self.target,
self.target_indirect,
@@ -146,19 +179,46 @@ class TERuleQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuer
# Matching on permission set
#
try:
- if not self._match_perms(rule):
+ if self.perms and rule.extended:
+ if self.perms_equal and len(self.perms) > 1:
+ # if criteria is more than one standard permission,
+ # extended perm rules can never match if the
+ # permission set equality option is on.
+ continue
+
+ if rule.xperm_type not in self.perms:
+ continue
+ elif not self._match_perms(rule):
continue
except RuleUseError:
continue
#
+ # Matching on extended permissions
+ #
+ try:
+ if self.xperms and not match_regex_or_set(
+ rule.perms,
+ self.xperms,
+ self.xperms_equal,
+ False):
+ continue
+
+ except RuleUseError:
+ continue
+
+ #
# Matching on default type
#
if self.default:
try:
- if not self._match_regex(
+ # because default type is always a single
+ # type, hard-code indirect to True
+ # so the criteria can be an attribute
+ if not match_indirect_regex(
rule.default,
self.default,
+ True,
self.default_regex):
continue
except RuleUseError:
@@ -169,7 +229,7 @@ class TERuleQuery(mixins.MatchObjClass, mixins.MatchPermission, query.PolicyQuer
#
if self.boolean:
try:
- if not self._match_regex_or_set(
+ if not match_regex_or_set(
rule.conditional.booleans,
self.boolean,
self.boolean_equal,
diff --git a/lib/python2.7/site-packages/setools/typeattrquery.py b/lib/python2.7/site-packages/setools/typeattrquery.py
index a91026c..6bb3736 100644..100755
--- a/lib/python2.7/site-packages/setools/typeattrquery.py
+++ b/lib/python2.7/site-packages/setools/typeattrquery.py
@@ -19,11 +19,13 @@
import logging
import re
-from . import compquery
from .descriptors import CriteriaSetDescriptor
+from .mixins import MatchName
+from .query import PolicyQuery
+from .util import match_regex_or_set
-class TypeAttributeQuery(compquery.ComponentQuery):
+class TypeAttributeQuery(MatchName, PolicyQuery):
"""
Query SELinux policy type attributes.
@@ -49,10 +51,14 @@ class TypeAttributeQuery(compquery.ComponentQuery):
types_equal = False
types_regex = False
+ def __init__(self, policy, **kwargs):
+ super(TypeAttributeQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching types."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+ self.log.info("Generating type attribute results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
self.log.debug("Types: {0.types!r}, regex: {0.types_regex}, "
"eq: {0.types_equal}".format(self))
@@ -60,7 +66,7 @@ class TypeAttributeQuery(compquery.ComponentQuery):
if not self._match_name(attr):
continue
- if self.types and not self._match_regex_or_set(
+ if self.types and not match_regex_or_set(
set(attr.expand()),
self.types,
self.types_equal,
diff --git a/lib/python2.7/site-packages/setools/typequery.py b/lib/python2.7/site-packages/setools/typequery.py
index 6634f76..8152984 100644..100755
--- a/lib/python2.7/site-packages/setools/typequery.py
+++ b/lib/python2.7/site-packages/setools/typequery.py
@@ -19,12 +19,13 @@
import logging
import re
-from . import compquery
-from . import mixins
from .descriptors import CriteriaSetDescriptor
+from .mixins import MatchAlias, MatchName
+from .query import PolicyQuery
+from .util import match_regex_or_set
-class TypeQuery(mixins.MatchAlias, compquery.ComponentQuery):
+class TypeQuery(MatchAlias, MatchName, PolicyQuery):
"""
Query SELinux policy types.
@@ -67,11 +68,15 @@ class TypeQuery(mixins.MatchAlias, compquery.ComponentQuery):
else:
self._permissive = bool(value)
+ def __init__(self, policy, **kwargs):
+ super(TypeQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching types."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
- self.log.debug("Alias: {0.alias}, regex: {0.alias_regex}".format(self))
+ self.log.info("Generating type results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
+ self._match_alias_debug(self.log)
self.log.debug("Attrs: {0.attrs!r}, regex: {0.attrs_regex}, "
"eq: {0.attrs_equal}".format(self))
self.log.debug("Permissive: {0.permissive}".format(self))
@@ -83,7 +88,7 @@ class TypeQuery(mixins.MatchAlias, compquery.ComponentQuery):
if not self._match_alias(t):
continue
- if self.attrs and not self._match_regex_or_set(
+ if self.attrs and not match_regex_or_set(
set(t.attributes()),
self.attrs,
self.attrs_equal,
diff --git a/lib/python2.7/site-packages/setools/userquery.py b/lib/python2.7/site-packages/setools/userquery.py
index 00910cf..9fa05cb 100644..100755
--- a/lib/python2.7/site-packages/setools/userquery.py
+++ b/lib/python2.7/site-packages/setools/userquery.py
@@ -19,11 +19,13 @@
import logging
import re
-from . import compquery
from .descriptors import CriteriaDescriptor, CriteriaSetDescriptor
+from .mixins import MatchName
+from .query import PolicyQuery
+from .util import match_regex_or_set, match_level, match_range
-class UserQuery(compquery.ComponentQuery):
+class UserQuery(MatchName, PolicyQuery):
"""
Query SELinux policy users.
@@ -74,10 +76,14 @@ class UserQuery(compquery.ComponentQuery):
roles_equal = False
roles_regex = False
+ def __init__(self, policy, **kwargs):
+ super(UserQuery, self).__init__(policy, **kwargs)
+ self.log = logging.getLogger(__name__)
+
def results(self):
"""Generator which yields all matching users."""
- self.log.info("Generating results from {0.policy}".format(self))
- self.log.debug("Name: {0.name!r}, regex: {0.name_regex}".format(self))
+ self.log.info("Generating user results from {0.policy}".format(self))
+ self._match_name_debug(self.log)
self.log.debug("Roles: {0.roles!r}, regex: {0.roles_regex}, "
"eq: {0.roles_equal}".format(self))
self.log.debug("Level: {0.level!r}, dom: {0.level_dom}, domby: {0.level_domby}, "
@@ -89,14 +95,14 @@ class UserQuery(compquery.ComponentQuery):
if not self._match_name(user):
continue
- if self.roles and not self._match_regex_or_set(
+ if self.roles and not match_regex_or_set(
user.roles,
self.roles,
self.roles_equal,
self.roles_regex):
continue
- if self.level and not self._match_level(
+ if self.level and not match_level(
user.mls_level,
self.level,
self.level_dom,
@@ -104,7 +110,7 @@ class UserQuery(compquery.ComponentQuery):
self.level_incomp):
continue
- if self.range_ and not self._match_range(
+ if self.range_ and not match_range(
user.mls_range,
self.range_,
self.range_subset,
diff --git a/lib/python2.7/site-packages/setools/util.py b/lib/python2.7/site-packages/setools/util.py
new file mode 100644
index 0000000..e92ecb2
--- /dev/null
+++ b/lib/python2.7/site-packages/setools/util.py
@@ -0,0 +1,165 @@
+# Copyright 2016, Tresys Technology, LLC
+#
+# This file is part of SETools.
+#
+# SETools is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 2.1 of
+# the License, or (at your option) any later version.
+#
+# SETools is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with SETools. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+
+
+def match_regex(obj, criteria, regex):
+ """
+ Match the object with optional regular expression.
+
+ Parameters:
+ obj The object to match.
+ criteria The criteria to match.
+ regex If regular expression matching should be used.
+ """
+
+ if regex:
+ return bool(criteria.search(str(obj)))
+ else:
+ return obj == criteria
+
+
+def match_set(obj, criteria, equal):
+ """
+ Match the object (a set) with optional set equality.
+
+ Parameters:
+ obj The object to match. (a set)
+ criteria The criteria to match. (a set)
+ equal If set equality should be used. Otherwise
+ any set intersection will match.
+ """
+
+ if equal:
+ return obj == criteria
+ else:
+ return bool(obj.intersection(criteria))
+
+
+def match_in_set(obj, criteria, regex):
+ """
+ Match if the criteria is in the list, with optional
+ regular expression matching.
+
+ Parameters:
+ obj The object to match.
+ criteria The criteria to match.
+ regex If regular expression matching should be used.
+ """
+
+ if regex:
+ return [m for m in obj if criteria.search(str(m))]
+ else:
+ return criteria in obj
+
+
+def match_indirect_regex(obj, criteria, indirect, regex):
+ """
+ Match the object with optional regular expression and indirection.
+
+ Parameters:
+ obj The object to match.
+ criteria The criteria to match.
+ regex If regular expression matching should be used.
+ indirect If object indirection should be used, e.g.
+ expanding an attribute.
+ """
+
+ if indirect:
+ if regex:
+ return [o for o in obj.expand() if criteria.search(str(o))]
+ else:
+ return set(criteria.expand()).intersection(obj.expand())
+ else:
+ return match_regex(obj, criteria, regex)
+
+
+def match_regex_or_set(obj, criteria, equal, regex):
+ """
+ Match the object (a set) with either set comparisons
+ (equality or intersection) or by regex matching of the
+ set members. Regular expression matching will override
+ the set equality option.
+
+ Parameters:
+ obj The object to match. (a set)
+ criteria The criteria to match.
+ equal If set equality should be used. Otherwise
+ any set intersection will match. Ignored
+ if regular expression matching is used.
+ regex If regular expression matching should be used.
+ """
+
+ if regex:
+ return [m for m in obj if criteria.search(str(m))]
+ else:
+ return match_set(obj, set(criteria), equal)
+
+
+def match_range(obj, criteria, subset, overlap, superset, proper):
+ """
+ Match ranges of objects.
+
+ obj An object with attributes named "low" and "high", representing the range.
+ criteria An object with attributes named "low" and "high", representing the criteria.
+ subset If true, the criteria will match if it is a subset obj's range.
+ overlap If true, the criteria will match if it overlaps any of the obj's range.
+ superset If true, the criteria will match if it is a superset of the obj's range.
+ proper If true, use proper superset/subset operations.
+ No effect if not using set operations.
+ """
+
+ if overlap:
+ return ((obj.low <= criteria.low <= obj.high) or (
+ obj.low <= criteria.high <= obj.high) or (
+ criteria.low <= obj.low and obj.high <= criteria.high))
+ elif subset:
+ if proper:
+ return ((obj.low < criteria.low and criteria.high <= obj.high) or (
+ obj.low <= criteria.low and criteria.high < obj.high))
+ else:
+ return obj.low <= criteria.low and criteria.high <= obj.high
+ elif superset:
+ if proper:
+ return ((criteria.low < obj.low and obj.high <= criteria.high) or (
+ criteria.low <= obj.low and obj.high < criteria.high))
+ else:
+ return (criteria.low <= obj.low and obj.high <= criteria.high)
+ else:
+ return criteria.low == obj.low and obj.high == criteria.high
+
+
+def match_level(obj, criteria, dom, domby, incomp):
+ """
+ Match the an MLS level.
+
+ obj The level to match.
+ criteria The criteria to match. (a level)
+ dom If true, the criteria will match if it dominates obj.
+ domby If true, the criteria will match if it is dominated by obj.
+ incomp If true, the criteria will match if it is incomparable to obj.
+ """
+
+ if dom:
+ return (criteria >= obj)
+ elif domby:
+ return (criteria <= obj)
+ elif incomp:
+ return (criteria ^ obj)
+ else:
+ return (criteria == obj)